From 64e22e7728bd0cf104893bbf98f893979c515ad0 Mon Sep 17 00:00:00 2001 From: Justin Hawkins Date: Wed, 1 Jun 2022 21:51:57 +0930 Subject: [PATCH] Add some basic benchmarks for tracking potential performance improvements/regressions --- content/content.go | 4 +- content/corpora/1.html | 608 +++++++++++++ content/corpora/10.html | 395 +++++++++ content/corpora/100.html | 498 +++++++++++ content/corpora/11.html | 415 +++++++++ content/corpora/12.html | 357 ++++++++ content/corpora/13.html | 367 ++++++++ content/corpora/14.html | 413 +++++++++ content/corpora/15.html | 382 ++++++++ content/corpora/16.html | 414 +++++++++ content/corpora/17.html | 525 +++++++++++ content/corpora/18.html | 496 +++++++++++ content/corpora/19.html | 563 ++++++++++++ content/corpora/2.html | 369 ++++++++ content/corpora/20.html | 388 +++++++++ content/corpora/21.html | 421 +++++++++ content/corpora/22.html | 422 +++++++++ content/corpora/23.html | 355 ++++++++ content/corpora/24.html | 1204 +++++++++++++++++++++++++ content/corpora/25.html | 510 +++++++++++ content/corpora/26.html | 457 ++++++++++ content/corpora/27.html | 1697 ++++++++++++++++++++++++++++++++++++ content/corpora/28.html | 678 +++++++++++++++ content/corpora/29.html | 401 +++++++++ content/corpora/3.html | 364 ++++++++ content/corpora/30.html | 411 +++++++++ content/corpora/31.html | 494 +++++++++++ content/corpora/32.html | 865 ++++++++++++++++++ content/corpora/33.html | 496 +++++++++++ content/corpora/34.html | 560 ++++++++++++ content/corpora/35.html | 533 ++++++++++++ content/corpora/36.html | 729 ++++++++++++++++ content/corpora/37.html | 1209 ++++++++++++++++++++++++++ content/corpora/38.html | 674 ++++++++++++++ content/corpora/39.html | 395 +++++++++ content/corpora/4.html | 726 ++++++++++++++++ content/corpora/40.html | 505 +++++++++++ content/corpora/41.html | 1789 ++++++++++++++++++++++++++++++++++++++ content/corpora/42.html | 356 ++++++++ content/corpora/43.html | 484 +++++++++++ content/corpora/44.html | 369 ++++++++ content/corpora/45.html | 366 ++++++++ content/corpora/46.html | 558 ++++++++++++ content/corpora/47.html | 734 ++++++++++++++++ content/corpora/48.html | 360 ++++++++ content/corpora/49.html | 407 +++++++++ content/corpora/5.html | 569 ++++++++++++ content/corpora/50.html | 419 +++++++++ content/corpora/51.html | 443 ++++++++++ content/corpora/52.html | 586 +++++++++++++ content/corpora/53.html | 470 ++++++++++ content/corpora/54.html | 446 ++++++++++ content/corpora/55.html | 1234 ++++++++++++++++++++++++++ content/corpora/56.html | 484 +++++++++++ content/corpora/57.html | 369 ++++++++ content/corpora/58.html | 455 ++++++++++ content/corpora/59.html | 408 +++++++++ content/corpora/6.html | 478 ++++++++++ content/corpora/60.html | 669 ++++++++++++++ content/corpora/61.html | 632 ++++++++++++++ content/corpora/62.html | 355 ++++++++ content/corpora/63.html | 629 ++++++++++++++ content/corpora/64.html | 365 ++++++++ content/corpora/65.html | 381 ++++++++ content/corpora/66.html | 1017 ++++++++++++++++++++++ content/corpora/67.html | 792 +++++++++++++++++ content/corpora/68.html | 527 +++++++++++ content/corpora/69.html | 634 ++++++++++++++ content/corpora/7.html | 903 +++++++++++++++++++ content/corpora/70.html | 483 ++++++++++ content/corpora/71.html | 368 ++++++++ content/corpora/72.html | 1657 +++++++++++++++++++++++++++++++++++ content/corpora/73.html | 885 +++++++++++++++++++ content/corpora/74.html | 443 ++++++++++ content/corpora/75.html | 370 ++++++++ content/corpora/76.html | 596 +++++++++++++ content/corpora/77.html | 1061 ++++++++++++++++++++++ content/corpora/78.html | 361 ++++++++ content/corpora/79.html | 413 +++++++++ content/corpora/8.html | 427 +++++++++ content/corpora/80.html | 449 ++++++++++ content/corpora/81.html | 578 ++++++++++++ content/corpora/82.html | 676 ++++++++++++++ content/corpora/83.html | 420 +++++++++ content/corpora/84.html | 361 ++++++++ content/corpora/85.html | 364 ++++++++ content/corpora/86.html | 501 +++++++++++ content/corpora/87.html | 676 ++++++++++++++ content/corpora/88.html | 568 ++++++++++++ content/corpora/89.html | 411 +++++++++ content/corpora/9.html | 518 +++++++++++ content/corpora/90.html | 1001 +++++++++++++++++++++ content/corpora/91.html | 658 ++++++++++++++ content/corpora/92.html | 1093 +++++++++++++++++++++++ content/corpora/93.html | 550 ++++++++++++ content/corpora/94.html | 448 ++++++++++ content/corpora/95.html | 572 ++++++++++++ content/corpora/96.html | 397 +++++++++ content/corpora/97.html | 422 +++++++++ content/corpora/98.html | 419 +++++++++ content/corpora/99.html | 356 ++++++++ db/bookmarks_test.go | 100 +++ 102 files changed, 57588 insertions(+), 2 deletions(-) create mode 100644 content/corpora/1.html create mode 100644 content/corpora/10.html create mode 100644 content/corpora/100.html create mode 100644 content/corpora/11.html create mode 100644 content/corpora/12.html create mode 100644 content/corpora/13.html create mode 100644 content/corpora/14.html create mode 100644 content/corpora/15.html create mode 100644 content/corpora/16.html create mode 100644 content/corpora/17.html create mode 100644 content/corpora/18.html create mode 100644 content/corpora/19.html create mode 100644 content/corpora/2.html create mode 100644 content/corpora/20.html create mode 100644 content/corpora/21.html create mode 100644 content/corpora/22.html create mode 100644 content/corpora/23.html create mode 100644 content/corpora/24.html create mode 100644 content/corpora/25.html create mode 100644 content/corpora/26.html create mode 100644 content/corpora/27.html create mode 100644 content/corpora/28.html create mode 100644 content/corpora/29.html create mode 100644 content/corpora/3.html create mode 100644 content/corpora/30.html create mode 100644 content/corpora/31.html create mode 100644 content/corpora/32.html create mode 100644 content/corpora/33.html create mode 100644 content/corpora/34.html create mode 100644 content/corpora/35.html create mode 100644 content/corpora/36.html create mode 100644 content/corpora/37.html create mode 100644 content/corpora/38.html create mode 100644 content/corpora/39.html create mode 100644 content/corpora/4.html create mode 100644 content/corpora/40.html create mode 100644 content/corpora/41.html create mode 100644 content/corpora/42.html create mode 100644 content/corpora/43.html create mode 100644 content/corpora/44.html create mode 100644 content/corpora/45.html create mode 100644 content/corpora/46.html create mode 100644 content/corpora/47.html create mode 100644 content/corpora/48.html create mode 100644 content/corpora/49.html create mode 100644 content/corpora/5.html create mode 100644 content/corpora/50.html create mode 100644 content/corpora/51.html create mode 100644 content/corpora/52.html create mode 100644 content/corpora/53.html create mode 100644 content/corpora/54.html create mode 100644 content/corpora/55.html create mode 100644 content/corpora/56.html create mode 100644 content/corpora/57.html create mode 100644 content/corpora/58.html create mode 100644 content/corpora/59.html create mode 100644 content/corpora/6.html create mode 100644 content/corpora/60.html create mode 100644 content/corpora/61.html create mode 100644 content/corpora/62.html create mode 100644 content/corpora/63.html create mode 100644 content/corpora/64.html create mode 100644 content/corpora/65.html create mode 100644 content/corpora/66.html create mode 100644 content/corpora/67.html create mode 100644 content/corpora/68.html create mode 100644 content/corpora/69.html create mode 100644 content/corpora/7.html create mode 100644 content/corpora/70.html create mode 100644 content/corpora/71.html create mode 100644 content/corpora/72.html create mode 100644 content/corpora/73.html create mode 100644 content/corpora/74.html create mode 100644 content/corpora/75.html create mode 100644 content/corpora/76.html create mode 100644 content/corpora/77.html create mode 100644 content/corpora/78.html create mode 100644 content/corpora/79.html create mode 100644 content/corpora/8.html create mode 100644 content/corpora/80.html create mode 100644 content/corpora/81.html create mode 100644 content/corpora/82.html create mode 100644 content/corpora/83.html create mode 100644 content/corpora/84.html create mode 100644 content/corpora/85.html create mode 100644 content/corpora/86.html create mode 100644 content/corpora/87.html create mode 100644 content/corpora/88.html create mode 100644 content/corpora/89.html create mode 100644 content/corpora/9.html create mode 100644 content/corpora/90.html create mode 100644 content/corpora/91.html create mode 100644 content/corpora/92.html create mode 100644 content/corpora/93.html create mode 100644 content/corpora/94.html create mode 100644 content/corpora/95.html create mode 100644 content/corpora/96.html create mode 100644 content/corpora/97.html create mode 100644 content/corpora/98.html create mode 100644 content/corpora/99.html create mode 100644 db/bookmarks_test.go diff --git a/content/content.go b/content/content.go index a14e291..e92a12a 100644 --- a/content/content.go +++ b/content/content.go @@ -33,13 +33,13 @@ func FetchPageInfo(bm entity.Bookmark) entity.PageInfo { c.OnResponse(func(r *colly.Response) { info.StatusCode = r.StatusCode info.Size = len(r.Body) - log.Printf("content type for %s: %s (%d)", r.Request.URL.String(), r.Headers.Get("Content-Type"), info.Size) + // log.Printf("content type for %s: %s (%d)", r.Request.URL.String(), r.Headers.Get("Content-Type"), info.Size) }) // Before making a request print "Visiting ..." c.OnRequest(func(r *colly.Request) { - log.Println("Visiting", r.URL.String()) + // log.Println("Visiting", r.URL.String()) }) c.OnError(func(r *colly.Response, err error) { diff --git a/content/corpora/1.html b/content/corpora/1.html new file mode 100644 index 0000000..451eb92 --- /dev/null +++ b/content/corpora/1.html @@ -0,0 +1,608 @@ + + + + +Bon Tuman-e Yek - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Bon Tuman-e Yek

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Bon Tuman-e Yek
+
بن تومان يك
village
Bon Tuman-e Yek is located in Iran
Bon Tuman-e Yek
Bon Tuman-e Yek
Coordinates: 33°24′11″N 47°57′42″E / 33.40306°N 47.96167°E / 33.40306; 47.96167Coordinates: 33°24′11″N 47°57′42″E / 33.40306°N 47.96167°E / 33.40306; 47.96167
Country Iran
ProvinceLorestan
CountyPol-e Dokhtar
BakhshMamulan
Rural DistrictMamulan
Population
 (2006)
 • Total77
Time zoneUTC+3:30 (IRST)
 • Summer (DST)UTC+4:30 (IRDT)
+

Bon Tuman-e Yek (Persian: بن تومان يك, also Romanized as Bon Tūmān-e Yek and Bontūmān-e Yek)[1] is a village in Mamulan Rural District, Mamulan District, Pol-e Dokhtar County, Lorestan Province, Iran. At the 2006 census, its population was 77, in 20 families.[2] +

+

References[edit]

+
+
    +
  1. ^ Bon Tuman-e Yek can be found at GEOnet Names Server, at this link, by opening the Advanced Search box, entering "-3793103" in the "Unique Feature Id" form, and clicking on "Search Database". +
    2. +
  2. ^ "Census of the Islamic Republic of Iran, 1385 (2006)" (Excel). Statistical Center of Iran. Archived from the original on 2011-11-11. +
    3. +
+
+ +
Stub icon

This Pol-e Dokhtar County location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Bon_Tuman-e_Yek&oldid=936566519"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/10.html b/content/corpora/10.html new file mode 100644 index 0000000..a1aefc2 --- /dev/null +++ b/content/corpora/10.html @@ -0,0 +1,395 @@ + + + + +Charles Drummond - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Charles Drummond

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
For the British trade union leader, see C. J. Drummond.
+

Charles Drummond (born 1936), is a Canadian securities trader, market technician, author, educator, speaker and technical analyst. Drummond developed and popularized the "Point and Line" method of technical analysis,[1] also known as "P&L Charting" and Drummond Geometry. His methods are in use today among technical analysts and traders.[2][3] In recent years his work has also been noted by Forex Traders.[4] Drummond is the author of nine books[5] and a website. +

+ + +

Career[edit]

+

Raised in Toronto, Drummondtraded in the Toronto futures exchanges in the 1970s and 1980s as he developed his theories. In the late 1980s he relocated to Nova Scotia where he maintained an organic farm and wrote many of his works on technical analysis.[6] +

+

Published works[edit]

+
  • "Energy Patterns" By Charles Drummond 2015, Stocks & Commodities Magazine Featured Article. 5 pages.[7]
    • +
  • How to Make Money in the Futures Market…and lots of it! By Charles Drummond. 1978, 575 Pages. Hearne Associates/Drummond Publications (Chicago).
    • +
  • Charles Drummond on Advanced P&L, by Charles Drummond. 1980, 547 pages. Hearne Associates/Drummond Publications (Chicago).
    • +
  • The P&L Labs, by Charles Drummond. 1981, 260 pages. Hearne Associates/Drummond Publications (Chicago).
    • +
  • The 1-1 Paper, by Charles Drummond. 1985, 277 pages. Hearne Associates/Drummond Publications (Chicago).
    • +
  • The Energy Paper, by Charles Drummond. 1991, 18 pages, Hearne Associates/Drummond Publications (Chicago).
    • +
  • P&L Accumulation/Distribution: Knowing When to Trade, by Charles Drummond. 1993, 185 pages. Hearne Associates/Drummond Publications (Chicago).
    • +
  • Knowing Where the Energy is Coming From, by Charles Drummond. 1995, 190 pages. Hearne Associates/Drummond Publications (Chicago).
    • +
  • Pattern Picking, by Charles Drummond. 1996, 22 pages. Drummond Publications.
    • +
  • Predicting Next Week's Range (& understanding how the daily plays it out), by Charles Drummond. 1996, 62 pages.
    • +
  • Psycho Paper '96: P&L's Connection with Awareness, by Charles Drummond. 1996, 160 pages. Hearne Associates/Drummond Publications (Chicago).
    • +
  • The Lessons, by Charles Drummond and Ted Hearne, 1997-2001.
+

References[edit]

+
+
    +
  1. ^ Mark Douglas, "Trading in the Zone", New York 2000, p. 96. +
    2. +
  2. ^ "Picking off Significant Market Turning Points ", by Ted Hearne, ChartPoint Magazine (Singapore) April 2002 +
    3. +
  3. ^ "Geometria Drummonda, Wyprzedzic' Tlum", Parketiet Gazeta Gieldy Profesjonalny Inwestor, Warszawa, (Pazdziernik '99) pp. 8-9. ISSN 1231-2207 +
    4. +
  4. ^ David Keller, "Breakthroughs in Technical Analysis: New Thinking from the World's Top Minds", New York, 2007, Bloomberg Press, pp. 1-19. +
    5. +
  5. ^ "Trading Exhausts" by Ted Hearne, Futures Magazine (September 1999, pp. 44-47 ) +
    6. +
  6. ^ Drummond, Charles [from old catalogue]. Charles Drummond's Household Almanac and Year-book of Useful Knowledge for 1857, Etc. +
    7. +
  7. ^ "Archived copy" (PDF). Archived from the original (PDF) on 2016-04-22. Retrieved 2016-04-10.{{cite web}}: CS1 maint: archived copy as title (link) +
    8. +
+

External links[edit]

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Charles_Drummond&oldid=1056861290"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/100.html b/content/corpora/100.html new file mode 100644 index 0000000..a0d441c --- /dev/null +++ b/content/corpora/100.html @@ -0,0 +1,498 @@ + + + + +Toyota UZ engine - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Toyota UZ engine

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Toyota UZ Engine
Toyota 3UZ-FE engine 001.JPG
3UZ-FE engine
Overview
ManufacturerToyota Motor Corporation
Production1989–2013
Layout
Configuration90° V8
ValvetrainDOHC 4 valves x cyl. w/VVT-i
Combustion
Fuel systemMulti-point fuel injection
Fuel typeGasoline
Cooling systemWater cooled
Output
Power output191–373 kW (256–500 hp; 260–507 PS)
Torque output353–441 N⋅m (260–325 lb⋅ft)
Chronology
PredecessorToyota V engine
SuccessorToyota UR engine
+

The Toyota UZ engine family is a gasoline[1] fueled 32-valve quad-camshaft V8 piston engine series used in Toyota's luxury offerings and sport utility vehicles.[2] Three variants have been produced: the 1UZ-FE, 2UZ-FE, and 3UZ-FE. Production spanned 24 years, from 1989 to mid 2013, ending with the final production of the 3UZ-FE-powered Toyota Crown Majesta I-FOUR.[3] Toyota's UZ engine family was replaced by the UR engine family. +

+ + +

1UZ-FE[edit]

+

The 4.0 L; 242.1 cu in (3,968 cc) all-alloy 1UZ-FE debuted in 1989 in the first generation Lexus LS 400/Toyota Celsior and the engine was progressively released across a number of other models in the Toyota/Lexus range. The engine is oversquare by design, with a bore and stroke size of 87.5 mm × 82.5 mm (3.44 in × 3.25 in).[2] It has proven to be a strong, reliable and smooth powerplant with features such as 6-bolt main bearings and belt-driven quad-camshafts. The water pump is also driven by the cam belt. The connecting rods and crankshaft are constructed of steel. The pistons are hypereutectic. +

+
1UZ-FE (rear view)
+

The FV2400-2TC derivative is one of the few road-going engines that is FAA approved for use in an airplane. +

Its resemblance to a race engine platform (6 bolt cross mains and over square configuration) was confirmed in 2007 by David Currier (in an interview with v-eight.com), vice president of TRD USA, stating that the 1UZ platform was based on CART/IRL engine design. It was planned to be used on GT500 vehicles, however its subsequent use in the Daytona Prototype use had not been planned. +

In its standard, original trim with 10.0:1 compression, power output is 191 kW (256 hp; 260 PS), torque of 353 N⋅m (260 lb⋅ft).[2] +

The engine was slightly revised in 1995 with lighter connecting rods and pistons and an increased compression ratio to 10.4:1 resulting in peak power of 195 kW (261 hp; 265 PS) at 5,400 rpm and torque of 365 N⋅m (269 lb⋅ft) at 4,400 rpm. +

In 1997, Toyota's VVT-i variable valve timing technology was introduced along with a further compression ratio increase to 10.5:1,[2] bumping power and torque to 216 kW (290 hp; 294 PS) at 5,900 rpm and 407 N⋅m (300 lb⋅ft) at 4,100 rpm. For the GS400, output was rated at 224 kW (300 hp; 305 PS) at 6,000 rpm and 420 N⋅m (310 lbf⋅ft) at 4,000 rpm. +

The 1UZ-FE was voted to the Ward's 10 Best Engines list for 1998 through 2000.[4][5] +

Applications (calendar years): +

+ +

2UZ-FE[edit]

+
2UZ-FE
+

The 2UZ-FE was a 4.7 L; 284.6 cu in (4,663 cc) version built in Tahara, Aichi, Japan and at Toyota Motor Manufacturing Alabama. Unlike its other UZ counterparts, this version uses a cast iron block to increase durability, as it was designed for low-revving, high-torque pickup and SUV applications. Its bore and stroke is 94 mm × 84 mm (3.70 in × 3.31 in).[2] Output varies by implementation, but one VVT-i variant produces 202 kW (271 hp; 275 PS) at 4800 rpm with 427 N⋅m (315 lb⋅ft) of torque at 3400 rpm. JDM versions produce 173 kW (232 hp; 235 PS) at 4800 rpm and 422 N⋅m (311 lb⋅ft) at 3600 rpm, while Australian models produce 170 kW (228 hp; 231 PS) at 4800 rpm and 410 N⋅m (302 lbf⋅ft) at 3600 rpm.[2] +

Like the 1UZ-FE, it has aluminum DOHC cylinder heads, MFI fuel injection, 4 valves per cylinder with bucket tappets, one-piece cast camshafts, and a cast aluminum intake manifold. For 2010, it was replaced by the 1UR-FE or 3UR-FE, depending on the country. +

Applications (calendar years):[7] +

+ +

Toyota Racing Development offered a bolt-on supercharger kit for the 2000–2003 Tundra/Sequoia and the 1998-2003 LX 470. +

Another 2UZ-FE variation adds VVT-i and electronic throttle control. +

Applications (calendar years):[7] +

+ +

3UZ-FE[edit]

+
3UZ-FE
+

The 3UZ-FE is a 4.3 L; 261.9 cu in (4,292 cc) version built in Japan. Bore and stroke is 91 mm × 82.5 mm (3.58 in × 3.25 in) +.[2] Output is 216 to 224 kW (290 to 300 hp; 294 to 305 PS) at 5600 rpm with 441 N⋅m (325 lb⋅ft) of torque at 3400 rpm. The engine block and heads are aluminum. It has a DOHC valvetrain with 4 valves per cylinder and VVT-i. It uses SEFI fuel injection. In 2003, the engine was paired with a six-speed automatic transmission, resulting in improved fuel economy over the previous five-speed automatic.[2] +

A 4.5L version replaced the 3S-GTE as the engine used in Toyota's 500 hp (373 kW) Super GT race cars up to 2009[citation needed] and a 5.0L version was used in the Grand American Road Racing (Grand Am) Series.[8] +

Applications (calendar years):[2] +

+ +

Derivatives[edit]

+

FV2400-2TC[edit]

+

In 1997, the US Federal Aviation Administration granted production certification for the FV2400-2TC, a twin-turbocharged airplane powerplant based on the 1UZ-FE.[9] The 360 hp (268 kW; 365 PS) FV2400 was developed in partnership with Hamilton Standard, which provided the digital engine-control system.[9] The goal was to produce a four-seat propeller aircraft.[10] +

+

VT300i[edit]

+

In 1998, a marine derivative of the UZ powerplant was produced for boating applications. The 4.0 L VT300i engine, producing 224 kW; 304 PS (300 hp) at 6000 rpm and 420 N⋅m (310 lb⋅ft) at 4200 rpm, used the same block as the UZ engine on the Lexus SC 400, GS 400, and LS 400. +

Applications (calendar years): +

+
  • 1998 Toyota Epic S21[11]
    • +
  • 1999-2001 Toyota Epic S22/SX22[12]
    • +
  • 1999-2001 Toyota Epic X22[13][14]
+

References[edit]

+
+
    +
  1. ^ "Toyota Gasoline 2UZ-FE Engine". WikiMotors. Retrieved 2016-07-27. +
    2. +
  2. ^ a b c d e f g h i "The Toyota UZ-series Engine Guide". AutoSpeed. Retrieved 2009-08-11. +
    3. +
  3. ^ "TOYOTA CROWN MAJESTA catalog - reviews, pics, specs and prices | Goo-net Exchange". www.goo-net-exchange.com. Retrieved 2016-09-06. +
    4. +
  4. ^ Visjic, Bill (1998-01-01). "Revved up! The 10 best engines of 1998". Ward's Auto World. Archived from the original on 2007-02-11. Retrieved 2007-05-15. +
    5. +
  5. ^ Visnic, Bill (2000-02-01). "10 Best Engines 2000". Ward's Auto. Retrieved 2017-09-03. +
    6. +
  6. ^ a b c Visnic, Bill (1998-01-01). "Toyota/Lexus 4L DOHC V-8". Ward's Auto World. US. Archived from the original on 2004-11-05. +
    7. +
  7. ^ a b "Used Car Information - MSN Autos". Microsoft. Archived from the original on 2008-12-17. Retrieved 2009-01-02. +
    8. +
  8. ^ "Toyota Outlines Motor Sports Activities for 2009" (Press release). Japan: Toyota. 2009-03-16. Archived from the original on 2009-07-06. +
    9. +
  9. ^ a b "Toyota is cleared to produce piston aero-engine". 1997-01-08. Retrieved 2017-09-20 – via Flight Global. +
    10. +
  10. ^ "Look, Up in the Air, It May Be a Toyota". The New York Times. 1996-12-20. Retrieved 2017-09-20. +
    11. +
  11. ^ Plueddeman, Clarles (July 1998). "Rising Fun - Toyota 21: Where does Godzilla go skiing..." Boating. US. +
    12. +
  12. ^ "Toyota Epic S22". Waterski Magazine. US. 2001-06-15. Archived from the original on 2011-07-19. Retrieved 2017-09-03. +
    13. +
  13. ^ "Toyota Epic X22". Waterski Magazine. US. 2001-06-15. Archived from the original on 2012-03-23. Retrieved 2017-09-03. +
    14. +
  14. ^ "Toyota Launches Into Wakeboarding with Epic X22". WakeWorld. US. 1999-01-19. Archived from the original on 2001-06-27. Retrieved 2007-05-15. +
    15. +
+

See also[edit]

+ + + + + + + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Toyota_UZ_engine&oldid=1081676727"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/11.html b/content/corpora/11.html new file mode 100644 index 0000000..4bbd221 --- /dev/null +++ b/content/corpora/11.html @@ -0,0 +1,415 @@ + + + + +Piekło, Warmian-Masurian Voivodeship - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Piekło, Warmian-Masurian Voivodeship

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
For other places with the same name, see Piekło.
+
Piekło
Settlement
Piekło is located in Poland
Piekło
Piekło
Coordinates: 53°47′20″N 19°42′45″E / 53.78889°N 19.71250°E / 53.78889; 19.71250
CountryPoland Poland
VoivodeshipWarmian-Masurian
CountyIława
GminaZalewo
Time zoneUTC+1 (CET)
 • Summer (DST)UTC+2 (CEST)
+

Piekło [ˈpjɛkwɔ] (German Kleinschnellwalde) is a settlement in the administrative district of Gmina Zalewo, within Iława County, Warmian-Masurian Voivodeship, in northern Poland.[1] It lies approximately 10 kilometres (6 mi) south-east of Zalewo, 24 km (15 mi) north-east of Iława, and 52 km (32 mi) west of the regional capital Olsztyn. +

+

References[edit]

+
+
    +
  1. ^ "Central Statistical Office (GUS) - TERYT (National Register of Territorial Land Apportionment Journal)" (in Polish). 2008-06-01. +
    2. +
+


+

+
+

Coordinates: 53°47′20″N 19°42′45″E / 53.78889°N 19.71250°E / 53.78889; 19.71250 +


+

+
Stub icon

This Iława County location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Piekło,_Warmian-Masurian_Voivodeship&oldid=1085391910"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/12.html b/content/corpora/12.html new file mode 100644 index 0000000..6af7b3d --- /dev/null +++ b/content/corpora/12.html @@ -0,0 +1,357 @@ + + + + +Arab-West Foundation - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Arab-West Foundation

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

The Arab-West Foundation (AWF) was established in 2005, and is registered in the Netherlands as the Stichting Arab West Understanding. It is connected to the work and ideals of the electronic magazine Arab-West Report. +

+

Aims[edit]

+

The foundation aims at encouraging and promoting tolerance, understanding and dialogue between Muslims and non-Muslims, and Arab and Western communities, societies and countries. To achieve this purpose the foundation cooperates with the Center for Arab-West Understanding and the Center for Intercultural Dialogue and Translation in Egypt. It promotes and supports Western students doing internships in Egypt, especially those who will engage in projects that can be carried out in cooperation with Egyptian students. +

AWF supports and encourages dialogue through a number of avenues, focusing on an increased understanding between Muslims and non-Muslims. Academic papers from Egyptian and non-Egyptian student interns address issues relevant to current affairs in Egypt.[1] Western interns participate in cultural sensitivity training to further their understanding of Arab-West relations and decrease misconceptions.[2] It aims at improving the general publics' understanding of the contemporary Islamic world in non-Muslim countries and vice versa. +

The Arab West Foundation further focuses on the Egyptian media as a means of increasing cultural integration, providing access to the archives of Arab-West Report. +

+

References[edit]

+
+
    +
  1. ^ "Academic Papers". +
    2. +
  2. ^ "Cultural Training". +
    3. +
+

External links[edit]

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Arab-West_Foundation&oldid=823858857"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/13.html b/content/corpora/13.html new file mode 100644 index 0000000..8eabcd7 --- /dev/null +++ b/content/corpora/13.html @@ -0,0 +1,367 @@ + + + + +Debre Zeyit, Benishangul Gumuz - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Debre Zeyit, Benishangul Gumuz

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
For the city in the Oromia Region, see Bishoftu.
+
Debre Zeyit
Debre Zeyit is located in Ethiopia
Debre Zeyit
Debre Zeyit
Location within Ethiopia
Coordinates: 10°35′N 35°48′E / 10.583°N 35.800°E / 10.583; 35.800Coordinates: 10°35′N 35°48′E / 10.583°N 35.800°E / 10.583; 35.800
CountryEthiopia
RegionBenishangul-Gumuz
ZoneMetekel Zone
Elevation
2,097 m (6,880 ft)
Population
 (2005)
 • Total4,179
Time zoneUTC+3 (EAT)
+

Debre Zeyit (also known as Wenbera) is a town in western Ethiopia. Located in the Metekel Zone of the Benishangul-Gumuz Region, Debre Zeit has a latitude and longitude of 10°35′N 35°48′E / 10.583°N 35.800°E / 10.583; 35.800 with an elevation of 2097 meters above sea level. +

The town was visited in 1900 by the American traveller Oscar T. Crosby, who mentions the presence of a market and an Ethiopian military outpost.[1] Crosby knew the settlement as Wenbera, as did the consul R E Cheesman, who stayed there for a few days in April 1927. He described the settlement as "a large village of a few hundred houses and is important chiefly for its market and as a centre for caravan traffic. One set of merchants plies between there and Roseires in the Sudan, and another goes to the Abyssinian main plateau; both carry the famous coffee grown at Kitar in Wanbera district. We had reached an altitude where the Amhara can live, but the population is strongly oromo."[2] +

+

Demographics[edit]

+

Based on figures from the Central Statistical Agency in 2005, Debre Zeyit has an estimated total population of 4,179 of whom 1,936 were males and 2,243 were females.[3] According to the 1994 national census, its total population was 2,429 of whom 1,120 were males and 1,309 were females. It is the largest settlement in Wenbera woreda. +

+

Notes[edit]

+
+
    +
  1. ^ Oscar T. Crosby, "Notes on a Journey from Zeila to Khartum", Geographical Journal, 18 (1901), pp. 46-61 +
    2. +
  2. ^ "Local History in Ethiopia" Archived 2007-09-27 at the Wayback Machine (pdf) The Nordic Africa Institute website (accessed 7 December 2007) +
    3. +
  3. ^ CSA 2005 National Statistics Archived November 23, 2006, at the Wayback Machine, Table B.3 +
    4. +
+
Stub icon

This article about a location in the Benishangul-Gumuz Region of Ethiopia is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Debre_Zeyit,_Benishangul_Gumuz&oldid=1035710135"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/14.html b/content/corpora/14.html new file mode 100644 index 0000000..7ede33f --- /dev/null +++ b/content/corpora/14.html @@ -0,0 +1,413 @@ + + + + +Ukrainka, Seryshevsky District, Amur Oblast - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Ukrainka, Seryshevsky District, Amur Oblast

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Ukrainka
+
Украинка
Selo
Ukrainka is located in Amur Oblast
Ukrainka
Ukrainka
Ukrainka is located in Russia
Ukrainka
Ukrainka
Coordinates: 51°08′N 128°30′E / 51.133°N 128.500°E / 51.133; 128.500[1]
CountryRussia
RegionAmur Oblast
DistrictSeryshevsky District
Time zoneUTC+9:00
+

Ukrainka (Russian: Украинка) is a rural locality (a selo) and the administrative center of Ukrainsky Selsoviet of Seryshevsky District, Amur Oblast, Russia. The population was 1,160 as of 2018.[2] There are 6 streets. +

+

Geography[edit]

+

Ukrainka is located 14 km northeast of Seryshevo (the district's administrative centre) by road. Belonogovo is the nearest rural locality.[3] +

+

References[edit]

+
+
    +
  1. ^ Карта села Украинка в Амурской области +
    2. +
  2. ^ Оценка численности постоянного населения Амурской области по городам и районам +
    3. +
  3. ^ Расстояние от Украинки до Серышева +
    4. +
+
+
Stub icon

This Amur Oblast location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Ukrainka,_Seryshevsky_District,_Amur_Oblast&oldid=1055307443"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/15.html b/content/corpora/15.html new file mode 100644 index 0000000..be9cb02 --- /dev/null +++ b/content/corpora/15.html @@ -0,0 +1,382 @@ + + + + +Diego Garcia (musician) - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Diego Garcia (musician)

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Garcia in 2012
+

Diego Garcia is an American musician. He was the lead singer of the band Elefant and later became a solo artist. +

Garcia was born in Detroit, Michigan to Argentine parents, raised in Tampa, Florida,[1] and educated at Brown University.[2] He first broke into the music world as the lead singer of the New York-based band Elefant, a group aligned with the postmodern movement. New York magazine once described him as the “Sexiest Lead Singer."[1] +

In April 2011 he released his first solo album Laura.[1][3] Garcia’s band includes an Italian-born cellist and a Spanish-styled guitarist, plus a tight rhythm section. Garcia cites the young Julio Iglesias as his role model. He has taken inspiration from and has been compared to Leonard Cohen due to their florid instrumental sounds and soul-rending ballads, but most importantly the album was inspired by his girlfriend Laura. The couple is now married, with a young daughter.[2] +

On August 9, 2013, Diego's second solo album release was announced.[4] Paradise was released October 8, 2013. +

+

Discography[edit]

+
  • Laura (2011)
    • +
  • Paradise (2013)
+

References[edit]

+
+
    +
  1. ^ a b c Francis, Naila (November 29, 2011). "Diego Garcia taps into tender, romantic side on new album". phillyBurbs. Archived from the original on January 31, 2013. +
    2. +
  2. ^ a b "How Diego Garcia came to excel at passionately romantic pop paeans".[permanent dead link] +
    3. +
  3. ^ "Diego Garcia performs live in The Current studio". Minnesota Public Radio. December 14, 2011. +
    4. +
  4. ^ "Diego Garcia's 'Paradise' Out, 10/8; New Single 'Sunnier Days' Now Available". +
    5. +
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Diego_Garcia_(musician)&oldid=1060020635"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/16.html b/content/corpora/16.html new file mode 100644 index 0000000..2d1ff1a --- /dev/null +++ b/content/corpora/16.html @@ -0,0 +1,414 @@ + + + + +Corinne Leclair - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Corinne Leclair

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Corinne Leclair
Personal information
Born (1970-06-24) June 24, 1970 (age 51)
Sport
SportSwimming
+
Medal record
+
+ + + + + + + + + + + + + + + + + + + + + + + + +
+
Women's swimming +
Representing  Mauritius +
All-Africa Games +
Gold medal – first place 1991 Cairo 400 m freestyle +
Silver medal – second place 1991 Cairo 100 m freestyle +
Silver medal – second place 1991 Cairo 200 m freestyle +
Silver medal – second place 1991 Cairo 800 m freestyle +
+
+

Corinne Leclair (born 24 June 1970) is a Mauritian swimmer who represented her country at the 1992 Summer Olympics.[1] +

Leclair was eleven years old when she started swimming, and just four years later she was competing in the 1985 Indian Ocean Island Games, the Games were held in Mauritius but the fifteen year old struggled against the more experienced ladies, but her time came when she competed in the 1990 Indian Ocean Island Games in Madagascar, where in the seven events she competed in she won six gold medals and one bronze medal, her golds came in the freestyle in 100, 200, 400 and 800 metres plus team gold in the 4 x 100 medley and 4 x 100 freestyle relay.[2] Leclair won one individual gold medal and three silvers at the 1991 All-Africa Games. +

Leclair was 22 years old when she represented Mauritius at the 1992 Summer Olympics in Barcelona, she entered four events in three days, first up was the 100 metres freestyle, she swam it in 1:00.95 and finished third in her heat and 44th overall,[3] the next day she competed in the 200 metre freestyle and finished in 35th place.[4] On her final day she competed in two events, the 400 metre freestyle where she had her best finish of 33rd place,[5] followed by 13th place with three teammates in the 4 x 100 metre freestyle relay, Leclair swam the fastest in her team.[6] +

Leclair won the Mauritian Sports Council Sportswoman of the year in 1990 and 1991 and is still the only swimmer to win the award.[7] +

In 2013 Leclair got married and moved to the United States, where is a swimming instructor and a certified American Red Cross Lifeguard.[2] +

+

References[edit]

+
+
    +
  1. ^ "Corinne Leclair". Olympics at Sports-Reference.com. Archived from the original on 18 April 2020. Retrieved 2 November 2017. +
    2. +
  2. ^ a b "When Corinne Leclair illuminated pools". 5plus.mu. Retrieved 2 November 2017. +
    3. +
  3. ^ "Barcelona 1992: Swimming – Women's 100m Freestyle Finals" (PDF). Barcelona 1992. LA84 Foundation. p. 373. Retrieved 2 November 2017. +
    4. +
  4. ^ "Barcelona 1992: Swimming – Women's 200m Freestyle Heats" (PDF). Barcelona 1992. LA84 Foundation. pp. 373–374. Retrieved 2 November 2017. +
    5. +
  5. ^ "Barcelona 1992: Swimming – Women's 400m Freestyle Heats" (PDF). Barcelona 1992. LA84 Foundation. p. 374. Retrieved 2 September 2017. +
    6. +
  6. ^ "Barcelona 1992: Swimming – Women's 4×100m Freestyle Relay Heats" (PDF). Barcelona 1992. LA84 Foundation. p. 382. Retrieved 5 September 2017. +
    7. +
  7. ^ "Winners of National Sport Award". mauritiussportscouncil.com. Retrieved 2 November 2017. +
    8. +
+

External links[edit]

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Corinne_Leclair&oldid=1059230997"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/17.html b/content/corpora/17.html new file mode 100644 index 0000000..e011f50 --- /dev/null +++ b/content/corpora/17.html @@ -0,0 +1,525 @@ + + + + +Biogeology - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Biogeology

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

Biogeology is the study of the interactions between the Earth's biosphere and the lithosphere.[1] +

+
Pyrite
+

Biogeology examines biotic, hydrologic, and terrestrial systems in relation to each other, to help understand the Earth's climate, oceans, and other effects on geologic systems.[2] +

For example, bacteria are responsible for the formation of some minerals such as pyrite, and can concentrate economically important metals such as tin and uranium. Bacteria are also responsible for the chemical composition of the atmosphere, which affects weathering rates of rocks. +

Prior to the late Devonian period, there was little plant life beyond lichens, and bryophytes. At this time large vascular plants evolved, growing up to 30 meters (98 ft 5.1 in) in height. These large plants changed the atmosphere, and altered the composition of the soil by increasing the amount of organic carbon. This helped prevent the soil being washed away through erosion. +

+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ Darwin Center for Biogeology (2007). "Darwin Center for Biogeology". Darwin Center for Biogeology. Retrieved September 16, 2007. +
    2. +
  2. ^ UCSB Geology (2007). "Biogeology research at UCSB". UCSB Geology. Archived from the original on August 10, 2007. Retrieved September 16, 2007. +
    3. +
+

External links[edit]

+ +
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Biogeology&oldid=1038891780"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/18.html b/content/corpora/18.html new file mode 100644 index 0000000..60862c5 --- /dev/null +++ b/content/corpora/18.html @@ -0,0 +1,496 @@ + + + + +American University of Iraq - Baghdad - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

American University of Iraq - Baghdad

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
The American University of Iraq, Baghdad
Other name
AUIB
TypePrivate
Established2018
Students260
Location
Baghdad
,
Baghdad Governorate
,
Iraq
CampusUrban
Colors  
Websiteauib.edu.iq
American University of Iraq - Baghdad logo from website 2021.png
+

The American University of Iraq – Baghdad (AUIB) is private, not-for-profit university established in 2018 and started its teaching activities in February 2021 with 260 students in three colleges including Arts & Sciences, International Studies, and Business. The campus has grown quickly with the addition of five more colleges including Pharmacy, Dentistry, Health Technologies, Nursing, and Law.[1][2] +

+ + +

History[edit]

+

The university opened in February, 2021. It models itself on other regional American-style liberal arts universities such as the American University of Beirut, and the American University of Cairo. +In 2017, after deciding the location, the United States Ambassador to Iraq signed an agreement that would pave the way for the university.[3] Its inaugural intake in 2021 comprised approximately three hundred undergraduates. Most of this cohort took English language skills courses at the university's English Language Academy before embarking on their baccalaureate programs.[4] The university opened with three colleges, arts and sciences, business, and International studies.[3] +

+

Campus[edit]

+

The university's campus is located in what was previously Saddam Hussein’s Al Faw Palace. The former despot built the palace in the 1990s.[3] +The grounds belong to the Iraqi government, which leased the former palace to the university on a fifty-year basis. The university has the option to extend the lease for another fifty years when the current lease expires.[3] +The campus consists of palaces and attached houses; it spans 643 acres,[5] and has a campus bus service. Diverted water from the Tigris River fills its lakes which some claim contain a unique species of large bass.[6] +Hussein’s initials remain etched on into the ceilings, columns, and walls.[3] +

+

Funding and motivation[edit]

+

A founder's message on the institution's website reads, "I am Saadi Saihood and my sons and I have made it our family’s mission to usher our country out of its legacy of terrorism and turbulence."[7] +

So far, the founders have invested $200 million on renovations and refurbishments.[4] +

The institution's website posits, “To be truly American, a university must adopt not only English as its language of instruction but also the culture and ethos of higher education in the United States as recognized through U.S. accreditation.” +

+

Adademic profile[edit]

+

The university's president, Michael Mulnix claims the university offers, “an American model of education focusing on the liberal arts,” +Before starting their majors, the university's students spend two years studying philosophy, sociology, psychology, and world history.[8] +

+

College of Arts and Sciences[edit]

+ + + + + + + + +
Department of Applied Sciences +Department of Humanities +Department of Social Sciences +
+ + + + + +
+

College of Business[edit]

+ + + + + + + + +
Department of Management, Marketing, and Management Information Systems +Department of Accounting, Finance, and Economics +Department of Business Administration +
+ + + + + +
+

College of International Studies[edit]

+ + + + +
Department of Strategic Studies and International Relations +Department of Government and Public Policy +Department of Political Science +
+

College of Healthcare Technologies[edit]

+ + + + + +
Department of Anesthesiology +Department of Radiology and Sonar Technology +Department of Optometry and Vision Sciences +Department of Dental Technology +
+

Other colleges listed on the university's website are; College of Law, College of Pharmacy, College of Dentistry and College of Nursing. +

+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ "Org's about page". Retrieved 2021-10-29.{{cite web}}: CS1 maint: url-status (link) +
    2. +
  2. ^ "American University Hopes to Fill Higher-Ed Gap in Iraq". Voice of America. 2021-02-15. Retrieved 2021-10-29.{{cite web}}: CS1 maint: url-status (link) +
    3. +
  3. ^ a b c d e Carrion, Francisco (2021-03-10). "From Saddam Hussein's residence to American university: the fate of a sumptuous Baghdad palace". El Mundo (Spain). Retrieved 2021-10-29.{{cite web}}: CS1 maint: url-status (link) +
    4. +
  4. ^ a b "American university hopes to fill higher-ed gap in Iraq". The Independent. 2021-02-15. Archived from the original on 2021-10-29. Retrieved 2021-10-29. +
    5. +
  5. ^ "Has Iraq Reached an Inflection Point?" (PDF). National U.S.–Arab Chamber of Commerce. 2021-03-22. Retrieved 2021-11-05.{{cite web}}: CS1 maint: url-status (link) +
    6. +
  6. ^ Williams, Brian (2007-03-08). "Saddam's Al Faw palace not at all what it seems". NBC News. Retrieved 2021-11-05.{{cite web}}: CS1 maint: url-status (link) +
    7. +
  7. ^ Saihood, Saadi. "Founder's Message". American University of Iraq - Baghdad. Retrieved 2021-11-05.{{cite web}}: CS1 maint: url-status (link) +
    8. +
  8. ^ Nabreel, Gilgamesh (2021-04-05). "New 'American' University in Baghdad Aims to Train Future Leaders". Al Fanar Media. Retrieved 2021-11-05.{{cite web}}: CS1 maint: url-status (link) +
    9. +
+

External links[edit]

+ +

+

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=American_University_of_Iraq_-_Baghdad&oldid=1090298301"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/19.html b/content/corpora/19.html new file mode 100644 index 0000000..2e5d2e2 --- /dev/null +++ b/content/corpora/19.html @@ -0,0 +1,563 @@ + + + + +Eddie Allen (fullback) - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Eddie Allen (fullback)

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Eddie Allen
Biographical details
Born(1918-05-05)May 5, 1918
Dansville, New York
DiedMarch 1, 2012(2012-03-01) (aged 93)
Playing career
1938–1940, 1946Penn
1947Chicago Bears
1948Brooklyn Dodgers (AAFC)
+
Position(s)Fullback
Coaching career (HC unless noted)
1949Upper Darby HS (OA)
1950–1957Drexel
+
Head coaching record
Overall33–24–1 (college)
+

Edward Bostwic Allen Jr. (May 5, 1918 – March 1, 2012) was an American football fullback who played one season in the National Football League (NFL) with the Chicago Bears and one season in the All-America Football Conference (AAFC) for the Brooklyn Dodgers.[1] Allen played college football at the University of Pennsylvania, and was head football coach at Drexel University +

+ + +

Early life and college career[edit]

+

Allen attended Batavia High School in Batavia, New York, where he was raised. +

Allen played for three seasons on the Penn Quakers football team until 1940, when he left to serve in the United States Army Air Forces during World War II. He served until 1945 and achieved the rank of captain.[2] Upon leaving the military, he returned to Penn for his fourth and final season. Allen was an All-American honorable mention at Penn. +

+

Professional career[edit]

+

Allen was selected 94th overall (11th round, pick 4) in the 1946 NFL Draft by the Chicago Bears. Allen appeared in nine games for the Bears, during the 1947 NFL season. During the season he played as both fullback and Punter. +

The following year, Allen played for the Brooklyn Dodgers of the All-America Football Conference. +

+

Coaching career[edit]

+

Allen began coaching at Daniels Field in 1941.[3] After serving as head coach at Upper Darby High School for the 1949 season, Allen was hired by Drexel University as head football coach in February 1950. During the 1955 college football season, Allen led Drexel to an undefeated season. In eight seasons as head coach at Drexel, Allen compiled an overall record of 33–24–1. On January 10, 1958, Allen resigned as head coach in order to devote more time to an investment firm at which he had been recently given a major promotion. +

+

Head coaching record[edit]

+

College[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
Year +Team +Overall +ConferenceStanding +Bowl/playoffs +
Drexel Dragons (Independent) (1950–1957) +
1950 +Drexel +6–1 +
1951 +Drexel +3–4 +
1952 +Drexel +3–4 +
1953 +Drexel +2–3–1 +
1954 +Drexel +5–2 +
1955 +Drexel +8–0 +
1956 +Drexel +5–3 +
1957 +Drexel +1–7 +
Drexel: +33–24–1 +
Total:33–24–1 +
+

References[edit]

+
+
    +
  1. ^ "New Coach" (PDF). The Triangle. February 10, 1950. p. 5. Retrieved February 16, 2018. +
    2. +
  2. ^ "The end of an era as last of Flying Allens passes", Genesee County New York Official Visitor Website, March 22, 2012. Retrieved July 19, 2020. +
    3. +
  3. ^ "Eddie Allen Resigns As Coach At DIT; Had 33–24–1 Log" (PDF). The Triangle. 17 January 1958. p. 1. Retrieved 16 February 2018. +
    4. +
+

External links[edit]

+ +
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Eddie_Allen_(fullback)&oldid=1081490501"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/2.html b/content/corpora/2.html new file mode 100644 index 0000000..d84d83d --- /dev/null +++ b/content/corpora/2.html @@ -0,0 +1,369 @@ + + + + +Oskar Sandberg - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Oskar Sandberg

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

Oskar Sandberg is a key contributor to the Freenet Project, and a PhD graduate of the Chalmers Technical University in Gothenburg, Sweden. Oskar collaborated with Ian Clarke to design the new "darknet" model employed in Freenet 0.7, work which was presented at the DEF CON security conference in July 2005. Oskar recently completed a Ph.D. about the mathematics of complex networks, especially with regard to the small world phenomenon. Besides this he has an active interest in distributed computer networks and network security, and has been an active contributor to the Freenet Project since 1999. Oskar now works at Google. +

+

Papers[edit]

+

Ian Clarke, Oskar Sandberg, Brandon Wiley, Theodore W. Hong: +Freenet: A Distributed Anonymous Information Storage and Retrieval System +link[permanent dead link] +

Oskar Sandberg: Searching in a small world (licentiate thesis) link +

+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Oskar_Sandberg&oldid=940584173"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/20.html b/content/corpora/20.html new file mode 100644 index 0000000..f0c42a6 --- /dev/null +++ b/content/corpora/20.html @@ -0,0 +1,388 @@ + + + + +Idaotsa - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Idaotsa

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Idaotsa
Village
Country Estonia
CountyHarju County
ParishViimsi Parish
Time zoneUTC+2 (EET)
 • Summer (DST)UTC+3 (EEST)
+

Idaotsa is a village in Viimsi Parish, Harju County in northern Estonia,[1] on the island of Prangli. The nearby Aksi island also belongs to Idaotsa village. +

+

References[edit]

+
+
    +
  1. ^ Classification of Estonian administrative units and settlements 2014 (retrieved 27 July 2021) +
    2. +
+

Coordinates: 59°37′N 25°01′E / 59.617°N 25.017°E / 59.617; 25.017 +

+
+


+

+
Stub icon

This Harju County location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Idaotsa&oldid=1035722547"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/21.html b/content/corpora/21.html new file mode 100644 index 0000000..654a102 --- /dev/null +++ b/content/corpora/21.html @@ -0,0 +1,421 @@ + + + + +Faculty of Organisation Studies in Novo Mesto - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Faculty of Organisation Studies in Novo Mesto

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

The Faculty of Organisation Studies in Novo Mesto (FOS; Slovene: Fakulteta za organizacijske študije v Novem mestu) is an independent (private) faculty,[1][2][clarification needed] in Novo Mesto, Slovenia. The Faculty of Organisation Studies in Novo Mesto holds ISO standards ISO 9001 and ISO/IEC 27001. The current dean is Boris Bukovec.[3] +

+ + +

History[edit]

+

The Faculty of Organisation Studies in Novo Mesto was established in 2008 as a public-private partnership project between the private institute IOM and the former University and Research Centre in Novo Mesto [sl]. When the latter was abolished in 2014, founding rights were transferred[4] to the City Municipality of Novo Mesto. +

+
Faculty of Organisation Studies centre
+

In 2015, the institution was recognised by the Information Commissioner of the Republic of Slovenia for its efforts in the field of data protection.[5] +

+

Study programmes[edit]

+

The Faculty of Organisation Studies in Novo Mesto offers study programmes at bachelor's, master's and doctoral levels in the field of quality management.[6] Study programmes are accredited by the Slovenian national higher school accreditation agency (NAKVIS). +

The bachelor's study programme lasts for 6 semesters and provides 180 ECTS credits. It is expert-oriented with the combination of compulsory courses in the field of economics, management and business administration, elective courses in relevant supportive fields and compulsory practical work in the business environment. +

The master's study programme lasts for 4 semesters and provides 120 ECTS credits. It is oriented towards deepening the theoretical background of the conceptualisation of excellence and applying it in different fields (based on the selection of elective courses). +

The doctoral study programme lasts for 6 semesters and provides 180 ECTS credits. It is research-based, with a compulsory subject of advanced methodology and an elective course (which provides also the proper field of the title) in the field closest to the candidate's research interest. +

+
Dean Boris Bukovec
+

International collaboration[edit]

+

Among other forms of cooperation with foreign institutions of higher education, the Faculty of Organisation Studies in Novo Mesto participates in the Erasmus+ programme of students and staff exchange.[7] +

+

Research and publishing[edit]

+

The Faculty of Organisation Studies in Novo Mesto is developing its research activities within the research institutes. Currently, there are two operational institutes: for business excellence and for innovative tourism. Research output is available at COBISS/SICRIS[8] (in Slovenian). +

Since 2012, the faculty has organised an annual conference called Governance in (Post) Transition, which encompasses various current topics in the field of social sciences. +

Every year since 2015, the Faculty has been organizing a scientific conference New Paradigms of Organizational Theories. +

Since 2012, the Faculty has been publishing the scientific journal Journal of Universal Excellence and, since 2016, the journal Challenges to the Future. The journal is indexed in databases DOAJ, EBSCO, COBISS, dLib, Google scholar, MIAR, WorldCat (OCLC) +

The faculty also publishes monographs[9] by Slovenian and international authors. +

The Faculty of Organisation Studies in Novo Mesto is also a member of the RENET network (Researchers' Excellence network)[10] +

+

References[edit]

+
+
    +
  1. ^ "Higher Education System in Slovenia". ECAHE. +
    2. +
  2. ^ "Higher Education System in Slovenia". MIZS, Government of Slovenia. Archived from the original on 2017-01-11. Retrieved 2017-01-16. +
    3. +
  3. ^ "Dolenjski list: Dekan FOŠ ostaja Boris Bukovec". 2014-06-21. Retrieved 2017-01-29. +
    4. +
  4. ^ "Official Gazette RS: 56/2014 pp.6479". +
    5. +
  5. ^ "Report on IC work for 2015: p 74" (PDF). Retrieved 2017-01-13. +
    6. +
  6. ^ "Radio Krka: Novomeška Fakulteta za organizacijske študije z novimi prostori". Retrieved 2017-01-29. +
    7. +
  7. ^ "List of Erasmus+ charter holders by country". +
    8. +
  8. ^ "FOŠ research output". +
    9. +
  9. ^ "List of publications by FOŠ (in Slovenian)". +
    10. +
  10. ^ "RENET members". +
    11. +
+

External links[edit]

+ +
+

+

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Faculty_of_Organisation_Studies_in_Novo_Mesto&oldid=1079756793"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/22.html b/content/corpora/22.html new file mode 100644 index 0000000..17b6b92 --- /dev/null +++ b/content/corpora/22.html @@ -0,0 +1,422 @@ + + + + +Marbletown, Wayne County, New York - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Marbletown, Wayne County, New York

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

Coordinates: 43°01′14″N 77°03′59″W / 43.02056°N 77.06639°W / 43.02056; -77.06639 +Marbletown is a hamlet in the Town of Arcadia, Wayne County, New York, United States, near the Ontario County line. It is located three miles (5 km) southeast of the Village of Newark, at an elevation of 486 feet (148 m). The primary cross roads where the hamlet is located are Marbletown Road (CR 336), Silver Hill Road and Miller Road. +

Marbletown Schoolhouse (built 1876), a historic building, is located on the corner of Marbletown Road and Miller Road. The school served as an educational place for area children until it closed in 1947.[1] +

+

References[edit]

+
+
    +
  1. ^ Newark-Arcadia Historical Society & Museum (Marbletown Schoolhouse), Retrieved Jan. 20, 2015. +
    2. +
+ +
+
Stub icon

This article about a location in Wayne County, New York is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Marbletown,_Wayne_County,_New_York&oldid=1032508452"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/23.html b/content/corpora/23.html new file mode 100644 index 0000000..ca1f371 --- /dev/null +++ b/content/corpora/23.html @@ -0,0 +1,355 @@ + + + + +Staffeldt - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Staffeldt

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

Staffeldt is a surname. Notable people with the surname include: +

+ + + + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Staffeldt&oldid=1009692020"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/24.html b/content/corpora/24.html new file mode 100644 index 0000000..6510ca2 --- /dev/null +++ b/content/corpora/24.html @@ -0,0 +1,1204 @@ + + + + +1999 Big East Conference Baseball Tournament - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

1999 Big East Conference Baseball Tournament

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
1999 Big East Conference
Baseball Tournament
Teams6
FormatDouble-elimination tournament
Finals site
ChampionsProvidence (2nd title)
Winning coachCharlie Hickey (1st title)
MVPMarc DesRoches (Providence)
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
1999 Big East Conference baseball standings +
ConfOverall +
TeamW L T PCTW L T PCT +
Notre Dame  ‍†‍‍y +20–5–0 .80043–18–0 .705 +
Rutgers  ‍‍‍y +19–7–0 .73137–21–0 .638 +
Providence  ‍‍‡‍y +18–8–0 .69249–16–0 .754 +
Seton Hall  ‍‍‍ +14–11–0 .56032–19–1 .625 +
St. John's  ‍‍‍ +13–11–1 .54032–22–2 .589 +
West Virginia  ‍‍‍ +12–13–0 .48029–28–0 .509 +
Villanova  ‍‍‍ +11–15–0 .42327–26–1 .509 +
Pittsburgh  ‍‍‍ +11–15–0 .42327–27–0 .500 +
Boston College  ‍‍‍ +10–15–1 .40426–21–1 .552 +
Connecticut  ‍‍‍ +10–16–0 .38527–24–0 .529 +
Georgetown  ‍‍‍ +2–24–0 .07718–34–0 .346 +
+
† – Conference champion
‡ – Tournament champion
y – Invited to the NCAA Tournament
As of June 30, 1999[1][2]; Rankings from Collegiate Baseball +
+

The 1999 Big East Conference Baseball Tournament was held at Mercer County Waterfront Park in Trenton, NJ. This was the fifteenth annual Big East Conference Baseball Tournament, and first to be held outside the state of Connecticut. The Providence Friars won the tournament championship and claimed the Big East Conference's automatic bid to the 1999 NCAA Division I Baseball Tournament.[3] +

+ + +

Format and seeding[edit]

+

The Big East baseball tournament was a 6 team double elimination tournament in 1999. The top six regular season finishers were seeded one through six based on conference winning percentage only.[3] +

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
TeamWLTPct.GBSeed +
Notre Dame2050.800
–
1
+
Rutgers1970.731
1.5
2
+
Providence1880.692
2.5
3
+
Seton Hall14110.560
6
4
+
St. John's13111.540
7
5
+
West Virginia12130.480
8
6
+
Villanova11150.423
9.5
–
+
Pittsburgh11150.423
9.5
–
+
Boston College10151.404
10
–
+
Connecticut10160.385
11.5
–
+
Georgetown2240.077
18.5
–
+
+

Bracket[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  +First round + +Semifinals + +Third Round + +Semi-Finals + +Finals +
  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +  +
  +1 +Notre Dame +7 +  +
  +6 +West Virginia +2 +  +  +1 +Notre Dame +3 +  +
  +  +4 +Seton Hall +11 +  +  +
  +  +  +4 +Seton Hall +2 +  +
  +  +  +5 +St. John's +7 +  +  +5 +St. John's +6 +  +
  +5 +St. John's +9 +  +  +  +  +2 +Rutgers +4 +  +  +
  +6 +West Virginia +6 +  +  +  +  +
  +2 +Rutgers +13 +  +  +  +  +5 +St. John's +1 +
  +5 +St. John's +9 +  +  +  +  +  +3 +Providence +6 +
  +  +  +2 +Rutgers +11 +  +  +  +  +
  +  +  +3 +Providence +4 +  +  +  +  +  +
  +3 +Providence +10 +  +  +  +  +  +2 +Rutgers +2 +  +  +  +  +  +  +  +
  +4 +Seton Hall +9 +  +  +  +  +3 +Providence +9 +  +  +  +  +  +  +
  +3 +Providence +8 +  +  +
  +1 +Notre Dame +4 +  +
+

[3] +

+

Jack Kaiser Award[edit]

+

Marc DesRoches was the winner of the 1999 Jack Kaiser Award. DesRoches was a senior pitcher for Providence.[3] +

+

References[edit]

+
+
    +
  1. ^ 2012 Big East Baseball Media Guide. Big East Conference. p. 61. Archived from the original on February 3, 2013. Retrieved January 27, 2013. +
    2. +
  2. ^ "College Baseball Conference Standings -- 1999". boydsworld.com. Retrieved January 27, 2013. +
    3. +
  3. ^ a b c d 2012 Big East Baseball Media Guide. Big East Conference. pp. 61–66. Archived from the original on February 3, 2013. Retrieved January 27, 2013. +
    4. +
+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=1999_Big_East_Conference_Baseball_Tournament&oldid=1077731203"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/25.html b/content/corpora/25.html new file mode 100644 index 0000000..ab585b8 --- /dev/null +++ b/content/corpora/25.html @@ -0,0 +1,510 @@ + + + + +Velundu Vinaiyillai - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Velundu Vinaiyillai

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+ +

+
Velundu Vinaiyillai
Directed byK. Shankar
Written byK. P. Arivanandham
Vietnam Veedu Sundaram (dialogues)
Screenplay byK. Shankar
Produced byS. Valliammai
StarringVijayakanth
Ambika
M. N. Nambiar
Jaiganesh
CinematographyM. C. Sekar
Edited byK. Shankar
V. Devan
Music byM. S. Viswanathan
Production
company
Om Muruga Arts
Distributed byOm Muruga Arts
Release date
+
  • 7 March 1987 (1987-03-07)
+
Running time
133 minutes
CountryIndia
LanguageTamil
+

Velundu Vinaiyillai (Tamil: வேலுண்டு வினையில்லை) is a 1987 Tamil devotional film, directed by K. Shankar and produced by S. Valliammai. The film stars Vijayakanth, Ambika, M. N. Nambiar and Jaiganesh in lead roles. The film had musical score by M. S. Viswanathan.[1][2][3] +

+ + +

Cast[edit]

+ +

Soundtrack[edit]

+

The music was composed by M. S. Viswanathan.[4] +

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
No.SongSingersLyricsLength (m:ss) +
1"Pothaicha"ChithraVaali04:55 +
2"Velundu"Vani JayaramKannadasan05:02 +
3"Unavinilae"K. J. YesudasTamil Nambi04:34 +
4"Kaayatha"Deepan ChakravarthySri Thavathiru Sankaradas Swamigal04:32 +
+

References[edit]

+
+
    +
  1. ^ "Velundu Vinaiyillai". filmibeat.com. Retrieved 19 September 2014. +
    2. +
  2. ^ "Velundu Vinaiyillai". spicyonion.com. Retrieved 19 September 2014. +
    3. +
  3. ^ "Velundu Vinaiyillai". gomolo.com. Retrieved 19 September 2014. +
    4. +
  4. ^ "Velundu Vinaiyillai Songs". raaga.com. Retrieved 19 September 2014. +
    5. +
+

External links[edit]

+ +
+


+

+
Stub icon

This article about a Tamil-language film of the 1980s is a stub. You can help Wikipedia by expanding it.

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Velundu_Vinaiyillai&oldid=1016082124"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/26.html b/content/corpora/26.html new file mode 100644 index 0000000..a4f21b7 --- /dev/null +++ b/content/corpora/26.html @@ -0,0 +1,457 @@ + + + + +Mrs. Henry F. Akin House - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Mrs. Henry F. Akin House

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Mrs. Henry F. Akin House
+
The Akin House.jpeg
Mrs. Henry F. Akin House is located in Chicago metropolitan area
Mrs. Henry F. Akin House
Mrs. Henry F. Akin House is located in Illinois
Mrs. Henry F. Akin House
Mrs. Henry F. Akin House is located in the United States
Mrs. Henry F. Akin House
Location901 S. 8th Ave., Maywood, Illinois
Coordinates41°52′46″N 87°50′31″W / 41.87944°N 87.84194°W / 41.87944; -87.84194 (Mrs. Henry F. Akin House)Coordinates: 41°52′46″N 87°50′31″W / 41.87944°N 87.84194°W / 41.87944; -87.84194 (Mrs. Henry F. Akin House)
Arealess than one acre
Builtc. 1910
ArchitectTallmadge & Watson
Architectural stylePrairie School
MPSMaywood MPS
NRHP reference No.92000487[1]
Added to NRHPMay 22, 1992
+

The Mrs. Henry F. Akin House is a historic house at 901 S. 8th Avenue in Maywood, Illinois. The house was built circa 1910 for Elizabeth R. Akin, the wife of former Maywood mayor Henry F. Akin. Tallmadge and Watson, Chicago-area architects who were pioneers of the Prairie School style, designed the home. The one-story bungalow features a stucco exterior, wood banding which forms geometric shapes, casement windows, and overhanging eaves, all typical elements of early Prairie works. The house is one of three in Maywood designed by prominent Prairie School architects and the only bungalow of the three.[2] +

The house was added to the National Register of Historic Places on May 22, 1992.[1] +

+

References[edit]

+
+
    +
  1. ^ a b "National Register Information System". National Register of Historic Places. National Park Service. November 2, 2013. +
    2. +
  2. ^ Benjamin, Susan S. (January 28, 1992). "National Register of Historic Places Registration Form: Akin, Mrs. Henry F., House" (PDF). Illinois Historic Preservation Division. Retrieved August 9, 2020.[dead link] +
    3. +
+
+


+

+

This article about a property in Cook County, Illinois on the National Register of Historic Places is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Mrs._Henry_F._Akin_House&oldid=1090531150"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/27.html b/content/corpora/27.html new file mode 100644 index 0000000..6f4c088 --- /dev/null +++ b/content/corpora/27.html @@ -0,0 +1,1697 @@ + + + + +Nasal bilabial click - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Nasal bilabial click

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Nasal bilabial velar click
ŋ͡ʘ
ᵑʘ
ʘ̃
Audio sample
+
+
Nasal bilabial uvular click
ɴ͡ʘ
ᶰʘ
+
Main articles: Bilabial click and nasal click
+

The bilabial nasal click is a click consonant found in some of the languages of southern Africa. The symbol in the International Phonetic Alphabet that represents this sound is ⟨ʘ̃⟩ or ⟨ᵑʘ⟩. +

+ + +

Features[edit]

+

Features of the bilabial nasal click: +

+
  • The airstream mechanism is lingual ingressive (also known as velaric ingressive), which means a pocket of air trapped between two closures is rarefied by a "sucking" action of the tongue, rather than being moved by the glottis or the lungs/diaphragm. The release of the forward closure produces the "click" sound. Voiced and nasal clicks have a simultaneous pulmonic egressive airstream.
    • +
  • Its place of articulation is bilabial, which means it is articulated with both lips.
    • +
  • Its phonation is voiced, which means the vocal cords vibrate during the articulation.
    • +
  • It is a nasal consonant, which means air is allowed to escape through the nose, either exclusively (nasal stops) or in addition to through the mouth.
+

Occurrence[edit]

+

Bilabial nasal clicks only occur in the Tuu and Kx'a families of southern Africa, in the Australian ritual language Damin, and for /mw/ in some of the languages neighboring Shona, such as at least for some speakers of Ndau and Tonga. +

+ + + + + + + + + + + + + + + + + + + + +
LanguageWordIPAMeaning +
Daminm!ii[ʘ̃iː]'vegetable' +
Tongakumwa[kʼuʘ̃wa]'to drink' +
Ndaumwana[ʘ̃wana]'child' +
+

Glottalized bilabial nasal click[edit]

+
Glottalized
bilabial nasal click
ʘ̃ˀ
ʘ̃͜ʔ
ᵑʘˀ
ᵑ̊ʘˀ
+
Main article: Glottalized click
+

The Tuu and Kx'a languages also have glottalized nasal clicks. These are formed by closing the glottis so that the click is pronounced in silence; however, any preceding vowel will be nasalized. +

+ + + + + + +
LanguageWordIPAMeaning +
+

Notes[edit]

+
+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Nasal_bilabial_click&oldid=951628182"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/28.html b/content/corpora/28.html new file mode 100644 index 0000000..70fc547 --- /dev/null +++ b/content/corpora/28.html @@ -0,0 +1,678 @@ + + + + +Shigatse Tingri Airport - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Shigatse Tingri Airport

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Shigatse Tingri Airport

日喀则 定日 机场

Rìkāzé Dìngrì Jīchǎng
Summary
Airport typePublic/Military
LocationTingri County, Xigazê
Elevation AMSL4,300 m / 14,108 ft
Coordinates28°36′09″N 86°48′37″E / 28.6025°N 86.8103°E / 28.6025; 86.8103
Map
Shigatse Tingri Airport is located in China
Shigatse Tingri Airport
Shigatse Tingri Airport
Location of airport in Xinjiang
Shigatse Tingri Airport is located in Tibet
Shigatse Tingri Airport
Shigatse Tingri Airport
Shigatse Tingri Airport (Tibet)

Shigatse Tingri Airport (Chinese: 日喀则 定日 机场; pinyin: Rìkāzé Dìngrì Jīchǎng) is an under-construction high-altitude airport in Tingri County, Xigazê, Tibet Autonomous Region.[1] Construction began in August 2019.[2][3] +

References[edit]

+
+
    +
  1. ^ "西藏日喀则市今后主要的三座飞机场" [The three main airports in Xigaze, Tibet in the future]. k.sina.cn. 2020-05-09. Retrieved 2021-07-31.{{cite web}}: CS1 maint: url-status (link) +
    2. +
  2. ^ "日喀则市人民政府·区县动态" [Substantial progress has been made in the construction of Tingri Airport]. www.rikaze.gov.cn. Shigatse Municipal People's Government. 19 August 2019. Retrieved 2021-07-31.{{cite web}}: CS1 maint: url-status (link) +
    3. +
  3. ^ "日喀则市人民政府·政府工作报告" [2021 Shigatse City Government Work Report]. www.rikaze.gov.cn. Shigatse Municipal People's Government. Retrieved 2021-07-31.{{cite web}}: CS1 maint: url-status (link) +
    4. +
Stub icon

This China-related article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Shigatse_Tingri_Airport&oldid=1036399977"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/29.html b/content/corpora/29.html new file mode 100644 index 0000000..5c09e7c --- /dev/null +++ b/content/corpora/29.html @@ -0,0 +1,401 @@ + + + + +Herbert E. Wolfe - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Herbert E. Wolfe

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

Herbert E. Wolfe (1917-1981) was an American businessman, banker, philanthropist, farmer, and mayor of St. Augustine, Florida. +

+ + +

Early life[edit]

+

Herbert Edward Wolfe was born on November 3, 1897, in Goodlettsville, Tennessee, the oldest of eight brothers. He went to Tennessee public schools but did not go to college. In 1917, he and his family moved to a potato farm in Elkton, a small town near St. Augustine, Florida.[1] He moved into the city in 1924 when he purchased Markland from the descendants of Andrew Anderson, and lived there for three decades. +

+

Business[edit]

+

In 1923, Wolfe started the H.E. Wolfe Construction Company, which constructed road work in Tennessee, Mississippi, Alabama, South Carolina, Georgia, and Florida.[1] Between 1926 and 1956 Wolfe organized the San Marco Contracting Company.[2] He served as president and chairman of the board of Rogers Manufacturing Company, which made heavy trailers and truck bodies. He served as a director with and vice president of the Florida East Coast Railway, and he served on the Florida Industrial Commission.[2] +

+
Exchange Bank of St. Augustine
+

In addition to his farming and construction business, Herbert Wolfe was also heavily involved in the banking industry in Northeast Florida. He organized three separate Exchange Banks: the Exchange Bank of St. Augustine opened in 1934, the Hastings Exchange Bank in Hastings, Florida opened in 1950, and the Exchange Bank of Palatka in Palatka, Florida opened in 1956. In St. Augustine he served as officer and chairman, in Hastings as a director, and in Palatka as president and chairman of the board.[2] The St. Augustine and Hastings banks eventually became part of the Atlantic National Bank in Jacksonville,[3] while the Palatka branch was sold in 1959.[4] +

+

Political life[edit]

+

For four years (1944–1948) Wolfe served on the city commission of St. Augustine. In 1948 he was mayor of St. Augustine.[2] He was involved in successful political campaigns for Florida senators; he served as campaign treasurer for both George Smathers in his 1950 campaign and Spessard Holland in his 1959 campaign.[5] +

+

Personal life and legacy[edit]

+

Wolfe married his wife Virgie Phelan Parrish in 1917 and they adopted three children; Helen, Marshall, and Charles. He was a member of many community organizations including the Kiwanis Club, the Newcomen Society of North America, Scottish Rite bodies, Morocco Temple, the Royal Order of Jesters, and St. Augustine Shrine Club.[2] In 1967 Wolfe received the first Rotary Community Service Award for outstanding contributions to the community.[6] Wolfe was the second person to receive the Order of La Florida from the City of St. Augustine in 1977.[7] +

During his lifetime he served on the board of many local, state, and national organizations including the Florida State Chamber of Commerce, the American Fire and Casualty Company, Flagler Hospital, Lightner Museum, Flagler College, Florida Southern College, the Florida Industrial Commission, the Children's Home Society in Jacksonville, the Eastern States Brangus Association, the Department of Defense Small Business Advisory Committee, and the National Highway Safety Committee under President Dwight D. Eisenhower.[4][5] +

In St. Augustine, he was known for championing historic preservation efforts. He was the first chairman of the St. Augustine Historical Restoration and Preservation Commission (later to become the Historic St. Augustine Preservation Board) as well as chairman of the Federal Quadricentennial Committee appointed by President John F. Kennedy. In 1969 he resigned from the Preservation Commission due to health problems.[8] +

Wolfe died on March 3, 1981, at Flagler Hospital in St. Augustine, Florida, at the age of 83.[1] +

The Herbert E. Wolfe Papers are housed at the St. Augustine Historical Society Research Library in St. Augustine.[9] +

+

References[edit]

+
+
    +
  1. ^ a b c "Herbert E Wolfe obituary 3". The Tennessean. Retrieved 2018-12-17. +
    2. +
  2. ^ a b c d e Miner, R.P. (March 15, 1969). "Shrine Class of Candidates To Be Named For Herbert E. Wolfe". The St. Augustine Record. +
    3. +
  3. ^ "Landmark: Cathedral Place Office Building". Historic City News. 2011. +
    4. +
  4. ^ a b "Business, Civic Leader Herbert E. Wolfe Dies". The St. Augustine Record. March 4, 1981. +
    5. +
  5. ^ a b Drane, Hank (November 11, 1964). "Herbert Wolfe Lives By American Dream". Florida Times-Union. +
    6. +
  6. ^ King, Tom (October 6, 1967). "H.E. Wolfe, Frank D. Upchurch Sr. Are Recipients Of Service Award". The St. Augustine Record. +
    7. +
  7. ^ "City Honors Wolfe, Highest Award Bestowed". The St. Augustine Record. February 15, 1977. +
    8. +
  8. ^ Wolfe, Herbert (August 6, 1969). Letter from Herbert E. Wolfe to Governor Claude G. Kirk. St. Augustine, Florida. +
    9. +
  9. ^ "H. E. Wolfe Papers (1897–1981) MC12". sahs.pastperfectonline.com. April 1993. Archived from the original on 20 December 2018. +
    10. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Herbert_E._Wolfe&oldid=1083465303"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/3.html b/content/corpora/3.html new file mode 100644 index 0000000..be71678 --- /dev/null +++ b/content/corpora/3.html @@ -0,0 +1,364 @@ + + + + +David Fuller (politician) - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

David Fuller (politician)

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

David Edward Fuller (July 28, 1941 – February 5, 2022) was an American politician from Montana.[1] +

+

Biography[edit]

+

Fuller was born in Helena, Montana, and graduated from Helena Senior High School. He attended the University of Montana. Fuller served on the Lewis and Clark County Commission and was a Democrat. He also served in the Montana Senate from 1983 to 1987. +

Fuller died in Helena on February 5, 2022, at age 80 from COVID-19-related symptoms.[2] +

+

References[edit]

+
+
    +
  1. ^ David Edward Fuller-obituary +
    2. +
  2. ^ "David Fuller Obituary (1941 – 2022) – East Helena, MT – Helena Independent Record". legacy.com. Retrieved 2022-02-14. +
    3. +
+
Flag of MontanaPolitician icon

This article about a Montana politician is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=David_Fuller_(politician)&oldid=1089888496"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/30.html b/content/corpora/30.html new file mode 100644 index 0000000..b557aec --- /dev/null +++ b/content/corpora/30.html @@ -0,0 +1,411 @@ + + + + +SH2D4A - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

SH2D4A

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
SH2D4A
Identifiers
AliasesSH2D4A, PPP1R38, SH2A, SH2 domain containing 4A
External IDsOMIM: 614968 MGI: 1919531 HomoloGene: 11117 GeneCards: SH2D4A
Orthologs
SpeciesHumanMouse
Entrez

63898

72281

Ensembl

ENSG00000104611

ENSMUSG00000053886

UniProt

Q9H788

Q9D7V1

RefSeq (mRNA)

NM_001174159
NM_001174160
NM_022071
NM_001363110
NM_001363111

NM_028182

RefSeq (protein)

NP_001167630
NP_001167631
NP_071354
NP_001350039
NP_001350040

NP_082458

Location (UCSC)Chr 8: 19.31 – 19.4 MbChr 8: 68.73 – 68.8 Mb
PubMed search[3][4]
Wikidata
View/Edit HumanView/Edit Mouse
+

SH2 domain-containing protein 4A is a protein that in humans is encoded by the SH2D4A gene.[5] +

+

Interactions[edit]

+

SH2D4A has been shown to interact with MAGEA11.[6] +

+

References[edit]

+
+
    +
  1. ^ a b c GRCh38: Ensembl release 89: ENSG00000104611 - Ensembl, May 2017 +
    2. +
  2. ^ a b c GRCm38: Ensembl release 89: ENSMUSG00000053886 - Ensembl, May 2017 +
    3. +
  3. ^ "Human PubMed Reference:". National Center for Biotechnology Information, U.S. National Library of Medicine. +
    4. +
  4. ^ "Mouse PubMed Reference:". National Center for Biotechnology Information, U.S. National Library of Medicine. +
    5. +
  5. ^ "Entrez Gene: SH2D4A SH2 domain containing 4A". +
    6. +
  6. ^ Rual JF, Venkatesan K, Hao T, Hirozane-Kishikawa T, Dricot A, Li N, Berriz GF, Gibbons FD, Dreze M, Ayivi-Guedehoussou N, Klitgord N, Simon C, Boxem M, Milstein S, Rosenberg J, Goldberg DS, Zhang LV, Wong SL, Franklin G, Li S, Albala JS, Lim J, Fraughton C, Llamosas E, Cevik S, Bex C, Lamesch P, Sikorski RS, Vandenhaute J, Zoghbi HY, Smolyar A, Bosak S, Sequerra R, Doucette-Stamm L, Cusick ME, Hill DE, Roth FP, Vidal M (October 2005). "Towards a proteome-scale map of the human protein-protein interaction network". Nature. 437 (7062): 1173–1178. Bibcode:2005Natur.437.1173R. doi:10.1038/nature04209. PMID 16189514. S2CID 4427026. +
    7. +
+

Further reading[edit]

+
+ +
+
Stub icon

This article on a gene on human chromosome 8 is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=SH2D4A&oldid=1081690864"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/31.html b/content/corpora/31.html new file mode 100644 index 0000000..c5c0223 --- /dev/null +++ b/content/corpora/31.html @@ -0,0 +1,494 @@ + + + + +Maxime de la Falaise - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Maxime de la Falaise

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+ +

+
Maxime de la Falaise
Maxime de la Falaise.jpg
Born
Maxine Birley

(1922-06-25)25 June 1922
West Dean, West Sussex, England, UK
Died30 April 2009(2009-04-30) (aged 86)
Provence, France
Known forModel, actress, author
Spouse(s)
Count Alain Le Bailly de La Falaise
+
​
​
(m. 1946; div. 1950)​

John McKendry
ChildrenLoulou Le Bailly de La Falaise
Alexis Le Bailly de La Falaise
Parent(s)Sir Oswald Birley
Rhoda Vava Mary Lecky Pike
RelativesMark Birley (brother)
Hugh Hornby Birley (2x great-grandfather)
+

Maxime Le Bailly, comtesse de La Falaise (25 June 1922 – 30 April 2009),[1][2] was an English 1950s model,[3] and, in the 1960s, an underground movie actress.[4] She was also a cookery writer and "food maven"[5] as well as a fashion designer for Blousecraft, Chloé and Gérard Pipart.[6] In her later years she pursued a career as a furniture and interior designer.[7] +

+ + +

Early life[edit]

+

She was born 22 June 1922 in West Dean, West Sussex, England as Maxine Birley[8] into a family of successful artists, businesspeople and academics. She grew up in Hampstead, and later at Charleston Manor, East Sussex. Her father, Sir Oswald Birley (1880–1952), was a celebrated portrait painter known for his portraits of royalty and others.[9][10] Her mother was Rhoda Vava Mary Lecky Pike, of County Carlow, a gardener and successful artist. Maxine's brother, Mark Birley (1930–2007), became an entrepreneur known for his investments in the hospitality industry.[citation needed][11] +

She changed her first name to Maxime after her first marriage, to French aristocrat Alain Le Bailly de La Falaise, in 1946.[12][13] She was known as Maxime de La Falaise McKendry, for a while, after her second marriage to John McKendry, Curator of Prints and Drawings at the Metropolitan Museum.[4][14] +

+

Career[edit]

+

During the Second World War, she worked as a minor codebreaker at Bletchley Park, before being invalided out after developing kleptomania.[15][12] +

+

Fashion[edit]

+

In the 1950s, Maxime de La Falaise worked for Elsa Schiaparelli as a vendeuse mondaine which she explained as "a sort of muse who was supposed to encourage sales to the rich English".[15] She modelled for photographers such as Jack Robinson and Cecil Beaton.[16] +

She "dressed with uninhibited chic"[3] and according to The Independent, Cecil Beaton once called her "the only truly chic Englishwoman".[17] +

+

Writing[edit]

+

While living in New York Maxime de La Falaise wrote a food column for Vogue magazine.[12] In 1980, she published a collection of these columns, with her own illustrations, under the title Food in Vogue. In 1973 she published Seven Centuries of English Cooking: A Collection of Recipes.[12] She also wrote the foreword to My Kingdom of Books (1999) by Richard Booth.[18] +

+

Andy Warhol[edit]

+

Andy Warhol envisioned Maxime de La Falaise as part of Andy Warhol's Nothing Serious, his 1971 video project designed for television.[14] Warhol included her along with such personalities as Candy Darling and Brigid Berlin in his 1973 black-and-white video Phoney (later incorporated into the 1991 Andy Warhol's Video & Television Retrospective),.[14] +

She also appeared in the 1974 film Blood for Dracula (not made by Warhol despite being titled Andy Warhol's Dracula in the US and West Germany).[12] +

According to the New York Times in 1977, Warhol had La Falaise design a menu for Andymat, Warhol's version of the automat, which included onion tarts, shepherds' pie, fish cakes, Irish lamb stew, key lime pie and a "nursery cocktail" of milk on the rocks. Her association with Warhol was such that one source called her "The Factory mother".[19] +

+

Personal life[edit]

+

On 18 July 1946, Maxine Birley became the second wife of Count (comte) Alain Le Bailly de La Falaise, (1905—1977) and was thus styled Countess (comtesse) Maxime de La Falaise.[1] They divorced in 1950, following a series of her infidelities, including an affair with British ambassador Duff Cooper.[1] They had two children: +

+ +

Maxime de La Falaise married, as her second husband, John McKendry, curator of prints and photography at the Metropolitan Museum of Art, who died in 1975. During the marriage it has been suggested that he had an affair with photographer Robert Mapplethorpe,[21][failed verification] while she had one with J. Paul Getty III, artist Max Ernst, and film director Louis Malle.[2][3][4][12] La Falaise is said to have aided Mapplethorpe's entry "into high society, European and American."[22] +

Maxime de La Falaise died of natural causes, aged 86, at her home in Saint-Rémy-de-Provence, Provence, on 30 April 2009.[2] +

+

References[edit]

+
+
    +
  1. ^ a b White, B. (23 June 2015). "Who's That Girl: Ella Richards". UK Daily Telegraph. Retrieved 21 August 2019. 1955 photo titled "Countess Maxima de la Falaise" +
    2. +
  2. ^ a b Fox, Margalit (1 May 2009). "Maxime de la Falaise, model, Designer and Muse, Is Dead at 86". The New York Times. Retrieved 2 May 2009. +
    3. +
  3. ^ a b c "The Little Extras – The Runway Divas". +
    4. +
  4. ^ a b Steger, Pat (28 May 1974). "Those European Prices". San Francisco Chronicle. +
    5. +
  5. ^ The Jack Robinson Gallery and Archive Archived 24 December 2005 at the Wayback Machine +
    6. +
  6. ^ "Obituary: Maxime de la Falaise". TheGuardian.com. 8 May 2009. +
    7. +
  7. ^ "Style Court: Maxime de la Falaise". 7 June 2008. +
    8. +
  8. ^ Burke's Landed Gentry. 1952. p. 186. Archived from the original on 23 February 2005. +
    9. +
  9. ^ http://www.charleston-manor.org.uk/ Charleston Manor +
    10. +
  10. ^ "Biography of Oswald Birley". Archived from the original on 24 August 2004. Retrieved 15 September 2008.{{cite web}}: CS1 maint: bot: original URL status unknown (link) +
    11. +
  11. ^ https://web.archive.org/web/20071223153142/http://www.telegraph.co.uk/news/main.jhtml?xml=/news/2007/08/27/db2701.xml&page=1 Mark Birley: Daily Telegraph obituary +
    12. +
  12. ^ a b c d e f Veronica Howell (9 May 2009). "Obituary:Maxime de la Falaise". The Guardian. London. Retrieved 22 September 2011. +
    13. +
  13. ^ Husband's full name, Alain R. Le Bailly de La Falaise, is cited on his September 1946 marriage license, accessed on ancestry.com on 7 November 2011 +
    14. +
  14. ^ a b c "Andy Warhol's Nothing Serious". +
    15. +
  15. ^ a b "Maxime de la Falaise". London: The Telegraph. 3 May 2009. Retrieved 22 September 2011. +
    16. +
  16. ^ http://www.michaelhoppengallery.com/artist,show,2,38,40,140,0,0,0,0,georges_dambier_maxime_de_la_falaise,_biarritz,_.html Archived 15 October 2008 at the Wayback Machine Michael Hoppen Gallery +
    17. +
  17. ^ http://www.encyclopedia.com/doc/1G1-123031115.html The Independent, 10 September 2004 excerpt re Cecil Beaton quote +
    18. +
  18. ^ https://www.amazon.co.uk/My-Kingdom-Books-Maxime-Falaise/dp/0862434955 My Kingdom of Books by Richard Booth (author), Maxime de La Falaise (foreword) +
    19. +
  19. ^ http://alucidspoonful.blogspot.com/2007/10/restaurant-evolution-part-iii-automat.html A Lucid Spoonfull +
    20. +
  20. ^ http://runway.blogs.nytimes.com/2008/06/05/on-rue-st-honore-paris/ New York Times +
    21. +
  21. ^ "Robert Mapplethorpe, 'John McKendry' 1975, printed 1992". Tate. Retrieved 9 August 2016. +
    22. +
  22. ^ "Drummer magazine". Archived from the original on 22 January 2009. Retrieved 10 September 2016. +
    23. +
+

External links[edit]

+ +
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Maxime_de_la_Falaise&oldid=1089632117"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/32.html b/content/corpora/32.html new file mode 100644 index 0000000..b86d564 --- /dev/null +++ b/content/corpora/32.html @@ -0,0 +1,865 @@ + + + + +Montpinchon - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Montpinchon

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Montpinchon
Commune
Montpinchon church
Montpinchon church
Location of Montpinchon
+
Montpinchon is located in France
Montpinchon
Montpinchon
Montpinchon is located in Normandy
Montpinchon
Montpinchon
Coordinates: 49°01′23″N 1°18′32″W / 49.0231°N 1.3089°W / 49.0231; -1.3089Coordinates: 49°01′23″N 1°18′32″W / 49.0231°N 1.3089°W / 49.0231; -1.3089
CountryFrance
RegionNormandy
DepartmentManche
ArrondissementCoutances
CantonQuettreville-sur-Sienne
IntercommunalityCoutances Mer et Bocage
Government
 • Mayor (2020–2026) Valerie Grieu-Leconte[1]
Area
1
16.94 km2 (6.54 sq mi)
Population
 (Jan. 2019)[2]
519
 • Density31/km2 (79/sq mi)
Time zoneUTC+01:00 (CET)
 • Summer (DST)UTC+02:00 (CEST)
INSEE/Postal code
50350 /50210
Elevation37–148 m (121–486 ft)
(avg. 142 m or 466 ft)
1 French Land Register data, which excludes lakes, ponds, glaciers > 1 km2 (0.386 sq mi or 247 acres) and river estuaries.
+

Montpinchon (French pronunciation: ​[mɔ̃pɛ̃ʃɔ̃]) is a commune in the Manche department in Normandy in north-western France. +

+

Heraldry[edit]

+ + + + +
Arms of Montpinchon
+		The arms of Montpinchon are blazoned :
Or, on a mount vert 2 keys in saltire argent, issuant from the mount 3 pine trees sable, and in chief in fess 3 annulets gules. +
Blason modèle fr Armes parlantes.svg Canting arms.
+

rebus mount+pine ; the 3 annulets are a reference to the arms of the Caillebot de La Salle family, former lords of Montpinchon and Cerisy +


+


+

+
+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ "Répertoire national des élus: les maires". data.gouv.fr, Plateforme ouverte des données publiques françaises (in French). 2 December 2020. +
    2. +
  2. ^ "Populations légales 2019". The National Institute of Statistics and Economic Studies. 29 December 2021. +
    3. +
+ + + + + +
+
+


+

+
Stub icon

This Manche geographical article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Montpinchon&oldid=1060272231"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/33.html b/content/corpora/33.html new file mode 100644 index 0000000..b8613b7 --- /dev/null +++ b/content/corpora/33.html @@ -0,0 +1,496 @@ + + + + +Unsprung mass - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Unsprung mass

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
In this simplified diagram the wheels, tires, and suspension are all part of the vehicle's unsprung weight, with only its one-piece chassis/body constituting its sprung weight
+

The unsprung mass (colloquially unsprung weight) of a vehicle is the mass of the suspension, wheels or tracks (as applicable), and other components directly connected to them. This contrasts with the sprung mass (or weight) supported by the suspension, which includes the body and other components within or attached to it. Components of the unsprung mass include the wheel axles, wheel bearings, wheel hubs, tires, and a portion of the weight of driveshafts, springs, shock absorbers, and suspension links. Brakes that are mounted inboard (i.e. as on the drive shaft, and not part of the wheel or its hub) are part of a vehicle's sprung mass. +

+ + +

Effects[edit]

+

The unsprung mass of a typical wheel/tire combination represents a trade-off between the pair's bump-absorbing/road-tracking ability and vibration isolation. Bumps and surface imperfections in the road cause tire compression, inducing a force on the unsprung mass. The unsprung mass then reacts to this force with movement of its own. The motion amplitude for small duration and amplitude bumps is inversely proportional to the weight. A lighter wheel which readily rebounds from road bumps will have more grip and more constant grip when tracking over an imperfect road. For this reason, lighter wheels are sought especially for high-performance applications. However, the lighter wheel will soak up less vibration. The irregularities of the road surface will transfer to the cabin through the suspension and hence ride quality and road noise are worse. For longer duration bumps that the wheels follow, greater unsprung mass causes more energy to be absorbed by the wheels and makes the ride worse. +

Pneumatic or elastic tires help by restoring some spring to the (otherwise) unsprung mass, but the damping possible from tire flexibility is limited by considerations of fuel economy and overheating. The shock absorbers, if any, also damp the spring motion and must be less stiff than would optimally damp the wheel bounce. So the wheels still vibrate after each bump before coming to rest. On dirt roads and on some softly paved roads, the induced motion generates small bumps, known as corrugations, washboarding or "corduroy" because they resemble smaller versions of the bumps in roads made of logs. These cause sustained wheel bounce in subsequent axles, enlarging the bumps. +

High unsprung mass also exacerbates wheel control issues under hard acceleration or braking. If the vehicle does not have adequate wheel location in the vertical plane (such as a rear-wheel drive car with Hotchkiss drive, a live axle supported by simple leaf springs), vertical forces exerted by acceleration or hard braking combined with high unsprung mass can lead to severe wheel hop, compromising traction and steering control. +

A beneficial effect of unsprung mass is that high frequency road irregularities, such as the gravel in an asphalt or concrete road surface, are isolated from the body more completely because the tires and springs act as separate filter stages, with the unsprung mass tending to uncouple them. +Likewise, sound and vibration isolation is improved (at the expense of handling), in production automobiles, by the use of rubber bushings between the frame and suspension, by any flexibility in the frame or body work, and by the flexibility of the seats. +

+

Unsprung mass and vehicle design[edit]

+

Unsprung mass is a consideration in the design of a vehicle's suspension and the materials chosen for its components. Beam axle suspensions, in which wheels on opposite sides are connected as a rigid unit, generally have greater unsprung mass than independent suspension systems, in which the wheels are suspended and allowed to move separately. Heavy components such as the differential can be made part of the sprung mass by connecting them directly to the body (as in a de Dion tube rear suspension). Lightweight materials, such as aluminum, plastic, carbon fiber, and/or hollow components can provide further weight reductions at the expense of greater cost and/or fragility. +

The term 'unsprung mass' was coined by the mathematician Albert Healey of the Dunlop tyre company. He presented one of the first lectures taking a rigid analytical approach to suspension design, 'The Tyre as a part of the Suspension System' to the Institution of Automobile Engineers in November 1924.[1] This lecture was published as a 100-page paper.[2] +

Inboard brakes can significantly reduce unsprung mass, but put more load on half axles and (constant velocity) universal joints, and require space that may not be easily accommodated. If located next to a differential or transaxle, waste heat from the brakes may overheat the differential or vice versa, particularly in hard use, such as racing. They also make anti-dive suspension characteristics harder to achieve because the moment created by braking does not act on the suspension arms. +

The Chapman strut used the driveshafts as suspension arms, thus requiring only the weight of one component rather than two. Jaguar's patented independent rear suspension (IRS) similarly reduced unsprung mass by replacing the upper wishbone arms of the suspension with the drive shafts, as well as mounting the brakes inboard in some versions. +

Scooter-type motorcycles use an integrated engine-gearbox-final drive system that pivots as part of the rear suspension and hence is partly unsprung. This arrangement is linked to the use of quite small wheels, further affecting their poor reputation for road-holding.[citation needed] +

+

See also[edit]

+ +

Notes[edit]

+
+
    +
  1. ^ Tompkins, Eric (1981). "9: The Beginnings of Tyre Science". The History of the Pneumatic Tyre. Dunlop Archive Project. p. 55. ISBN 0-903214-14-8. +
    2. +
  2. ^ Healey, Albert 3 (1925). "The Tyre as a part of the Suspension System". Proc. Inst. London: Institution of Automobile Engineers. +
    3. +
+

External links[edit]

+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Unsprung_mass&oldid=1012709794"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/34.html b/content/corpora/34.html new file mode 100644 index 0000000..db85158 --- /dev/null +++ b/content/corpora/34.html @@ -0,0 +1,560 @@ + + + + +Samu Kerevi - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Samu Kerevi

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+

+
Samu Kerevi
Samu Kerevi 2018.jpg
Birth nameSamuela Kerevi
Date of birth (1993-09-27) 27 September 1993 (age 28)
Place of birthViseisei, Fiji
Height1.86 m (6 ft 1 in) [1]
Weight108 kg (17 st 0 lb) [1]
SchoolBrisbane State High School
Notable relative(s)Radike Samo (cousin)
Rugby union career
Position(s) +Centre
Senior career
Years +Team +Apps +(Points)
2014–2019
2020–		 +Brisbane City
Suntory Sungoliath		 +19
13		 +(70)
(45)
+
Correct as of 21 September 2021
Super Rugby
Years +Team +Apps +(Points)
2014–2019 +Reds +73 +(130)
+
Correct as of 21 September 2021
National team(s)
Years +Team +Apps +(Points)
2012
2016–		 +Fiji U20
Australia		 +5
36		 +(15)
(30)
+
Correct as of 19 September 2021
+

Samu Kerevi (born 27 September 1993) is a Fijian-born Australian rugby union player currently playing for Suntory Sungoliath in the Japanese Top League.[2] His usual position is centre. He previously played for the Queensland Reds in Super Rugby and has played for the Australian national team.[3] +

+ + +

Family and early life[edit]

+

Samuela Kerevi was born in Viseisei, Fiji. He moved with his family to Australia at aged 4.[4] His father, Nimilote Kerevi, is a former Fiji international soccer player. His brother Josua Kerevi has also played representative rugby.[4] +

Kerevi attended Brisbane State High School, and represented Queensland at the Australian Schools Rugby Championships in 2011.[5] +

Kerevi obtained Australian citizenship in August 2016.[6] +

+

Rugby career[edit]

+

In 2012, Samu Kerevi (his ref name was Musashi) played Premier Rugby for GPS Old Boys in Brisbane.[7] He was selected alongside his brother Josua in the Fiji Under-20 team for the 2012 IRB Junior World Championship in South Africa.[1] In the opening pool match against Wales, he scored the first try of the tournament and he followed that up with a double against Samoa.[8] +

Kerevi was a member of the ARU's National Academy in 2012 and 2013.[9][10] He was selected for Australia Under-20 to play in the 2013 IRB Junior World Championship in France, but was unable to take part due to a shoulder injury.[3][11] +

In July 2013, he signed an extended player squad contract with the Queensland Reds for the 2014 Super Rugby season.[3][12] +

In June 2016, he was included in the 33-member Australia team for the 2016 England rugby union tour of Australia.[13] He made his debut at inside centre against England, in the defeat in Brisbane. Australia would go on to be white-washed in the series 3-0. +

Kerevi continues to play regularly for the Australian team and featured in their squad for the 2019 Rugby World Cup.[14] Following the world cup Kerevi signed with Japanese club Suntory Sungoliath who he is currently playing for in the Top League. +

Kerevi was a member of the Australian men's rugby seven's squad at the Tokyo 2020 Olympics. The team came third in their pool round and then lost to Fiji 19-nil in the quarterfinal.[15] Full details. +

+

Reference list[edit]

+
+
    +
  1. ^ a b c Narawa, Emoni (31 May 2012). "Brothers in arms". Fiji Times. Archived from the original on 4 November 2013. Retrieved 29 October 2013. +
    2. +
  2. ^ "Samu Kerevi confirms Japan deal". ESPN.com. 13 June 2019. Retrieved 26 December 2020. +
    3. +
  3. ^ a b c "Kerevi Signs with Reds". fijirugby.com. 1 August 2013. Archived from the original on 4 November 2013. Retrieved 4 November 2013. +
    4. +
  4. ^ a b "Sorovaki names Fiji U20s team for Wales". fijilive.com. 4 June 2012. Archived from the original on 4 November 2013. Retrieved 3 November 2013. +
    5. +
  5. ^ "Queensland Schoolboys Teams 2011". QRFSU. Archived from the original on 29 September 2011. Retrieved 29 October 2013. +
    6. +
  6. ^ Pandaram, Jamie. "After a long battle, Wallaby Samu Kerevi finally gains Australian citizenship". The Daily Telegraph. News Corporation. Retrieved 14 October 2016. +
    7. +
  7. ^ "Musashi High Performer of the Week". redsrugby.com.au. 2011. Archived from the original on 19 October 2013. Retrieved 3 November 2013. +
    8. +
  8. ^ "Kerevi, Simolo rated in top 20". Fiji Broadcast Corporation. 19 June 2012. Archived from the original on 4 November 2013. Retrieved 3 November 2013. +
    9. +
  9. ^ "National Academy U19 match at Ballymore on Saturday". redsrugby.com.au. 10 October 2012. Retrieved 3 November 2013. +
    10. +
  10. ^ "Australia's next generation set to face Reds College XV". rugby.com.au. 13 April 2013. Archived from the original on 4 November 2013. Retrieved 3 November 2013. +
    11. +
  11. ^ "Australian Under 20s Squad". rugby.com.au. 2013. Archived from the original on 14 October 2013. Retrieved 3 November 2013. +
    12. +
  12. ^ Tucker, Jim (23 July 2013). "Reds need to rework style to return to top of Australian rugby pile". Courier-Mail. Archived from the original on 22 July 2013. Retrieved 29 October 2013. +
    13. +
  13. ^ "Wallabies v England Test series: Stirling Mortlock on centre dilemma". Fox Sports. 3 June 2016. Retrieved 3 June 2016. +
    14. +
  14. ^ "Wallabies place faith in experience for World Cup bid". www.abc.net.au. 22 August 2019. Retrieved 26 December 2020. +
    15. +
  15. ^ "Australian Olympic Team for Tokyo 2021". The Roar. Retrieved 6 April 2022. +
    16. +
+

External links[edit]

+ +
+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Samu_Kerevi&oldid=1081219138"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/35.html b/content/corpora/35.html new file mode 100644 index 0000000..ef2387e --- /dev/null +++ b/content/corpora/35.html @@ -0,0 +1,533 @@ + + + + +Pacem in terris - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Pacem in terris

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
For the communist-era Czechoslovakian organization, see Association of Catholic Clergy Pacem in Terris.
+

+

+
Pacem in terris
Latin for 'Peace on Earth'
+Encyclical of Pope John XXIII
Coat of arms of Pope John XXIII
Signature date11 April 1963[1]
SubjectThat peace between all peoples must be based on truth, justice, love and freedom
Number8 of 8 of the pontificate
Text
 
+

Pacem in terris (lit. 'Peace on Earth') was a papal encyclical issued by Pope John XXIII on 11 April 1963 on the rights and obligations of individuals and of the state, as well as the proper relations between states. It emphasized human dignity and equality among all people, and made mention of issues such as the rights of women, nuclear non-proliferation, and the United Nations, all of which it endorsed. It was the last encyclical drafted by John XXIII, who had been diagnosed with cancer in September 1962 and died two months after the encyclical's completion. Biographer Peter Hebblethwaite called it Pope John's "last will and testament".[2] Published on Holy Thursday, the Pope called it his "Easter gift". +

Due to its importance and popularity, Pacem in Terris is deposited at the UN archives. +

+ + +

Title[edit]

+

The full title of the encyclical is On Establishing Universal Peace in Truth, Justice, Charity and Liberty. The short title Pacem in terris is derived from the opening words of the encyclical, as is customary with papal documents: +

+ + + + + + + + + + + +
Part of a series on
Catholic social teaching
Emblem of the Holy See
Emblem of the Holy See
+Overview
+
+ +
+
Pope Leo XIII
+ +
+
Pope Pius XI
+ +
+
Pope Pius XII
+ +
+
Pope John XXIII
+ +
+
Second Vatican Council
+ +
+
Pope Paul VI
+ +
+
Pope John Paul II
+ +
+
Pope Benedict XVI
+ +
+
Pope Francis
+ +
+
Other figures
+ +
+046CupolaSPietro.jpg Catholicism portal
+
Pacem in terris, quam homines universi cupidissime quovis tempore appetiverunt, condi confirmarique non posse constat, nisi ordine, quem Deus constituit, sancte servato.
+
("Peace on earth, for which all men of every era have most eagerly yearned, cannot be firmly established unless the order which God laid down is dutifully observed.")
+

History[edit]

+
German Stamp 1969
+

Pacem in terris was the first encyclical that a pope addressed to "all men of good will", rather than only to Catholics, quoting the praise to God as said by the heavenly army above the manger of Bethlehem (Latin Vulgate: in terra pax in hominibus bonae voluntatis, Luke 2:14; English translation: 2:13–14).[3] Learned Hand Professor of Law at Harvard Law School, Mary Ann Glendon, interprets this to mean, "He was insisting that the responsibility for setting conditions for peace does not just belong to the great and powerful of the world—it belongs to each and every one of us."[4] In theological terms, it marked a major shift in papal teaching from reliance on classical scholastic categories of natural law to a more inductive approach based on the signs of the times.[5] +

In this work, John XXIII reacted to the political situation in the middle of the Cold War. Coming just months after the 1962 Cuban Missile Crisis, during which the Vatican served as an intermediary between the White House and the Kremlin,[6] the document also reflected the Pope's experience of 1960 in trying to resolve difficulties arising out the four-power occupation of Berlin. The "peace encyclical" was issued only two years after the erection of the Berlin Wall. It also draws on Pope John's reading of Saint Augustine's The City of God and Thomas Aquinas' view of Eternal Law.[7] In this it echoes the Gospel's core values and principles of patristic and medieval thought, while reflecting the historical period in which it was written.[8] +

Sociologist Monsignor Pietro Pavan and a small group of theologians helped draft it.[9] In Pavan's view Pacem in terris would present the teachings of Leo XIII on the eternal law, "in light of the changing tides of history, and allow them to resonate with a much wider audience".[7] +

The Pope explains in this encyclical that conflicts "should not be resolved by recourse to arms, but rather by negotiation". He further emphasizes the importance of respect of human rights as an essential consequence of the Christian understanding of men. He clearly establishes "that every man has the right to life, to bodily integrity, and to the means which are suitable for the proper development of life." +

Pacem in terris is an extended reflection on the moral order. The document is divided into four sections. +

+
  • The first section of the encyclical establishes the relationship between individuals and humankind, encompassing the issues of human rights and moral duties.
    • +
  • The second section addresses the relationship between man and state, dwelling on the collective authority of the latter.
    • +
  • The third section establishes the need for equality amongst nations and the need for the state to be subject to rights and duties that the individual must abide by.
    • +
  • The final section presents the need for greater relations between nations, thus resulting in collective states assisting other states. The encyclical ends with the urging of Catholics to assist non-Christians and non-Catholics in political and social aspects.
+

Reception[edit]

+

“Pacem in Terris was more than an encyclical—it was an event," recalls Glendon.[4] +Pacem in Terris was the first papal encyclical published in its entirety in the New York Times.[10] The Washington Post said, "Pacem in terris is not just the voice of an old priest, nor just that of an ancient Church; it is the voice of the conscience of the world."[4] According to the periodical Catholic World Report, "Two years later, it was the subject of a conference at the United Nations attended by over 2,000 statespersons and scholars."[4] +

+

Legacy[edit]

+

F. Russell Hittinger describes the encyclical "as a kind of magna carta of the Catholic Church's position on human rights and natural law".[7] Pope John XXIII's 1963 encyclical Pacem in terris ("Peace on Earth") radically affected Catholic social teaching not only on war and peace, but on church-state relations, women's rights, religious freedom, international relations and other major issues. Fr. J. Bryan Hehir called Pacem in terris "a pivotal text in [papal] encyclical history" that played a major role in the development of the Second Vatican Council's Declaration on Religious Freedom and its Pastoral Constitution on the Church in the Modern World, and on Pope John Paul II's encyclical Centesimus annus ("The Hundredth Year"), which marked the centennial of Pope Leo XIII's 1891 encyclical on labor, Rerum Novarum.[5] It also influenced the 1965 Declaration on Religious Freedom (Dignitatis humanae).[5] +

In commemoration of this encyclical, the annual Pacem in Terris Peace and Freedom award was instituted in 1964, first by the Roman Catholic Diocese of Davenport and later by the Quad Cities Pacem in Terris Coalition.[11][12] +

During an event held on 6 May 2019, in Bulgaria, where John XXIII had gained a reputation for protecting Jews when serving as the country's Vatican representative,[13] Pope Francis invoked the encyclical as a "code of conduct" for peace between Catholics and other religions.[13][14] +

+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ Pope John XXIII (11 April 1963). "Pacem in Terris". Vatican. +
    2. +
  2. ^ Hebblethwaite, Peter (2010) [1st ed: John XXIII: Pope of the Council (1984)]. John XXIII: Pope of the Century (abridged, revised, and retitled ed.). London: Bloomsbury Publishing. pp. 4, 214, 232, 240, 241–251. ISBN 978-1-441-18413-9. {{cite book}}: External link in |orig-year= (help) +
    3. +
  3. ^ Other translations did not follow the Latin version or, as in the case of the CEI, have stopped following it with the 1973 revised edition of the Jerusalem Bible: compare the Italian text of the encyclical's address and the different translation subsequently introduced by the Italian bishops. +
    4. +
  4. ^ a b c d "United Nations Conference". www.catholicworldreport.com. Retrieved 12 April 2020. +
    5. +
  5. ^ a b c "Experts: 'Pacem in Terris' had radical impact on church teaching". National Catholic Reporter. 18 April 2013. Retrieved 12 April 2020. +
    6. +
  6. ^ "Catholic Spirit: Of Popes, Presidents and Peace". Minnesota Catholic Conference. 26 April 2012. Retrieved 12 April 2020. +
    7. +
  7. ^ a b c Hittinger, Russell. "Quinquagesimo Ante: Reflections on Pacem in Terris Fifty Years Later", The Global Quest for Tranquillitas Ordinis. Pacem in Terris, Fifty Years Later Pontifical Academy of Social Sciences, Acta 18, 2013 +
    8. +
  8. ^ Sanchez Sorondo, Marcelo. "The Magnitude of 'Walking in the Truth' (3 Jn 1)", The Global Quest for Tranquillitas Ordinis. Pacem in Terris, Fifty Years Later Pontifical Academy of Social Sciences, Acta 18, 2013 +
    9. +
  9. ^ Murphy, Francis X., "Cardinal Pietro Pavan: inveterate optimist", America, February 1996 +
    10. +
  10. ^ Mannion, Gerard. "Pacem in Terris@50: Gifts Old and New for Church and Society in Recent Times", Pacem in Terris Conference 2013, Georgetown University +
    11. +
  11. ^ "Pacem in Terris". Diocese of Davenport. Archived from the original on 12 May 2008. Retrieved 1 June 2011. +
    12. +
  12. ^ Arland-Fye, Barb (19 May 2010). "Peace activist Fr. John Dear to get Pacem in Terris Award". The Catholic Messenger. Davenport, IA. Retrieved 1 June 2011.[permanent dead link] +
    13. +
  13. ^ a b Brockhaus, Hannah. "Pope Francis says First Communion Mass in Bulgaria". Catholic News Agency. Retrieved 12 April 2020. +
    14. +
  14. ^ "Pope in Bulgaria prays for peace according to the example of St Francis - Vatican News". www.vaticannews.va. 6 May 2019. Retrieved 12 April 2020. +
    15. +
+

Further reading[edit]

+ +

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Pacem_in_terris&oldid=1060005841"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/36.html b/content/corpora/36.html new file mode 100644 index 0000000..36b9b41 --- /dev/null +++ b/content/corpora/36.html @@ -0,0 +1,729 @@ + + + + +Albert M. Chan - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Albert M. Chan

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Albert M. Chan
AlbertMChan.jpg
Albert M. Chan at the 13th Annual Vancouver Asian Film Festival
Born
Albert Michael Chan

(1975-10-01) October 1, 1975 (age 46)
Toronto, Ontario, Canada
OccupationActor, filmmaker
Years active2004—present
WebsiteOfficial Website of Albert M. Chan
+

Albert M. Chan (born October 1, 1975) is a Canadian actor and filmmaker based in the United States.[1] +

+ + +

Background[edit]

+

Chan was born in Toronto, Ontario, Canada, and lived in Mississauga, Ontario, Canada. He moved to Boston, Massachusetts in 1997, to attend the Massachusetts Institute of Technology, where he received his Ph.D. in Electrical Engineering.[1] +

+

Career[edit]

+

Career development[edit]

+

Chan first began his career working on student films, indie films, and theatre in the Boston area while still a student at the Massachusetts Institute of Technology. It took several years before he landed his first major role in 2006, a part in Walt Disney Picture's Underdog,[2] which was released in 2007. He followed up with TV roles that same year in The CW Television Network pilot I'm Paige Wilson and Showtime's Brotherhood. +

Also in 2007, Chan took matters into his own hands and wrote, directed, produced, and starred in his own film, Fate Scores, which also featured the acoustic guitar song "It Won't Be Long", written and performed by Chan.[2] In his directorial debut, Chan was recognized by the National Film Board of Canada as second runner-up for Best Canadian Short Film at the Vancouver Asian Film Festival in 2009.[3] Fate Scores premiered at the Wisconsin Film Festival on April 5, 2009, and has since appeared in seven additional film festivals in North America.[4] The film was acquired for distribution in 2010 by Moving Images Distribution (formerly Canadian Filmmakers Distribution West). +

In 2008, Chan was cast in a supporting role working alongside Matthew McConaughey and Jennifer Garner in the New Line Cinema romantic comedy Ghosts of Girlfriends Past and also completed filming Every Day, starring Helen Hunt and Liev Schreiber, which opened at the 2010 Tribeca Film Festival. +

In 2009, Chan filmed the supporting role of Richard in the indie feature Life of Lemon, starring Dan Lauria, Beth Grant, and Rachel Miner and also had a role on the NBC hit drama Law & Order: Special Victims Unit. In 2010, he was cast in ABC's Body of Proof, and the following year he was cast in Spike Lee's HBO pilot Da Brick. +

Chan returned to filmmaking in 2011 when he wrote, directed, executive produced, and starred in his own film, The Commitment, about an interracial gay couple adopting a newborn baby. The film was inspired by an unsuccessful adoption in Chan's actual life. "Those familiar with domestic adoption had told us before we began that the adoption process is truly a roller coaster ride, and now we finally understood what these people meant," Chan explained on the film's official website.[5] "I dealt with the feelings of loss and disappointment the only way I knew how—I wrote a screenplay. Four unsuccessful birthparent matches and one year later, The Commitment went into production. Two weeks after the film wrapped, our beautiful son Andrew was born, the result of our fifth match." The film premiered in Palm Springs on September 22, 2012, and has since won the 2013 National Association of Social Workers Media Award for Best Feature Film (edging out fellow nominees Moonrise Kingdom and What to Expect When You're Expecting (film), the Audience Award for Best Short at the 2013 Desperado LGBT Film Festival (Phoenix, AZ), both the Jury Award and Audience Award for Best LGBT Film at the 2013 SENE Film, Music, & Arts Festival (Providence, RI), a Best LGBT Film nomination at the 2013 Out in the Desert: Tucson's International LGBT Film Festival, Audience Favorite - Short Series at the 2012 Palm Springs Gay and Lesbian Film Festival (shared with Little Ones and Groom's Cake), and Best Supporting Actress - Short Film at the Summer 2012 Asians On Film Festival.[5] The film has screened at over 40 film festivals on six continents.[5] +

In 2012, Chan appeared as Roy on the NBC hit comedy series 30 Rock. He also filmed two television movies: Clear History starring Larry David and Jon Hamm and directed by Greg Mottola for HBO, and The Makeover starring Julia Stiles and Camryn Manheim for ABC and the Hallmark Hall of Fame. The Makeover premiered on ABC on January 27, 2013, and Clear History premiered on HBO on August 10, 2013. Also in 2013, Chan was cast Lloyd Chang in his second role on the NBC hit drama Law & Order: Special Victims Unit, opposite special guest star Cybill Shepherd. +

In 2014, Chan completed Descendants of the Past, Ancestors of the Future, a film he wrote and directed, starring Golden Globe, Emmy, and Drama Desk nominee Tina Chen,[6] which won Best Screenplay and Best Actress at the 2015 NYC Downtown Short Film Festival.[7] The film, based on the immigration history of Chan's family, was awarded a Puffin Foundation Grant and named a finalist for the Roy W. Dean Film Grant.[6] +

In 2016, Chan was cast in the Boston Marathon bombing film Patriots Day starring Mark Wahlberg and Kevin Bacon and also in the final season of the hit HBO series Girls, which aired at the beginning of 2017. That same year, Chan guest starred on the FOX drama Gotham and shot a recurring role as Tony Q on the upcoming TV series Big Dogs. +

Chan also wrote and co-directed Welcome to the World in 2017, a dark drama about a troubled man who records a video message for his sister. Chan shot the film in one continuous take with a budget of less than $140.[8] Richard Propes of The Independent Critic gave the film four stars and wrote, "riveting piece of human drama... Chan's performance is deeply moving... lingers in your brain long after the closing credits".[9] Kirk Fernwood of One Film Fan praised the film as "intelligent, inventive, and inspired... Chan does a fantastic job... drawing you in with every word... the finale is a stroke of creative brilliance and artistry".[10] The film has screened at over 40 film festivals on six continents.[11] +

In 2019, Chan was cast as a therapist in the Anna Kendrick HBO Max series Love Life, which premiered in 2020. That same year, he scored a role on the hit NBC series New Amsterdam. Also, two of his projects premiered on the same day on Amazon Prime Video: the feature film Big Exit in which Chan plays insurance agent Tim, and the TV series Big Dogs in which Chan has a recurring role as wardrobe stylist Tony Q. The latter also premiered on Tubi. +

+

Other work[edit]

+

He is currently an on-line spokesperson for Staples Inc. where he demonstrates printers as Mike from EasyTech. +

As a consequence of both his academic and acting careers, Chan has an Erdős–Bacon number of 4. He co-authored a peer-reviewed paper on OFDM, giving him an Erdős number of 3.[12][13][14] Chan appeared alongside Kevin Bacon in Patriots Day, giving him a Bacon number of 1.[15] +

+

Press[edit]

+

Chan has been featured as an up-and-coming actor and director in numerous print and on-line articles including a story by The Advocate,[16] an Asian American Risings A-Profiler feature,[17] four Sampan articles,[18][19][20][8] two Bay Windows interviews,[21][22] an MIT Alumni Association profile,[23] and a Slice of MIT article.[24] He has also appeared as a panelist at a sneak preview of the PBS TV show American Masters: Hollywood Chinese. +

+

Filmography[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Year +Title +Role +Notes +
2004 +Overserved +Wang Long + +
2005 +Number Two Pencil +Phillip + +
2006 +Interrogation +Charles Han + +
2007 +Underdog +Geek Worker + +
Brotherhood +Brothel Manager +1 Episode (Not Dark Yet 3:5-6) +
American Experience +Chinese Prisoner +1 Episode (The Living Weapon) +
I'm Paige Wilson +Dealer +The CW Television Network pilot +
2008 +Ana's Time +Ken Chuen + +
2009 +Ghosts of Girlfriends Past +Groomsman Sam + +
Law & Order: Special Victims Unit +Banker +1 Episode (Sugar) +
Fate Scores +Guitarist +Also director and writer +
2010 +Every Day +Dr. Lee + +
2011 +Life of Lemon +Richard + +
Body of Proof +Lab Tech +1 Episode (Letting Go) +
Da Brick +Tim +HBO pilot +
2012 +30 Rock +Roy +1 Episode (Alexis Goodlooking and The Case of The Missing Whisky) +
The Commitment +Robert +Also Director and Writer +
2013 +The Makeover +Pearce + +
Clear History +Electron Motors Co-Worker + +
Law & Order: Special Victims Unit +Lloyd Chang +1 Episode (An American Tragedy) +
2014 +Descendants of the Past, Ancestors of the Future +Andrew +Also director and writer +
2016 +Patriots Day +Computer Forensic Tech + +
2017 +Girls +Ming +1 Episode (All I Ever Wanted) +
Welcome to the World +Man +Also co-director and writer +
Gotham +Pharmacist +1 Episode (A Dark Knight: The Blade's Path) +
2020 +New Amsterdam +EEG Tech +1 Episode (Perspectives) +
Love Life +Therapist +1 Episode (Bradley Field) +
Big Dogs +Tony Q +2 Episodes (Things I've Done, All for None) +
Big Exit +Tim + +
2022 +Julia +Owner +1 Episode (Crepes Suzette) +
The Storied Life of A. J. Fikry +Mr. Balboni + +
+

References[edit]

+
+
    +
  1. ^ a b "Asian Actor Albert M. Chan". AlbertMChan.com. Retrieved October 17, 2012. +
    2. +
  2. ^ a b Albert M. Chan at IMDb +
    3. +
  3. ^ "Vancouver Asian Film Festival 2009: NFB award winner announced". Archived from the original on 2012-10-17. +
    4. +
  4. ^ "Fate Scores official website". +
    5. +
  5. ^ a b c "The Commitment official website". +
    6. +
  6. ^ a b "Descendants of the Past, Ancestors of the Future official website". +
    7. +
  7. ^ "Duo Multicultural Arts Center - FILM". duotheater.org. Retrieved 2017-10-27. +
    8. +
  8. ^ a b "Local director/actor Albert M. Chan to present East Coast premiere of 'Welcome to the World' in Boston". sampan.org. Retrieved 2017-10-27. +
    9. +
  9. ^ "The Independent Critic - "Welcome to the World" a Deeply Moving New Short Film". theindependentcritic.com. Retrieved 2017-10-27. +
    10. +
  10. ^ "Short Film Review "Welcome To The World ← One Film Fan". onefilmfan.com. Retrieved 2017-10-27. +
    11. +
  11. ^ "Welcome to the World official website". +
    12. +
  12. ^ Lee, Inkyu; Chan, Albert M.; Sundberg, Carl-Erik (2004). "Space-time bit-interleaved coded modulation for OFDM systems". IEEE Transactions on Signal Processing. 52 (3): 820–25. doi:10.1109/TSP.2003.822350. +
    13. +
  13. ^ Duren, Peter; Khavinson, Dmitry; Shapiro, Harold S.; Sundberg, Carl-Erik (1994). "Invariant subspaces in Bergman spaces and the biharmonic equation". Michigan Mathematical Journal. 41 (2): 247–59. doi:10.1307/mmj/1029004992. +
    14. +
  14. ^ Erdős, Paul; Shapiro, Harold S. (1965). "Large and small subspaces of Hilbert space". Michigan Mathematical Journal. 12 (2): 169–78. doi:10.1307/mmj/1028999306. +
    15. +
  15. ^ Patriots Day at IMDb as "Computer Forensic Tech" +
    16. +
  16. ^ Want to Help Gay Asian Film Become First To Win Social Work Award?, a March 9, 2013 article from The Advocate +
    17. +
  17. ^ "Asian American Risings A-Profiler Feature". Archived from the original on 2009-11-25. Retrieved 2009-11-27. +
    18. +
  18. ^ Sampan Newspaper interview[permanent dead link] +
    19. +
  19. ^ Local Asian-American Director’s Gay Adoption Film Nominated for National Media Award, a March 1, 2013 article from Sampan +
    20. +
  20. ^ Golden Globe, Emmy, and Drama Desk Nominee Joins Cast of Asian Family Drama, an August 15, 2013 article from Sampan +
    21. +
  21. ^ Big Score, an April 30, 2009 article from Bay Windows +
    22. +
  22. ^ The Commitment at Boston's Asian American Film Festival, an October 10, 2012 article from Bay Windows +
    23. +
  23. ^ "MIT Alumni Association profile". Archived from the original on 2009-04-27. Retrieved 2009-11-27. +
    24. +
  24. ^ Slice of MIT article +
    25. +
+

External links[edit]

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Albert_M._Chan&oldid=1062001035"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/37.html b/content/corpora/37.html new file mode 100644 index 0000000..3d06e77 --- /dev/null +++ b/content/corpora/37.html @@ -0,0 +1,1209 @@ + + + + +2020 Norwegian Athletics Championships - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

2020 Norwegian Athletics Championships

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
2020 Norwegian Athletics Championships
Dates18–20 September
Host cityBergen
VenueFana Stadion
Fana stadion.jpg
← 2019
2021 →

+

The 2020 Norwegian Athletics Championships (Norwegian: NM i friidrett 2020) was the year's national outdoor track and field championships for Norway. It was held from 2–4 August at the Fana Stadion in Bergen. It was organised by Fana IL, IL Gneist and IL Bjarg serving as organisers. +

The King's Cups were won by Jakob Ingebrigtsen and Amalie Iuel. +

+ + +

Championships[edit]

+

Several outdoor senior national championships were staged. Separate championships are also arranged for juniors and masters athletes, and in several cases there are separate junior and maseters events incorporated into the senior championships.[1] +

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Championship +Date +Place +
Short Cross Country18–19 April (canceled)Trondheim +
Relays23–24 May (postponed until 2021)Stavanger +
Marathon4 July (postponed until 2021)Jølster +
Combined events8–9 August (postponed from 31 May)Fagernes +
Mountain running29 August (postponed until 2021)Førde +
Half marathon3 OctoberJessheim +
Trail running26 September (postponed until 2021)Molde +
Long-distance cross country11 OctoberSkien +
100 kilometres5 December (postponed until spring 2021)Bergen +
+

Results[edit]

+

Men[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Event +Gold +Silver +Bronze +
100 metres +Even Meinseth [no]
IL Gular		10.69 +Mathias Hove Johansen
IL Skjalg		10.70 +Jacob Vaula [no]
Stord IL		10.84 +
200 metres +Mathias Hove Johansen
IL Skjalg		21.36 +Andreas Haara Bakketun
IL Gular		21.79 +Filip Bøe
Fana IL		22.05 +
400 metres +Fredrik Gerhardsen Øvereng
Overhalla IL		47.21 +Andreas Haara Bakketun
IL Gular		47.89 +Tor-Junor Kringstad Vedde
IL Gular		48.21 +
800 metres +Jakob Ingebrigtsen
Sandnes IL		1:48.72 +Sigurd Tveit
Kristiansand Løpeklubb		1:49.08 +Didrik Hexeberg Warlo
IL Tyrving		1:49.15 +
1500 metres +Jakob Ingebrigtsen
Sandnes IL		3:33.93 +Mats Hauge
IL Gular		3:46.99 +Moa Abounnachat Bollerød
Sem IF		3:47.47 +
5000 metres +Narve Gilje Nordås
Sandnes IL		14:02.66 +Zerei Kbrom Mezngi
Stavanger FIK		14:03.67 +Bjørnar Sandnes Lillefosse
IL Gular		14:03.98 +
10,000 metres +Zerei Kbrom Mezngi
Stavanger FIK		28:04.29 +Narve Gilje Nordås
Sandnes IL		28:20.55 +Bjørnar Sandnes Lillefosse
IL Gular		28:23.46 +
110 m hurdles +Vladimir Vukicevic
SK Vidar		14.00 +Joachim Sandberg
IK Tjalve		14.67 +Julian Skimmeland Aasheim
Stord IL		15.14 +
400 m hurdles +Karsten Warholm
Dimna IL		48.23 +Andreas Joseph Dixon
Fana IL		53.61 +Herman Ellingsen
IL Gneist		55.36 +
3000 m s'chase +Harald Kårbø
Stord IL		8:53.11 +Fredrik Sandvik
Ullensaker/Kisa IL		8:53.16 +Abdalla Targan Tambaw Yousif
IF Herkules		9:07.58 +
5000 m walk +Tobias Lømo
IK Tjalve		23:50.79 +Andreas Døske
Haugesund IL		24:18.68 +Magnus Græsli
Leinstrand IL		24:30.67 +
Half marathon +Marius Vedvik
IL Gular		1:04:42 +Isaac Tesfamichael
Leksvik IL		1:04:53 +Eivind Øygard
Jølster IL		1:05:17 +
Cross country (long course) +Filip Ingebrigtsen
Sandnes IL		29:23 +Magnus Tuv Myhre
Brandbu IF		30:27 +Jonatan Vedvik
Tønsberg Friidrettsklubb		30:38 +
Long jump +Henrik Flåtnes [no]
Tønsberg FIK		7.62 m +Ingar Kiplesund [no]
SK Vidar		7.40 m +Marius Bull Hjeltnes
IK Tjalve		6.86 m +
High jump +* Sander Skotheim [no]
IK Tjalve		2.08 m +Erlend Bolstad Raa
Fana IL		2.05 m +Vetle Raa Ellingsen
Fana IL		2.00 m +
Triple jump +Henrik Flåtnes [no]
Tønsberg FIK		15.77 m +Ingar Kiplesund
SK Vidar		15.65 m +Sander Aae Skotheim
IK Tjalve		15.02 m +
Pole vault +Sondre Guttormsen
SK Vidar		5.55 m +Pål Haugen Lillefosse
Fana IL		5.50 m +Simen Guttormsen
SK Vidar		5.45 m +
Shot put +Marcus Thomsen
IK Tjalve		18.39 m +Sven Martin Skagestad
Norna-Salhus IL		17.63 m +Ola Stunes Isene
Sturla IF		16.40 m +
Discus throw +Ola Stunes Isene
Sturla IF		60.19 m +Sven Martin Skagestad
Norna-Salhus IL		59.27 m +Eivind Henriksen
IK Tjalve		52.83 m +
Javelin throw +Kasper Sagen
Bækkelagets SK		79.90 m +Myron Weinberg
Kristiansands IF		67.36 m +Sondre Alexander Høyland
IL Tyrving		66.47 m +
Hammer throw +Eivind Henriksen
IK Tjalve		76.40 m +Evald Osnes Devik
Gloppen FIL		65.10 m +Kjetil Røste Ringen
Brandbu IF		60.86 m +
1000 m relay +IL Gular
Even Meinseth [no]
Torbjørn Lysne
Andreas Haara Bakketun
Tor-Junor Kringstad Vedde		1:54.18 +IL Skjalg
Sergejs Kononovs
Mike Lubsen
Mathias Hove Johansen
Oscar Alm Harestad		1:54.34 +IL Gneist
Gjert Høie Sjursen
Herman Ellingsen
Kristoffer André Johannes Blücher
Thomas Strønstad-Løseth		1:54.85 +
Decathlon +Martin Roe
FRI IL		7991 pts +Gjert Høie Sjursen
IL Gneist		6542 pts +Simen Sebastian Hansen
Ås IL		5890 pts +
+

Women[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Event +Gold +Silver +Bronze +
100 metres +Helene Rønningen
IL Tyrving		11.76 +Ingvild Meinseth
Sørild FIK		11.96 +Vilde Humstad Aasmo
IK Tjalve		12.18 +
200 metres +Henriette Jæger
Aremark IF		23.60 +Line Kloster
SK Vidar		23.81 +* Linn Oppegaard [no]
Moss IL		24.36 +
400 metres +Henriette Jæger
Aremark IF		52.90 +* Linn Oppegaard [no]
Moss IL		53.56 +Ingrid Pernille Rismark
SK Vidar		54.88 +
800 metres +Hedda Hynne
IK Tjalve		2:03.64 +Ingeborg Østgård
FIK Ren-Eng		2:05.00 +Amalie Manshaus Sæten
Ullensaker/Kisa IL		2:05.55 +
1500 metres +Amalie Manshaus Sæten
Ullensaker/Kisa IL		4:38.30 +Sigrid Jervell Våg
IK Tjalve		4:39.55 +Ina Halle Haugen
IL Runar		4:39.76 +
5000 metres +Sigrid Jervell Våg
IK Tjalve		16:15.02 +Vienna Søyland Dahle
IL Skjalg		16:16.29 +Maria Sagnes Wågan
IK Tjalve		16:17.68 +
10,000 metres +Vienna Søyland Dahle
IL Skjalg		33:28.39 +Maria Sagnes Wågan
IK Tjalve		33:31.90 +Hanne Mjøen Maridal
Ullensaker/Kisa IL		33:39.39 +
100 m hurdles +Andrea Rooth
Lambertseter IF		13.50 +Ingrid Pernille Rismark
SK Vidar		13.97 +Marlén Aakre
Fredrikstad IF		14.04 +
400 m hurdles +Amalie Iuel
IK Tjalve		55.63 +Andrea Rooth
Lambertseter IF		56.95 +Nora Kollerød Wold
Fredrikstad IF		57.10 +
3000 m s'chase +Andrea Modin Engesæth
IL Runar		9:57.95 +Sara Aarsvoll Svarstad
SK Vidar		10:21.30 +Sigrid Alvik
IL Tyrving		10:21.47 +
3000 m walk +Siri Gamst Glittenberg
Laksevåg TIL		13:37.45 +Maren Karlsen Bekkestad
Sturla IF		13:49.05 +Fride Møller Flatin
Dimna IL		14:41.42 +
Half marathon +Vienna Søyland Dahle
Skjalg IL		1:14:19 +Hanne Mjøen Maridal
Ullensaker/Kisa IL		1:14:29 +Astrid Brathaug Sørset
Tyrving IL		1:18:26 +
Cross country (long course) +Karoline Bjerkeli Grøvdal
IK Tjalve		19:04 +Maria Sagnes Wågan
IK Tjalve		20:22 +Silje Fjørtoft
Ullensaker/Kisa IL		20:50 +
Long jump +Mia Guldteig Lien
Ranheim IL		6.22 m +Thale Leirfall Bremset
Stjørdal FIK		6.04 m +Henriette Jæger
Aremark IF		6.04 m +
High jump +Mia Guldteig Lien
Ranheim IL		1.80 m +Hedvig Kallåk
IL Tyrving		1.75 m +Tonje Angelsen
IK Tjalve		1.75 m +
Triple jump +Hedda Kronstrand Kvalvåg
IK Tjalve		12.73 m +Mari Sellevåg Aarø
Norna-Salhus IL		12.69 m +Rachel Ombeni
Norna-Salhus IL		12.28 m +
Pole vault +Lene Retzius
IL i BUL		3.80 m +Agnes Elisabeth Morud
Ranheim IL		3.50 m +Kitty Augusta Friele Faye
Fana IL		3.30 m +
Shot put +Elisabeth Thon Rosvold
Asker Skiklubb		13.59 m +Birthe Franck-Petersen
Ålesund FIK		13.26 m +Hanna Emilie Hjeltnes
Ullensaker/Kisa IL		12.95 m +
Discus throw +Elisabeth Thon Rosvold
Asker Skiklubb		49.76 m +Lotta Flatum Fallingen
Brandbu IF		48.64 m +Solveig Fredriksen
Fana IL		46.94 m +
Javelin throw +Ane Dahlen
IL Tyrving		54.76 m +Stella Weinberg
Kristiansands IF		54.49 m +Kaja Mørch Pettersen
Larvik Turn & IF		52.03 m +
Hammer throw +Beatrice Nedberge Llano
Laksevåg TIL		66.78 m +Oda Marie Myklebust
Bergens TF		56.78 m +Solveig Fredriksen
Fana IL		56.32 m +
1000 m relay +IK Tjalve
Vilde Humstad Aasmo
Line Maltun Helland
Kaitesi Auma Ertzgaard
Amalie Iuel		2:10.26 +SK Vidar
Helene Oulie
Maria Aaberg
Ingrid Pernille Rismark
Line Kloster		2:10.56 +Fredrikstad IF
Emma Skibstad Bekkevik
Marlén Aakre
Ida Andrea Breigan
Nora Kollerød Wold		2:11.39 +
Heptathlon +Telma Eid
Søndre Land IL		5093 pts +Elise Hoel Ulseth
IL Norodd		5027 pts +Not awarded +
+

Referanser[edit]

+
+
    +
  1. ^ "HOVEDTERMINLISTE 2020" (PDF). +
    2. +
+
Results
+ +

External links[edit]

+ +
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=2020_Norwegian_Athletics_Championships&oldid=1055436829"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/38.html b/content/corpora/38.html new file mode 100644 index 0000000..d4c50a8 --- /dev/null +++ b/content/corpora/38.html @@ -0,0 +1,674 @@ + + + + +James Storme - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

James Storme

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
James Storme
+Spelers Standaard Luik , Storme (kop), Bestanddeelnr 918-1932.jpg
Personal information
Date of birth + (1943-04-12) 12 April 1943 (age 79)
Senior career*
Years +Team +Apps +(Gls)
1961–1965 +Gent + +
1965–1968 +Standard Liège + +
1968–1970 +Union Saint-Gilloise + +
1980–1961 +Gent + +
1975–1976 +VG Oostend + +
Teams managed
1988–1990 +Oostende
1990–1991 +Gent-Zeehaven
1991–1993 +Boom
1993 +Kortrijk
1994 +Boom
1994–1995 +Lokeren
1995–1996 +Beerschot
1997–1998 +Mons
1999 +Sint-Niklaas
1999–2000 +Roeselare
+*Club domestic league appearances and goals
+

James Storme (born 12 April 1943) is a Belgian football midfielder and later manager.[1][2] +

+

References[edit]

+
+
    +
  1. ^ James Storme at WorldFootball.net +
    2. +
  2. ^ Footballdatabase +
    3. +
+
+
+
+
+
+
+


+

+
Flag of BelgiumSoccer icon

This biographical article relating to Belgian football is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=James_Storme&oldid=1063376142"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/39.html b/content/corpora/39.html new file mode 100644 index 0000000..a8ee2df --- /dev/null +++ b/content/corpora/39.html @@ -0,0 +1,395 @@ + + + + +The Best American Travel Writing - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

The Best American Travel Writing

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

The Best American Travel Writing is a yearly anthology of travel literature published in United States magazines. It was started in 2000 as part of The Best American Series published by Houghton Mifflin. Articles are chosen using the same procedure with other titles in the Best American series; the series editor chooses about 100 article candidates, from which the guest editor picks 25 or so for publication; the remaining runner-up articles listed in the appendix. +

Jason Wilson has been the series editor since inception in 2000. +

+

Guest editors[edit]

+ +

References[edit]

+
    +
  1. ^ The best American travel writing 2016. Bryson, Bill,, Wilson, Jason, (Travel writer),, Chabon, Michael,, Corbett, Sara,, Eggers, Dave,, Ehrlich, Gretel. Boston. 2016. ISBN 9780544812093. OCLC 932050824.{{cite book}}: CS1 maint: others (link) +
    2. +
+
Stub icon

This article about an anthology of written works is a stub. You can help Wikipedia by expanding it.

+
Stub icon

This article about a travel book is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=The_Best_American_Travel_Writing&oldid=977775225"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/4.html b/content/corpora/4.html new file mode 100644 index 0000000..aea19d9 --- /dev/null +++ b/content/corpora/4.html @@ -0,0 +1,726 @@ + + + + +Minimalist photography - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Minimalist photography

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Minimalist photo
+

+Minimalist photography is a form of photography that is distinguished by extreme, austere simplicity.[1] It emphasizes spareness and focuses solely on the smallest number of objects in the composition process. Minimalist photographers usually focus solely on one particular subject, rather than an abundance of color, patterns and information.[2] +

+ + +

Etymology[edit]

+
Costa Blanca Spain by Dari Ingal
+
Minimalist landscape by Martin Vorel
+

Minimalist photography arises from the notion of minimalism in art, which is a style used by many 20th century artists. This style emphasizes the use of a minimal number of compositional elements: color, objects, shapes and texture.[3] The aim of minimalist photography is to express a concept, in order to bring forth a distinctive visual experience or elicit an emotional response from the viewer. In the world of photography, it is viewed as an exceptionally intuitive and personal concept, entrusting interpretation and understanding to the audience perspective of the art[according to whom?]. +

+

History[edit]

+

Minimalist photography stems from its initial art movement; minimalism, which was a movement in the 1950s that emerged in the United States, also known as Minimalist Art, Reductive Art or ABC Art. As the name denotes, minimalism — which originates from the word minimum — means the slightest or the littlest amount required.[4] In the art world, minimalism employs a limited amount of elements to construct the desired effect. Generally speaking, the most crucial characteristic of this style is its ultimate simplicity, impartial and neutral approach. For example, an artist utilizing minimalism will normally use a restricted quantity of colors coupled with a simplified subject matter in the construction of the artwork. Artists focus on the idea of simplicity and plainness in their creations and the resulting movement has been a great source of inspiration for other artists in the following decades[according to whom?]. +

+

Technique[edit]

+
Minimal Airuno
+

Minimalism as an art movement first originated in the 1950s. It is also known as Reductive Art, ABC Art and Minimalist Art. This movement eliminates its objects to the smallest amount of colors, shapes, and textures in order to establish a needed effect. Reducing color, lines and form to a minimum amount in its composition is the main goal of minimalist artists. The most important characteristics of this art movement include; simplicity (where no excessive subject matters are utilized), repetitions (where artists employ repetitive colors and lines in the artworks), geometric shapes (where rectangles and circles are often employed in the painting to convey a sense of simpleness and coherence). Other important characteristics include using very little materials, props and other symbols in the creation of the composition.[5] For example, black and white images are a representation of the minimalist style as color is being reduced to minimize distractions. Minimalism as a concept in arts can be dated back to the 1900s. Influences of minimalism are still employed today in diverse fields such as photography, design, sculpture and architecture. +

+

Photography[edit]

+
Minimal Nana

Minimalist photography focuses on simplicity and its artistic style can be encapsulated by the quote, "less is more." Minimalist photographers achieve this effect by casting aside all the unnecessary components in creating their works.[6] This principle is demonstrated in various minimalist photographs, for example, when capturing a mountain or an ocean on camera, the entirety of the scenery will be presented as one big vast space. The vacancy and bareness of the space shown enables the audience to imagine and craft their own version of interpretation and comprehension, instead of including the photographer's own inputs and insights. In order to expand and concentrate on the expansive space, it is crucial to minimize contradicting elements such as people or distracting buildings. Doing so conveys a sense of barrenness and desolation that creates a theatrical atmosphere and visual experience. Therefore, a minimalist photograph is often captured early in the morning, sunrise or dark at night. This ensures that the scene is not filled with crowds and that the overall composition appears neat and simplified. +

Minimalist photography[edit]

+

"As an approach in photography, minimalism or minimalistic photography could be taken by the photographer in all genres. No matter your are a portrait, architecture, landscape etc. photographer, minimalist photos are always an option as long as you have a minimal look toward your surroundings" -Milad Safabakhsh, Founder of Minimalist Photography Awards.[7] +

Minimalist photography often pays attention to one single subject in its composition, using nature as its background. Some representative subject matters include geometric patterns, lines and textures, which can range between an apple, a mountain or a bridge, to name a few examples. Although this style of photography is derived from the art movement in the early 1950s, its impact is exhibited in various forms of digital photography. +

+

Gallery[edit]

+
    +
  • +
    Early morning at Begnas lake presented in minimalist approach
    +
    +

    Early morning at Begnas lake presented in minimalist approach +

    +
    +
    • +
  • +
    +
    +

    Yellow boxes +

    +
    +
    • +
  • +
    +
    +

    Lake +

    +
    +
    • +
+

References[edit]

+
    +
  1. ^ Philippines, Digital Photography, 2010, ‘TECHNIQUE Minimalist Magic’, Minimalist Magic, 20 Oct. 2010, pp. 062–067. +
    2. +
  2. ^ Kantilaftis, Helen (2014-10-27). "Minimalist Photography". Student Resources. Retrieved 2021-03-04. +
    3. +
  3. ^ VanEenoo, Cedric, 2011, ‘Minimalism in Art and Design: Concept, influences, implications and perspectives’, Journal of Fine and Studio Art, vol. 2(1), pp. 7-12. +
    4. +
  4. ^ Jovanovic Srdjan, 2009, ‘Hedonism in Abstract Art: Minimalist Digital Abstract Photography’, Rupkatha Journal on Interdisciplinary Studies in Humanities, vol. 1, pp. 88-91. +
    5. +
  5. ^ Inan, Sukriye, 2014, ‘The effects of minimalist movement on painting arts and music’, University Department of Fine Art, vol. 5, pp. 11-22. +
    6. +
  6. ^ Tuck, Kirk, 2008, Minimalist Lighting, Professional Techniques for Location Photography, Amherst Media, New York. +
    7. +
  7. ^ "Official website | Minimalist Photography Awards". www.minimalistphotographyawards.com. +
    8. +
+

See also[edit]

+ + + + + + +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Minimalist_photography&oldid=1065448446"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/40.html b/content/corpora/40.html new file mode 100644 index 0000000..9af8498 --- /dev/null +++ b/content/corpora/40.html @@ -0,0 +1,505 @@ + + + + +Ap4A - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Ap4A

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Ap4A +
Diadenosine tetraphosphate.svg +
Names +
Preferred IUPAC name +
O1,O7-Bis{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl} tetrahydrogen tetraphosphate
+
Other names +
Diadenosine tetraphosphate; 5',5'''-Diadenosine tetraphosphate; AppppA
+
Identifiers +
+
+
3D model (JSmol)
+
+
+
+
+ +
  • C1=NC2=C(C(=N1)N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@@H]4[C@H]([C@H]([C@@H](O4)N5C=NC6=C5N=CN=C6N)O)O)O)O
+
+
Properties +
+C20H28N10O19P4 +
Molar mass +836.390 g·mol−1 +
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
+
+ +
+

Diadenosine tetraphosphate or Ap4A is a putative alarmone, ubiquitous in nature being common to everything from bacteria to humans. It is made up of two adenosines joined together by a 5′-5′ linked chain of four phosphates. Adenosine polyphosphates are capable of inducing multiple physiological effects.[1] +

+ + +

Function[edit]

+

In Eukaryotes[edit]

+

Ap4A can be created by a non-canonical activity of the Lysyl-tRNA synthetase (LysRS). This function of LysRS is activated by the phosphorylation of LysRS on serine 207, its subsequent dissociation from the multi-synthetase complex (MSC).[2] The molecule's role as a second messenger has recently been discovered in The LysRS-Ap4A-MITF signaling pathway.[3] Ap4A binds to the MITF-HINT1 inhibitory complex, specifically to the molecule histidine triad nucleotide–binding protein 1(HINT1), releasing the Microphthalmia-associated transcription factor (MITF) and causing an increase in the transcription of its target genes.[4] Ap4A also positively regulates the activity of the transcription factor USF2 through a similar molecular mechanism to that of MITF.[5] +

It has also been shown, that Ap4A plays a role in the functionality of dendritic cells (DCs). An increase in the intracellular amount Improves their motility and antigen presenting ability through alterations in small GTPases present in the cells. This was discovered by creating mice deficient in the enzyme NUDT2, which serves as an Ap4A hydrolase and thus controls the levels of Ap4A in the cell.[6] Ap4A, however, has also been shown to cause apoptosis in several cell lines through an unknown mechanism, the degradation of Ap4A was necessary for the process as hydrolysis‐resistant analogues of the molecule showed no apoptotic activity.[7] +

+

In Prokaryotes[edit]

+

In E. Coli, Ap4A has been shown to function as an alarmone, as the intracellular concentrantion of the molecule increases upon heat stress.[8] Ap4A can also be incorporated into RNA as a 5' Cap along with other dinucleoside polyphosphates. It serves as a substrate for the RNA polymerase and the intracellular levels of these capped RNAs increase upon stress, suggesting that the cap adds a level of stability to the RNA.[9] +

Myxococcus xanthus is a type of Gram-negative bacteria, and M. xanthus lysyl-tRNA synthetase (LysS) is an enzyme from the bacteria that synthesizes diadenosine tetraphosphates (Ap4A) when adenosine triphosphate (ATP) is present. Diadenosine pentaphosphate (Ap5A) is synthesized from Ap4A with ATP.[10] +

+

References[edit]

+
+
    +
  1. ^ Luo, Jiankai; Jankowski, Vera; GüNgär, Nihayrt; Neumann, Joachim; Schmitz, Wilhelm; Zidek, Walter; SchlüTer, Hartmut; Jankowski, Joachim (2004). "Endogenous diadenosine tetraphosphate, diadenosine pentaphosphate, and diadenosine hexaphosphate in human myocardial tissue". Hypertension. 43 (5): 1055–9. doi:10.1161/01.hyp.0000126110.46402.dd. PMID 15066958. +
    2. +
  2. ^ Ofir-Birin, Yifat; Fang, Pengfei; Bennett, Steven P.; Zhang, Hui-Min; Wang, Jing; Rachmin, Inbal; Shapiro, Ryan; Song, Jing; Dagan, Arie; Pozo, Jorge; Kim, Sunghoon; Marshall, Alan G.; Schimmel, Paul; Yang, Xiang-Lei; Nechushtan, Hovav; Razin, Ehud; Guo, Min (2013-01-10). "Structural Switch of Lysyl-tRNA Synthetase between Translation and Transcription". Molecular Cell. 49 (1): 30–42. doi:10.1016/j.molcel.2012.10.010. ISSN 1097-2765. PMC 3766370. PMID 23159739. +
    3. +
  3. ^ *Lee, Yu-Nee; Nechushtan, Hovav; Figov, Navah; Razin, Ehud (April 2004). "The function of lysyl-tRNA synthetase and Ap4A as signaling regulators of MITF activity in FcepsilonRI-activated mast cells". Immunity. 20 (2): 145–51. doi:10.1016/S1074-7613(04)00020-2. PMID 14975237. +
    4. +
  4. ^ Yu, Jing; Liu, Zaizhou; Liang, Yuanyuan; Luo, Feng; Zhang, Jie; Tian, Cuiping; Motzik, Alex; Zheng, Mengmeng; Kang, Jingwu; Zhong, Guisheng; Liu, Cong (2019-10-11). "Second messenger Ap4A polymerizes target protein HINT1 to transduce signals in FcεRI-activated mast cells". Nature Communications. 10 (1): 4664. doi:10.1038/s41467-019-12710-8. ISSN 2041-1723. PMC 6789022. PMID 31604935. +
    5. +
  5. ^ Lee, Yu-Nee; Razin, Ehud (2005-10-15). "Nonconventional Involvement of LysRS in the Molecular Mechanism of USF2 Transcriptional Activity in FcεRI-Activated Mast Cells". Molecular and Cellular Biology. 25 (20): 8904–8912. doi:10.1128/MCB.25.20.8904-8912.2005. ISSN 0270-7306. PMC 1265770. PMID 16199869. +
    6. +
  6. ^ Shu, Shin La; Paruchuru, Lakshmi Bhargavi; Tay, Neil Quanwei; Chua, Yen Leong; Foo, Adeline Shen Yun; Yang, Chris Maolin; Liong, Ka Hang; Koh, Esther Geok Liang; Lee, Angeline; Nechushtan, Hovav; Razin, Ehud; Kemeny, David Michael (2019-06-28). "Ap4A Regulates Directional Mobility and Antigen Presentation in Dendritic Cells". iScience. 16: 524–534. doi:10.1016/j.isci.2019.05.045. ISSN 2589-0042. PMC 6595237. PMID 31254530. +
    7. +
  7. ^ Vartanian, Amalia; Alexandrov, Ivan; Prudowski, Igor; McLennan, Alexander; Kisselev, Lev (1999). "Ap4A induces apoptosis in human cultured cells". FEBS Letters. 456 (1): 175–180. doi:10.1016/S0014-5793(99)00956-4. ISSN 1873-3468. PMID 10452553. +
    8. +
  8. ^ Despotović, Dragana; Brandis, Alexander; Savidor, Alon; Levin, Yishai; Fumagalli, Laura; Tawfik, Dan S. (2017). "Diadenosine tetraphosphate (Ap4A) – an E. coli alarmone or a damage metabolite?". The FEBS Journal. 284 (14): 2194–2215. doi:10.1111/febs.14113. ISSN 1742-4658. PMID 28516732. +
    9. +
  9. ^ Hudeček, Oldřich; Benoni, Roberto; Reyes-Gutierrez, Paul E.; Culka, Martin; Šanderová, Hana; Hubálek, Martin; Rulíšek, Lubomír; Cvačka, Josef; Krásný, Libor; Cahová, Hana (2020-02-26). "Dinucleoside polyphosphates act as 5′-RNA caps in bacteria". Nature Communications. 11 (1): 1052. Bibcode:2020NatCo..11.1052H. doi:10.1038/s41467-020-14896-8. ISSN 2041-1723. PMC 7044304. PMID 32103016. +
    10. +
  10. ^ Kimura, Yoshio; Tanaka, Chihiro; Oka, Manami (July 2018). "Identification of Major Enzymes Involved in the Synthesis of Diadenosine Tetraphosphate and/or Adenosine Tetraphosphate in Myxococcus xanthus". Current Microbiology. 75 (7): 811–817. doi:10.1007/s00284-018-1452-x. ISSN 1432-0991. PMID 29468302. S2CID 3402370. +
    11. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Ap4A&oldid=1064871734"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/41.html b/content/corpora/41.html new file mode 100644 index 0000000..b122bb4 --- /dev/null +++ b/content/corpora/41.html @@ -0,0 +1,1789 @@ + + + + +1969–70 Football League Cup - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

1969–70 Football League Cup

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+ +

+ +
1969–70 Football League Cup
Country England
 Wales
Teams92
Defending championsSwindon Town
ChampionsManchester City (1st title)
Runners-upWest Bromwich Albion
+

The 1969–70 Football League Cup was the tenth season of the Football League Cup, a knockout competition for England's top 92 football clubs. The competition started on 12 August 1969 and ended with the final on 7 March 1970. +

The final was contested by First Division team Manchester City and First Division side West Bromwich Albion at Wembley Stadium in London. Jeff Astle opened the scoring for Albion after five minutes, becoming the first player to score in the final of both the League Cup and FA Cup at Wembley. He had already scored in the first leg of the 1966 League Cup Final four years previously at West Ham United's Boleyn Ground. City equalised through Mike Doyle to send the game into extra-time, and eventually won 2–1, with Glyn Pardoe scoring the winner. +

This was the first season in which all ninety-two football league clubs competed in the tournament. +

+ + +

First round[edit]

+

Ties[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Date +Home Team +Score (half-time) +Away Team +Home Scorers +Away Scorers +Attendance +
12 August 1969Bradford Park Avenue0–2 (0-1)Rotherham UnitedBrown (og), Mullen3,980 +
12 August 1969Newport County2–3 (0-1)Swansea CityHill, CooperThomas (p), Nurse, Gwyther3,824 +
12 August 1969Scunthorpe United0-2 (0-2)HartlepoolRon Young (2)2,800 +
12 August 1969Southend United2–2 (0-2)BrentfordChisnall, Gelson (og),Mansley (2)9,356 +
13 August 1969Aldershot0–1 (0-0)GillinghamFolds5,179 +
13 August 1969Barnsley0–1 (0-0)Halifax TownFlowers9,546 +
13 August 1969Bolton Wanderers6–3 (1-3)RochdaleByron (3), Wharton (p), Greaves (2)Butler (2), Jenkins10,057 +
13 August 1969Bournemouth & Boscombe Athletic3–0 (2-0)Bristol RoversHold, McDougall (2)7,478 +
13 August 1969Bradford City1–1 (1-1)ChesterfieldHamArcher6,449 +
13 August 1969Brighton & Hove Albion1–0 (0-0)PortsmouthDawson19,787 +
13 August 1969Chester1–2 (0-1)Aston VillaDeardenMcMahon, Hamilton10,510 +
13 August 1969Colchester United1–1 (1-1)ReadingMassayHarris (p)5,165 +
13 August 1969Crewe Alexandra0–0Wrexham4,948 +
13 August 1969Darlington3–0 (2-0)York CityO'Neill (2), Gauden3,953 +
13 August 1969Exeter City1–1 (1-0)Bristol CityBanksKellard8,003 +
13 August 1969Grimsby Town0–2 (0-1)Doncaster RoversRobertson, Mobley (og)6,243 +
13 August 1969Mansfield Town3–1 (2-0)Notts CountyBates, Jones (og), WaltersBarker6,727 +
13 August 1969Orient0–0Fulham8,676 +
13 August 1969Oxford United2–0 (0-0)Northampton TownG. Atkinson, Jones7,158 +
13 August 1969Peterborough United1–1 (1-1)Luton TownPriceSheffield10,249 +
13 August 1969Plymouth Argyle2–2 (1-2)Torquay UnitedKitchener (og), BurnsideE Walsh, Binney15,199 +
13 August 1969Port Vale0–1 (0-1)Tranmere RoversBeamish4,955 +
13 August 1969Preston North End0–1 (0-0)BuryArrowsmith9,021 +
13 August 1969Shrewsbury Town1–0 (0-0)WalsallMcLaughlin6,971 +
13 August 1969Southport5–1 (0-0)Oldham AthleticColquhoun (og), A Russell, Andrew (2), RedrobeBeardall2,873 +
13 August 1969Stockport County0–2 (0-1)Blackburn RoversKnighton, Connelly5,925 +
13 August 1969Watford2–1 (2-1)Lincoln CityEndean, ScullionHubbard10,086 +
13 August 1969Workington0–0Barrow3,969 +
+

Replays[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Barrow3–1Workington18 August 1969 +
Brentford0–0[1]Southend United18 August 1969 +
Bristol City3–2Exeter City19 August 1969 +
Chesterfield0–1Bradford City20 August 1969 +
Fulham3–1Leyton Orient18 August 1969 +
Luton Town5–2Peterborough United19 August 1969 +
Reading0–3Colchester United20 August 1969 +
Torquay United1–0Plymouth Argyle20 August 1969 +
Wrexham1–0Crewe Alexandra18 August 1969 +
+

Second Replay[edit]

+ + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Brentford2–3[1]Southend United21 August 1969 +
+

Second round[edit]

+

Ties[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Aston Villa1–2West Bromwich Albion3 September 1969 +
Barrow1–2Nottingham Forest3 September 1969 +
Blackburn Rovers4–2Doncaster Rovers3 September 1969 +
Blackpool3–1Gillingham3 September 1969 +
Bolton Wanderers0–0Rotherham United3 September 1969 +
Brighton & Hove Albion2–0Birmingham City3 September 1969 +
Bristol City0–0Leicester City2 September 1969 +
Carlisle United2–0Huddersfield Town2 September 1969 +
Charlton Athletic0–2Wrexham2 September 1969 +
Coventry City0–1Chelsea2 September 1969 +
Crystal Palace3–1Cardiff City3 September 1969 +
Darlington0–1Everton3 September 1969 +
Fulham0–1Leeds United3 September 1969 +
Hartlepool1–3Derby County3 September 1969 +
Hull City1–0Norwich City3 September 1969 +
Ipswich Town4–0Colchester United3 September 1969 +
Luton Town2–2Millwall2 September 1969 +
Manchester United1–0Middlesbrough3 September 1969 +
Mansfield Town2–2Queens Park Rangers3 September 1969 +
Oxford United4–1Bury3 September 1969 +
Sheffield United2–0Newcastle United2 September 1969 +
Sheffield Wednesday1–1Bournemouth & Boscombe Athletic3 September 1969 +
Shrewsbury Town2–2Southend United2 September 1969 +
Southampton1–1Arsenal2 September 1969 +
Southport0–3Manchester City3 September 1969 +
Stoke City0–2Burnley3 September 1969 +
Sunderland1–2Bradford City3 September 1969 +
Swansea City1–3Swindon Town2 September 1969 +
Tranmere Rovers2–1Torquay United3 September 1969 +
Watford1–2Liverpool3 September 1969 +
West Ham United4–2Halifax Town3 September 1969 +
Wolverhampton Wanderers1–0Tottenham Hotspur3 September 1969 +
+

Replays[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Arsenal2–0[1]Southampton4 September 1969 +
Bournemouth & Boscombe Athletic1–0Sheffield Wednesday9 September 1969 +
Leicester City0–0[1]Bristol City10 September 1969 +
Millwall0–1[1]Luton Town8 September 1969 +
Queens Park Rangers4–0Mansfield Town9 September 1969 +
Rotherham United3–3[1]Bolton Wanderers9 September 1969 +
Southend United2–0Shrewsbury Town8 September 1969 +
+

Second Replays[edit]

+ + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Leicester City3–1Bristol City15 September 1969 +
Rotherham United1–0Bolton Wanderers11 September 1969 +
+

Third round[edit]

+

Ties[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Arsenal0–0Everton24 September 1969 +
Bournemouth & Boscombe Athletic0–2Leicester City24 September 1969 +
Bradford City2–1Southend United24 September 1969 +
Brighton & Hove Albion2–3Wolverhampton Wanderers24 September 1969 +
Crystal Palace2–2Blackpool24 September 1969 +
Carlisle United2–1Blackburn Rovers24 September 1969 +
Derby County3–1Hull City24 September 1969 +
Ipswich Town1–1West Bromwich Albion24 September 1969 +
Leeds United1–1Chelsea24 September 1969 +
Manchester City3–2Liverpool24 September 1969 +
Manchester United2–0Wrexham23 September 1969 +
Nottingham Forest1–0West Ham United23 September 1969 +
Oxford United1–0Swindon Town24 September 1969 +
Queens Park Rangers6–0Tranmere Rovers23 September 1969 +
Rotherham United1–1Burnley24 September 1969 +
Sheffield United3–0Luton Town23 September 1969 +
+

Replays[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Everton1–0Arsenal30 September 1969 +
Blackpool0–1Crystal Palace30 September 1969 +
Burnley2–0Rotherham United30 September 1969 +
Chelsea2–0Leeds United6 October 1969 +
West Bromwich Albion2–0Ipswich Town30 September 1969 +
+

Fourth round[edit]

+

Ties[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Burnley0–0Manchester United14 October 1969 +
Crystal Palace1–1Derby County14 October 1969 +
Carlisle United1–0Chelsea14 October 1969 +
Leicester City2–0Sheffield United14 October 1969 +
Manchester City2–1Everton14 October 1969 +
Nottingham Forest0–1Oxford United14 October 1969 +
Queens Park Rangers3–1Wolverhampton Wanderers14 October 1969 +
West Bromwich Albion4–0Bradford City14 October 1969 +
+

Replays[edit]

+ + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Derby County3–0Crystal Palace29 October 1969 +
Manchester United1–0Burnley20 October 1969 +
+

Fifth Round[edit]

+

Ties[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Derby County0–0Manchester United12 November 1969 +
Leicester City0–0West Bromwich Albion29 October 1969 +
Manchester City3–0Queens Park Rangers29 October 1969 +
Oxford United0–0Carlisle United29 October 1969 +
+

Replays[edit]

+ + + + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Manchester United1–0Derby County19 November 1969 +
Carlisle United1–0Oxford United4 November 1969 +
West Bromwich Albion2–1Leicester City5 November 1969 +
+

Semi-finals[edit]

+

First Leg[edit]

+ + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +
Carlisle United1–0West Bromwich Albion19 November 1969 +
Manchester City2–1Manchester United3 December 1969 +
+

Second Leg[edit]

+ + + + + + + + + + + + + + + + + + + + +
Home Team +Score +Away Team +Date +Agg +
Manchester United2–2Manchester City17 December 19693–4 +
West Bromwich Albion4–1Carlisle United3 December 19694–2 +
+

Final[edit]

+
Main article: 1970 Football League Cup Final
+

The final was held at Wembley Stadium, London on 7 March 1970.[2] +

+
+
+ + + + +
Manchester City2 (0) – 1 (1)[1]West Bromwich Albion
Doyle
Pardoe		Astle
Attendance: 97,963
Referee: V.James
+

References[edit]

+

General +

+
  • "English League Cup 1969/1970". Soccerbase. Retrieved 3 February 2009.
    • +
  • "England League Cup Full Results 1960–1996". Rec.Sport.Soccer Statistics Foundation. Archived from the original on 21 February 2009. Retrieved 3 February 2009.
    • +
  • "English League Cup 1969–1970:Results". statto.com. Archived from the original on 31 May 2008. Retrieved 17 January 2012.
+

Specific +

+
+
    +
  1. ^ a b c d e f g After Extra Time +
    2. +
  2. ^ "Final Details". Retrieved 3 April 2010. +
    3. +
+
+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=1969–70_Football_League_Cup&oldid=1001025912"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/42.html b/content/corpora/42.html new file mode 100644 index 0000000..0e19a23 --- /dev/null +++ b/content/corpora/42.html @@ -0,0 +1,356 @@ + + + + +Dalys Island - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Dalys Island

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Dalys Island
Dalys Island is located in New York
Dalys Island
Dalys Island
Geography
LocationMohawk River
Coordinates42°50′21″N 73°59′49″W / 42.83917°N 73.99694°W / 42.83917; -73.99694[1]
Highest elevation236 ft (71.9 m)
Administration
 United States
State New York
CountySchenectady
TownsGlenville
+

Dalys Island or Daleys Island is an island on the Mohawk River west of Scotia in Schenectady County, New York. +

+

References[edit]

+
    +
  1. ^ "Dalys Island". Geographic Names Information System. United States Geological Survey. Retrieved 2017-12-05. +
    2. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Dalys_Island&oldid=1039320319"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/43.html b/content/corpora/43.html new file mode 100644 index 0000000..0f2ee01 --- /dev/null +++ b/content/corpora/43.html @@ -0,0 +1,484 @@ + + + + +Oryx Quest - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Oryx Quest

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

Oryx Quest was the name of the first round-the-world yacht race to start and finish in the Middle East[1] and was held in February 2005 in Qatar.[2] +

The race, organised by British sailor Tracy Edwards, was regarded as a follow-up to The Race of 2000 and was designed to complement existing Multihull races. It was hoped that the size of the prize and the potential speed of the participating boats would make it the most-exciting round-the-world race to date. Record prize money of $1 million was offered by Qatar Sports International which was headed by Sheikh Tamim bin Hamad bin Khalifa Al Thani, the Heir Apparent of Qatar, which hoped to gain publicity as a tourism destination. The prize money however, along with the £6 million sponsorship was never paid by Qatar Sports International. +

On 5 February four multihulled yachts began the route, off Doha. +

+ + +

Entries[edit]

+

The participants were: +

+ +

Results[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Pos Boat nameCrew Country Time
1Doha 2006 + Brian Thompson Great Britain62d 21h 1m 22s +
2Daedalus + Tony Bullimore Great Britain75d 0h 20m 48s +
–Cheyenne + David Scully United StatesDNF +
–Geronimo + Olivier de Kersauson FranceDNF +
+
+
+

+Legend: DNF – Did not finish; +

+

Race[edit]

+

Geronimo was the first elimination on 2 March, as a result of hull damage following a collision with flotsam. de Kersauson returned to Australia to have the boat repaired, and to break the record for the circumnavigation of the continent in July. A week later the mast of Cheyenne broke just after the boat had rounded Cape Horn. With two remaining boats, Doha 2006 won the race, finishing with an overall time of 62 days, 21 hours and 1 minute. The more-than-20-year-old Daedalus crossed the finishing line some 13 days later. +

+

Media coverage[edit]

+

Media coverage in the Middle East, Far East and Asia (Qatar's key target markets) was valued at $46 million and the weekly race programmes made by APP were seen in 600 million homes, making it the most widely watched race in yachting history. The website including the children's 'Ali the Albatross' education pages received over 20 million hits. Tracy and her team also put together Qatar's first Sports Education Programme to which over 10,000 Qatari school children signed up. +

+

Financial fiasco[edit]

+

HSBC paid £3 million towards the event and Edwards personally borrowed £8 million to pay suppliers, her team and each of the competitors was paid between $1 million and $2 million each to enter (the first time a yacht race has managed to do this). However, Qatar Sports International reneged on the £6 million sponsorship deal and $1 million prize money and Edwards was consequently forced into bankruptcy and lost her home. She was discharged in September 2005. Edwards' legal team in Qatar won the first stage of her legal action in Qatar on 31 January 2006. Legal action to recover monies owed to Quest, its suppliers and Edwards herself is still ongoing. +

+

Criticism[edit]

+

Organiser Edwards was criticised by Bruno Peyron for splitting the field of potential participants by insisting on her own event, so that as a result Peyron was not able to recruit enough participants for his own event: a second edition of The Race. He won the 2005 Jules Verne Trophy instead, improving the record for circumnavigation which had previously been held by Cheyenne. +

+

References[edit]

+
+
    +
  1. ^ "Oryx Quest 2005 update". Yachting World. 28 September 2004. Retrieved 15 June 2018. +
    2. +
  2. ^ "Oryx Quest 2005 start". Yachting World. 5 February 2005. Retrieved 15 June 2018. +
    3. +
+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Oryx_Quest&oldid=1004427302"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/44.html b/content/corpora/44.html new file mode 100644 index 0000000..13e7aab --- /dev/null +++ b/content/corpora/44.html @@ -0,0 +1,369 @@ + + + + +Ernie Sulik - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Ernie Sulik

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+ +
Ernie Sulik
1933-36 Zeenut Ernie Sulik.jpg
Outfielder
Born: (1910-07-07)July 7, 1910
San Francisco, California
Died: May 31, 1963(1963-05-31) (aged 52)
Oakland, California
Batted: Left
Threw: Left
MLB debut
April 15, 1936, for the Philadelphia Phillies
Last MLB appearance
September 27, 1936, for the Philadelphia Phillies
MLB statistics
Batting average.287
Home runs6
Runs batted in36
+
Teams
+ +
+

Ernest Richard Sulik (July 7, 1910 – May 31, 1963), was a Major League Baseball outfielder who played in 1936 with the Philadelphia Phillies. He batted and threw right-handed. +

He was born in San Francisco, California and died in Oakland, California. +

+

External links[edit]

+ +


+

+
Stub icon 1 Flag of United StatesBiography icon

This biographical article relating to an American baseball outfielder born in the 1910s is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Ernie_Sulik&oldid=1073807780"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/45.html b/content/corpora/45.html new file mode 100644 index 0000000..0b1a87a --- /dev/null +++ b/content/corpora/45.html @@ -0,0 +1,366 @@ + + + + +Francisco Funes - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Francisco Funes

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+
Francisco Funes
Personal information
Born (1950-03-28) 28 March 1950 (age 72)
San Juan Nonualco, El Salvador
+

Francisco Funes (born 25 March 1950) is a former Salvadoran cyclist. He competed in the individual road race and the team time trial events at the 1968 Summer Olympics.[1] +

+

References[edit]

+
+
    +
  1. ^ "Francisco Funes Olympic Results". sports-reference.com. Archived from the original on 21 March 2014. Retrieved 13 September 2014. +
    2. +
+

External links[edit]

+ +


+

+
Flag of El SalvadorBiography icon

This biographical article relating to Salvadoran cycling is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Francisco_Funes&oldid=1046559472"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/46.html b/content/corpora/46.html new file mode 100644 index 0000000..c95f0a1 --- /dev/null +++ b/content/corpora/46.html @@ -0,0 +1,558 @@ + + + + +Ciceribacter lividus - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Ciceribacter lividus

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Ciceribacter lividus +
Scientific classification +
Domain: +
Bacteria
+
Phylum: +
Pseudomonadota
+
Class: +
Alphaproteobacteria
+
Order: +
Hyphomicrobiales
+
Family: +
Rhizobiaceae
+
Genus: +
Ciceribacter
+
Species: +
C. lividus
+
Binomial name +
Ciceribacter lividus
Kathiravan et al. 2013[1]
+
Type strain +
DSM 25528, KCTC 32403, MSSRFBL1[2] +
+

Ciceribacter lividus is a nitrogen fixing, Gram-negative, aerobic and motile bacterium from the genus of Ciceribacter which has been isolated from rhizosphere soil from the plant Cicer arietinum in Kannivadi in India.[1][3][4] +

+

References[edit]

+
    +
  1. ^ a b Parte, A.C. "Ciceribacter". LPSN. +
    2. +
  2. ^ "DSM 25528 Strain Passport - StrainInfo". www.straininfo.net. +
    3. +
  3. ^ "Ciceribacter lividus". www.uniprot.org. +
    4. +
  4. ^ Kathiravan, R.; Jegan, S.; Ganga, V.; Prabavathy, V. R.; Tushar, L.; Sasikala, C.; Ramana, C. V. (1 August 2013). "Ciceribacter lividus gen. nov., sp. nov., isolated from rhizosphere soil of chick pea (Cicer arietinum L.)". International Journal of Systematic and Evolutionary Microbiology. 63 (Pt 12): 4484–4488. doi:10.1099/ijs.0.049726-0. PMID 23907221. +
    5. +
+

External links[edit]

+ +
+


+

+

This Hyphomicrobiales article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Ciceribacter_lividus&oldid=1075872936"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/47.html b/content/corpora/47.html new file mode 100644 index 0000000..7b81174 --- /dev/null +++ b/content/corpora/47.html @@ -0,0 +1,734 @@ + + + + +Dalton Hilliard - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Dalton Hilliard

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+ +
Dalton Hilliard
No. 21
Position:Running back
Personal information
Born: (1964-01-21) January 21, 1964 (age 58)
Patterson, Louisiana
Career information
High school:Patterson (LA)
College:LSU
NFL Draft:1986 / Round: 2 / Pick: 31
Career history +
+ +
+
Career highlights and awards +
+ +
+
Career NFL statistics
Rushing yards:4,164
Average:3.7
Total Touchdowns:53
Player stats at NFL.com · PFR
+
+

Dalton Andrea Hilliard (born January 21, 1964) is a former professional American football running back for the New Orleans Saints from 1986-1993. He played his entire National Football League (NFL) career for the Saints and was a Pro Bowl selection in 1989. He is a member of the New Orleans Saints Hall of Fame. +

+ + +

College career[edit]

+

Hilliard played college football at Louisiana State University from 1982 to 1985. He is one of three running backs to rush for over 4,000 yards in their career at LSU. He is 5th all-time in rushing touchdowns in SEC history with 44. +

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
College rushing statistics* [1] +
YearTeamGPRushingReceivingScrimmage +
AttYdsAvgTDRecYdsAvgTDPlaysYdsTD +
1982LSU111939014.7113136811.952241,26916 +
1983LSU111777474.26312488.002089956 +
1984LSU112541,2685.013242048.512781,47214 +
1985LSU112581,1344.414343139.202921,44714 +
CareerLSU118824,0504.6441201,1339.461,0025,18350 +

*Does not include bowl games. +

Professional career[edit]

+

Hilliard played eight seasons with the New Orleans Saints. His most productive season came in 1989 when he rushed for 1,262 yards and scored 18 touchdowns. He became the first player in NFL history to rush for 1200 yards, catch 50 passes, score 18 touchdowns and have fewer than 8 fumbles in a single season. [2] +

+

NFL career statistics[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
YearTeamGPAttYdsAvgLngTDRecYdsAvgLngTD +
1986NO +161214253.5365171076.3170 +
1987NO +121235084.13072326411.5381 +
1988NO +162048234.0365343359.9261 +
1989NO +1633412623.74013525149.9545 +
1990NO +6902843.2170141258.9201 +
1991NO +10792523.2654211276.0141 +
1992NO +161154453.9223484659.7414 +
1993NO +16501653.3162402967.4341 +
Career1081,1264,1643.765392492,2339.05414 +
+

Personal life[edit]

+

Hilliard is from Patterson, Louisiana and lived in Destrehan, Louisiana during his playing career. He is the father of Dalton Hilliard, Jr., who played football at Brother Martin High School and Nicholls State. +

Hilliard is the uncle of Ike Hilliard and Kenny Hilliard.[3] +

+

References[edit]

+
+
    +
  1. ^ "Dalton Hilliard 2". Archived from the original on 2015-12-22. Retrieved 2015-12-14. +
    2. +
  2. ^ "Dalton Hilliard NFL Football Statistics". Pro-Football-Reference.com. Sports Reference.com. Archived from the original on April 16, 2016. Retrieved April 16, 2016. +
    3. +
  3. ^ Seeing is believing with Hilliard +
    4. +
+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Dalton_Hilliard&oldid=1079786433"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/48.html b/content/corpora/48.html new file mode 100644 index 0000000..bbfdddd --- /dev/null +++ b/content/corpora/48.html @@ -0,0 +1,360 @@ + + + + +Fata Tamati - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Fata Tamati

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Fata Tamati
Member of the Legislative Assembly
In office
1948–1951
Succeeded byMataia Europa/Anapu Solofa
ConstituencyTuamasaga
+
+

Fata Tamati was a Western Samoan chief and politician. He served as a member of the Legislative Assembly from 1948 to 1951. +

+

Biography[edit]

+

When the Legislative Assembly was established in 1948, Tamati was chosen to represent Tuamasaga by the three Fautua (high chiefs).[1] He was not re-elected in 1951. +

+

References[edit]

+
+
    +
  1. ^ W. Samoa's New Assembly Now Taking Shape: Samoan Members Chosen Pacific Islands Monthly, May 1948, p49 +
    2. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Fata_Tamati&oldid=1087074469"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/49.html b/content/corpora/49.html new file mode 100644 index 0000000..5b61a8f --- /dev/null +++ b/content/corpora/49.html @@ -0,0 +1,407 @@ + + + + +Costa Rican seasonal moist forests - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Costa Rican seasonal moist forests

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Costa Rican seasonal moist forests
Poas Volcano 007.jpg
Poas Volcano area, Costa Rica
Ecoregion territory (in purple)
Ecoregion territory (in purple)
Ecology
RealmNeotropic
BiomeTropical and subtropical moist broadleaf forests
Geography
Area10,791 km2 (4,166 sq mi)
CountryCosta Rica, Nicaragua
Coordinates9°45′N 84°15′W / 9.75°N 84.25°W / 9.75; -84.25Coordinates: 9°45′N 84°15′W / 9.75°N 84.25°W / 9.75; -84.25
+

The Costa Rican seasonal moist forests ecoregion (WWF ID: NT0119) covers the Pacific Slope of the volcanic mountain range of northwestern Costa Rica and the extreme south of Nicaragua. The area has a distinct dry season during which the characteristic deciduous trees drop their leaves. The forests themselves have been highly degraded in the past by human conversion to agriculture and settlement. The Costa Rican capital city of San Jose is in the middle of this ecoregion.[1][2][3][4] +

+ + +

Location and description[edit]

+

The northern mountain range in Costa Rica, the Cordillera de Guanacaste, stretches for 110 km from the border with Nicaragua southeast to Costa Rica's Cordillera Central (Costa Rica). As the range occurs where the Cocos Plate is subducting beneath the Caribbean Plate there are many stratovolcancos in the Cordillera de Guancaste. The mean elevation in the ecoregion is 580 metres (1,900 ft); the highest point is 580 metres (1,900 ft).[3] The ecoregion to the east at higher elevations is the Talamancan montane forests ecoregion. At lower elevations to the west the bordering ecoregion is the Central American dry forests region. +

+

Climate[edit]

+

The climate of the ecoregion is Tropical monsoon climate (Köppen climate classification (Am)). This climate is characterized by relatively even temperatures throughout the year (all months being greater than 18 °C (64 °F) average temperature), and a pronounced dry season. The driest month has less than 60 mm of precipitation, but more than (100-(average/25) mm. This climate is mid-way between a tropical rainforest and a tropical savannah.[5][6] Precipitation averages 1,500 mm/year, falling mostly in the 'wet season' of April to October.[1] +

+

Flora and fauna[edit]

+

About one-third of the ecoregion is closed broadleaf evergreen forest, one third is open forest of various types, and one-third of the territory has been converted to agriculture.[3] Because the ecoregion is in the rain shadow of the mountains, there is a distinct dry season (December through March). The plants of the region have accordingly developed adaptations for coping with the dry season, such the deciduous trees dropping their leaves in winter. +

Animal life in the ecoregion is linked to the wetter regions to the east and higher elevations. Taking advantage of the seasonal dryness, many invertebrates and birds migrate into the drier forests for breeding and for taking advantage of the differing food availability cycle.[1] +

IN the past 100 years, humans have cleared most of the area for agriculture, only perhaps 10% of the forest remains in its original state. Lower elevations have been cleared for cattle raising, higher elevations for coffee, corn, beans, and dairy cattle.[1] +

+

Protected areas[edit]

+

11% of the ecoregion is officially protected.[3] These protected areas include: +

+ +

References[edit]

+
+
    +
  1. ^ a b c d "Costa Rican seasonal moist forests". World Wildlife Federation. Retrieved March 21, 2020. +
    2. +
  2. ^ "Map of Ecoregions 2017". Resolve, using WWF data. Retrieved September 14, 2019. +
    3. +
  3. ^ a b c d "Costa Rican seasonal moist forests". Digital Observatory for Protected Areas. Retrieved August 1, 2020. +
    4. +
  4. ^ "Costa Rican seasonal moist forests". The Encyclopedia of Earth. Retrieved August 28, 2020. +
    5. +
  5. ^ Kottek, M., J. Grieser, C. Beck, B. Rudolf, and F. Rubel, 2006. "World Map of Koppen-Geiger Climate Classification Updated" (PDF). Gebrüder Borntraeger 2006. Retrieved September 14, 2019.{{cite web}}: CS1 maint: multiple names: authors list (link) +
    6. +
  6. ^ "Dataset - Koppen climate classifications". World Bank. Retrieved September 14, 2019. +
    7. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Costa_Rican_seasonal_moist_forests&oldid=1082137599"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/5.html b/content/corpora/5.html new file mode 100644 index 0000000..3fe7f5b --- /dev/null +++ b/content/corpora/5.html @@ -0,0 +1,569 @@ + + + + +Eunidia nigroapicaloides - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Eunidia nigroapicaloides

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Eunidia nigroapicaloides +
Scientific classification +
Kingdom: +
Animalia
+
Phylum: +
Arthropoda
+
Class: +
Insecta
+
Order: +
Coleoptera
+
Suborder: +
Polyphaga
+
Family: +
Cerambycidae
+
Genus: +
Eunidia
+
Species: +
E. nigroapicaloides
+
Binomial name +
Eunidia nigroapicaloides
Breuning, 1976
+
+

Eunidia nigroapicaloides is a species of beetle in the family Cerambycidae. It was described by Stephan von Breuning in 1976.[1] +

+

References[edit]

+
+
    +
  1. ^ BioLib.cz - Eunidia nigroapicaloides. Retrieved on 8 September 2014. +
    2. +
+
+


+

+

This Eunidiini article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Eunidia_nigroapicaloides&oldid=932998102"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/50.html b/content/corpora/50.html new file mode 100644 index 0000000..ebdc738 --- /dev/null +++ b/content/corpora/50.html @@ -0,0 +1,419 @@ + + + + +Welsh, Ohio - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Welsh, Ohio

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

Welsh is an unincorporated community in Meigs County, in the U.S. state of Ohio.[1] +

Welsh is located along State Route 143, near the Welsh Farm, and is named after the Welsh family that settled in the area. Rev. TA Welsh moved to Meigs County in the mid-1840s. He came to serve as pastor of the Alexander Presbyterian Church, and later was an integral part of establishing the Harrisonville Presbyterian Church, where some of his descendants still attend. During his life, TA served in the Ohio State House of Representatives and Ohio State Senate. His home also served as a stop on the Underground Railroad. +

References: +1. Welsh Family history. TA Welsh is my gg-grandfather. +2. History of Harrisonville Church. +3. History of Alexander Presbyterian Church. +

+

History[edit]

+

A post office called Welsh was established in 1898, and remained in operation until 1907.[2] A share of the early settlers of Meigs County were of Welsh extraction.[3] +

+

References[edit]

+
+
    +
  1. ^ U.S. Geological Survey Geographic Names Information System: Welsh, Ohio +
    2. +
  2. ^ "Meigs County". Jim Forte Postal History. Retrieved 12 December 2015. +
    3. +
  3. ^ Pickens, Jordan D.; Tribe, Ivan M. (10 March 2014). Meigs County. Arcadia Publishing. p. 7. ISBN 978-1-4671-1134-8. +
    4. +
+
+

Coordinates: 39°09′02″N 82°10′23″W / 39.15056°N 82.17306°W / 39.15056; -82.17306 +


+

+
Stub icon

This Meigs County, Ohio state location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Welsh,_Ohio&oldid=942343147"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/51.html b/content/corpora/51.html new file mode 100644 index 0000000..e2e52ef --- /dev/null +++ b/content/corpora/51.html @@ -0,0 +1,443 @@ + + + + +Bronson Winthrop - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Bronson Winthrop

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Bronson Winthrop
Born
Frederic Bronson Winthrop

(1863-12-22)December 22, 1863
Paris, France
DiedJuly 14, 1944(1944-07-14) (aged 80)
Syosset, New York, U.S.
Alma materTrinity College, Cambridge
Columbia Law School
EmployerWinthrop & Stimson
Parent(s)Egerton Leigh Winthrop
Charlotte Troup Bronson
+

Frederic Bronson Winthrop (December 22, 1863 – July 14, 1944)[1] was an American philanthropist and lawyer with Winthrop & Stimson who was prominent in New York society during the Gilded Age. +

+ + +

Early life[edit]

+

Winthrop was born on December 22, 1863 in Paris, France where his family was living during the U.S. Civil War. His parents were Egerton Leigh Winthrop[2] and Charlotte Troup (née Bronson) Winthrop.[3][4] He had two older siblings,[5][6] Egerton Leigh Winthrop, Jr., a lawyer and banker in New York,[7][8] and Charlotte Bronson Winthrop.[9] His father, also a prominent lawyer, was a former president of the Knickerbocker Club.[2] +

His paternal grandparents were Benjamin Robert Winthrop and Elizabeth Ann Neilson (née Coles) Winthrop.[10] Through his father, he was a descendant of Wait Winthrop and Joseph Dudley (both Massachusetts Bay Colony leaders), and through his great-grandmother, Judith (née Stuyvesant) Winthrop, he was a direct descendant of Peter Stuyvesant, the Director-General of New Netherland,[11] and Robert Livingston the Elder, the 1st Lord of Livingston Manor.[12][11][13] His maternal grandfather was Frederic Bronson and his uncle was Frederic Bronson Jr.[14] His great-grandfather, Isaac Bronson, was a founder of the New York Life and Trust Company. +

Winthrop graduated with an A.B. degree and an A.M. degree from Trinity College, Cambridge in England in 1889. In 1891, he graduated with an LL.B. degree from Columbia University.[1] +

+

Career[edit]

+

Following his graduation from Columbia Law, he passed the bar and began the practice of law in New York. From 1893 until 1897, he was with the firm of Root, Howard, Winthrop & Stimson, of which Elihu Root (later a U.S. Senator, Secretary of War and Secretary of State under Theodore Roosevelt) was a partner.[1] In 1901, he formed Winthrop & Stimson with Henry L. Stimson, who later served as Secretary of State and Secretary of War.[15] Winthrop also served as treasurer of the New York City Bar Association.[16] +

Winthrop was a director of the Bank of the Manhattan Company, a trustee of the American Surety Company and a vice president (honorary) of the Community Service Society.[1] In 1934, he was elected vice president of the Charity Organization Society and served in that role until 1939 when the organization joined with the New York Association for Improving the Condition of the Poor into the Community Service Society.[1] +

+

Society life[edit]

+

In 1892, Winthrop, along with his father and several members of his mother's family, was included in Ward McAllister's "Four Hundred", purported to be an index of New York's best families, published in The New York Times.[17][18] Conveniently, 400 was the number of people that could fit into Mrs. Astor's ballroom.[19] +

He was a member of the Knickerbocker Club, the Union Club of the City of New York, the Century Club, the Downtown Club, the University Club of New York, the Grolier Club, the Republican Club, the Meadow Brook Golf Club, and the Piping Rock Club.[1] +

+

Personal life[edit]

+

After his father's death, he inherited a one third portion of his estate, along with his brother and deceased sister's only child.[20] He received his father's New York home and Newport cottage with his brother as tenants in common.[20] +

Winthrop, who did not marry, died at his home on Long Island on July 14, 1944.[1] He had a townhouse in New York City at 39 East 72nd Street. Winthrop's first summer home in Muttontown, New York (within the Town of Oyster Bay), now known as Nassau Hall, was designed by Delano & Aldrich around 1904.[21] He had the firm build him another home next door, a 12,000 square foot mansion, in 1911.[22] The 168 acre estate was purchased by Landsdell Christie, who sold the property to Nassau County in 1968.[23] The 1904 home is today called Nassau Hall and houses the Nassau County Museum's administrative offices.[23] +

+

References[edit]

+
+
    +
  1. ^ a b c d e f g "B. WINTHROP DEAD; STIMSON PARTNER; Senior Member of Law Firm Here Was 80; A Leader in Social, Charity Circles" (PDF). The New York Times. July 15, 1944. Retrieved 29 June 2018. +
    2. +
  2. ^ a b "EGERTON L. WINTHROP DEAD | Veteran Lawyer and Banker Was Ex-President of Knickerbocker Club" (PDF). The New York Times. April 7, 1916. Retrieved 29 June 2018. +
    3. +
  3. ^ "DIED. WINTHROP" (PDF). The New York Times. February 17, 1872. Retrieved 29 June 2018. +
    4. +
  4. ^ Lewis, Arnold; Turner, James; McQuillin, Steven (2016). The Opulent Interiors of the Gilded Age: All 203 Photographs from "Artistic Houses," with New Text. Courier Corporation. p. 70. ISBN 9780486319476. Retrieved 29 June 2018. +
    5. +
  5. ^ The National Cyclopaedia of American Biography: Being the History of the United States as Illustrated in the Lives of the Founders, Builders, and Defenders of the Republic, and of the Men and Women who are Doing the Work and Moulding the Thought of the Present Time. University Microfilms. 1967. p. 303. Retrieved 29 June 2018. +
    6. +
  6. ^ Greene, Richard Henry; Stiles, Henry Reed; Dwight, Melatiah Everett; Morrison, George Austin; Mott, Hopper Striker; Totten, John Reynolds; Pitman, Harold Minot; Ditmas, Charles Andrew; Forest, Louis Effingham De; Mann, Conklin; Maynard, Arthur S. (1954). The New York Genealogical and Biographical Record. New York Genealogical and Biographical Society. Retrieved 29 June 2018. +
    7. +
  7. ^ "EGERTON WINTHROP, IS DEAD; Formerly Was President of the Board of Education of This City. ACTIVE IN PHILANTHROPY Served for Years as Head of the Legal Aid Society -- Was Born In France" (PDF). The New York Times. January 13, 1926. Retrieved 29 June 2018. +
    8. +
  8. ^ Pennoyer, Peter; Walker, Anne (2003). The Architecture of Delano & Aldrich. W. W. Norton & Company. p. 31. ISBN 9780393730876. Retrieved 29 June 2018. +
    9. +
  9. ^ "Charlotte Winthrop (1863-1893)". www.nyhistory.org. New-York Historical Society. Retrieved 16 October 2017. +
    10. +
  10. ^ "FUNERAL OF BENJAMIN R. WINTHROP" (PDF). The New York Times. August 21, 1879. Retrieved 29 June 2018. +
    11. +
  11. ^ a b The Saint Nicholas Society of the City of New York: History, Customs, Record of Events, Constitution, Certain Genealogies, and Other Matters of Interest. V. 1-. Saint Nicholas Society of the City of New York. 1905. p. 32. Retrieved 30 March 2018. +
    12. +
  12. ^ Reynolds, Cuyler (1914). Genealogical and Family History of Southern New York and the Hudson River Valley: A Record of the Achievements of Her People in the Making of a Commonwealth and the Building of a Nation. Lewis Historical Publishing Company. pp. 1011-1015. Retrieved 30 March 2018. +
    13. +
  13. ^ "The Death of Hon. George Folsom" (PDF). The New York Times. April 11, 1869. Retrieved 29 June 2018. +
    14. +
  14. ^ MacRury, Elizabeth Banks (1968). More About The Hill: Greenfield Hill. Printed by City Print. Co. pp. 101, 163. Retrieved 29 June 2018. +
    15. +
  15. ^ Conant, Jennet (2013). Tuxedo Park: A Wall Street Tycoon and the Secret Palace of Science That Changed the Course of World War II. Simon and Schuster. p. 28. ISBN 9781476767291. Retrieved 2 July 2018. +
    16. +
  16. ^ Dietrich, Kris (2015). Taboo Genocide: Holodomor 1933 & the Extermination of Ukraine. p. 952. ISBN 9781499056082. Retrieved 2 July 2018. +
    17. +
  17. ^ McAllister, Ward (16 February 1892). "THE ONLY FOUR HUNDRED | WARD M'ALLISTER GIVES OUT THE OFFICIAL LIST. HERE ARE THE NAMES, DON'T YOU KNOW, ON THE AUTHORITY OF THEIR GREAT LEADER, YOU UNDER- STAND, AND THEREFORE GENUINE, YOU SEE" (PDF). The New York Times. Retrieved 26 March 2017. +
    18. +
  18. ^ Patterson, Jerry E. (2000). The First Four Hundred: Mrs. Astor's New York in the Gilded Age. Random House Incorporated. p. 234. ISBN 9780847822089. Retrieved 13 June 2018. +
    19. +
  19. ^ Keister, Lisa A. (2005). Getting Rich: America's New Rich and How They Got That Way. Cambridge University Press. p. 36. ISBN 9780521536677. Retrieved 20 October 2017. +
    20. +
  20. ^ a b "WILL OF EGERTON L. WINTHROP | Relics of Dutch Days and Stuyvesant Heirlooms Left to Sons" (PDF). The New York Times. April 18, 1916. Retrieved 29 June 2018. +
    21. +
  21. ^ "The Bronson Winthrop Estate". www.oldlongisland.com. April 13, 2010. Retrieved 2 July 2018. +
    22. +
  22. ^ Chamoff, Lisa (May 24, 2015). "Restored 1911 home on sale for $3.499M". Newsday. Retrieved 2 July 2018. +
    23. +
  23. ^ a b Kellerman, Vivien (April 5, 1998). "If You're Thinking of Living In/Muttontown, L.I.; Horse Country Just Below the Gold Coast". Retrieved 2 July 2018. +
    24. +
+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Bronson_Winthrop&oldid=1064356509"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/52.html b/content/corpora/52.html new file mode 100644 index 0000000..d77f3bd --- /dev/null +++ b/content/corpora/52.html @@ -0,0 +1,586 @@ + + + + +Tina's Groove - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Tina's Groove

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Tina's Groove
Tinasgroove12912.jpg
Rina Piccolo's Tina's Groove (January 29, 2012).
Author(s)Rina Piccolo
Launch date2002 (2002)
End dateJuly 2, 2017 (July 2, 2017)
Syndicate(s)King Features Syndicate
Publisher(s)Andrews & McMeel
Genre(s)Humor
+

Tina's Groove was a comic strip by Rina Piccolo with a restaurant setting. Distributed by King Features Syndicate, it began in 2002.[1][2] The comic strip ended its run on July 2, 2017.[3] +

+ + +

Characters and story[edit]

+

"Tina’s Groove chronicled the personal and workplace adventures of a single, smart, attractive waitress who worked at Pepper’s restaurant. Shrewdly self-aware, Tina refuted clichéd notions of single women as neurotics obsessed with career or marriage. Tina found her groove and empowered herself by embracing life and everyone she met head-on."[4] +

+
  • Tina works as a waitress at Pepper's Restaurant and is "happy being Tina", living life rather than waiting for it to begin. She is described as "smart, funny and real", an everywoman in her 30s who "struggles to deal with her job, dating and the ups and downs of day-to-day living".[1]
    • +
  • Gus, Tina's boyfriend, whom she met at a speed dating event in 2012.[5]
    • +
  • Suzanne, Tina's best friend and fellow waitress is "always looking for a good time" and enjoys casual relationships with a large number of men.[1]
    • +
  • Monica, the hostess at Pepper's,[6] is spacey and oblivious.[1] Maybe she sees things others don't, or maybe she's just crazy.[7] She is hopelessly in love with Rob, although the feeling is not mutual.[8]
    • +
  • Carlos the chef is known for his ego[1] and his outdated views on gender and romance.[9]
    • +
  • Rob the general manager is shy and reserved, but a bit of a control freak.[1]
    • +
  • Other recurring characters include Claud the taxi driver, Tina's mother, Jake the bartender, and various unnamed customers.[1]
+

Piccolo offered her description of the characters on July 4, 2012: +

+
Tina’s imperfections, if she has any, are of the kind that are quirky, and therefore endearing. This is good for a cartoon character. I believe the main character of a comic strip should be one that’s likable. But does that mean the main character should be flawless? It’s the weaknesses, or fixations, that make characters interesting. The other characters of the strip all have fixations that make them imperfect. Rob, the manager of Pepper’s Restaurant, is a misfit neat/control freak who hasn’t yet realized that it’s now cool to be a geek. Carlos is a sack of testosterone who must prove himself to be the manliest at any cost. Suzanne is a spoiled 30 something flake who has so many weaknesses she’s created a personality out of being less than perfect. And then there’s Monica. If you read the strip then I don’t have to waste my words on Monica. Tina stands apart. One good reason for this is that Tina is what’s known in the comedy world as the “Straight Man”. She’s the only sane character in a world of insanity. In the strip she represents logic, the voice of reason, while every one else is crazy. This is where most of the humor comes from.[10]
+

Readers have wondered if Tina is depressed or deeply worried about something, but Piccolo explains that this impression is mistaken and may be an inadvertent effect of Tina's hairstyle, specifically the hair bangs being drawn "at the same angle that you’d use to draw a 'worried eyebrow' expression". +

+
"Tina’s not depressed — no more than any other person. When I started the strip I didn’t know a lot about her, but I did know what I didn’t want her to be. I didn’t want my main character to be sappy and sickeningly sweet. I wanted to write her as a girl who had real-world traits who just happened to be nice in a normal, non-mushy way... The thing is, I don’t want Tina to be smiling in every situation — that would be sappy."[11]
+

The strip ran in such newspapers as the Cincinnati Enquirer, the Arizona Republic and the Toronto Star, and it is also available through King Features' DailyINK email service.[12] +

+

Books[edit]

+
Comparisons with this Tina's Groove from 2006 show how the art style and characters evolved.
+

In 2006, Andrews & McMeel published Tina’s Groove: A Cartoon Collection (ISBN 978-0740756979), collecting selected strips from its first few years.[1] +

+

References[edit]

+
+
    +
  1. ^ a b c d e f g h "About Tina's Groove". DailyINK. Retrieved 2013-10-08. +
    2. +
  2. ^ Dean Mullaney, Bruce Canwell and Brian Walker, King of the Comics : One Hundred Years of King Features Syndicate. San Diego : IDW Publishing, 2015. ISBN 9781631403736 (pp.276,303) +
    3. +
  3. ^ Piccolo, Rina (2017-06-24). "Farewell, Tina". Retrieved 2017-07-03. +
    4. +
  4. ^ Tina's Groove: About +
    5. +
  5. ^ "Tina's Groove". DailyINK. 2012-11-06. Retrieved 2013-10-08. +
    6. +
  6. ^ "Tina's Groove - About the Characters". TinasGroove.com. Retrieved March 21, 2014. +
    7. +
  7. ^ "Tina's Groove". DailyINK. 2013-09-30. Retrieved 2013-10-08. +
    8. +
  8. ^ "Tina's Groove". DailyINK. 2013-09-03. Retrieved 2013-10-08. +
    9. +
  9. ^ "Tina's Groove". DailyINK. 2013-09-18. Retrieved 2013-10-08. +
    10. +
  10. ^ Piccolo, Rina (2012-07-04). "Is Tina Too Perfect?". Retrieved 2013-10-08. +
    11. +
  11. ^ Piccolo, Rina (2012-07-20). "Readers Ask Why Tina Never Smiles". Retrieved 2013-10-08. +
    12. +
  12. ^ Tina's Groove +
    13. +
+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Tina%27s_Groove&oldid=1003987747"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/53.html b/content/corpora/53.html new file mode 100644 index 0000000..48bf715 --- /dev/null +++ b/content/corpora/53.html @@ -0,0 +1,470 @@ + + + + +Reino, Campania - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Reino, Campania

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Reino
Comune
Comune di Reino
Location of Reino
+
Reino is located in Italy
Reino
Reino
Location of Reino in Italy
Reino is located in Campania
Reino
Reino
Reino (Campania)
Coordinates: 41°17′N 14°49′E / 41.283°N 14.817°E / 41.283; 14.817Coordinates: 41°17′N 14°49′E / 41.283°N 14.817°E / 41.283; 14.817
CountryItaly
RegionCampania
ProvinceBenevento (BN)
Government
 • MayorAntonio Calzone 
Area
[1]
 • Total23.64 km2 (9.13 sq mi)
Elevation
450 m (1,480 ft)
Population
 (1 January 2015)[2]
 • Total1,219
 • Density52/km2 (130/sq mi)
Demonym(s)Reinesi
Time zoneUTC+1 (CET)
 • Summer (DST)UTC+2 (CEST)
Postal code
82020
Dialing code0824
WebsiteOfficial website
+

Reino is a comune (municipality) in the Province of Benevento in the Italian region Campania, located about 70 km northeast of Naples and about 15 km north of Benevento. As of 31 December 2004, it had a population of 1,344 and an area of 23.6 km2.[3] +

Reino borders the following municipalities: Circello, Colle Sannita, Fragneto l'Abate, Pesco Sannita, San Marco dei Cavoti. +

+

References[edit]

+
+
    +
  1. ^ "Superficie di Comuni Province e Regioni italiane al 9 ottobre 2011". Italian National Institute of Statistics. Retrieved 16 March 2019. +
    2. +
  2. ^ "Popolazione Residente al 1° Gennaio 2018". Italian National Institute of Statistics. Retrieved 16 March 2019. +
    3. +
  3. ^ All demographics and other statistics: Italian statistical institute Istat. +
    4. +
+
+
+
+


+

+
Stub icon

This Campanian location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Reino,_Campania&oldid=986644692"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/54.html b/content/corpora/54.html new file mode 100644 index 0000000..9d4db3e --- /dev/null +++ b/content/corpora/54.html @@ -0,0 +1,446 @@ + + + + +Jenny Perret - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Jenny Perret

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Jenny Perret
Curler
Jenny Perret 2018 ACC-1.jpg
Born (1991-12-23) 23 December 1991 (age 30)
Schaumburg, Illinois
Team
Curling clubCC Bern & CC Glarus[1]
Mixed doubles
partner		Martin Rios
Career
Member Association  Switzerland
World Mixed Doubles Championship
appearances		2 (2017, 2021)
European Championship
appearances		1 (2017)
Olympic
appearances		2 (2018, 2022)
+
Medal record
+
+ + + + + + + + + + + + + + + + + + + + + + + + +
+
Women's Curling +
Representing   Switzerland +
Winter Olympics +
Silver medal – second place2018 PyeongchangMixed doubles +
World Mixed Doubles Championship +
Gold medal – first place2017 Lethbridge +
European Mixed Championship +
Bronze medal – third place2014 Tårnby +
+
+

Jenny Sarah Perret (born 23 December 1991) is a Swiss curler from Lyss.[2] She and partner Martin Rios won the 2017 World Mixed Doubles Curling Championship.[3] The pair also represented Switzerland at the 2018 Winter Olympics where they won a silver medal. +

In addition to her success in the mixed doubles discipline, Perret also won a bronze medal at the 2014 European Mixed Curling Championship and was the Swiss women's team alternate at the 2018 Winter Olympics. +

+

References[edit]

+
+
    +
  1. ^ "Curling - Athlete Profile: Jenny PERRET - Pyeongchang 2018 Olympic Winter Games". www.olympic.org. +
    2. +
  2. ^ https://olympics.com/beijing-2022/olympic-games/en/results/curling/athlete-profile-n1049792-jenny-perret.htm[bare URL] +
    3. +
  3. ^ Swiss Olympic - Curling macht den Auftakt bei den Olympiaselektionen(in German) +
    4. +
+

External links[edit]

+ +
+
Stub icon

This biographical article relating to curling in Switzerland is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Jenny_Perret&oldid=1090017585"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/55.html b/content/corpora/55.html new file mode 100644 index 0000000..dd563d3 --- /dev/null +++ b/content/corpora/55.html @@ -0,0 +1,1234 @@ + + + + +Christian Bäckman - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Christian Bäckman

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+ +
Christian Bäckman
+BackmanHockey.jpg
Born + (1980-04-28) 28 April 1980 (age 42)
Alingsås, Sweden
Height +6 ft 4 in (193 cm)
Weight +210 lb (95 kg; 15 st 0 lb)
Position +Defence
Shot +Left
Played for +Frölunda HC
St. Louis Blues
New York Rangers
Columbus Blue Jackets
National team + Sweden
NHL Draft +24th overall, 1998
St. Louis Blues
Playing career +1998–2015
+

Christian Rune Bäckman (born 28 April 1980) is a Swedish former professional ice hockey defenceman. He played over 300 games in the National Hockey League (NHL) with the St. Louis Blues, New York Rangers and Columbus Blue Jackets, and spent the latter part of his career with Frölunda HC of the Swedish Hockey League.[1] +

+ + +

Playing career[edit]

+

Bäckman was drafted by St. Louis Blues in the 1998 NHL Entry Draft, 1st round, 24th overall. It was not until the 2002–03 NHL season that he got a contract for play in the NHL. He only played four games for St. Louis in his first season, spending the rest of the season playing for Worcester Ice Cats in the American Hockey League (AHL). Between 2003–04 and 2007–08 he was a regular for St. Louis recording 64 points (19 goals, 45 assists), and 130 penalty minutes in 228 games.[2] +

During the 2004–05 NHL lockout Bäckman played for his Swedish youth club Frölunda in Elitserien where he totalled 19 points in 50 games, winning the Elitserien playoffs.[2] +

St. Louis announced on 10 August 2006 that the club re-signed Bäckman for a multi-year contract, although no contract details was released.[3] According to Swedish newspaper Aftonbladet the contract gives Bäckman 50 million Swedish kronor (approx. $7 million) over three years.[4] +

On 26 February 2008, Bäckman was traded to the New York Rangers in exchange for a 4th round draft pick. On 2 March 2008, in his second game as a Ranger, Bäckman scored his first goal as a Ranger on Antero Niittymäki of the Philadelphia Flyers, off assists from Brendan Shanahan and Scott Gomez.[5] +

On 2 July 2008, Bäckman was traded, along with Fedor Tyutin, to the Columbus Blue Jackets for Nikolai Zherdev and Dan Fritsche. In October 2009, Bäckman signalled the conclusion of his North American career by signing with Frölunda HC. +

+

Personal life[edit]

+

Bäckman was born 1980 in a small town Alingsås. He has two siblings. He grew up in mostly Alingsås but moved to Gothenburg to start his Ice Hockey career. +

Bäckman is married to wife Jeanette Bäckman. Together they have 3 children. William Bäckman born in 2001, Thea Bäckman born in 2004 and Ellie Bäckman born in 2010. He spends his off-season in Gothenburg, Sweden. +

+

Career statistics[edit]

+

Regular season and playoffs[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +Regular season + +Playoffs +
Season +Team +League +GP +G +A +Pts +PIM +GP +G +A +Pts +PIM +
1996–97 +Västra Frölunda HC +J20 +2625716 +————— +
1997–98 +Västra Frölunda HC +J20 +285141912 +————— +
1998–99 +Västra Frölunda HC +J20 +904412 +————— +
1998–99 +Västra Frölunda HC +SEL +490444 +40000 +
1999–2000 +Västra Frölunda HC +J20 +31120 +31120 +
1999–2000 +Västra Frölunda HC +SEL +2710114 +50000 +
1999–2000 +Gislaveds SK +SWE II +215278 +————— +
2000–01 +Västra Frölunda HC +SEL +501101132 +30222 +
2001–02 +Västra Frölunda HC +SEL +44741138 +100008 +
2002–03 +Worcester IceCats +AHL +728192766 +30115 +
2002–03 +St. Louis Blues +NHL +40000 +————— +
2003–04 +Worcester IceCats +AHL +41232 +————— +
2003–04 +St. Louis Blues +NHL +665131816 +50224 +
2004–05 +Frölunda HC +SEL +504151940 +1427910 +
2005–06 +St. Louis Blues +NHL +526121848 +————— +
2006–07 +St. Louis Blues +NHL +617111836 +————— +
2007–08 +St. Louis Blues +NHL +45191030 +————— +
2007–08 +New York Rangers +NHL +1826820 +800012 +
2008–09 +Columbus Blue Jackets +NHL +5625732 +————— +
2009–10 +Frölunda HC +SEL +4710182846 +71236 +
2010–11 +Frölunda HC +SEL +21413178 +————— +
2011–12 +Frölunda HC +SEL +5511162748 +60222 +
2012–13 +Frölunda HC +SEL +577152236 +61340 +
2013–14 +Frölunda HC +SHL +5025736 +71122 +
2014–15 +Frölunda HC +SHL +3343716 +130228 +
SEL/SHL totals +48051103154318 +755192438 +
NHL totals +302235679182 +1302216 +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Medal record +
Representing  Sweden +
Ice hockey +
Olympic Games +
Gold medal – first place2006 Turin +
World Championships +
Silver medal – second place2004 Czech Republic +
Bronze medal – third place2010 Germany +
European Junior Championship +
Gold medal – first place1998 Sweden +
Silver medal – second place1997 Czech Republic +
+

International[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Year +Team +Event +Result + +GP +G +A +Pts +PIM +
1997 +Sweden +EJC18 +2nd place, silver medalist(s) +40002 +
1998 +Sweden +EJC18 +1st place, gold medalist(s) +62682 +
1999 +Sweden +WJC +4th +60330 +
2000 +Sweden +WJC +5th +71126 +
2004 +Sweden +WC +2nd place, silver medalist(s) +91236 +
2005 +Sweden +WC +4th +91126 +
2006 +Sweden +OG +1st place, gold medalist(s) +81236 +
2010 +Sweden +WC +3rd place, bronze medalist(s) +903310 +
Junior totals +233101310 +
Senior totals +35381128 +
+

Awards and honors[edit]

+ + + + + + + + + + + + + + +
Award +Year + +
SHL +
All-Star Team +2005 + +
Le Mat trophy (Frölunda HC) +2005 + +
+

References[edit]

+
+
    +
  1. ^ "Bäckman retires from professional career". aftonbladet.se (in Swedish). 2015-06-07. Retrieved 2015-06-07. +
    2. +
  2. ^ a b "Christian Bäckman player profile". Elite Prospects. Retrieved 11 August 2006. +
    3. +
  3. ^ "Blues Sign Christian Backman To Multi-Year Contract". St. Louis Blues Hockey Club L.L.C. Archived from the original on 13 August 2006. Retrieved 11 August 2006. +
    4. +
  4. ^ "Bäckmans lönehöjning: 10 miljoner per år" (in Swedish). Aftonbladet.se. Archived from the original on 13 August 2006. Retrieved 11 August 2006. +
    5. +
  5. ^ "Rangers 5, Flyers 4, SO". 2008-03-02. Retrieved 2008-03-04.[dead link] +
    6. +
+

External links[edit]

+ + + + + + + + + + +
Awards and achievements +
Preceded by + St. Louis Blues first round draft pick
1998 +		Succeeded by +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Christian_Bäckman&oldid=1087197511"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/56.html b/content/corpora/56.html new file mode 100644 index 0000000..4d32f8d --- /dev/null +++ b/content/corpora/56.html @@ -0,0 +1,484 @@ + + + + +2002 African Championships in Athletics – Men's 3000 metres steeplechase - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

2002 African Championships in Athletics – Men's 3000 metres steeplechase

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+

+
2002 African Championships
in Athletics
Athletics pictogram.svg
Track events
100 mmenwomen
200 mmenwomen
400 mmenwomen
800 mmenwomen
1500 mmenwomen
5000 mmenwomen
10,000 mmenwomen
100 m hurdleswomen
110 m hurdlesmen
400 m hurdlesmenwomen
3000 m
steeplechase		men
4×100 m relaymenwomen
4×400 m relaymenwomen
Road events
10 km walkwomen
20 km walkmen
Field events
High jumpmenwomen
Pole vaultmenwomen
Long jumpmenwomen
Triple jumpmenwomen
Shot putmenwomen
Discus throwmenwomen
Hammer throwmenwomen
Javelin throwmenwomen
Combined events
Heptathlonwomen
Decathlonmen
+

The men's 3000 metres steeplechase event at the 2002 African Championships in Athletics was held in Radès, Tunisia on August 8.[1] +

+

Results[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
RankNameNationalityTimeNotes +
1st place, gold medalist(s)Brahim Boulami Morocco8:19.51 +
2nd place, silver medalist(s)Wilson Boit Kipketer Kenya8:20.92 +
3rd place, bronze medalist(s)Stephen Cherono Kenya8:23.85 +
4Ezekiel Kemboi Kenya8:27.14 +
5Lotfi Turki Tunisia8:28.07 +
6Elarbi Khattabi Morocco8:32.39 +
7Abdelhakim Maazouz Algeria8:33.49 +
8Luleseged Wale Ethiopia8:40.33 +
9Gulte Bekele Ethiopia8:47.96 +
Zouhair Ouerdi MoroccoDNF +
+

References[edit]

+
+
    +
  1. ^ Results +
    2. +
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=2002_African_Championships_in_Athletics_–_Men%27s_3000_metres_steeplechase&oldid=1079103018"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/57.html b/content/corpora/57.html new file mode 100644 index 0000000..3fe65bd --- /dev/null +++ b/content/corpora/57.html @@ -0,0 +1,369 @@ + + + + +Vijaykumar Vyshak - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Vijaykumar Vyshak

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+
Vijaykumar Vyshak
Personal information
Born (1997-01-31) 31 January 1997 (age 25)
Bangalore, Karnataka, India
Source: Cricinfo, 24 February 2021
+

Vijaykumar Vyshak (born 31 January 1997) is an Indian cricketer.[1] He made his List A debut on 24 February 2021, for Karnataka in the 2020–21 Vijay Hazare Trophy.[2] He made his Twenty20 debut on 5 November 2021, for Karnataka in the 2021–22 Syed Mushtaq Ali Trophy.[3] He made his first-class debut on 17 February 2022, for Karnataka in the 2021–22 Ranji Trophy.[4] +

+

References[edit]

+
+
    +
  1. ^ "Vijaykumar Vyshak". ESPN Cricinfo. Retrieved 24 February 2021. +
    2. +
  2. ^ "Elite, Group C, Bengaluru, Feb 24 2021, Vijay Hazare Trophy". ESPN Cricinfo. Retrieved 24 February 2021. +
    3. +
  3. ^ "Elite, Group B, Guwahati, Nov 6 2021, Syed Mushtaq Ali Trophy". ESPN Cricinfo. Retrieved 5 November 2021. +
    4. +
  4. ^ "Elite, Group C, Chennai, Feb 17 - 20 2022, Ranji Trophy". ESPN Cricinfo. Retrieved 17 February 2022. +
    5. +
+

External links[edit]

+ +
Stub icon 1 Stub icon 2

This biographical article related to an Indian cricket person born in 1997 is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Vijaykumar_Vyshak&oldid=1074349221"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/58.html b/content/corpora/58.html new file mode 100644 index 0000000..a9d1d36 --- /dev/null +++ b/content/corpora/58.html @@ -0,0 +1,455 @@ + + + + +In the Name of Love (1925 film) - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

In the Name of Love (1925 film)

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+

+ +
In the Name of Love
In the Name of Love (1925), still02.jpg
Richard Arlen, Greta Nissen, and Ricardo Cortez in In the Name of Love
Directed byHoward Higgin
Screenplay bySada Cowan
Based onThe Lady of Lyons by Edward Bulwer-Lytton
Produced byJesse L. Lasky
Adolph Zukor
StarringRicardo Cortez
Greta Nissen
Wallace Beery
Raymond Hatton
Lillian Leighton
Edythe Chapman
Richard Arlen
CinematographyCharles Edgar Schoenbaum
Production
company
Distributed byParamount Pictures
Release date
+
  • August 10, 1925 (1925-08-10)
+
Running time
60 minutes
CountryUnited States
LanguageSilent (English intertitles)
+

In the Name of Love is a 1925 American silent comedy film directed by Howard Higgin and written by Sada Cowan. It is based on the play The Lady of Lyons by Edward Bulwer-Lytton. It stars Ricardo Cortez, Greta Nissen, Wallace Beery, Raymond Hatton, Lillian Leighton, Edythe Chapman, and Richard Arlen. It was released on August 10, 1925 by Paramount Pictures.[1][2] +

+ + +

Plot[edit]

+

As described in a film magazine advertisement,[3] young Frenchman Raoul Melnotte, leaving his boyhood sweetheart Marie behind, goes to America to make his fortune. Marie promises to wait for him. Ten years later he returns to France, his fortune still unmade. Marie, however, has grown rich and snobbish. Hosts of men have made love to her, but her heart is set upon meeting a Prince of Como, who is visiting France, and will have nothing to do with Raoul. Glavis and the Marquis de Beausant, who have been lilted by the coquettish Marie, suggest to Raoul that he masquerade as the Prince of Como, marry Marie, and then humiliate her. He carries through the plan, and she weds him. When she finds out that she has been tricked, she is furious. Her brother Dumas, discovering the fraud, attacks Raoul and is about to kill him when Marie, realizing that she loves the masquerader in spite of everything, saves his life. +

+

Cast[edit]

+
+
+

Preservation[edit]

+

With no prints of In the Name of Love located in any film archives,[4] it is a lost film.[5] +

+

References[edit]

+
+
    +
  1. ^ "In the Name of Love". afi.com. Retrieved February 6, 2015. +
    2. +
  2. ^ "In the Name of Love (1925) - Overview - TCM.com". Turner Classic Movies. Retrieved February 6, 2015. +
    3. +
  3. ^ "Paramount Pictures advertisement: In the Name of Love", Exhibitors Herald, 21 (08): insert after p. 50, May 16, 1925, retrieved February 11, 2022 Public Domain This article incorporates text from this source, which is in the public domain. +
    4. +
  4. ^ The Library of Congress / FIAF American Silent Feature Film Survival Catalog: In the Name of Love +
    5. +
  5. ^ "In the Name of Love at Arn Andersen's Lost Film Files:lost Paramount films of - 1925". Archived from the original on August 22, 2015. Retrieved January 22, 2018. +
    6. +
+

External links[edit]

+ + + + + + +
+


+

+
Stub icon

This article about a silent comedy film from the 1920s is a stub. You can help Wikipedia by expanding it.

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=In_the_Name_of_Love_(1925_film)&oldid=1087904820"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/59.html b/content/corpora/59.html new file mode 100644 index 0000000..1912a22 --- /dev/null +++ b/content/corpora/59.html @@ -0,0 +1,408 @@ + + + + +David Merdy - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

David Merdy

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
David Merdy
Personal information
Date of birth +19 December 1975
Place of birth +France
Position(s) +Forward[1][2]
Senior career*
Years +Team +Apps +(Gls)
-1998 +Stade Rennais F.C. +7 +(1)
1996-1997 +Troyes AC→(loan) +33 +(5)
1997-1998 +ASOA Valence→(loan) +24 +(4)
1998-2000 +Wasquehal Football +13 +(0)
2000-2001 +AS Béziers + +
2001/2002 +Kilmarnock F.C. +0 +(0)
2002/2003 +SO Romorantin + +
2004-2007 +Rodez AF + +
2007-2009 +Bergerac Périgord FC + +
2009-2010 +Espérance de Plouguerneau + +
2010-2011 +AF Lozère + +
+Stade Olympique Millau Football + +
+*Club domestic league appearances and goals
+

David Merdy (born 19 December 1975 in France) is a French retired footballer.[3] +

+

References[edit]

+
+
    +
  1. ^ Interview with Le Foot Bordeaux +
    2. +
  2. ^ MERDY IN FOR THE KIL thefreelibrary.com +
    3. +
  3. ^ The hilarious and cringeworthy Scottish football chants that have us all in stitches dailyrecord.co.uk +
    4. +
+


+

+
Flag of FranceSoccer icon

This biographical article relating to French football is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=David_Merdy&oldid=1067949448"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/6.html b/content/corpora/6.html new file mode 100644 index 0000000..fe81ee0 --- /dev/null +++ b/content/corpora/6.html @@ -0,0 +1,478 @@ + + + + +Spring Green Primitive Baptist Church - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Spring Green Primitive Baptist Church

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Spring Green Primitive Baptist Church
+
Spring Green Primitive Baptist Church is located in North Carolina
Spring Green Primitive Baptist Church
Spring Green Primitive Baptist Church is located in the United States
Spring Green Primitive Baptist Church
LocationJct. of NC 1409 and NC 903, near Hamilton, North Carolina
Coordinates35°53′40″N 77°11′41″W / 35.89444°N 77.19472°W / 35.89444; -77.19472Coordinates: 35°53′40″N 77°11′41″W / 35.89444°N 77.19472°W / 35.89444; -77.19472
Area3.5 acres (1.4 ha)
Built1878 (1878)
Architectural styleGreek Revival
NRHP reference No.05000323[1]
Added to NRHPApril 20, 2005
+

Spring Green Primitive Baptist Church is a historic Primitive Baptist church located near Hamilton, Martin County, North Carolina. It was built in 1878, and is a front-gable, frame building with late Greek Revival style design elements. The building measures 36 feet, 4 inches, wide and 55 feet, 4 1/2 inches deep. Also on the property is the contributing church cemetery.[2] +

It was added to the National Register of Historic Places in 2005.[1] +

+

References[edit]

+
+
    +
  1. ^ a b "National Register Information System". National Register of Historic Places. National Park Service. July 9, 2010. +
    2. +
  2. ^ Penne Sandbeck (November 2004). "Spring Green Primitive Baptist Church" (pdf). National Register of Historic Places - Nomination and Inventory. North Carolina State Historic Preservation Office. Retrieved 2015-01-01. +
    3. +
+
+


+

+

This article about a property in Martin County, North Carolina on the National Register of Historic Places is a stub. You can help Wikipedia by expanding it.

+
Stub icon 1 Stub icon 2

This article about a church or other Christian place of worship in North Carolina is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Spring_Green_Primitive_Baptist_Church&oldid=1089499942"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/60.html b/content/corpora/60.html new file mode 100644 index 0000000..16fee66 --- /dev/null +++ b/content/corpora/60.html @@ -0,0 +1,669 @@ + + + + +Onbovo - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Onbovo

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Onbovo
+
Онбово
Village
Onbovo is located in Vologda Oblast
Onbovo
Onbovo
Onbovo is located in Russia
Onbovo
Onbovo
Coordinates: 60°45′N 46°15′E / 60.750°N 46.250°E / 60.750; 46.250[1]
CountryRussia
RegionVologda Oblast
DistrictVelikoustyugsky District
Time zoneUTC+3:00
+

Onbovo (Russian: Онбово) is a rural locality (a village) in Samotovinskoye Rural Settlement, Velikoustyugsky District, Vologda Oblast, Russia. The population was 30 as of 2002.[2] +

+

Geography[edit]

+

Onbovo is located 5 km northwest of Veliky Ustyug (the district's administrative centre) by road. Popovkino is the nearest rural locality.[3] +

+

References[edit]

+
+
    +
  1. ^ Деревня Онбово на карте +
    2. +
  2. ^ Данные переписи 2002 года: таблица 2С. М.: Федеральная служба государственной статистики, 2004. +
    3. +
  3. ^ Расстояние от Онбова до Великого Устюга +
    4. +
+
+

This Velikoustyugsky District location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Onbovo&oldid=1053031668"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/61.html b/content/corpora/61.html new file mode 100644 index 0000000..34da203 --- /dev/null +++ b/content/corpora/61.html @@ -0,0 +1,632 @@ + + + + +2012 Prosperita Open - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

2012 Prosperita Open

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
2012 Prosperita Open
DateApril 30 – May 6
Edition9th
SurfaceClay
LocationOstrava, Czech Republic
Champions
Singles
France Jonathan Dasnières de Veigy
Doubles
Moldova Radu Albot / Russia Teymuraz Gabashvili
+
+ + + +
← 2011 ·Prosperita Open· 2013 →
+

The 2012 Prosperita Open was a professional tennis tournament played on clay courts. It was the ninth edition of the tournament which was part of the 2012 ATP Challenger Tour. It took place in Ostrava Czech Republic between April 30 and May 6, 2012 +

+ + +

ATP entrants[edit]

+

Seeds[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Country +Player +Rank1 +Seed +
 CZE +Jan Hájek +137 +1 +
 RUS +Teymuraz Gabashvili +153 +2 +
 FRA +Guillaume Rufin +157 +3 +
 CZE +Jan Mertl +180 +4 +
 ITA +Simone Vagnozzi +207 +5 +
 BEL +Yannick Mertens +215 +6 +
 CZE +Dušan Lojda +216 +7 +
 FRA +Mathieu Rodrigues +223 +8 +
+
  • 1 Rankings are as of April 23, 2012.
+

Other entrants[edit]

+

The following players received wildcards into the singles main draw: +

+ +

The following players received entry from the qualifying draw: +

+ +

Champions[edit]

+

Singles[edit]

+
Main article: 2012 Prosperita Open – Singles
+ +

Doubles[edit]

+
Main article: 2012 Prosperita Open – Doubles
+ +

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=2012_Prosperita_Open&oldid=1073642398"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/62.html b/content/corpora/62.html new file mode 100644 index 0000000..562a11d --- /dev/null +++ b/content/corpora/62.html @@ -0,0 +1,355 @@ + + + + +Korean United Church of Chile - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Korean United Church of Chile

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

The Korean United Church of Chile was founded by missionaries of the Presbyterian Church in Korea (HapDong). It has close fellowship with the Korean-American Presbyterian Church. It has 350 members and adopted the Westminster Confession and the Heidelberg Catechism.[1][2] +

+

References[edit]

+
    +
  1. ^ "Address data base of Reformed churches and institutions". +
    2. +
  2. ^ "Overview of the worldwide reformed church". +
    3. +
+

+

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Korean_United_Church_of_Chile&oldid=1063554373"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/63.html b/content/corpora/63.html new file mode 100644 index 0000000..db93f75 --- /dev/null +++ b/content/corpora/63.html @@ -0,0 +1,629 @@ + + + + +56th Infantry Division "Casale" - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

56th Infantry Division "Casale"

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
56th Infantry Division "Casale"
56a Divisione Fanteria Casale.png
56th Infantry Division "Casale" insignia
Active1939–1943
CountryItaly Kingdom of Italy
BranchItaly Royal Italian Army
TypeInfantry
SizeDivision
Garrison/HQForlì
EngagementsWorld War II
Commanders
Notable
commanders		General Enea Navarini[1]
Insignia
Identification
symbol		Mostrina - 11°, 12°, 311° "Casale".png World War II - Mostrina - 56° Rgt. Artiglieria "Casale".png World War II - Mostrina - Genio Divisione "Casale".png World War II - Mostrina - Sanità Divisione "Casale".png World War II - Mostrina - Sussistenza Divisione "Casale".png World War II - Mostrina - Battaglioni mortaisti.png
Casale Division gorget patches
+

The 56th Infantry Division "Casale" (Italian: 56ª Divisione di fanteria "Casale") was an infantry division of the Royal Italian Army during World War II. The Casale was activated on 15 June 1939 in Forlì and named for the city of Casale Monferrato and recruited most its men from the Romagna region. The division was sent to Greece as occupation and force. There the division was disbanded by invading German forces in the Aetolia-Acarnania region of Greece after the announcement of the Armistice of Cassibile on 8 September 1943.[2][3] +

+ + +

History[edit]

+

The division's lineage begins with the Brigade "Casale" established on 21 December 1821, which on 25 October 1831 split to form the 1st and 2nd infantry regiments under the brigade's command. On 4 May 1839 the two regiments were re-numbered as 11th and 12th infantry regiments.[4] +

+

World War I[edit]

+

The brigade fought on the Italian front in World War I. On 28 October 1926 the brigade command was disbanded and the brigade's two regiments were transferred to other brigades: the 11th Infantry Regiment "Casale" to the XVII Infantry Brigade and the 12th Infantry Regiment "Casale" to the XII Infantry Brigade.[5][6] +

On 24 May 1939 the 12th Infantry Regiment "Casale" in Trieste changed its name to 73rd Infantry Regiment "Lombardia" and joined the newly activated 57th Infantry Division "Lombardia". On the same date a new 12th Infantry Regiment "Casale" was raised in Cesena. On 15 June 1939 the 56th Infantry Division "Casale" was activated in Forlì and received its two namesake infantry regiments and the newly raised 56th Artillery Regiment "Casale".[2] +

+

World War II[edit]

+

On 14 March 1941 the Casale left Italy for Albania to reinforce the failing Italian Spring Offensive during the Greco-Italian War. The division immediately entered the front in the Shushicë valley. By 20 March 1941 the Casale was assigned to the XXV Army Corps and fought in the Tepelenë area. Contact with retreating Greek forces was lost soon after the start of the Battle of Greece on 6 April 1941, and the Casale engaged in a cautious advance along the Drin river. On 18 April 1941 the Casale encountered a Greek rearguard at Lumi i Kardhiqit, and by 19 April 1941 the division had reached Gjirokastër. On 22 April 1941 the division reached the Greek border near Delvinaki, where it met with German patrols. Afterwards the division was used for mopping-up operations in Greece in the area of Zitsa, Negrades, and Paramythia.[2] +

While the 56th Infantry Division "Casale" was on occupation duty in Greece the division's regimental depots in Italy raised the 153rd Infantry Division "Macerata": the depot of the 11th Infantry Regiment "Casale" raised the 121st Infantry Regiment "Macerata", the depot of the 12th Infantry Regiment "Casale" raised the 122nd Infantry Regiment "Macerata", and the depot of the 56th Artillery Regiment "Casale" raised the 153rd Artillery Regiment "Macerata".[7] +

After this task was completed the Casale was moved to the south of the Ambracian Gulf and established garrisons in Agrinio, Amfilochia and Missolonghi. The division performed several anti-partisan raids in Agrinio, Kato Achaia, Chrysovitsa, and other locations. After the announcement of the Armistice of Cassibile on 8 September 1943, parts of the 11th Infantry Regiment joined Greek partisans, while the rest of the division was disbanded by German forces.[2] +

+

Organization[edit]

+
Coat of Arms of the 12th Infantry Regiment "Casale", 1939
+
  • 56a Divisione Fanteria Casale.png 56th Infantry Division "Casale", in Forlì[3] +
    • 11th Infantry Regiment "Casale", in Forlì[5] +
      • +
    • 12th Infantry Regiment "Casale", in Cesena[6] +
      • Command Company
        • +
      • 3x Fusilier battalions
        • +
      • Support Weapons Company (65/17 infantry support guns)
        • +
      • Mortar Company (81mm Mod. 35 mortars)
      • +
    • 311th Infantry Regiment "Casale" (raised on 1 November 1941 by the depot of the 28th Infantry Regiment "Pavia", transferred to the 5th Guardia alla Frontiera Grouping in Slovenia on 27 May 1942)[8] +
      • +
    • 56th Artillery Regiment "Casale", in Rimini +
      • +
    • LVI Mortar Battalion (81mm Mod. 35 mortars)
      • +
    • 56th Anti-tank Company (47/32 anti-tank guns; transferred to the 212th Coastal Division)
      • +
    • 156th Anti-tank Company (47/32 anti-tank guns; replaced the 56th Anti-tank Company)
      • +
    • 47th Engineer Company
      • +
    • 56th Telegraph and Radio Operators Company
      • +
    • 60th Medical Section
      • +
    • 50th Supply Section
      • +
    • 56th Truck Section
      • +
    • 156th Transport Section
      • +
    • 41st Bakers Section
      • +
    • 48th Carabinieri Section
      • +
    • 49th Carabinieri Section
      • +
    • 45th Field Post Office
+

Attached to the division from early 1941 until early 1942:[3] +

+
  • 23rd CC.NN. Legion "Bersaglieri del Mincio" +
    • XX CC.NN. Battalion
      • +
    • XXXVI CC.NN. Battalion
      • +
    • 23rd CC.NN. Machine Gun Company
+

Attached to the division in 1943:[3] +

+
  • CC.NN. Group "Po"
    • +
  • XXXVI CC.NN. Battalion
    • +
  • VI Carabinieri Battalion
    • +
  • II Group/ 33rd Artillery Regiment "Acqui" (detached from the 33rd Infantry Division "Acqui")
    • +
  • CXIX Artillery Group
+

Commanding officers[edit]

+

The division's commanding officers were:[2][3] +

+ +

References[edit]

+
+
    +
  1. ^ Enrico Tagliazucchi and Franco Agostini. "Royal Italian Army". World War II Armed Forces – Orders of Battle and Organizations. Archived from the original on 4 April 2009. Retrieved 4 May 2009. +
    2. +
  2. ^ a b c d e "56ª Divisione di fanteria "Casale"". Regio Esercito. Retrieved 30 October 2021. +
    3. +
  3. ^ a b c d e Bollettino dell'Archivio dell'Ufficio Storico N.II-3 e 4 2002. Rome: Ministero della Difesa - Stato Maggiore dell’Esercito - Ufficio Storico. 2002. p. 304. Retrieved 30 October 2021. +
    4. +
  4. ^ Voghera, Enrico (1909). Annuario militare del regno d'Italia - Volume I. Rome. p. 382. +
    5. +
  5. ^ a b "11° Reggimento di fanteria "Casale"". Regio Esercito. Retrieved 19 December 2021. +
    6. +
  6. ^ a b "12° Reggimento di fanteria "Casale"". Regio Esercito. Retrieved 19 December 2021. +
    7. +
  7. ^ "153ª Divisione di fanteria "Macerata"". Regio Esercito. Retrieved 22 December 2021. +
    8. +
  8. ^ "311° Reggimento di fanteria "Casale"". Regio Esercito. Retrieved 22 December 2021. +
    9. +
+ +


+

+
+

+

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=56th_Infantry_Division_%22Casale%22&oldid=1063283348"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/64.html b/content/corpora/64.html new file mode 100644 index 0000000..091342b --- /dev/null +++ b/content/corpora/64.html @@ -0,0 +1,365 @@ + + + + +Vila Robert Williams - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Vila Robert Williams

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
For other uses, see Robert Williams (disambiguation).
+ +

Vila Robert Williams (now Caála) was a town in Huambo province of Angola, in the then Portuguese Angola (before 1975). The town of Robert Williams was just west of Nova Lisboa (now Huambo) and was remarkable for huge outcroppings of boulders that jutted from the fields just outside the town. In those outcroppings researchers could find pottery shards, primitive metal smelting pits, and other archeological detritus. It is named after the Robert Williams who founded the Robert Williams and Company.[1] +

+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ Mvusi, Thandekile Ruth Mason (1994). "The 'politics of trypanosomiasis' revisited: labour mobilization and labour migration in colonial Zambia: the Robert Williams Company in Lubemba, 1901-1911". Transafrican Journal of History. 23: 43–68. JSTOR 24520269. +
    2. +
+

Coordinates: 14°56′0″S 18°18′0″E / 14.93333°S 18.30000°E / -14.93333; 18.30000 +


+

+
Stub icon

This Angola location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Vila_Robert_Williams&oldid=1051458361"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/65.html b/content/corpora/65.html new file mode 100644 index 0000000..4e6bbc3 --- /dev/null +++ b/content/corpora/65.html @@ -0,0 +1,381 @@ + + + + +Federal School of Dental Technology & Therapy - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Federal School of Dental Technology & Therapy

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

The Federal College of Dental Technology & Therapy is a higher education institute in Trans-Ekulu, Enugu State, Nigeria. It was established in 1955 in Lagos as the Federal School of Dental Technology and Hygiene, training dental technicians and hygienists. It became the Federal School of Dental Technology and Therapy in 1978, with the larger goal of training dental technologists and therapists. The school moved to its present location in 1982. The school is funded by the Federal Government of Nigeria. +Graduates of school of Dental Technology are awarded a Higher National Diploma after five years, and graduates will go for one-year internship before professional registration. +Graduates may practice as professionals after registration with the Dental Technologists or Dental Therapists Registration Boards of Nigeria. *NUC Approves FEDCODTTEN's Undergraduate Degree Programmes* +

The National Universities Commission (NUC) has approved the running of different undergraduate degree programmes in the Federal College of Dental Technology and Therapy, Enugu. +According to a letter dated February 10, 2021, the Commission authorised the running of the programmes in the precinct of the College. +The Commission listed the accredited undergraduate programmes and the degrees to be awarded as: Biomedical Technology (B.Tech), Dental Technology (B.Tech), Prosthetics and Orthotics (B.Tech) and Public Health Technology (B.Tech). +The B.Tech degree in Public Health involves four main areas of specialisation. +The four areas of specialisation which are already running as separate departments are: i.Public Health, ii.Dental Therapy, iii.Dental Nursing and +iv. Social Work. +The programmes had earlier commenced in affiliation with the Federal University of Technology, Owerri (FUTO). +With the current approval, the status of the College as an authorised degree awarding institution is given the required standing. +[1] +

The school was once the only school which trained dental technologists and therapists in Nigeria, until recently when other schools were established for this purpose. +

In August 2009, the new chairman of the board said it had been largely static over the years, and that he was looking for federal and state funding for upgrades. +[2] +The name of the Rector of the College is Dr. John Emaimo. +

+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ "About". Federal School of Dental Technology & Therapy. Retrieved 2010-03-20. +
    2. +
  2. ^ "Dental Technology". The Guardian. August 25, 2009. Archived from the original on 2010-04-14. Retrieved 2010-03-20. +
    3. +
+

External links[edit]

+

Official website +

+


+

+
Stub icon 1 Stub icon 2

This article on a Nigerian institution of higher education is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Federal_School_of_Dental_Technology_%26_Therapy&oldid=1031744956"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/66.html b/content/corpora/66.html new file mode 100644 index 0000000..a6a593b --- /dev/null +++ b/content/corpora/66.html @@ -0,0 +1,1017 @@ + + + + +Passy-Grigny - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Passy-Grigny

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Passy-Grigny
Commune
The church in Passy-Grigny
The church in Passy-Grigny
+
+
Coat of arms of Passy-Grigny
Coat of arms
Location of Passy-Grigny
+
Passy-Grigny is located in France
Passy-Grigny
Passy-Grigny
Passy-Grigny is located in Grand Est
Passy-Grigny
Passy-Grigny
Coordinates: 49°07′37″N 3°40′45″E / 49.1269°N 3.6792°E / 49.1269; 3.6792Coordinates: 49°07′37″N 3°40′45″E / 49.1269°N 3.6792°E / 49.1269; 3.6792
CountryFrance
RegionGrand Est
DepartmentMarne
ArrondissementÉpernay
CantonDormans-Paysages de Champagne
IntercommunalityPaysages de la Champagne
Government
 • Mayor (2020–2026) Fabrice Hubert
Area
1
11.99 km2 (4.63 sq mi)
Population
 (Jan. 2019)[1]
383
 • Density32/km2 (83/sq mi)
Time zoneUTC+01:00 (CET)
 • Summer (DST)UTC+02:00 (CEST)
INSEE/Postal code
51425 /51700
1 French Land Register data, which excludes lakes, ponds, glaciers > 1 km2 (0.386 sq mi or 247 acres) and river estuaries.
+

Passy-Grigny (French pronunciation: ​[pasi ɡʁiɲi]) is a commune in the Marne department in north-eastern France. +

+
Commandry of Passy-Grigny.
+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ "Populations légales 2019". The National Institute of Statistics and Economic Studies. 29 December 2021. +
    2. +
+ + + + + +
+


+

+
+


+

+
Stub icon

This Marne geographical article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Passy-Grigny&oldid=1053978907"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/67.html b/content/corpora/67.html new file mode 100644 index 0000000..55ab39e --- /dev/null +++ b/content/corpora/67.html @@ -0,0 +1,792 @@ + + + + +Craig Dahl - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Craig Dahl

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+
For the American ice hockey coach, see Craig Dahl (ice hockey).
+ +
Craig Dahl
refer to caption
Dahl with the San Francisco 49ers
No. 30, 43
Position:Safety
Personal information
Born: (1985-06-17) June 17, 1985 (age 36)
Mankato, Minnesota
Height:6 ft 1 in (1.85 m)
Weight:207 lb (94 kg)
Career information
High school:Mankato (MN) East
College:North Dakota State
Undrafted:2007
Career history +
+ +
+
Career highlights and awards +
+ +
+
Career NFL statistics
Total tackles:416
Sacks:4.0
Forced fumbles:4
Fumble recoveries:3
Pass deflections:18
Interceptions:5
Player stats at NFL.com
+
+

Craig Dahl (born June 17, 1985) is a former American football safety who played nine seasons in the National Football League. He was signed by the Giants as an undrafted free agent in 2007. He played college football at North Dakota State. +

He earned a Super Bowl ring during his first stint with the Giants in their Super Bowl XLII win against Tom Brady and the New England Patriots. Dahl has also played for the St. Louis Rams and the San Francisco 49ers. +

+ + +

Early years[edit]

+

Dahl was a First-team All-state, All-conference and All-city for Mankato East High School. He ran for 3,398 yards and passed for 1,769 yards as a quarterback over his final two years and scored 57 touchdowns. He quarterbacked the team to a runner up finish at the state tournament his junior year. He also competed in basketball and track & field (as a High jumper and long jumper). He holds many football records for the high school as well as many track records. (see below) +

He Holds the following records in track at Mankato East High School. +38.84 in 300 Hurdles, +Long Jump, and +Triple Jump +

As a sophomore, he finished 10th at the state meet in Long Jump. +

As a Junior he hurdled/jumped at the state meet finishing with the following times and places. +4th in the 110 hurdles running 14.85 +3rd in Long Jump with a jump of 22-07.25 +

As a senior, he hurdled/jumped at the state meet finishing with the following times and places. +5th in the 110 hurdles running 15.02 +3rd in the 300 Hurdles running 38.84 +3rd in the Long Jump jumping 22-31⁄4 +4th in the Triple Jump jumping 44-21⁄4 +

+

College career[edit]

+

Dahl played in 43 games for the Bison and posted 238 tackles (134 solo), 8 passes defensed, 7 interceptions and two sacks. In 2006 As a senior, recorded 61 tackles (32 solo), 2 interceptions and a sack and was First-team All-GWFC. In 2005, he was Second-team All-Great West and had 71 tackles, an interception forced a fumble and blocked a kick. He started in all 11 games at strong safety and led NDSU with 49 solo tackles including one tackle for loss and second overall with 71 total tackles and two pass breakups, one interception, a fumble recovery and one forced fumble. In 2004, as a sophomore, he started all 11 games and was named First-team All-Great West Football Conference. In 2003, he played in 10 games and had 24 tackles, and an interception and blocked a kick . +

+

Professional career[edit]

+

Pre-draft[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + +
Pre-draft measurables +
HeightWeight40-yard dash10-yard split20-yard split20-yard shuttleThree-cone drillVertical jumpBroad jumpBench press +
6 15⁄8 +216 lb
(98 kg) +		4.59 s1.60 s2.65 s4.26 s6.69 s35 in
(0.89 m)		10 ft 2 in
(3.10 m)		17 reps +
All values from NFL Combine.[1] +
+

New York Giants[edit]

+

Dahl signed with the New York Giants after playing college football at North Dakota State University. On September 2, 2007, he was placed on the 53-man roster. Through week 12 of the 2007 season, Dahl had three tackles. One tackle was against his home-state Vikings. On December 8, 2007, Craig made his first NFL start of his career against the Eagles. He had five tackles in the game. He tore his anterior cruciate ligament in a game against the New England Patriots, and did not play again. +

Dahl was waived by the Giants in February 2008 after failing a physical. He was re-signed on July 30, 2008, however, Dahl later again in the Giants' third preseason game tore his ACL. He was placed on injured reserve ending his season. +

An exclusive-rights free agent after the 2008 season, Dahl was not tendered an offer and became an unrestricted free agent in the 2009 offseason. +

+

St. Louis Rams[edit]

+

Dahl was signed by the St. Louis Rams on March 17, 2009. The move reunited him with Rams head coach Steve Spagnuolo, who was the Giants' defensive coordinator during Dahl's time in New York. The Rams re-signed Dahl on March 7, 2010. +

+

San Francisco 49ers[edit]

+

Dahl signed a three-year deal with the San Francisco 49ers on March 16, 2013.[2] +

He was released by the 49ers on September 4, 2015.[3] +

+

Second stint with Giants[edit]

+

Dahl re-signed with the New York Giants on September 7, 2015.[4] +

+

NFL statistics[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Year +Team +Games +Tackles +Fumbles +Interceptions +
GGSCombTotalAstSackFFFRYdsIntYdsAvgLngTDPD +
2007NYG +0902191630.0000000000 +
2009STL +1408655782.0020000003 +
2010STL +15139887111.011022311.52306 +
2011STL +1603615290.02001-3-3-301 +
2012STL +16167862160.0000138383802 +
2013SF +16013940.0000000000 +
2014SF +1601231940.0000100002 +
2015NYG +15044434101.0100000004 +
Career11747401336654.043055811.638018 +

[5] +

References[edit]

+
+
    +
  1. ^ "Craig Dahl, DS #13 SS, North Dakota State". DraftScout.com. Retrieved March 14, 2021. +
    2. +
  2. ^ 49ers Sign Safety Craig Dahl +
    3. +
  3. ^ Alper, Josh (September 4, 2015). "49ers release Philip Wheeler, Joe Looney and Craig Dahl". NBCSports.com. Retrieved September 7, 2015. +
    4. +
  4. ^ Sessler, Marc (September 7, 2015). "Giants release safety Stevie Brown". NFL.com. Retrieved September 7, 2015. +
    5. +
  5. ^ "Craig Dahl statistics". ESPN Internet Ventures. +
    6. +
+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Craig_Dahl&oldid=1073044336"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/68.html b/content/corpora/68.html new file mode 100644 index 0000000..76206f9 --- /dev/null +++ b/content/corpora/68.html @@ -0,0 +1,527 @@ + + + + +Quitman, Arkansas - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Quitman, Arkansas

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Quitman, Arkansas
City
Location of Quitman in Cleburne County and Faulkner County, Arkansas.
Location of Quitman in Cleburne County and Faulkner County, Arkansas.
Coordinates: 35°22′52″N 92°13′5″W / 35.38111°N 92.21806°W / 35.38111; -92.21806Coordinates: 35°22′52″N 92°13′5″W / 35.38111°N 92.21806°W / 35.38111; -92.21806
CountryUnited States
StateArkansas
CountiesCleburne, Faulkner
Area
[1]
 • Total1.90 sq mi (4.91 km2)
 • Land1.90 sq mi (4.91 km2)
 • Water0.00 sq mi (0.00 km2)
Elevation
584 ft (178 m)
Population
 (2020)
 • Total694
 • Density366.23/sq mi (141.42/km2)
Time zoneUTC-6 (Central (CST))
 • Summer (DST)UTC-5 (CDT)
ZIP code
72131
Area code(s)501
FIPS code05-57950
GNIS feature ID0053864
+

Quitman is a city in Cleburne and Faulkner counties in the U.S. state of Arkansas. Its population was 762 at the 2010 census.[2] The portion of the city in Faulkner County is part of the Little Rock–North Little Rock–Conway Metropolitan Statistical Area. +

+ + +

Geography[edit]

+

Quitman is located in southwestern Cleburne County at 35°22′52″N 92°13′5″W / 35.38111°N 92.21806°W / 35.38111; -92.21806 (35.381231, -92.218190).[3] It extends southwest along Arkansas Highway 25 into Faulkner County. Highway 25 leads 15 miles (24 km) northeast to Heber Springs, the Cleburne County seat, and southwest 14 miles (23 km) to U.S. Route 65 north of Greenbrier. +

According to the United States Census Bureau, Quitman has a total area of 2.0 square miles (5.1 km2), all land.[2] +

+

Demographics[edit]

+ + + + + + + + + +
Historical population +
CensusPop.%± +
1880177—
189032784.7%
190038317.1%
191047123.0%
1920366−22.3%
1930333−9.0%
194039318.0%
1950345−12.2%
1960305−11.6%
197035416.1%
198055657.1%
199063213.7%
200071413.0%
20107626.7%
2020694−8.9%
U.S. Decennial Census[4]
+

2020 census[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Quitman racial composition[5] +
Race +Number +Percentage +
White (non-Hispanic) +634 +91.35% +
Black or African American (non-Hispanic) +4 +0.58% +
Native American +4 +0.58% +
Asian +1 +0.14% +
Other/Mixed +37 +5.33% +
Hispanic or Latino +14 +2.02% +
+

As of the 2020 United States census, there were 694 people, 311 households, and 218 families residing in the city. +

+

2000 census[edit]

+

At the 2000 census there were 714 people in 316 households, including 204 families, in the city. The population density was 378.2 people per square mile (145.9/km2). There were 358 housing units at an average density of 189.6/sq mi (73.1/km2). The racial makeup of the city was 98.88% White, 1.04% Native American, 0.14% Asian, and 0.84% from two or more races. 0.42% of the population were Hispanic or Latino of any race.[6] +Of the 316 households 31.3% had children under the age of 18 living with them, 50.6% were married couples living together, 9.8% had a female householder with no husband present, and 35.4% were non-families. 32.6% of households were one person and 20.6% were one person aged 65 or older. The average household size was 2.26 and the average family size was 2.84. +

The age distribution was 25.6% under the age of 18, 8.3% from 18 to 24, 26.3% from 25 to 44, 17.9% from 45 to 64, and 21.8% 65 or older. The median age was 38 years. For every 100 females, there were 85.0 males. For every 100 females age 18 and over, there were 80.6 males. +

The median household income was $24,375 and the median family income was $31,964. Males had a median income of $28,750 versus $18,047 for females. The per capita income for the city was $15,537. About 11.8% of families and 14.0% of the population were below the poverty line, including 12.2% of those under age 18 and 23.2% of those age 65 or over. +


+

+

Education[edit]

+
Quitman Branch of the Cleburne County Library
+

Public education of elementary and secondary school students is available from Quitman School District leading to graduation from Quitman High School. +

+

References[edit]

+
+
    +
  1. ^ "2020 U.S. Gazetteer Files". United States Census Bureau. Retrieved October 29, 2021. +
    2. +
  2. ^ a b "Geographic Identifiers: 2010 Demographic Profile Data (G001): Quitman city, Arkansas". U.S. Census Bureau, American Factfinder. Archived from the original on February 12, 2020. Retrieved June 17, 2014. +
    3. +
  3. ^ "US Gazetteer files: 2010, 2000, and 1990". United States Census Bureau. 2011-02-12. Retrieved 2011-04-23. +
    4. +
  4. ^ "Census of Population and Housing". Census.gov. Retrieved June 4, 2015. +
    5. +
  5. ^ "Explore Census Data". data.census.gov. Retrieved 2021-12-31. +
    6. +
  6. ^ "U.S. Census website". United States Census Bureau. Retrieved 2008-01-31. +
    7. +
+

External links[edit]

+
+
+


+

+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Quitman,_Arkansas&oldid=1064525863"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/69.html b/content/corpora/69.html new file mode 100644 index 0000000..b3a517f --- /dev/null +++ b/content/corpora/69.html @@ -0,0 +1,634 @@ + + + + +Carlie Hanson - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Carlie Hanson

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Carlie Hanson
Born (2000-05-18) May 18, 2000 (age 22)
Onalaska, Wisconsin, U.S.
Genres
+ +
Occupation(s)Singer-songwriter
Years active2016–present
LabelsWarner Bros.
Websitewww.carliehanson.com
+

Carlie Hanson (born May 18, 2000) is an American singer-songwriter. In 2018, she released the song "Only One", which garnered attention after being featured on a playlist curated by Taylor Swift. She released her debut extended play, Junk, in June 2019. This was followed by her 2020 extended play, DestroyDestroyDestroyDestroy. Her debut album, Tough Boy, was released in February 2022. +

+ + +

Early life and education[edit]

+

Hanson was born and raised in Onalaska, Wisconsin. She was inspired to become a singer by Justin Bieber and, at 14, she and a friend began posting cover songs on YouTube, hoping to follow Bieber's path.[4] +

+

Career[edit]

+

In May 2016, while working as a cashier at McDonald's, Hanson entered a local iHeartRadio contest to see Zayn in concert.[5] As her entry, she recorded a video of herself singing "Pillowtalk" by Zayn while sitting in a parked car outside a shopping mall. She posted the video to Instagram, and it was quickly reposted by iHeart, drawing significant attention. Hanson was subsequently contacted by a talent agent who invited her to Toronto to audition and record for producers from House of Wolf.[6] While in Los Angeles, she worked with songwriter Dale Anthoni.[4][7] In November 2017, Taylor Swift included Hanson's second single, "Only One", on an Apple Music playlist of her favorite songs. Hanson released a video for the song in March 2018, directed by Similar But Different, who assembled an all-female crew for the shoot.[8] In April 2018, "Only One" was averaging 400,000 streams daily.[9] +

In September 2018, Hanson began touring with Troye Sivan and Kim Petras on Sivan's Bloom Tour, playing at venues including Radio City Music Hall in New York and the Greek Theater in Los Angeles.[10] In a review of the Minneapolis show, Twin Cities Media wrote: "She's badass, she’s unapologetic, she’s poppy yet gritty, she's effortlessly cool, her music absolutely bangs, and she’s selfmade. Carlie Hanson is a little bit of Lorde, a little of Billie Eilish meets Kiiara, and a lot of something all her own."[11][12] +

In January 2019, Hanson supported Yungblud on a series of shows in Europe. She then signed with Warner Bros. Records in February 2019,[13] and Primary Wave Music in March 2019.[14][15] On April 26, 2019, Hanson released "Back in My Arms".[16] The song was later announced to be the lead single from her debut extended play, Junk.[17] On May 24, 2019, she released "WYA", the second single from Junk.[18] Later that day, Taylor Swift added another of Hanson's songs, "Back in My Arms", to her Apple Music playlist.[19] The EP, consisting of five songs, was released on June 7, 2019.[20] In September 2019, she embarked on The WYA Tour across Europe and the United Kingdom.[21] +

In November 2019, Hanson released the single "Side Effects".[22] This was followed by other singles including "Daze Inn",[23] "Stealing All My Friends",[24] and "Good Enough".[25] In September 2020, she collaborated with Puerto Rican-American rapper Iann Dior on the song "Ego",[26] and subsequently announced her second extended play, DestroyDestroyDestroyDestroy, which was released on October 23, 2020.[27] The EP was followed by Hanson's debut studio album Tough Boy, released on February 18, 2022.[1] On January 28, 2022, she was featured on a track originally by Salem Ilese, fronted by Will Gould of Creeper from their eponymous extended play. The song, titled "Fall Out of Love", was used for the end credits of the 2022 movie Scream. +

+

Personal life[edit]

+

In 2018, Hanson stated that she does not have a label for her sexuality, but confirmed that she has had relationships with men and women.[28] She has since publicly spoken out about LGBTQ+ rights in the media, including an interview with Subvrt Magazine in 2018 where she voiced her opinion about the importance of LGBTQ+ role models.[29] +

+

Discography[edit]

+

Studio albums[edit]

+ + + + + + +
Title +Details +
Tough Boy + + +
+

Extended plays[edit]

+ + + + + + + + + +
Title +Details +
Junk + +
  • Released: June 7, 2019
    • +
  • Label: Warner Bros.
    • +
  • Format: Digital download
+
DestroyDestroy
DestroyDestroy +		 +
  • Released: October 23, 2020
    • +
  • Label: Warner Bros.
    • +
  • Format: Digital download
+
+

Singles[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
Title +Year +Album +
"Why Did You Lie" +2017 +Non-album singles +
"Only One" +
"Us" +2018 +
"Mood" +
"Toxins" +
"Numb" +
"Back in My Arms" +2019 +Junk +
"WYA" +
"Side Effects" +DestroyDestroy
DestroyDestroy +
"Daze Inn" +2020 +
"Stealing All My Friends" +
"Good Enough" +
"Ego"
(featuring Iann Dior) +
"Gucci Knife"
(featuring MASN) +		2021 +Tough Boy +
"Snot"
(featuring Deb Never) +
"Fuck Your Labels" +2022 +
+

Music videos[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Title +Year +Director(s) +
"Only One" +2018 +Unknown +
"Numb" +2019 +Nicholas Jandora +
"Back in My Arms" +Danilo Parra +
"Daze Inn"[30] +2020 +Serena Reynolds +
"Stealing All My Friends" +Danielle DeGrasse-Alston +
"Good Enough" +Christina Xing +
"Ego" +Ryan Baxley +
"Gucci Knife" +2021 +Nicholas Jandora +
"Snot" +Lucas Chemotti +
+

References[edit]

+
+
    +
  1. ^ a b "Carlie Hanson Releases New Single From Upcoming 'Tough Boy' Album". BroadwayWorld. Retrieved January 16, 2021. +
    2. +
  2. ^ "Carlie Hanson, Alt-Pop's New Teen Queen, On Making Sense Of Her Odds and Ends". Billboard. Retrieved 2020-01-13. +
    3. +
  3. ^ Ramynke, Ashley. "Interview: Wisconsin-native Carlie Hanson on translating the bad habits of her teenage years to pop single "Toxins"". Los Angeles Times. Retrieved 2019-03-21. +
    4. +
  4. ^ a b Erickson, Randy. "Major (label) things ahead for Onalaska singer Carlie Hanson". La Crosse Tribune. Retrieved 2019-03-21. +
    5. +
  5. ^ "Carlie Hanson: Pop music's fresh-faced phenom – PCC Courier". Retrieved 2019-05-24. +
    6. +
  6. ^ "Meet Carlie Hanson: 18-Year-Old Pop Star in the Making". PAPER. 2018-06-12. Retrieved 2019-03-21. +
    7. +
  7. ^ "Meet Carlie Hanson, the singer you'll be hooked on all summer...and all fall...and all year, really". babe. 2018-07-17. Retrieved 2019-03-24. +
    8. +
  8. ^ "Watch Carlie Hanson's Music Video for "Only One"". www.lofficielusa.com. Retrieved 2019-03-24. +
    9. +
  9. ^ "Carlie Hanson Announces Debut Live Shows in Los Angeles, CA and New York, NY on May 18th and May 29th – WithGuitars". www.withguitars.com. Retrieved 2019-03-24. +
    10. +
  10. ^ "Carlie Hanson on her sexuality, struggles with mental health and touring with Troye Sivan". Gay Times. 2018-07-20. Retrieved October 22, 2020. +
    11. +
  11. ^ "Troye Sivan Brings The Bloom Tour To Minneapolis' State Theater". TwinCitiesMedia.net. 2018-10-19. Retrieved 2019-03-24. +
    12. +
  12. ^ Kennedy, Christian. "Carlie Hanson is the most Taurus person you'll ever meet". The Michigan Daily. Retrieved 2019-03-21. +
    13. +
  13. ^ Erickson, Randy. "Onalaska's Carlie Hanson signs record contract with Warner Bros". madison.com. La Crosse Tribune. Retrieved 2019-03-21. +
    14. +
  14. ^ "Publishing Briefs: Denzel Curry Signs With Concord Music, Carlie Hanson Teams With Primary Wave & More". Billboard. Retrieved 2019-03-24. +
    15. +
  15. ^ "Carlie Hanson – Numb". The Hype Magazine. Retrieved 2019-03-24. +
    16. +
  16. ^ "Pre-save Carlie Hanson's single 'Back in my Arms'". campaigns.topsify.com. Retrieved 2019-04-20. +
    17. +
  17. ^ "Carlie Hanson Drops "Back In My Arms" Video, Announces 'Junk' EP". idolator. 2019-05-03. Retrieved 2019-05-03. +
    18. +
  18. ^ "WYA comes out this Friday!!!! and my EP 'Junk' is available for Pre-Order now bitch so let's go📺🕹". May 20, 2019. Retrieved May 21, 2019 – via Twitter. +
    19. +
  19. ^ "Taylor Swift Shares New Playlist Of Songs She's 'Loving Right Now': Listen". Billboard. Retrieved 2019-05-24. +
    20. +
  20. ^ BWW News Desk. "Carlie Hanson Releases Video For BACK IN MY ARMS, Debut EP Out 6/7". BroadwayWorld.com. Retrieved 2019-05-03. +
    21. +
  21. ^ "Carlie Hanson". Golden Voice. Retrieved October 22, 2020. +
    22. +
  22. ^ Hanson, Carlie [@carliehanson] (November 18, 2019). "SIDE EFFECTS November 22nd new era baby let's fucking go. pre-save in BIO" (Tweet) – via Twitter. +
    23. +
  23. ^ "Carlie Hanson Checks Into the 'Daze Inn' for Delirious New Video". Billboard. Retrieved March 29, 2020. +
    24. +
  24. ^ Hanson, Carlie [@carliehanson] (June 23, 2020). "Stealing All My Friends Friday 2.26 poured my heart into this song." (Tweet) – via Twitter. +
    25. +
  25. ^ "10 Cool New Pop Songs To Get You Through The Week: Carlie Hanson, Astrid S, Clean Bandit & More". Billboard. August 24, 2020. Retrieved August 25, 2020. +
    26. +
  26. ^ "Hear Carlie Hanson and iann dior let their "Ego" speak in new collab". AltPress. Retrieved October 22, 2020. +
    27. +
  27. ^ "Carlie Hanson Announces New EP "DestroyDestroyDestroyDestroy", Drops New Song "Ego" featuring iann dior". PMStudio. Retrieved October 22, 2020. +
    28. +
  28. ^ "Carlie Hanson on her sexuality, struggles with mental health and touring with Troye Sivan". Gay Times. Retrieved October 22, 2020. +
    29. +
  29. ^ "Rising Star Carlie Hanson Talks LGBTQ+ Issues & Mental Health". Subvrt Mag. 2018-10-25. Retrieved 2020-06-27. +
    30. +
  30. ^ "Carlie Hanson drops video for euphoric pop anthem Daze Inn". Gay Times Magazine. Retrieved March 29, 2020.[permanent dead link] +
    31. +
+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Carlie_Hanson&oldid=1077497605"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/7.html b/content/corpora/7.html new file mode 100644 index 0000000..aed620a --- /dev/null +++ b/content/corpora/7.html @@ -0,0 +1,903 @@ + + + + +Dwight Helminen - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Dwight Helminen

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+ +
Dwight Helminen
+Helminen Dwight Pelicans 2011 1.jpg
Born + (1983-06-22) June 22, 1983 (age 38)
Hancock, Michigan, U.S.
Height +5 ft 10 in (178 cm)
Weight +191 lb (87 kg; 13 st 9 lb)
Position +Center
Shoots +Left
ECHL team
Former teams		 +Kalamazoo Wings
JYP
Carolina Hurricanes
San Jose Sharks
Pelicans
NHL Draft +244th overall, 2002
Edmonton Oilers
Playing career +2004–present
+

Dwight Edward Helminen (born June 22, 1983) is a professional American ice hockey center who most recently played with the Kalamazoo Wings of the ECHL. His brother Lars plays with Linz EHC of the EBEL. +

+ + +

Playing career[edit]

+

Helminen was born in Hancock, Michigan, and raised in Brighton, Michigan.[citation needed] As a youth, he played in the 1997 Quebec International Pee-Wee Hockey Tournament with the Detroit Compuware minor ice hockey team.[1] +

He was drafted 244th overall in the 2002 NHL Entry Draft by the Edmonton Oilers. Dwight played junior hockey for the U.S. Junior National Team in the United States Hockey League (USHL) and college hockey at the University of Michigan for the Wolverines. On March 3, 2004, the New York Rangers acquired his rights from the Oilers along with a 2004 second round draft pick and Steve Valiquette in exchange for Petr Nedvěd and Jussi Markkanen.[citation needed] +

Since turning professional, Helminen has played for the Charlotte Checkers in the ECHL and the Hartford Wolf Pack in the American Hockey League (AHL), before signing with JYP Jyväskylä in the Finnish SM-liiga in 2007.[citation needed] +

Helminen signed a one-year contract with the Carolina Hurricanes on July 3, 2008. He was then assigned to the Hurricanes' affiliate, the Albany River Rats of the AHL. Helminen made his NHL debut in the 2008–09 season after an injury to Brandon Sutter. He played in 23 regular season games by season's end with the Hurricanes, as well as one playoff game.[citation needed] +

On July 16, 2009, Helminen signed a one-year contract with the San Jose Sharks.[2] In the 2009–10 season, on February 11, 2010, Helminen scored his first goal with the Sharks, against the Detroit Red Wings. On April 22, 2010, he scored a goal against the Colorado Avalanche in the Sharks' first-round playoff series.[citation needed] +

Midway through the 2011–12 season, Helminen left KLH Chomutov of the Czech first division league to return to North America, signing with the Kalamazoo Wings of the ECHL on February 6, 2012.[3] +

+

Career statistics[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +Regular season + +Playoffs +
Season +Team +League +GP +G +A +Pts +PIM +GP +G +A +Pts +PIM +
2001–02 +University of Michigan +CCHA +39 +10 +8 +18 +10 +— +— +— +— +— +
2002–03 +University of Michigan +CCHA +39 +17 +16 +33 +34 +— +— +— +— +— +
2003–04 +University of Michigan +CCHA +41 +17 +12 +29 +4 +— +— +— +— +— +
2004–05 +Hartford Wolf Pack +AHL +41 +2 +7 +9 +10 +— +— +— +— +— +
2004–05 +Charlotte Checkers +ECHL +28 +5 +16 +21 +10 +15 +7 +3 +10 +2 +
2005–06 +Hartford Wolf Pack +AHL +77 +32 +23 +55 +40 +13 +3 +5 +8 +10 +
2006–07 +Hartford Wolf Pack +AHL +80 +15 +24 +39 +32 +7 +1 +1 +2 +2 +
2007–08 +JYP +SM-l +52 +20 +25 +45 +10 +6 +3 +3 +6 +0 +
2008–09 +Albany River Rats +AHL +54 +15 +15 +30 +26 +— +— +— +— +— +
2008–09 +Carolina Hurricanes +NHL +23 +1 +1 +2 +0 +1 +0 +0 +0 +0 +
2009–10 +Worcester Sharks +AHL +74 +12 +10 +22 +16 +— +— +— +— +— +
2009–10 +San Jose Sharks +NHL +4 +1 +0 +1 +0 +7 +1 +0 +1 +4 +
2010–11 +Pelicans +SM-l +60 +12 +16 +28 +40 +— +— +— +— +— +
2011–12 +Piráti Chomutov +CZE.1 +24 +4 +14 +18 +6 +— +— +— +— +— +
2011–12 +Kalamazoo Wings +ECHL +20 +7 +11 +18 +6 +14 +5 +7 +12 +2 +
NHL totals +27 +2 +1 +3 +0 +8 +1 +0 +1 +4 +
+

Awards and honors[edit]

+ + + + + + + + + +
Award +Year + +
CCHA All-Tournament Team +2003 +[4] +
+

References[edit]

+
+
    +
  1. ^ "Pee-Wee players who have reached NHL or WHA" (PDF). Quebec International Pee-Wee Hockey Tournament. 2018. Retrieved 2019-02-11. +
    2. +
  2. ^ "Sharks sign four players, re-sign Vesce". San Jose Sharks. 2009-07-16. Archived from the original on 2009-07-18. Retrieved 2009-07-16. +
    3. +
  3. ^ "Wings add NHL experience". Kalamazoo Wings. 2012-02-06. Archived from the original on 2012-02-08. Retrieved 2012-02-06. +
    4. +
  4. ^ "2012-13 CCHA Media Guide". ISSUU.com. Retrieved 2014-04-23. +
    5. +
+

External links[edit]

+ + + + + + + + + + +
Awards and achievements +
Preceded by + CCHA Best Defensive Forward
2003–04 +		Succeeded by +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Dwight_Helminen&oldid=1057961065"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/70.html b/content/corpora/70.html new file mode 100644 index 0000000..2b11a65 --- /dev/null +++ b/content/corpora/70.html @@ -0,0 +1,483 @@ + + + + +Gun (2010 film) - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Gun (2010 film)

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+

+ +
Gun
Gun Film Poster.jpg
Poster
Directed byJessy Terrero
Written byCurtis Jackson
Produced byRandall Emmett
Curtis Jackson
George Furla
StarringCurtis Jackson
Val Kilmer
AnnaLynne McCord
James Remar
Danny Trejo
La La
Christa Campbell
John Larroquette
CinematographyZeus Morand
Edited byKirk Morri
Music byBen Zarai
David Allen Kitchens
Production
companies
Cheetah Vision Films
Hannibal Pictures
Richard Jackson Films
120 Tax Credit Finance
Emmett/Furla Films
Distributed byImage Entertainment
Release date
+ +
Running time
82 minutes
CountryUnited States
LanguageEnglish
+

Gun is a 2010 direct-to-video action film directed by Jessy Terrero, written by 50 Cent and starring himself, Val Kilmer and James Remar. Filming took place in Detroit and Grand Rapids, Michigan. +

+ + +

Synopsis[edit]

+

Angel (Kilmer) gets out of prison only to get involved in the gun-running ring of his old friend, Rich (Jackson). Rich and friends raid a club, killing Ali Tyrell, another arms dealer. +

Later, an officer investigates and calls a meeting, but two ATF agents come in disrupting the meeting. The meeting continues, discussing a mathematics teacher buying a Smith & Wesson firearm but his house gets robbed by a gangster and later he kills someone with the same gun. He subsequently decides to sell the gun back to the same shop, without knowing that the shop owner gives the firearms to Rich and his friends. +

Angel meets with Rich who helped him before to move guns. Afterwards, Rich and his friends torture an arms dealer who lied to them. Rich meets a news reporter to talk about the gun business and she takes him to his house. +

The next day, Angel meets the officer and it's shown that he was let out of prison to be an informant for them, with a flashback scene shown his wife being killed. The reporter goes to her wealthy boss to sell advanced guns to Rich, but her boss gives a lecture saying he might be a thug selling guns and saying his family been in the arms business since the Hoover administration now to advanced guns but she says they could trust him. +

The next day they meet without knowing that Angel is against them and the police are seeing their every move. The boss introduces himself to Rich and gives his van full of guns to him. He calls one of his minions to give Rich one of the guns to examine. Rich immediately agrees to buy them and is just about to pay when the police attack. During the fight Rich gets shot. Angel rescues him, but when they are alone turns and points his gun at Rich, who realizes that Angel has been the rat all along. +

Angel tells him that the cocktail waitress that was killed was his wife. Rich laughs and tells Angel that he is just like him, a killer, and that everybody that Angel has killed was someone's son or husband. As Angel breaks down, Rich pulls a gun, but Angel gets the shot off first. Rich lies on the ground, telling Angel to kill him, that nobody will miss him and that he'll see him in Hell. As Angel is about to kill him, the agent shoots Angel. +

As time elapsed, Angel walks down a corridor with a sling on his arm, and he meets with his daughter. The agent is seen walking into his office and is questioned by reporters on how he feels about Rich's plea bargain, and on the rumors that he has stepped down. The movie ends with Rich walking to his cell in handcuffs, and he looks up through the bars as the cell is opening. +

+

Cast[edit]

+ +

References[edit]

+
+
+

External links[edit]

+ +
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Gun_(2010_film)&oldid=1089780148"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/71.html b/content/corpora/71.html new file mode 100644 index 0000000..be24feb --- /dev/null +++ b/content/corpora/71.html @@ -0,0 +1,368 @@ + + + + +CZ 75 Tactical Sports - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

CZ 75 Tactical Sports

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
CZ 75 Tactical Sports
TypeCompetition Semi-automatic pistol
Place of origin Czech Republic
Service history
In service2005–present
Production history
ManufacturerČeská Zbrojovka
Produced2005–present
No. built30.000+
Specifications
Mass1.3 kg (2.47 lb
Cartridge9×19mm Parabellum
.40 S&W
Actionshort recoil, tilting barrel
Rate of firesemi-automatic
Effective firing range50 m (for 9mm CZ-75 family and CZ-75 Automatic)
Feed systemdetachable box magazines: +
  • 9mm: 20
    • +
  • .40 S&W: 17 (20 with extension)
+
SightsFront blade, rear square notch
+

The CZ 75 Tactical Sports pistol [1] is a Czech single-action firearm specifically designed for practical shooting competitions. It is the successor of the CZ 75 Standard IPSC model. Though almost identical in external appearance, the TS features some improvements, especially in its trigger mechanism, magazine capacity and durability. It was officially discontinued for production in 2018 by CZ. +

+

Background[edit]

+

Originally, the CZ 75 IPSC models were manufactured in versions for two IPSC practical shooting divisions: Modified (the 75 M IPSC) and Standard (the 75 ST IPSC). Currently, there are no CZ models available for Modified Division. Recently CZ introduced the CZ 75 TS Czechmate [2] a competition variant based on the Tactical Sports 9mm model; equipped with a compensator and electronic red dot sight on a frame mount; designed especially for IPSC Open Division. +

The CZ 75 TS comes in two calibers: .40 S&W (17 cartridges in the magazine) and 9mm (20 cartridges in the magazine). The .40 S&W caliber offers a score advantage by considering a higher or “major” caliber (according to the IPSC rules). However, the 9mm model is appealing to shooters who do not reload their ammo and in countries where the law does not allow the use of major calibers, as well as for those who want to take advantage of the low recoil and very high magazine capacity of the 9mm version. +

CZ Custom has marketed a magazine extender for the .40 S&W version that increases capacity from 17 to 20 cartridges,[3] but with this accessory the pistol is no longer legal in IPSC Standard Division, though it is eligible for USPSA Limited Division. +

+

References[edit]

+
+
    +
  1. ^ > CZ 75 Tactical Sport. CZ-USA. Retrieved on 2011-06-09. +
    2. +
  2. ^ > CZ 75 TS Czechmate Archived 2011-02-27 at the Wayback Machine. CZ-USA. Retrieved on 2011-06-09. +
    3. +
  3. ^ CZ TS Extended Base Pad BK Archived 2010-11-27 at the Wayback Machine. Czcustom.com. Retrieved on 2011-06-09. +
    4. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=CZ_75_Tactical_Sports&oldid=1040737697"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/72.html b/content/corpora/72.html new file mode 100644 index 0000000..649463e --- /dev/null +++ b/content/corpora/72.html @@ -0,0 +1,1657 @@ + + + + +Dinajpur-3 - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Dinajpur-3

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Dinajpur-3
Constituency
for the Jatiya Sangsad
দিনাজপুর-৩.svg
DistrictDinajpur District
DivisionRangpur Division
Electorate349,569 (2018)[1]
Current constituency
Created1973
PartyAwami League
Member(s)Iqbalur Rahim
+

Dinajpur-3 is a constituency represented in the Jatiya Sangsad (National Parliament) of Bangladesh since 2008 by Iqbalur Rahim of the Awami League. +

+ + +

Boundaries[edit]

+

The constituency encompasses Dinajpur Sadar Upazila.[2][3] +

+

History[edit]

+

The constituency was created for the first general elections in newly independent Bangladesh, held in 1973. +

+

Members of Parliament[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
ElectionMemberParty +
+1973 +Mohammad Fazlul Karim +Awami League[4] +
+1979 +Rezwanul Haque +Bangladesh Nationalist Party[5] +
Major Boundary Changes +
+1986 +Amzad Hossain +Awami League[6] +
+1988 +Mokhlesur Rahman +Jatiya Party[7] +
+1991 +M. Abdur Rahim +BAKSAL +
+1996 +Khurshid Jahan +Bangladesh Nationalist Party +
+2008 +Iqbalur Rahim +Awami League +
+

Elections[edit]

+

Elections in the 2010s[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
General Election 2014: Dinajpur-3[8] +
Party +Candidate +Votes +% +±% +
+Bangladesh Awami League +Iqbalur Rahim +96,349 +59.1 ++5.4 +
+Workers Party +Mahmudul Hasan Manik +3,327 +1.0 +N/A +
Majority +93,022 +93.3 ++79.8 +
Turnout +99,676 +31.7 ++57.4 +
+Bangladesh Awami League hold +
+

Elections in the 2000s[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
General Election 2008: Dinajpur-3[2][9][10] +
Party +Candidate +Votes +% +±% +
+Bangladesh Awami League +Iqbalur Rahim +140,934 +56.4 ++12.9 +
+BNP +Shafiul Alam Prodhan +107,353 +43.0 +-6.2 +
+BDB +Md. Asraful Islam +638 +0.3 +N/A +
+IAB +A. K. M. Lofijuddin Choudhuri +603 +0.2 +N/A +
Majority +33,581 +13.5 ++2.5 +
Turnout +249,528 +89.1 ++5.7 +
+Bangladesh Awami League gain from BNP +
+

Khurshid Jahan died in June 2006. To fill the vacant seat, the Election Commission planned a by-election for 7 September. The High Court, however, blocked the by-election on the grounds that it would be wasteful, as the parliament's tenure was due to end in October with the formation of a caretaker government in preparation for the next general election.[11] +

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
General Election 2001: Dinajpur-3[12] +
Party +Candidate +Votes +% +±% +
+BNP +Khurshid Jahan +102,640 +51.8 ++17.8 +
+Bangladesh Awami League +M. Abdur Rahim +80,814 +40.8 ++8.1 +
+IJOF +Mokhlesur Rahman +13,952 +7.0 +N/A +
+Bangladesh Janata Party +Fayez Uddin Ahmed +459 +0.2 ++0.1 +
+Workers Party +Mahmudul Hasan Manik +293 +0.2 +0.0 +
+JSD +Md. Abdul Hye +113 +0.1 +-0.1 +
Majority +21,826 +11.0 ++9.7 +
Turnout +198,271 +83.4 ++4.6 +
+BNP hold +
+

Elections in the 1990s[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
General Election June 1996: Dinajpur-3[12] +
Party +Candidate +Votes +% +±% +
+BNP +Khurshid Jahan +51,802 +34.0 ++12.8 +
+Bangladesh Awami League +M. Abdur Rahim +49,857 +32.7 +N/A +
+JP(E) +Mokhlesur Rahman +34,931 +22.9 +-0.1 +
+Jamaat-e-Islami +Muzibur Rahman +13,396 +8.8 +-7.2 +
+IOJ +Md. Rustam Ali +607 +0.4 +N/A +
+Gano Forum +Khatibuddin Ahmed +589 +0.4 +N/A +
+JSD +M. Golam Rahman +287 +0.2 +N/A +
+Workers Party +Md. Rafiqul Amin +257 +0.2 +N/A +
+JSD (R) +Imamul Islam +189 +0.1 +-0.1 +
+Zaker Party +Md. Shaker Ullah +166 +0.1 +-0.4 +
+Independent +Md. Motahar Hossain +123 +0.1 +N/A +
+Bangladesh Janata Party +Fayez Uddin Ahmed +81 +0.1 +N/A +
Majority +1,945 +1.3 +-13.4 +
Turnout +152,285 +78.8 ++15.8 +
+BNP gain from BAKSAL +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
General Election 1991: Dinajpur-3[12] +
Party +Candidate +Votes +% +±% +
+BAKSAL +M. Abdur Rahim +44,784 +37.8 + +
+JP(E) +Mokhlesur Rahman +27,318 +23.0 + +
+BNP +M. A. Jalil +25,109 +21.2 + +
+Jamaat-e-Islami +Md. Abul Kashem +18,969 +16 + +
+Independent +Amzad Hossain +703 +0.6 + +
+Zaker Party +M. A. Towab +550 +0.5 + +
+Jatiya Ganatantrik Party +Md. Aminul Haq +394 +0.3 + +
+JSD (R) +Imamul Islam +273 +0.2 + +
+FP +Syed Zakir Hossein +148 +0.1 + +
+Independent +Md. Siddiqur Rahman +127 +0.1 + +
+JSD (S) +Md. Abdur Rahim Sarkar +93 +0.1 + +
+Independent +Syed Sharafat Hossein +88 +0.1 + +
Majority +17,466 +14.7 + +
Turnout +118,556 +63.0 + +
+BAKSAL gain from JP(E) +
+

References[edit]

+
+
    +
  1. ^ "Dinajpur-3". The Daily Star. Retrieved 31 December 2018. +
    2. +
  2. ^ a b "Constituency Maps of Bangladesh" (PDF). Bangladesh Election Commission. 2010. Archived from the original (PDF) on 14 August 2014. Retrieved 13 August 2014. +
    3. +
  3. ^ "Delimitation of Constituencies" (PDF). Bangladesh Election Commission (in Bengali). 2013. Archived from the original (PDF) on 27 July 2014. Retrieved 23 July 2014. +
    4. +
  4. ^ "List of 1st Parliament Members" (PDF). Bangladesh Parliament (in Bengali). Retrieved 13 February 2018. +
    5. +
  5. ^ "List of 2nd Parliament Members" (PDF). Bangladesh Parliament (in Bengali). Retrieved 13 August 2014. +
    6. +
  6. ^ "List of 3rd Parliament Members" (PDF). Bangladesh Parliament (in Bengali). Retrieved 13 August 2014. +
    7. +
  7. ^ "List of 4th Parliament Members" (PDF). Bangladesh Parliament (in Bengali). Retrieved 13 August 2014. +
    8. +
  8. ^ "Dinajpur-3". Bangladesh Election Result 2014. Dhaka Tribune. Archived from the original on 7 March 2018. Retrieved 8 February 2018. +
    9. +
  9. ^ "Bangladesh Parliament Election - Detail Results". Amar Desh. Retrieved 8 February 2018. +
    10. +
  10. ^ "Nomination submission List". Bangladesh Election Commission (in Bengali). Archived from the original on 11 February 2018. Retrieved 9 February 2018. +
    11. +
  11. ^ Adam, Gani (19 August 2006). "By-elections to Dinajpuir-3 and Commilla-8 seats may not be held EC secretary". bdnews24.com. Retrieved 6 March 2018. +
    12. +
  12. ^ a b c "Parliament Election Result of 1991,1996,2001 Bangladesh Election Information and Statistics". Vote Monitor Networks. Archived from the original on 22 December 2008. Retrieved 11 February 2018. +
    13. +
+

External links[edit]

+ +
+

Coordinates: 25°37′N 88°38′E / 25.62°N 88.64°E / 25.62; 88.64 +


+

+
Stub icon

This Bangladesh location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Dinajpur-3&oldid=1059500490"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/73.html b/content/corpora/73.html new file mode 100644 index 0000000..094131c --- /dev/null +++ b/content/corpora/73.html @@ -0,0 +1,885 @@ + + + + +Emil Weber Meek - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Emil Weber Meek

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Emil Weber Meek
Emil Meek (34352206024) (cropped).jpg
Meek at the 2017 World RX of Norway
BornEmil Weber Meek
(1988-08-20) August 20, 1988 (age 33)
Tønsberg, Norway
Other namesValhalla
NationalityNorwegian
Height5 ft 10 in (1.78 m)
Weight170 lb (77 kg; 12 st)
DivisionWelterweight
Reach74+1⁄2 in (189 cm)[1]
StanceOrthodox
Fighting out ofTrondheim, Norway
TeamFrontline Academy
MMA Trondheim
Years active2012–present
Mixed martial arts record
Total16
Wins9
By knockout7
By submission1
By decision1
Losses6
By knockout2
By submission1
By decision3
No contests1
+
Amateur record
Total6
Wins6
Losses0
+
Other information
Mixed martial arts record from Sherdog
+

Emil Weber Meek (born August 20, 1988) is a Norwegian professional mixed martial artist that competed in the UFC's Welterweight division.[2] +

+ + +

Background[edit]

+

Meek grew up in Nesna in Nordland, and later lived in Mosjøen, Trondheim and Oslo.[3] In 2009, Meek started his mixed martial arts (MMA) career at the now defunct, Trondheim Fight Gym. Emil Meek runs MMA Trondheim together with Thomas Formo.[4] +

+

Mixed martial arts career[edit]

+

Meek began his MMA career as an amateur, where he compiled an undefeated record (6-0).[5] +

Meek made his professional debut on March 12, 2011, against Magnus Frekman. Meek defeated Frekman via TKO 45 seconds into the first round. For his second fight, he fought Mohammed Abdallah. He lost the bout by TKO in the first round. After this loss, Meek went on a four-fight win streak.[2] He was awarded 2013 Prospect of the Year by MMA Viking.[6] +

On August 20, 2016, he won the Venator Fighting Championship Welterweight title by defeating Rousimar Palhares by knockout in the first round. Meek stopped Palhares with a series of punches and elbows to the side of the head, while defending from Palhares' takedown attempt.[7] +

+

Ultimate Fighting Championship[edit]

+

On December 10, 2016, Meek made his promotional debut against returning veteran Jordan Mein at UFC 206.[8] He won the fight via unanimous decision.[9] +

Meek was expected to face Nordine Taleb on May 28, 2017, at UFC Fight Night 109.[10] However, Meek pulled out of the fight on May 12 citing injury.[11] Meek was replaced by promotional newcomer Oliver Enkamp.[12] +

Meek was scheduled to faced Kamaru Usman on December 30, 2017, at UFC 219.[13] However, the fight was rescheduled for January 14, 2018 at UFC Fight Night: Stephens vs. Choi.[14] He lost the fight by unanimous decision.[15] +

Meek faced Bartosz Fabiński on July 22, 2018, at UFC Fight Night 134.[16] He lost the fight via unanimous decision.[17] +

Meek faced Jake Matthews on February 23, 2020, at UFC Fight Night: Felder vs. Hooker.[18] He lost the fight via unanimous decision.[19] +

On June 17, 2021, it was announced that Meek was released from the UFC.[20] +

+

Post-UFC career[edit]

+

After the release, Meek was scheduled to face Thibault Gouti at Ares FC 2 on December 11, 2021.[21] Gouti pulled out of the bout and was replaced by Louis Glismann.[22] He lost the fight via an armbar in round one.[23] +

+

Championships and accomplishments[edit]

+
  • Venator Fighting Championship +
    • Venator Welterweight Championship (One time; former)
    • +
  • Nordic MMA Awards: MMAViking.com +
    • 2013 Prospect of the Year[24]
      • +
    • 2016 Fighter of the Year[25]
+

Mixed martial arts record[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + +
Professional record breakdown + +
16 matches +9 wins +6 losses +
By knockout +7 +2 +
By submission +1 +1 +
By decision +1 +3 +
No contests +1 +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Res. +Record +Opponent +Method +Event +Date +Round +Time +Location +Notes +
Loss +9–6 (1) +Louis Glismann +Submission (armbar) +Ares FC 2 +December 11, 2021 +1 +1:00 +Paris, France + +
Loss +9–5 (1) +Jake Matthews +Decision (unanimous) +UFC Fight Night: Felder vs. Hooker +February 23, 2020 +3 +5:00 +Auckland, New Zealand + +
Loss +9–4 (1) +Bartosz Fabiński +Decision (unanimous) +UFC Fight Night: Shogun vs. Smith +July 22, 2018 +3 +5:00 +Hamburg, Germany + +
Loss +9–3 (1) +Kamaru Usman +Decision (unanimous) +UFC Fight Night: Stephens vs. Choi +January 14, 2018 +3 +5:00 +St. Louis, Missouri, United States + +
Win +9–2 (1) +Jordan Mein +Decision (unanimous) +UFC 206 +December 10, 2016 +3 +5:00 +Toronto, Ontario, Canada + +
Win +8–2 (1) +Rousimar Palhares +KO (punches and elbows) +Venator FC 3: Palhares vs. Meek +May 21, 2016 +1 +0:45 +Milan, Italy +Won the Venator Welterweight Championship. +
Win +7–2 (1) +Christophe Van Dijck +TKO (punches) +Battle of Botnia 2015 +November 28, 2015 +2 +4:35 +Umeå, Sweden + +
Win +6–2 (1) +Kai Puolakka +Submission (guillotine choke) +Cage 32 +October 23, 2015 +3 +2:20 +Helsinki, Finland + +
Loss +5–2 (1) +Albert Odzimkowski +TKO (punches) +Fight Exclusive Night 8: Summer Edition +July 31, 2015 +1 +3:30 +Kołobrzeg, Poland + +
NC +5–1 (1) +Piotr Danielski +NC (overturned) +Berserkers Arena 7: Exped Cup +May 14, 2015 +3 +5:00 +Szczecin, Poland +Overturned due to referee mistake. +
Win +5–1 +Per Franklin +TKO (punch) +Superior Challenge 9 +November 23, 2013 +2 +1:40 +Goteborg, Sweden + +
Win +4–1 +Tato Primera +TKO (punches) +Strength and Honor Championship 8: Paraisy vs. Balde +September 21, 2013 +1 +0:50 +Geneva, Switzerland + +
Win +3–1 +Raymond Jarman +TKO (punches) +European MMA 5: Frederiksberg +April 19, 2013 +1 +N/A +Copenhagen, Denmark + +
Win +2–1 +Frodi Vitalis Hansen +TKO (punches) +European MMA 4: Fight Time in Viborg +March 2, 2013 +1 +1:00 +Viborg, Denmark + +
Loss +1–1 +Mohammed Abdallah +TKO (punches) +Fighter Gala 25 +May 12, 2012 +1 +4:33 +Frederiksberg, Denmark + +
Win +1–0 +Magnus Frekman +TKO (punches) +Red Mist Promotions: Ultimate Rage 1 +March 12, 2011 +1 +0:25 +Barnsley, England + +
+

[26] +

+

References[edit]

+
+
    +
  1. ^ "Emil Meek | UFC". www.ufc.com. Retrieved 2018-12-12. +
    2. +
  2. ^ a b "Emil "Valhalla" Meek". Sherdog. Retrieved November 2, 2021. +
    3. +
  3. ^ "En fighter i verdensklasse". Trening.no (in Norwegian). +
    4. +
  4. ^ "MMA Trondheim". MMA Trondheim. +
    5. +
  5. ^ "Emil Meek". +
    6. +
  6. ^ "Prospect of the Year:Emil "Hulk" Weber Meek". MMAviking.com. 2013-12-13. +
    7. +
  7. ^ "UFC congratulates Emil Meek on knocking out Rousimar Palhares". BJPenn.com. +
    8. +
  8. ^ Ariel Helwani (2016-10-17). "Jordan Mein vs. Emil Meek targeted for UFC 206". mmafighting.com. Retrieved 2016-10-17. +
    9. +
  9. ^ Steven Marrocco (2016-12-10). "UFC 206 results: Emil Meek cruises in UFC debut, takes decision from Jordan Mein". mmajunkie.com. Retrieved 2016-12-10. +
    10. +
  10. ^ Staff (2017-04-07). "Emil Meek vs. Nordine Taleb set for UFC Fight Night 109". mmajunkie.com. Retrieved 2017-04-07. +
    11. +
  11. ^ Staff (2017-05-12). "Emil Meek says he's out of UFC Fight Night 109 fight with Nordine Taleb in Sweden". mmajunkie.com. Retrieved 2017-05-12. +
    12. +
  12. ^ Ashah Tafari (2017-05-12). "Oliver Enkamp ready for UFC Stockholm - replaces Emil "Valhalla" Meek" (in Swedish). mmanytt.se. Retrieved 2017-05-16. +
    13. +
  13. ^ DNA, MMA. "TUF 21 winnaar Kamaru Usman treft "Valhalla Army" tijdens UFC 219". mmadna.nl. Retrieved 2017-10-20. +
    14. +
  14. ^ "Kamaru Usman vs. Emil Meek rescheduled for UFC Fight Night 124 in St. Louis". MMAjunkie. 2017-12-15. Retrieved 2017-12-15. +
    15. +
  15. ^ Dave Doyle (2018-03-23). "UFC St. Louis results: Kamaru Usman wins dominant decision over Emil Meek". mmafighting.com. Retrieved 2018-03-23. +
    16. +
  16. ^ Staff, MMA Viking (2018-06-01). "Emil Meek Booked for UFC Hamburg Versus Bartosz Fabinski - Nordic MMA Everyday at MMA Viking". Nordic MMA Everyday at MMA Viking. Retrieved 2018-06-01. +
    17. +
  17. ^ "UFC Fight Night 134 results: Bartosz Fabinski takes down Emil Meek at will in decision win". MMAjunkie. 2018-07-22. Retrieved 2018-07-22. +
    18. +
  18. ^ "Kiwi Dan Hooker confirmed as main event for UFC Auckland". The New Zealand Herald. 2019-11-27. ISSN 1170-0777. Retrieved 2019-11-27. +
    19. +
  19. ^ Doherty, Dan (2020-02-22). "UFC Auckland Results: Jake Matthews Fends Off Emil Weber Meek". Cageside Press. Retrieved 2020-02-23. +
    20. +
  20. ^ "Complete, updated current UFC roster list - Bloody Elbow". 2021-06-28. Archived from the original on 2021-06-28. Retrieved 28 June 2021. +
    21. +
  21. ^ "Fernand Lopez's Ares FC returns from long layoff, features Taylor Lapilus vs. Wilson Reis in December". MMAjunkie.com. October 29, 2021. +
    22. +
  22. ^ "MMA-Meek tilbake i buret – går kamp i Paris i desember". www.vg.no (in Norwegian Bokmål). Retrieved 2021-12-13. +
    23. +
  23. ^ "Meek tapte på armbar i comebacket". www.vg.no (in Norwegian Bokmål). Retrieved 2021-12-13. +
    24. +
  24. ^ Joona Pylkäs (December 13, 2013). "2013 Prospect of the Year: Emil Weber Meek". mmaviking.com. +
    25. +
  25. ^ "2016 Fighter of the Year : Emil Weber Meek". mmaviking.com. January 9, 2017. +
    26. +
  26. ^ Sherdog.com. "Emil". Sherdog. Retrieved 2018-12-12. +
    27. +
+

External links[edit]

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Emil_Weber_Meek&oldid=1067957734"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/74.html b/content/corpora/74.html new file mode 100644 index 0000000..a2b619f --- /dev/null +++ b/content/corpora/74.html @@ -0,0 +1,443 @@ + + + + +Saints and Soldiers: Airborne Creed - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Saints and Soldiers: Airborne Creed

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Saints and Soldiers: Airborne Creed
Saints and Soldiers - Airborne Creed.jpg
Theatrical release poster
Directed byRyan Little
Written byLamonte Grey
Lincoln Hoppe
Produced byAdam Abel
Ryan Little
StarringCorbin Allred
David Nibley
Jasen Wade
CinematographyRyan Little
Music byJ Bateman
Production
company
Go Films
Distributed byPurdie Distribution
Release date
+
  • August 17, 2012 (2012-08-17)
+
Running time
97 minutes
CountryUnited States
LanguageEnglish
+

Saints and Soldiers: Airborne Creed is a 2012 war drama film directed by Ryan Little and produced by Little and Adam Abel. It is based on events that took place during the invasion of Southern France in World War II. The film stars Corbin Allred, David Nibley, and Jasen Wade. The film's story has no relation to the events or characters portrayed in the 2003 war film Saints and Soldiers. The film was shot in Utah, on a tight budget, saving money by using volunteer World War II reenactors as some of the actors and extras. The film received mixed reviews; many critics found the film mediocre yet still praised the performances and cinematography. This film precedes the third film in the series, Saints and Soldiers: The Void, which was released in 2014. +

+ + +

Plot[edit]

+

In August 1944, the Allies have invaded German-occupied Southern France. German Army Second Lieutenant Erich Neumann (Lincoln Hoppe) executes two French men. On the early morning of August 15, paratroopers from the 517th Parachute Regimental Combat Team land in Provence, France under heavy fire from the Germans. Two soldiers, Corporals Harland 'Bud' Curtis (Jasen Wade) and James Rossi (Corbin Allred) land separately and alone. Curtis is spotted by a German Patrol and quickly surrenders. After throwing a grenade to distract the Germans, Rossi kills the entire patrol and rescues Curtis. The two set off towards their intended landing area before finding an abandoned shelter where they are followed by Curtis's squad leader Sergeant Caleb Jones (David Nibley). MISTAKE: The Sergeant states he is from Bravo company, but there was no Bravo company until after Korea. It was called Baker company. The three travel through the French country as quickly as possible to avoid being pursued. They encounter Neumann and they kill his troops, but put of mercy spare him. +

The three soldiers continue making their way to Les Arcs and agree to help French Resistance prisoners escape. They free the resistance prisoners; Philippe, Gustave and Jacques. The group arrives at Les Arcs and Jones spots a German Panzer IV and an armored half-track vehicle full of German troops about to leave, intending to attack the rest of the paratroopers. The three attempt to ambush the Germans, but are all badly wounded. After Curtis's death, Rossi regains consciousness and is approached by Neumann, who Jones spared earlier. Rossi gets up to fight but collapses due to his wounds. Neumann, also wounded, does not kill him, showing him the same mercy that Jones' showed him. +

He takes Rossi to an abandoned farm, where he bandages his wounds and makes him a meal. The following morning an American detachment discovers Rossi, alive, and Neumann, who has died from his wound. In a military field hospital Rossi is informed that sergeant Jones is alive but wounded and Curtis is dead. The dead Neumann remains in the abandoned farm. +

+

Cast[edit]

+
  • Corbin Allred as Corporal James Rossi
    • +
  • David Nibley as Sergeant Caleb Jones
    • +
  • Jasen Wade as Corporal Harland "Bud" Curtis
    • +
  • Lincoln Hoppe as Captain Erich Neumann
    • +
  • Nichelle Aiden as Charlotte
    • +
  • Virginie Fourtina Anderson as Emilie
    • +
  • Loïc Anthian as Phillipe
    • +
  • Lance Otto as Jacques
    • +
  • Erich Cannon as Gustave
    • +
  • Curt Doussett as Lt. Woodward
    • +
  • Calvin Harrison as Pvt. Stewart
+

Production[edit]

+

The director of Saints and Soldiers Ryan Little struggled with his producer Adam Abel to create a sequel to the film, because nearly all of his main characters died in the first film. However, due to the popularity of the first film, they decided to do a sequel.[1] The film was originally titled "Foxhole".[2] The film was based on the events surrounding the 517th Parachute Infantry Regiment, part of Operation Dragoon, which occurred two months after D-Day.[3] Specifically it was inspired by the true stories from L. Vaughn Curtis's book called Letters Home: A Paratrooper's Story, based on the experience and letters of Curtis's father Harland "Bud" Curtis.[4] They also adapted it from Little's short film The Last Good War for which Little won a student Emmy award. Corbin Allred was also cast in this film, but as a different character from the original. The film was shot in Utah on a tight budget and used volunteer World War II reenactors as many of the actors and extras.[1] +

+

Release and reception[edit]

+

Saints and Soldiers: Airborne Creed, was released on August 17, 2012.[5] The film received mixed reviews. The Evening Standard 's review described the film as "watchable but hardly memorable",[6] while The Guardian's critic Peter Bradshaw wrote the film was "well-acted" and "competently put together" but with "plenty of cliches", describing it as "a kind of diet or lite version of Steven Spielberg's Saving Private Ryan."[7] Deseret News stated that Airborne Creed is "less believable" than its predecessor. For example, scenes appear "staged" and "quickly thrown together".[3] However, they praise the acting.[3] KSL news stated that the film falls short of the original but is still, "packed with emotion and solid performances" and "beautiful cinematography."[8] +

+

See also[edit]

+ + +

Further reading[edit]

+
  • Kershaw, Alex (May 11, 2004). The Bedford Boys: One American Town's Ultimate D-day Sacrifice. Da Capo Press. ISBN 0-306-81355-6.
    • +
  • Lefebvre, Laurent (September 2008). 29th Division ... a division of heroes. American d-Day. ISBN 978-2-9519963-9-7.
    • +
  • Lefebvre, Laurent (June 1, 2004). They Were on Omaha Beach. American d-Day. ISBN 2-9519963-5-7.
+

References[edit]

+
+
    +
  1. ^ a b Means, Sean P. (August 15, 2012). "'Saints and Soldiers' sequel explores faith at war". The Salt Lake Tribune. Retrieved April 17, 2019. +
    2. +
  2. ^ Toone, Trent (August 14, 2014). "Actors, filmmakers celebrate Saints and Soldiers franchise with roundtable discussion". Deseret News. Deseret News Publishing Company. Retrieved April 12, 2019. +
    3. +
  3. ^ a b c O'Neill, Shawn (August 17, 2012). "'Saints and Soldiers: Airborne Creed' honors those who served". Deseret News. Deseret News Publishing Company. Retrieved April 17, 2019. +
    4. +
  4. ^ Curtis, L. Vaughn. "Letters Home: A Paratrooper's Story". The American Legion. Retrieved April 19, 2019. +
    5. +
  5. ^ Clyde, John (August 17, 2012). "'Saints and Soldiers: Airborne Creed' falls short of original but still delivers". KSL. KSL Broadcasting. Retrieved April 11, 2019. +
    6. +
  6. ^ "Also showing: Saints and Soldiers 2: Airborne Creed, The Campaign and Husbands". The Evening Standard. September 28, 2012. Retrieved April 19, 2019. +
    7. +
  7. ^ Peter Bradshaw (27 September 2012). "Saints and Soldiers: Airborne Creed – review". The Guardian. Retrieved 5 August 2016. +
    8. +
  8. ^ "'Saints and Soldiers: Airborne Creed' falls short of original but still delivers". KSL. Retrieved April 17, 2019. +
    9. +
+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Saints_and_Soldiers:_Airborne_Creed&oldid=1031623024"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/75.html b/content/corpora/75.html new file mode 100644 index 0000000..a2cde73 --- /dev/null +++ b/content/corpora/75.html @@ -0,0 +1,370 @@ + + + + +Oswald Junkes - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Oswald Junkes

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+
Oswald Junkes
Personal information
NationalityGerman
Born(1921-06-13)13 June 1921
Trier, Germany
Died2 November 1993(1993-11-02) (aged 72)
Newel, Germany
Sport
SportWeightlifting
+

Oswald Junkes (13 June 1921 – 2 November 1993) was a German weightlifter. He competed in the men's featherweight event at the 1952 Summer Olympics.[1] +

+

References[edit]

+
+
    +
  1. ^ Evans, Hilary; Gjerde, Arild; Heijmans, Jeroen; Mallon, Bill; et al. "Oswald Junkes Olympic Results". Olympics at Sports-Reference.com. Sports Reference LLC. Archived from the original on 17 April 2020. Retrieved 24 December 2019. +
    2. +
+
+
Stub icon

This biographical article relating to weightlifting in Germany is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Oswald_Junkes&oldid=958098047"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/76.html b/content/corpora/76.html new file mode 100644 index 0000000..810d71f --- /dev/null +++ b/content/corpora/76.html @@ -0,0 +1,596 @@ + + + + +Succinea sanctaehelenae - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Succinea sanctaehelenae

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Succinea sanctaehelenae +
Succinea sanctaehelenae 28438131.jpg +
+
+
Scientific classification +
Kingdom: +
Animalia
+
Phylum: +
Mollusca
+
Class: +
Gastropoda
+
(unranked): +
clade Heterobranchia
+

clade Euthyneura
clade Panpulmonata
+clade Eupulmonata
+clade Stylommatophora
+

+clade Elasmognatha
+
Superfamily: +
Succineoidea
+
Family: +
Succineidae
+
Subfamily: +
Succineinae
+
Genus: +
Succinea
+
Species: +
S. sanctaehelenae
+
Binomial name +
Succinea sanctaehelenae
Lesson, 1830
+
+

Succinea sanctaehelenae is a species of land snail in the family Succineidae, the amber snails. It is known commonly as the blushing snail.[2] It is endemic to the island of Saint Helena in the South Atlantic Ocean. +

+

References[edit]

+
+
    +
  1. ^ Mollusc Specialist Group (1996). "Succinea sanctaehelenae". IUCN Red List of Threatened Species. 1996: e.T21132A9249529. doi:10.2305/IUCN.UK.1996.RLTS.T21132A9249529.en. Retrieved 17 November 2021. +
    2. +
  2. ^ Pryce, D. Dry Gut (southern ridge) Invertebrate Survey. May, 2013. +
    3. +
+
+


+

+
Stub icon

This Succineidae-related article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Succinea_sanctaehelenae&oldid=1058804801"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/77.html b/content/corpora/77.html new file mode 100644 index 0000000..2f90151 --- /dev/null +++ b/content/corpora/77.html @@ -0,0 +1,1061 @@ + + + + +2011–12 BCHL season - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

2011–12 BCHL season

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
2011–12 BCHL Season
LeagueBritish Columbia Hockey League
SportHockey
DurationRegular season
2011-09-23 – 2012-03-11
Playoffs
2012-03-16 – 2013-04-11
Number of teams16
Finals championsPenticton Vees
BCHL seasons
+

The 2011–12 BCHL season marked the 50th anniversary of the British Columbia Hockey League (BCHL). The sixteen teams from the Coastal and Interior Conferences played 60 game schedules. +

Come March, the top teams from each division will play for the Fred Page Cup, the BCHL Championship. The winner of the Fred Page Cup plays the AJHL champion in a best-of-seven series for the right to represent the Pacific region in the Royal Bank Cup +

+ + +

Changes[edit]

+
  • The Fred Page Cup Playoffs have been reduced by one round. The top four teams from each conference will advance instead of the top six.
    • +
  • The Quesnel Millionaires moved to Chilliwack, becoming the Chilliwack Chiefs
    • +
  • In response to Chilliwack having a team again, the Langley Chiefs renamed themselves to the Langley Rivermen
+

Final standings[edit]

+

Note: GP = Games Played, W = Wins, L = Losses, T = Ties, OTL = Overtime Losses, Pts = Points +

+ + + + +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Interior Conference +
Team +Centre +W–L–T-OTL +Points +
Penticton VeesPenticton, BC54–4–0–2110 +
Merritt CentennialsMerritt, BC34–18–2–676 +
Prince George Spruce KingsPrince George, BC, BC33–21–2–472 +
Chilliwack ChiefsChilliwack, BC33–22–2–371 +
Vernon VipersVernon, BC30–27–1–263' +
Westside WarriorsWest Kelowna, BC22–29–2–753 +
Salmon Arm SilverbacksSalmon Arm, BC16–35–0–941 +
Trail Smoke EatersTrail, BC11–42–1–629 +
Coastal Conference +
Team +Centre +W–L–T-OTL +Points +
Powell River KingsPowell River, BC40–16–2–284 +
Surrey EaglesWhite Rock, BC36–15–2–781 +
Cowichan Valley CapitalsDuncan, BC36–16–1–780 +
Coquitlam ExpressCoquitlam, BC33–22–2–371 +
Nanaimo ClippersNanaimo, BC26–25–0–961 +
Alberni Valley BulldogsPort Alberni, BC22–34–2–248 +
Langley RivermenLangley Township, BC19–35–1–544 +
Victoria GrizzliesVictoria, BC21–38–1–643 +
+
+
  • Teams are listed on the official league website. [1]
+

2011–2012 BCHL Fred Page Cup Playoffs[edit]

+
Conference Semifinals +Conference Finals +Fred Page Cup Final +
         
1 +Penticton +4 +
4 +Chilliwack +2 +
1 +Penticton +4 +
Interior Conference +
2 +Merritt +1 +
2 +Merritt +4 +
3 +Prince George +0 +
1 +Penticton +4 +
+
2 +Powell River +0 +
1 +Powell River +4 +
4 +Coquitlam +2 +
1 +Powell River +4 +
Coastal Conference +
2 +Surrey +1 +
2 +Surrey +4 +
3 +Cowichan Valley +3 +
+

2012 Doyle Cup[edit]

+

The 2012 Doyle Cup was played between the BCHL Champion Penticton Vees, and the AJHL Champion Brooks Bandits +

+
Doyle Cup +
   
AB +Brooks +1 +
BC +Penticton +4 +
+

Game Results[edit]

+
  • Game 1: Penticton 7 – 2 Brooks
    • +
  • Game 2: Penticton 1 – 0 Brooks
    • +
  • Game 3: Brooks 4 – Penticton 3
    • +
  • Game 4: Brooks 1 – 6 Penticton
    • +
  • Game 5: Brooks 2 – 6 Penticton
+

Penticton would then move on to the 2012 Royal Bank Cup. They would win the national championship with a 4–3 win over the MHL champion Woodstock Slammers in the final. +

+

Scoring leaders[edit]

+

GP = Games Played, G = Goals, A = Assists, P = Points, PIM = Penalties in minutes +

+ + + + +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Player +Team +GP +G +A +Pts +PIM +
Paul De Jersey +Prince George Spruce Kings +59 +41 +57 +98 +58 +
Joey Bonik +Penticton Vees +60 +30 +66 +96 +29 +
Mario Lucia +Penticton Vees +56 +42 +52 +94 +42 +
Wade Murphy +Penticton Vees +60 +36 +55 +91 +66 +
Travis St. Denis +Penticton Vees +54 +37 +52 +89 +83 +
Alex Petan +Coquitlam Express +55 +38 +50 +88 +70 +
Connor Reilly +Penticton Vees +54 +35 +31 +86 +29 +
Mike Reilly +Penticton Vees +51 +24 +59 +86 +42 +
Steven Fogarty +Penticton Vees +60 +33 +49 +82 +32 +
Jujhar Khaira +Prince George Spruce Kings +54 +29 +50 +79 +69 +
+
+

Leading goaltenders[edit]

+

Note: GP = Games Played, Mins = Minutes Played, W = Wins, L = Losses, T = Ties, GA = Goals Against, SO = Shutouts, Sv% = Save Percentage, GAA = Goals against average. +Regulation losses and overtime losses have been combined for total losses. +

+ + + + +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Player +Team +GP +Mins +W +L +T +GA +SO +Sv% +GAA +
Michael Garteig +Penticton Vees +45 +2578 +41 +5 +0 +83 +5 +0.927 +1.93 +
Cole Huggins +Coquitlam Express +34 +1726 +21 +6 +2 +86 +2 +0.918 +2.99 +
Tyler Steel +Merritt Centennials +29 +1640 +15 +11 +1 +71 +3 +0.916 +2.60 +
Andrew Hunt +Surrey Eagles +52 +3079 +30 +19 +1 +150 +1 +0.913 +2.92 +
Sean Maguire +Powell River Kings +31 +1774 +17 +12 +1 +69 +3 +0.913 +2.33 +
+
+

Based on goaltenders with a minimum of 20 games. +

+

Award winners[edit]

+

With the exception of the Brett Hull Trophy and goaltender awards, each award is given to two players; One in each conference. +

+
  • Brett Hull Trophy (Top Scorer): Paul De Jersey (Prince George)
    • +
  • Best Defenceman: Craig Dalrymple (Powell River) & Mike Reilly (Penticton)
    • +
  • Bruce Allison Memorial Trophy (Rookie of the Year): Alexander Kerfoot (Coquitlam) & Mario Lucia (Penticton)
    • +
  • Bob Fenton Trophy (Most Sportsmanlike): Alexander Kerfoot (Coquitlam) & Regan Soquila (Merritt)
    • +
  • Top Goaltender: Michael Garteig (Penticton)
    • +
  • Wally Forslund Memorial Trophy (Best Goaltending Duo): Sean Maguire & Jonah Inoo (Powell River)
    • +
  • Vern Dye Memorial Trophy (Regular Season MVP): Alex Petan (Coquitlam) & Paul De Jersey (Prince George)
    • +
  • Joe Tennant Memorial Trophy (Coach of the Year): Matt Erhart (Surrey) & Fred Harbinson (Penticton)
    • +
  • Ron Boileau Memorial Trophy (Best Regular Season Record): Penticton Vees
    • +
  • Cliff McNabb Trophy (Coastal Conference Champions): Powell River Kings
    • +
  • Ryan Hatfield Trophy (Interior Conference Champions): Penticton Vees
    • +
  • Fred Page Cup (League Champions): Penticton Vees
+

Records broken[edit]

+

The Penticton Vees, with three NHL draftees on their squad, went on an unprecedented streak throughout the course of the season that saw multiple BCHL records fall: +

+
  • Winning streak: 42 (New BCHL record)
    • +
  • Points: 110 (New BCHL record for a 60-game season)
    • +
  • Wins: 54 (New BCHL record for a 60-game season)
+

Players selected in 2012 NHL Entry Draft[edit]

+ +

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ "British Columbia Hockey League (Design, Hosting, Registration & Administration tools by esportsdesk.com)". bchl.ca. Archived from the original on 2014-10-08. Retrieved 2014-04-17. +
    2. +
+

External links[edit]

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=2011–12_BCHL_season&oldid=1089249466"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/78.html b/content/corpora/78.html new file mode 100644 index 0000000..df01714 --- /dev/null +++ b/content/corpora/78.html @@ -0,0 +1,361 @@ + + + + +Bitterroot College - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Bitterroot College

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

Bitterroot College University of Montana is a public community college located in Hamilton, Montana, United States. Founded in 2009, the school is one of seven two-year institutions in the state that operate within the University of Montana System. The school offers an Associate of Arts degree and various certificate programs.[1] +

+

References[edit]

+
+
    +
  1. ^ "Bitterroot College". www.umt.edu. Retrieved 2017-08-01. +
    2. +
+

Coordinates: 46°14′46″N 114°10′05″W / 46.24612°N 114.16812°W / 46.24612; -114.16812 +


+

+

This article about a university or college in Montana is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Bitterroot_College&oldid=1075387190"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/79.html b/content/corpora/79.html new file mode 100644 index 0000000..aaf0910 --- /dev/null +++ b/content/corpora/79.html @@ -0,0 +1,413 @@ + + + + +Arsenio López - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Arsenio López

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
For other people named Alex Lopez, see Alex Lopez (disambiguation).
+
Arsenio López
Personal information
Full nameArsenio Alexander López
Rosario
Nickname(s)"Alex"
National team Puerto Rico
Born (1979-05-03) May 3, 1979 (age 43)
Humacao, Puerto Rico
Height1.91 m (6 ft 3 in)
Weight84 kg (185 lb)
Sport
SportSwimming
StrokesBreaststroke, medley
ClubBolles School Swim Club
College teamUniversity of Florida
CoachGregg Troy
+
+

Arsenio Alexander López Rosario (born May 3, 1979), also known as Alex Lopez, is a Puerto Rican former swimmer and three-time Olympian who specialized in breaststroke and individual medley events.[1] +

Lopez was born in Humacao, Puerto Rico. He attended the Bolles School in Jacksonville, Florida, where he was a member of the Bolles School Swimming Club. Lopez accepted an athletic scholarship to attend the University of Florida in Gainesville, Florida, where he competed for the Florida Gators swimming and diving team under coach Gregg Troy. He majored in civil engineering at the university. +

Lopez made his Olympic debut, as a 17-year-old teen, at the 1996 Summer Olympics in Atlanta. He failed to reach the top 16 final in any of his individual events, finishing twenty-seventh in the 200-meter individual medley (2:06.99) and twenty-fifth in the 400-meter individual medley (4:34.81).[2][3] He also placed seventeenth, as a member of the Puerto Rican team (including finalist Ricardo Busquets), in the 4×100-meter freestyle relay (3:28.27).[4] +

At the 2000 Summer Olympics in Sydney, Lopez decided to drop two of his events from Atlanta and experiment with the 100-meter breaststroke. He finished in a first-place tie with Latvia's Valērijs Kalmikovs on the fourth heat with a time of 1:04.02.[5] In the 200-meter individual medley, he raced to a fourth seed in heat three by 0.07 seconds behind South Korea's Han Kyu-Chul in 2:06.49.[6] Lopez did not qualify for the semifinals, finishing thirty-fourth each in all of his events from the heats. +

Lopez shortened his program at the 2004 Summer Olympics in Athens, when he swam only for the 100-meter breaststroke. He cleared a FINA B-standard entry time of 1:04.01 from the 2003 Pan American Games in Santo Domingo, Dominican Republic.[7] He challenged seven other swimmers in the same heat as Sydney, including four-time Olympian Ratapong Sirisanont (Thailand), who was later disqualified for a false start. Lopez posted a time of 1:03.99 to take a second seed by a 1.02-second margin behind winner Jakob Johann Sveinsson of Iceland. Lopez ended his third Olympic stint by sharing a thirty-fifth place tie with New Zealand's Ben Labowitch on the morning prelims.[8][9] +

+

See also[edit]

+ + +

References[edit]

+
+
    +
  1. ^ Evans, Hilary; Gjerde, Arild; Heijmans, Jeroen; Mallon, Bill; et al. "Arsenio López". Olympics at Sports-Reference.com. Sports Reference LLC. Archived from the original on 18 April 2020. Retrieved 5 May 2013. +
    2. +
  2. ^ "Atlanta 1996: Aquatics (Swimming) – Men's 200m Individual Medley Heat 2" (PDF). Atlanta 1996. LA84 Foundation. p. 48. Archived from the original (PDF) on 23 May 2011. Retrieved 28 April 2013. +
    3. +
  3. ^ "Atlanta 1996: Aquatics (Swimming) – Men's 400m Individual Medley Heat 1" (PDF). Atlanta 1996. LA84 Foundation. p. 50. Archived from the original (PDF) on 23 May 2011. Retrieved 28 April 2013. +
    4. +
  4. ^ "Atlanta 1996: Aquatics (Swimming) – Men's 4×100m Freestyle Relay Heat 3" (PDF). Atlanta 1996. LA84 Foundation. p. 51. Archived from the original (PDF) on 23 May 2011. Retrieved 28 April 2013. +
    5. +
  5. ^ "Sydney 2000: Swimming – Men's 100m Breaststroke Heat 4" (PDF). Sydney 2000. LA84 Foundation. p. 240. Archived from the original (PDF) on 19 August 2011. Retrieved 19 April 2013. +
    6. +
  6. ^ "Sydney 2000: Swimming – Men's 200m Individual Medley Heat 3" (PDF). Sydney 2000. LA84 Foundation. p. 308. Archived from the original (PDF) on 19 August 2011. Retrieved 23 April 2013. +
    7. +
  7. ^ "Swimming – Men's 100m Breaststroke Startlist (Heat 4)" (PDF). Athens 2004. Omega Timing. Retrieved 24 March 2013. +
    8. +
  8. ^ "Men's 100m Breaststroke Heat 4". Athens 2004. BBC Sport. 14 August 2004. Retrieved 31 January 2013. +
    9. +
  9. ^ Whitten, Phillip (14 August 2004). "Prelims, Men's 100 Breaststroke: Kitajima, Hansen Qualify One-Two; Japanese Sets Olympic Record". Swimming World Magazine. Archived from the original on 3 December 2013. Retrieved 19 April 2013. +
    10. +
+

External links[edit]

+ +
+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Arsenio_López&oldid=1014623101"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/8.html b/content/corpora/8.html new file mode 100644 index 0000000..ecd59c5 --- /dev/null +++ b/content/corpora/8.html @@ -0,0 +1,427 @@ + + + + +Bala, Ahor - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Bala, Ahor

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+ +

+
Bala
Village
Bala Rawla.jpg
Bala is located in Rajasthan
Bala
Bala
Location in Rajasthan, India
Bala is located in India
Bala
Bala
Bala (India)
Bala is located in India
Bala
Bala
Bala (India)
Coordinates: 25°37′21″N 72°45′23″E / 25.6225748°N 72.7562804°E / 25.6225748; 72.7562804Coordinates: 25°37′21″N 72°45′23″E / 25.6225748°N 72.7562804°E / 25.6225748; 72.7562804
StateRajasthan
DistrictJalor
Founded byRathores of Jodhpur State
Government
 • BodyPanchayati raj (India)
Elevation
163 m (535 ft)
Population
 (2011)
 • Total4,264
Languages
 • OfficialHindi , Marwari
PIN
02978
ISO 3166 codeRJ-IN
Vehicle registrationRJ-16
Sex ratio1056♂/♀
+

Bala is a village and a Gram Panchayat in the Ahore Tehsil of Jalore district of Rajasthan in northwest India. +

+

Geography[edit]

+

Bala is located in Ahor, Tehsil in the Jalore district of Rajasthan.[1] It has an average elevation of 163 m (535 ft). It is located 38 kilometers north of the district headquarters in Jalore, 27 kilometers from Ahore and 394 kilometers from the state capital, Jaipur. +

+

Demographics[edit]

+

According to a 2011 census, the population of Bala is 4,264. At the time of the census, there were 2,074 men and 2,190 women. Children ages 0 to 6 make up 14.66 percent of the total population. The average sex ratio of Bala village is 1,056, which is higher than the Rajasthan state average of 928. The sex ratio among children is 959 which is higher than the Rajasthan average of 888. +

Bala village has a lower literacy rate than that of the Rajasthan's average. In 2011, the literacy rate of Bala village was 58.97 percent, compared to 66.11 percent of Rajasthan. In Bala, literacy stands at 71.17 percent among men and 47.61 percent among women. +

+

References[edit]

+
+
    +
  1. ^ "Falling Rain Genomics, Inc – Ahor". Archived from the original on 4 December 2008. Retrieved 3 September 2008. +
    2. +
+
+


+

+
Stub icon

This article related to a location in Rajasthan is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Bala,_Ahor&oldid=1090360596"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/80.html b/content/corpora/80.html new file mode 100644 index 0000000..b5aa181 --- /dev/null +++ b/content/corpora/80.html @@ -0,0 +1,449 @@ + + + + +Dungeness River Bridge - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Dungeness River Bridge

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Dungeness River Bridge
Dungeness River Bridge.jpg
Coordinates48°05′07″N 123°08′53″W / 48.0853°N 123.148°W / 48.0853; -123.148
CarriesPedestrians
CrossesDungeness River
LocaleSequim, Washington
Heritage statusNRHP
Characteristics
DesignHowe through truss
MaterialTimber
History
Construction end1930
Dungeness River Bridge
+
Dungeness River Bridge 2.jpg
Dungeness River Bridge is located in Washington (state)
Dungeness River Bridge
LocationRailroad Bridge Park, at end of West Hendrickson Road
Nearest citySequim, Washington
Coordinates48°05′07″N 123°08′52″W / 48.08534°N 123.14788°W / 48.08534; -123.14788Coordinates: 48°05′07″N 123°08′52″W / 48.08534°N 123.14788°W / 48.08534; -123.14788
Built1930
ArchitectChicago, Milwaukee, St. Paul and Pacific Railroad
Architectural styletimber Howe through truss
MPSHistoric Bridges/Tunnels in Washington State TR
NRHP reference No.82004201
Added to NRHPJuly 16, 1982
+
Location
+

The Dungeness River Bridge is the centerpiece of Railroad Bridge Park near the town of Sequim, Washington. It crosses the Dungeness River. The bridge was first constructed by the Seattle, Port Angeles, and Western Railway, a subsidiary of the Chicago, Milwaukee, St. Paul and Pacific Railroad (also known as the Milwaukee Road) in 1916. Because of the ready availability of timber, the bridge was built of wood. This first bridge was replaced in 1930. The new bridge was also built of timber, and like its predecessor, is a through Howe truss 156 feet long and 22 feet high. Two wooden trestles are on the east and west approaches.[1] +

After the Milwaukee Road's bankruptcy, the bridge was left abandoned. In 1992, volunteers began to work on the bridge and replace planking and created a bike trail. In 1995, the property surrounding the bridge was purchased by the Washington State Audubon Society, which then created the Dungeness River Center and a park, called Railroad Bridge Park. The bike path through the park and over the bridge is connected to the Olympic Discovery Trail, a rails-to-trails initiative. +

The bridge was listed in the National Register of Historic Places due to its being one of the last timber Howe through-truss railroad bridges still remaining in Washington. +

In February 2015, due to high winds and rainfall, the Bridge's center collapsed. The repaired and improved bridge was reopened in March 2016.[2] +

+

References[edit]

+

Notes +

+
+
    +
  1. ^ "Nomination Form for Dungeness River Bridge". National Park Service. +
    2. +
  2. ^ "Major trail link is back on line". Sequim Gazette. Sequim Gazette. 30 March 2016. Retrieved 11 April 2016. +
    3. +
+

Bibliography +

+
  • Soderberg, Lisa. Dungeness River Bridge. OAHP Inventory, Office of Archaeology and Historic Preservation, Olympia Washington. 1979. On file at the National Park Service, Washington, DC.
    • +
  • Soderberg, Lisa. Historic Bridges and Tunnels in Washington State Thematic Resources. National Register of Historic Places Inventory - Nomination Form. On file at the National Park Service, Washington DC.
+

External links[edit]

+

Media related to Dungeness River Bridge at Wikimedia Commons +

+ +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Dungeness_River_Bridge&oldid=1014869582"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/81.html b/content/corpora/81.html new file mode 100644 index 0000000..c7d16d7 --- /dev/null +++ b/content/corpora/81.html @@ -0,0 +1,578 @@ + + + + +Harpalus pallidipennis - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Harpalus pallidipennis

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Harpalus pallidipennis +
Scientific classification edit +
Kingdom: +Animalia +
Phylum: +Arthropoda +
Class: +Insecta +
Order: +Coleoptera +
Family: +Carabidae +
Subfamily: +Harpalinae +
Tribe: +Harpalini +
Genus: +Harpalus +
Species: +
H. pallidipennis
+
Binomial name +
Harpalus pallidipennis
A. Morawitz, 1862
+
+

Harpalus pallidipennis is a species of ground beetle in the subfamily Harpalinae.[1] It was described by A. Morawitz in 1862.[1] +

+

References[edit]

+
+
    +
  1. ^ a b "Harpalus Latreille, 1802: 92". Carabidae of the World. 2011. Retrieved 28 July 2013. +
    2. +
+
+


+

+

This Harpalus article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Harpalus_pallidipennis&oldid=1008505145"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/82.html b/content/corpora/82.html new file mode 100644 index 0000000..68b1698 --- /dev/null +++ b/content/corpora/82.html @@ -0,0 +1,676 @@ + + + + +Mechack Jérôme - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Mechack Jérôme

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
Mechack Jérôme
+Mechack Jérôme.jpg
Jérôme with Haiti in 2017
Personal information
Date of birth + (1990-04-21) April 21, 1990 (age 32)[1]
Place of birth +Liancourt, Haiti
Height +5 ft 10 in (1.78 m)
Position(s) +Defender
Club information
Current team
 +Indy Eleven
Number +4
Senior career*
Years +Team +Apps +(Gls)
2006–2009 +Baltimore + +
2009–2010 +Mirandela +4 +(0)
2010 +Austin Aztex +3 +(0)
2011–2012 +Orlando City +34 +(2)
2013–2014 +Sporting Kansas City +12 +(0)
2014 +Montreal Impact +0 +(0)
2015 +Charlotte Independence +17 +(0)
2015–2018 +Jacksonville Armada +81 +(3)
2019–2021 +El Paso Locomotive +51 +(0)
2022– +Indy Eleven +0 +(0)
National team‡
2008– +Haiti +76 +(4)
+*Club domestic league appearances and goals, correct as of November 7, 2021
‡ National team caps and goals, correct as of February 1, 2017
+

Mechack Jérôme (born April 21, 1990) is a Haitian professional footballer who plays for Indy Eleven in the USL Championship. +

+ + +

Club career[edit]

+

Jérôme played for Baltimore in the Ligue Haïtienne, and then for Mirandela in the Portuguese Second Division, before being spotted by Austin Aztex head coach Adrian Heath while playing for the Haiti national team in a friendly match against the Aztex on April 28, 2010. +

Jérôme signed for the Aztex in June 2010 and made his debut for the team on September 11, 2010 in a 3–1 loss to the Puerto Rico Islanders.[2] Prior to the 2011 season, new owners purchased the club, moved it to Orlando, Florida, renamed it Orlando City and joined the USL Pro league for 2011. +

He signed a multi-year contract with Orlando City on September 1, 2011.[3] +

Jérôme was signed by Sporting Kansas City of Major League Soccer on February 28, 2013.[4] The club released him on March 31, 2014.[5] +

On June 6, 2014 he signed with Montreal Impact.[6] He was released three weeks later.[7] +

Jérôme signed with Charlotte Independence of United Soccer League on May 1, 2015.[8] He then signed with Jacksonville Armada FC of the North American Soccer League in September 2015.[9] Two months later he re-signed with Jacksonville for the 2016 season.[10] +

Jérôme signed with USL Championship expansion club El Paso Locomotive on January 21, 2019.[11] El Paso re-signed Jérôme for the 2020 season on November 21.[12] +

In December 2021, it was announced Jérôme would make the move to Indy Eleven ahead of the 2022 season.[13] +

+

International career[edit]

+

Jerome played for Haiti at the 2007 CONCACAF U17 Tournament and the 2007 FIFA U-17 World Cup, before making his debut for the full senior Haiti national team in 2008. He was part of the Haiti squad which competed in the 2008 Caribbean Championship, and helped his country qualify for the 2009 CONCACAF Gold Cup. +

+

Career statistics[edit]

+
Scores and results list Haiti's goal tally first, score column indicates score after each Jérôme goal.
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
List of international goals scored by Mechack Jérôme[14] +
No. +Date +Venue +Opponent +Score +Result +Competition +
118 November 2014Montego Bay Sports Complex, Montego Bay, Jamaica Cuba1–02–12014 Caribbean Cup +
24 September 2015Grenada National Stadium, St. George's, Grenada Grenada2–13–12018 FIFA World Cup qualification +
39 November 2016Stade Sylvio Cator, Port-au-Prince, Haiti French Guiana1–02–52017 Caribbean Cup qualification +
411 June 2019Centro de Alto Rendimiento, Alajuela, Costa Rica Guyana1–03–1Friendly +
+

Honours[edit]

+

Baltimore SC +

+ +

Orlando City +

+ +

Sporting Kansas City +

+ +

References[edit]

+
+
    +
  1. ^ "FIFA Tournaments - Players & Coaches - Mechack JEROME". February 19, 2019. Archived from the original on 19 February 2019. +
    2. +
  2. ^ "USSF Division-2 Pro League". demosphere.com. +
    3. +
  3. ^ "Archived copy". Archived from the original on 2012-05-24. Retrieved 2011-09-02.{{cite web}}: CS1 maint: archived copy as title (link) +
    4. +
  4. ^ "Sporting Kansas City signs Christian Duke, Mechack Jerome - ESPN FC". ESPNFC.com. +
    5. +
  5. ^ "Sporting KC waives Mechack Jerome". Sporting Kansas City. +
    6. +
  6. ^ "Impact signs defender Mechack Jérôme". Montreal Impact. +
    7. +
  7. ^ "Impact signs Polish left back Krzysztof Krol". Montreal Impact. +
    8. +
  8. ^ "Independence Shores Up Defense With Addition Of Mechack Jérôme". Charlotte Independence. Archived from the original on 2015-11-17. Retrieved 2015-11-14. +
    9. +
  9. ^ "Armada FC Signs Haitian National Defender Mechack Jérôme". armadafc.com. +
    10. +
  10. ^ "Mechack Jérôme Re-signs With Armada FC". armadafc.com. +
    11. +
  11. ^ "EL PASO LOCOMOTIVE FC SIGNS HAITIAN INTERNATIONAL DEFENDER, MECHACK JÉRÔME". January 21, 2019. +
    12. +
  12. ^ "Haitian National Team veteran Mechack Jérôme returning to Locomotive FC for 2020". November 21, 2019. +
    13. +
  13. ^ USLChampionship com Staff (December 3, 2021). "Indy Announces Arrival of Rebellon, Jerome for 2022 Season". USL Championship. +
    14. +
  14. ^ "Jérôme, Mechack". National Football Teams. Retrieved 1 February 2017. +
    15. +
+

External links[edit]

+ +
+
+


+

+
Flag of HaitiSoccer icon

This biographical article related to Haitian association football is a stub. You can help Wikipedia by expanding it.

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Mechack_Jérôme&oldid=1077625615"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/83.html b/content/corpora/83.html new file mode 100644 index 0000000..55434bd --- /dev/null +++ b/content/corpora/83.html @@ -0,0 +1,420 @@ + + + + +List of cities and towns in Sokoto State - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

List of cities and towns in Sokoto State

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+

This is a list of populated places in Sokoto State, Nigeria. It is not complete but includes the most populated cities, towns and villages. +

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=List_of_cities_and_towns_in_Sokoto_State&oldid=1081961315"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/84.html b/content/corpora/84.html new file mode 100644 index 0000000..ca9c865 --- /dev/null +++ b/content/corpora/84.html @@ -0,0 +1,361 @@ + + + + +Yin Qing - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Yin Qing

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
In this Chinese name, the family name is Yin.
+

Yin, Qing (Chinese: 印青; pinyin: Yìn Qīng) is a Chinese composer. His folk-music based opera The Ballad of Canal (2012) was the first modern opera based on folk music themes produced by the NCPA.[1] +

+

References[edit]

+
+
    +
  1. ^ "NCPA Original Opera - The Ballad of Canal Will Debut". Chinaculture.org. 2012-06-18. Retrieved 2012-12-23. +
    2. +
+


+

+
Stub icon

This article about a Chinese composer is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Yin_Qing&oldid=1010822724"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/85.html b/content/corpora/85.html new file mode 100644 index 0000000..ca6d975 --- /dev/null +++ b/content/corpora/85.html @@ -0,0 +1,364 @@ + + + + +Danish Aviation Systems - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Danish Aviation Systems

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Danish Aviation Systems ApS.
TypePrivate
GenreAviation
Founded2009
HeadquartersRoskilde, Denmark
Key people
Steven Friberg (CEO)
Productsunmanned aerial vehicless, Research and development
WebsiteDanish Aviation Systems official website
+

Danish Aviation Systems is a Danish supplier and developer of unmanned aerial vehicles.[1][2] +

+

References[edit]

+
+
    +
  1. ^ Kenan Seeberg (12 April 2010). "DR vil have fjernstyrede droner - Danmark". BT.dk. Retrieved 2010-07-27. +
    2. +
  2. ^ Thomas Djursing (12 April 2010). "Billig minidrone åbner for et væld af civile anvendelser | Ingeniøren". Ing.dk. Retrieved 2010-07-27. +
    3. +
+

External links[edit]

+ +


+

+
Stub icon

This article on an unmanned aerial vehicle is a stub. You can help Wikipedia by expanding it.

+
Stub icon

This Danish corporation or company article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Danish_Aviation_Systems&oldid=1045198642"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/86.html b/content/corpora/86.html new file mode 100644 index 0000000..6069a79 --- /dev/null +++ b/content/corpora/86.html @@ -0,0 +1,501 @@ + + + + +The White Bird and His Wife - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

The White Bird and His Wife

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

The White Bird and His Wife is an East Asian folktale published as part of the compilation of The Bewitched Corpse. Scholars related it to the cycle of the animal bridegroom: a human woman that marries a supernatural husband in animal form and, after losing him, has to seek him out. +

+ + +

Origin[edit]

+

The Tales of the Bewitched Corpse is a compilation of Indo-Tibetan stories that was later brought to Mongolia and translated to Mongolic languages.[1][2] The collection is known in India as Vetala Pañcaviṃśati, in Tibet as Ro-sgrung,[3] in Mongolia as Siditü kegür, and in Oirat as Siddhi kǖr.[4][5] +

+

Summary[edit]

+
The girl finds the cage with her husband's bird-soul locked inside. Illustration by Maurice Day for Wonder Tales from Tibet (1922).
+

The following summary is based on Rachel Harriette Busk's[6] and Bernhard Jülg [de]'s translations of the story.[7] +

In a distant kingdom called Fair-flower-garden, a man lives with his three daughters grazing their goat herds. One day, the goats vanish, and the elder daughter goes to look for them. She finds a large red door and goes through, then a gate of mother-of-pearl and another of emerald. A white bird[a] appears to her and tells her that he can show where her herds are, as long as she consents to marry him. The elder daughter refuses. +

The next day, the middle daughter goes to look for the goats, and the same bird appears with the same proposal. She also refuses. The following day, the youngest daughter goes to look for her goats, and bird appears to her. The youngest believes its words and agrees to marry him. +

Some time after, a large gathering is happening near a local temple, and will last 13 days. The white bird's wife joins the people as the loveliest woman in the gathering. A mysterious rider on a dappled gray horse also joins the people. The white bird's wife goes back to the bird's palace and tells her husband about the rider at the gathering. +

This goes on for the next days. On the 12th day of the gathering, the white bird's wife pours out her heart to an old woman about the mysterious rider. The old woman advises the girl to pretend to go to the gathering, wait for her husband to take off the birdskin, assume human form and ride to the festival on his dappled gray horse. +

On the 13th day, the girl waits until her husband becomes human and leaveson his horse, then burns the perch, the birdcage and the featherskin. Later, after her husband returns, the girl tells him that she burned his featherskin and the cage, to keep him in human form permanently. Her husband despair at her action, because his soul was inside the cage, and now "gods and dæmons" will come for him. The only solution is for her to stand the gate of mother-of-pearl and hew a stick for seven days and seven nights, without interruption. +

The girl gets some motes of feather-grass to apply to her eyelids. She resists for seven days, but, on the seventh night, the motes of grass come off her eyes and she fails the task, thus allowing her husband to be taken. She then goes looking for him anywhete between the heavens and the earth. +

One day, she hears his voice coming from up in the mountains. She follows it until she reaches a stream, where she finds her husband, carrying pairs of boots on his back. He explains that the gods and demons made him their water-carrier, and the worn-out boots indicate that he has been like this for some time. The girl asks what she can do to rescue him, and her husband tells her to build a new birdcage and to woo his soul back into it. +

+

Variants[edit]

+

In the translated version by Charles John Tibbitts with the title The Bird-Man, a father lives with his three daughters, who herds their calves; the sisters pass through a golden door, a silver door and a brazen door and find the bird; the youngest sister marries the bird. During the 13 days' feast around the large pagoda in the neighbourhood, the bird, in human form, rides a white horse, and his wife burns his birdhouse, which was the husband's soul. When the wife finally finds him again after he disappears, he explains that he is forced to draw water for the Tschadkurrs and the Tângâri. The wife saves him by building a new birdhouse.[10] +

+

Mongolia[edit]

+

According to Hungarian orientalist László L. Lőrincz, all Mongolian versions of The Bewitched Corpse contain 13 tales. The seventh tale of the compilation is titled Sibaɣun ger-tü ("The Man in the Form of a Bird").[11] In a 1959 publication of Mongolian fairy tales, a variant was published as its eighth tale, whose translated title is Histoire de la femme dont le mari était un coq ("The story of the girl whose husband is a rooster").[12] +

Russian Mongolist Boris Ya. Vladimirtsov [ru] translated and published in 1958 a Mongol-Oirat version of The Bewitched Corpse, whose seventh tale is titled "Имеющий птичью оболочку" ("Having a Bird Skin"): the man and his three daughters live in a place called Jirgalangiin-ӧy. Later in the tale, the youngest daughter marries the bird and burns his birdskin to keep him human forever, but he explains to her that his life was in the birdskin.[13] +

+

Kalmyk people[edit]

+

Baira Goryaeva, expert on Kalmyk folklore, grouped tales about lost spouses (husbands and wives) under the same type of the Kalmyk tale corpus: type 400/1, "Муж ищет исчезнувшую или похищенную жену (жена ищет мужа)" ("Man searching for lost wife/Wife searching for lost husband"). She noted that the Mongol-Oirat tale "Имеющий птичью оболочку" fit the tale type she abstracted.[14] +

Charles Fillingham Coxwell [de] translated a Kalmyk variant with the title The Story of the Bird-Cage Husband: an old man lives with his three daughters in the "Land of the Lustrous Flower Gardens", and they spend their days grazing their buffalo. One day, their animal disappears. The elder sisters goes looking for it and reaches a large red portal that leads to a court. She passes by the red portal, then by a gate of mother-of-pearl and finally by a gate of emerald, and finds herself in a grand palace with a little bird sitting on a table. The little bird tells her it can reveal the fate of the buffalo, in exchange for her marrying him. She refuses. The middle sister passes by the same three portals and declines the same offer. The youngest sister agrees to become the bird's wife, and it returns the buffalo to her family. Some time later, an assembly of people gathers as part of a 13 days' visit to a divine image in a monastery. The girl goes to the assembly and sees a fine youth on a blue-gray horse. The girl returns home and tells her little bird husband about the youth. This goes on for 11 days. On the 12th day of the assembly, an old woman tells the girl the youth on the horse is her husband, and that she should toss her husband's bird-cage into the fire. The girl follows the old woman's instructions. Later that night, the husband returns and she tells him about the bird-cage. The husband despairs at the fact and gives his wife a stick, for her to beat herself with it near the gate of mother-of-pearl for seven days and nights until his battle with the demons ceases. The girl obeys and resists for 6 days and nights, until, on the 7th day, she tires and her husband is taken by the demons. The girl searches for her husband, until she hears his voice in a mountain and in the depths of a river. Finding her husband near a pile of stones, he tells her he has become a water-carrier for "gods and demons" and that she can save him by building another bird-cage, then vanishes. Heeding his words, the girl returns to their home, fashions a new bird-cage and "invites her husband's soul" to enter it.[15] +

Austrian journalist Adolf Gelber [de] translated the tale as Das Geheimnis des weißen Vogels ("The Secret of the White Bird"). In his translation, the third sister goes through the red gate, the gates of gold, mother-of-pearl and emerald and finds the bird; the girl agrees to be the bird's wife and returns the buffalo to her father. After the girl burns her husband's featherskin, her husband, in human form, tells her that the old woman was a messenger from the gods and devils. After the husband disappears, the old woman comes and advises the girl to keep looking for her husband. At the end of the tale, the girl is risen to the sky and meets her husband there.[16] +

German theologue Johann Andreas Christian Löhr [de] translated the Kalmyk tale as Die weiße Eule ("The White Owl"), wherein the bird the maiden marries is explicitly identified as a white owl.[17] +

+

Tibet[edit]

+

Tibetologist August Hermann Francke, in a 1923 article, reported the existence of Tibetan manuscript from the Bar-bog family from Lahul. The manuscript, titled Ňos-grub-can-gyi-sgruns, contained 13 tales, the seventh named Bya-shubs-rgyal-po (German: der König in Vogelgestalt; English: "The King in Bird-form").[18] +

According to Lörincz, M. K. Kolmaš provided the Eötvös Loránd University with a microfilm of a xylography from East Tibet. The xylographic version contained 16 tales, the ninth tale titled Rgyal-bu bya-šubs-čan-kyi leu'ste (French: Histoire du prince au corps d'oiseau; "Story of the Prince with the body of a bird").[19] Lörincz also distinguishes between literary and folkloric (oral) versions of the tale: in the Tibetan redaction, the bird is identified as a rooster; in the literary versions, the three girls search for the lost cattle, whereas in oral versions the cattle just disappears.[20] +

In a variant translated as "Царевич в птичьей оболочке" ("The Prince in Bird Skin") or The Feathered Prince,[21] three orphaned sisters live together and earn their living by milking their female buffalo and selling its milk and butter. One day, the animal disappears, and the elder sister goes looking for it. After a while, she sits by a rock near a cave. A little bird appears to her and begs for some food, and asks her to marry it. The elder sister refuses and returns home. The next day, the middle sister goes to look for the animal and rests by the same stone, and the same white bird propositions her, but she declines. Lastly, the youngest sister agrees to marry the white bird, and he directs her into the cave. Inside, magnificent and richly decorated rooms appear before her with every door she opens. At last, the little bird perches upon a couch and tells her that their buffalo was devoured by an evil raksha. The girl begins to live there as the white bird's wife, tidying the place and preparing the food. Some time later, a festival is held in a nearby village, with musicians, equestrian games, and all sorts of amusement. The white bird's wife goes to the festival, and sees a handsome youth on a gray horse, who gazes at her. The girl leaves the festival and meets an old woman. The girl pours out her woes to her, lamenting over the fact that her husband is just a little bird, but the old woman reassures her that the youth at the festival was her husband, and that she only has to burn his bird disguise the next time. The girl follows the old woman's instructions the next day, and burns the bird skin. The same night, her husband (in human form) comes home and asks her about the bird skin. The girl tells him she burned the birdskin, and the man reveals he is a prince, and that the birdskin was to protect him from an evil witch. Saying this, a whirlwind comes and takes the prince. The girl tries to find him and wanders through valleys and deserts, until she finds him one day near a temple, carrying jugs of water and wearing faded boots. The prince tells her to get feathers from all species of bird for a new bird coat, and, once she has fashioned it, she must chant a special prayer for him to return to her. Saying his, he disappears. The girl returns to their cave palace and gathers all feathers she can must, fashions a new bird skin and chants the correct chant to summon her husband back to her. He appears and both live happily.[22] +

In a variant published by Tibetologist David MacDonald with the title The Story of the Bird who turned into a Prince, in the land of Mo-tshul, a old farmer lives with his three daughters; the three sisters pass by a red door, a gold door and a turquoise door and meet the bird on a throne; the youngest sister marries the bird and burns his feathered cloak; she does penance to try to save her husband by standing at a door and turning a "devil-stick" or "devil-rod"; after her husband vanishes, she finds him in the summit of a hill, and he explains he must wear out a pair of boots by traveling at the behest of the devils. She saves her husband by fashioning a new feathered cloak and by saying fervent prayers, until he appears at their door.[23] +

Author Eleanore Myers Jewett translated the tale as The White Bird's Wife and sourced it from Tibet. In her translation, the youngest daughter is named Ananda.[24] +

+

Buryat people[edit]

+

Researcher Nadežda Šarakšinova reported a Buryat language translation of The Bewitched Corpse with 22 tales. In this version, the tale is numbered 5 and its title is translated as The Woman who Had a Bird Husband.[25] +

+

Romani people[edit]

+

Transylvania linguist Heinrich von Wlislocki collected a Romani tale from Siebenbürgen (Transylvania), which he considered to be related to the tale from the Siddi-Kur. In the Romani tale, titled O coro rom te pinsteri or Der arme Zigeuner und die Taube ("The Poor Gypsy Man and the Dove"), a father lives with his three sons who work for a local lord, the eldest grazes the horses, the middle one the cattle and the youngest the pigs. When the horses vanish one day, the eldest tries to find them and passes through a set of doors: a wooden one, an iron one, a silver one, then a golden one, and sees a white dove on a table. The dove talks to him and says it can find the horse if the boy marries her. He declines, telling her that he already has a sweetheart. The same thing happens to the middle brother. When the youngest brother meets the white dove, the boy agrees to marry her. He begins to live with the dove, eating the best food and drinking the best drinks, until he gets bored and wishes to see human people again. The dove tells him that the king will be part of a three day festival in the plains, and he can go there to have fun. The boy finds some money and buys finer clothes to join the people at the festival. When night comes, a young woman clad in golden clothes appears and enjoys the festivities. After the boy returns to the dove, he tells the bird about the maiden at the festival. The next day, the boy sits on a rock by the stream and sighs over the golden maiden. A frog tells him that the golden maiden is the white dove, changed into an animal by an evil sorcerer, and that he can burn her dove feathers when she goes to the festival. That night, the boy waits for his wife to go to the festival and burns the dove feathers. He breaks the enchantment and lives happily with his wife.[26] +

+

Analysis[edit]

+

Tale type[edit]

+

The tale has been related by scholarship to the international tale type ATU 425, "The Search for the Lost Husband", of the international Aarne-Thompson-Uther Index.[27][28] These tales refer to a marriage between a human woman and a husband of supernatural origin that appears in animal shape. Sometimes the human wife tries to break the enchantment by destroying the husband's animal skin, but he vanishes and she must undergo a penance to get her husband back.[29] +

According to philologist researcher Irina S. Nadbitova, from the Kalmyk Institute for Humanities research RAS, a similar narrative exists in the Kalmyk Folktale Corpus, with two variants she listed. Nadbitova classified it as type 432, "Финист – ясный сокол" ("Finist, the Bright Falcon", the name of a Russian fairy tale).[30] +

+

Related tales[edit]

+

According to Lörincz, in a Tibetan language translation of The Bewitched Corpse, titled Ro-sgruṅ (published by professor Damdinsuren), tales nr. 4 and nr. 9 (out of 21 of the compilation) are tales about animal husbands. As such, they can be classified as tale type ATU 425 and its subtypes.[31] +

Hungarian Mongolist Ágnes Birtalan [hu] translated the tales collected by linguist Gábor Bálint [hu] in the 19th century from Kalmyk sources. The third tale of his collection, named Moγǟ köwǖn ("The snake-lad") by Birtalan, also contains the animal husband (a snake), his disappearance and later the wife's quest for him.[32] +

+

See also[edit]

+ +

Footnotes[edit]

+
+
    +
  1. ^ In an early 19th century publication by German priest Benjamin Fürchtegott von Bergmann, he claimed that the original language word was Zagaom Schabucha, referring to a species of great owl.[8][9] +
    2. +
+

References[edit]

+
+
    +
  1. ^ de Rachewiltz, Igor; and Rybatzki, Volker. Introduction to Altaic Philology. Leiden, The Netherlands: Brill, 31 May. 2010. pp. 227, 233. doi: https://doi.org/10.1163/ej.9789004185289.i-524 +
    2. +
  2. ^ Kára, G. "Mongolian Literature". In: Turkic and Mongolian Literature. History of civilizations of Central Asia, v. 5. UNESCO. p. 738. ISBN 978-92-3-103876-1. +
    3. +
  3. ^ Francke, A. H. “Die Geschichten Des Toten Ṅo-Rub-Can. Eine Tibetische Form Der Vetālapañcavimśatikā Aus Purig”. In: Zeitschrift Der Deutschen Morgenländischen Gesellschaft 75 (1921): 72–74. http://www.jstor.org/stable/43373227. +
    4. +
  4. ^ de Rachewiltz, Igor; and Rybatzki, Volker. Introduction to Altaic Philology. Leiden, The Netherlands: Brill, 31 May. 2010. pp. 227, 233. doi: https://doi.org/10.1163/ej.9789004185289.i-524 +
    5. +
  5. ^ Kára, G. "Tibetan and Mongolian Literature". In: History of civilizations of Central Asia. UNESCO, 2000. p. 386. ISBN 92-3-103654-8. +
    6. +
  6. ^ Busk, Rachel Harriette. Sagas from the Far East or, Kalmouk and Mongolian Traditionary Tales. London: Griffith and Farran. 1873. pp. 89-96. +
    7. +
  7. ^ Jülg, Bernhard. Kalmükische Märchen. Leipzig: F.A. Brockhaus, 1866. pp. 39-42. +
    8. +
  8. ^ Bergmann, Benjamin Fürchtegott B. Nomadische Streifereien unter den Kalmüken in den Jahren 1802 und 1803. C.J.G. Hartmann, 1804. p. 312 (footnote). +
    9. +
  9. ^ Thoms, William John. Lays And Legends of Various Nations: Illustrative of Their Traditions, Popular Literature, Manners, Customs, And Superstitions. Vol. 4. London: G. Cowie, 1834. p. 72 (footnote). +
    10. +
  10. ^ Tibbitts, Charles John. Folk-Tales and Legends: Oriental. London: W. W. Gibbings. 1889. pp. 101-106. +
    11. +
  11. ^ LŐRINCZ, L. “LES «CONTES DU CADAVRE ENSORCELÉ» DANS LA LITTÉRATURE ET LE FOLKLORE MONGOLS”. In: Acta Orientalia Academiae Scientiarum Hungaricae 20, no. 2 (1967): 205, 222. http://www.jstor.org/stable/23682112. +
    12. +
  12. ^ LŐRINCZ, L. “LES «CONTES DU CADAVRE ENSORCELÉ» DANS LA LITTÉRATURE ET LE FOLKLORE MONGOLS”. In: Acta Orientalia Academiae Scientiarum Hungaricae 20, no. 2 (1967): 214, 215. http://www.jstor.org/stable/23682112. +
    13. +
  13. ^ Владимирцов, Борис Яковлевич. "Волшебный мертвец. Монгольско-ойратские сказки" [Bewitched Corpse: Mongol-Oirat Fairy Tales]. Издательство восточной литературы, 1958. Tale nr. 7. +
    14. +
  14. ^ Горяева Б.Б. "Калмыцкая волшебная сказка: сюжетный состав и поэтикостилевая система". Элиста: ЗАОр «НПП «Джангар», 2011. pp. 38-39. ISBN 978-5-94587-476-3. +
    15. +
  15. ^ Coxwell, C. F. Siberian And Other Folk Tales. London: The C. W. Daniel Company, 1925. pp. 206-209. +
    16. +
  16. ^ Gelber, Adolf. Kalmückische Märchen: Wie der Chansohn zwölfmal den Siddhi-Kür holte. Wien; Berlin; Leipzig; München: Rikola Verlag, 1921. pp. 61-65. +
    17. +
  17. ^ Löhr, Johann Andreas Christian. Grosses Märchenbuch. Neu geordnet von Gustav Harrer. 2. Aufl. Leipzig: E. Berndt, 1880. pp. 476-478. +
    18. +
  18. ^ Francke, A. H. “Zur Tibetischen Vetālapancaviṁśatikā (Siddhikür)”. In: Zeitschrift Der Deutschen Morgenländischen Gesellschaft 77 (n.F. 2) (1923): 239–240. http://www.jstor.org/stable/43367829. +
    19. +
  19. ^ LÖRINCZ, L. "LES «CONTES DU CADAVRE ENSORCELÉ» (RO-SGRUN) DANS LA LITTÉRATURE ET LE FOLKLORE TIBÉTAINS". In: Acta Orientalia Hungaricae 18 (1965): 307. +
    20. +
  20. ^ LÖRINCZ, L. "LES «CONTES DU CADAVRE ENSORCELÉ» (RO-SGRUN) DANS LA LITTÉRATURE ET LE FOLKLORE TIBÉTAINS". In: Acta Orientalia Hungaricae 18 (1965): 312. +
    21. +
  21. ^ Benson, Sandra. Tales of the golden corpse: Tibetan folk tales. Northampton, Mass.: Interlink Books, 2007. pp. 121-126. ISBN 9781566566322. +
    22. +
  22. ^ Игра Веталы с человеком (Тибетские народные сказки) [Tibetan Folk Tales]. Мoskva: Наука Главная редакция восточной литературы, 1969. pp. 62-66. +
    23. +
  23. ^ Macdonald, D. (1931). "Tibetan Tales II". In: Folklore, 42:3, 308-310. DOI: 10.1080/0015587X.1931.9718409 +
    24. +
  24. ^ Jewett, Eleanore Myers. Wonder Tales from Tibet. Boston: By Little, Brown, and Company. 1922. pp. 27-49. +
    25. +
  25. ^ ŠARAKŠINOVA, NADEŽDA O. “LES CONTES DU CADAVRE ENSORCELÉ CHEZ LES BOURIATES”. In: Acta Orientalia Academiae Scientiarum Hungaricae 16, no. 1 (1963): 46–47. http://www.jstor.org/stable/23682290. +
    26. +
  26. ^ Wlislocki, Heinrich von, and Mühlbach. “Märchen Des Siddhi-Kür in Siebenbürgen”. In: Zeitschrift Der Deutschen Morgenländischen Gesellschaft 41, no. 3 (1887): 448, 454-455 (Romani text), 455-457 (German translation). http://www.jstor.org/stable/43361883. +
    27. +
  27. ^ LÖRINCZ, L. "LES «CONTES DU CADAVRE ENSORCELÉ» (RO-SGRUN) DANS LA LITTÉRATURE ET LE FOLKLORE TIBÉTAINS". In: Acta Orientalia Hungaricae 18 (1965): 312. +
    28. +
  28. ^ Ralston, William. "Beauty and the Beast". In: The Nineteenth Century. Vol. 4. (July–December, 1878). London: Henry S. King & Co. pp. 1000–1001. +
    29. +
  29. ^ Coxwell, C. F. Siberian And Other Folk Tales. London: The C. W. Daniel Company, 1925. p. 258. +
    30. +
  30. ^ Надбитова, И. С. "Указатель сюжетов калмыцких волшебных сказок". In: http://www.ruthenia.ru/folklore/nadbitova1.htm (Online article). +
    31. +
  31. ^ LŐRINCZ, L. “LES RECUEILS RO-SGRU Ṅ TIBÉTAINS CONTENANT 21 CONTES”. In Acta Orientalia Academiae Scientiarum Hungaricae 21, no. 3 (1968): 317, 319, 321. http://www.jstor.org/stable/23682727. +
    32. +
  32. ^ Kalmyk Folklore and Folk Culture in the mid-19th Century. Philological Studies on the Basis of Gábor Bálint of Szentkatolna’s Kalmyk Texts.. Oriental Studies 15. Budapest: 2011. pp. 86, 89-91. ISBN 978-963-7451-22-5. +
    33. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=The_White_Bird_and_His_Wife&oldid=1089371998"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/87.html b/content/corpora/87.html new file mode 100644 index 0000000..93535a2 --- /dev/null +++ b/content/corpora/87.html @@ -0,0 +1,676 @@ + + + + +Grove Park railway station - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Grove Park railway station

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+ +

+ +

+
Grove Park National Rail
Grove Park 180408 D.adkins.jpg
Grove Park is located in Greater London
Grove Park
Grove Park
Location of Grove Park in Greater London
LocationGrove Park
Local authorityLondon Borough of Lewisham
Managed bySoutheastern
Station codeGRP
DfT categoryC2
Number of platforms5
Fare zone4
National Rail annual entry and exit
2016–17Increase 2.617 million[1]
– interchange  0.660 million[1]
2017–18Increase 2.675 million[1]
– interchange Decrease 0.647 million[1]
2018–19Increase 2.740 million[1]
– interchange Increase 0.691 million[1]
2019–20Decrease 2.616 million[1]
– interchange Decrease 0.633 million[1]
2020–21Decrease 0.785 million[1]
– interchange Decrease 81,447[1]
Key dates
1 November 1871Opened
Other information
External links + +
WGS8451°25′50″N 0°01′19″E / 51.4306°N 0.0219°E / 51.4306; 0.0219Coordinates: 51°25′50″N 0°01′19″E / 51.4306°N 0.0219°E / 51.4306; 0.0219
Underground sign at Westminster.jpg London transport portal
+

Grove Park is a railway station in southeast London, England. It is located on Baring Road (the A2212) within Travelcard Zone 4, and serves the areas of Grove Park and Downham in the London Borough of Lewisham. It is 8 miles 78 chains (14.4 km) down the line from London Charing Cross. +

It serves as an interchange between local South Eastern Main Line services & the Bromley North Line shuttle. Prior to 1952 there was also a connection to trams. +

The station was opened in 1871. +

+ + +

Platforms[edit]

+

Currently there are five platforms. Platform 1 serves Bromley North branch line, which is detached from the rest of the station, while platforms 2 to 5 are on the South Eastern Main Line which runs from Charing Cross to Hastings. The adjacent stations are Elmstead Woods to the south, Hither Green to the north, and Sundridge Park on the Bromley North branch line. +

There are regular services to London Charing Cross and London Cannon Street. +

+

Services[edit]

+
Grove Park station in Network SouthEast colours with a Class 416 calling in 1992
+

All services at Grove Park are operated by Southeastern using Class 376, 465, 466 and 707 EMUs. +

The typical off-peak service in trains per hour is:[2] +

+ +

On Sundays the Bromley North shuttle does not run. +

+ + + + + + + + + + + + +
Preceding station +National Rail National Rail +Following station +
Southeastern
TerminusSoutheastern
Monday-Saturday only
+

Connections[edit]

+

London Buses routes 124, 126, 136, 181, 261, 284, 273 and 638 and night route N136 serve the station.[3] +

+

References[edit]

+
+
    +
  1. ^ a b c d e f g h i j "Estimates of station usage". Rail statistics. Office of Rail Regulation. Please note: Some methodology may vary year on year. +
    2. +
  2. ^ Table 204 National Rail timetable, December 2021 +
    3. +
  3. ^ Transport for London bus map +
    4. +
+

External links[edit]

+ + + + + + +
+
+
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Grove_Park_railway_station&oldid=1072789813"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/88.html b/content/corpora/88.html new file mode 100644 index 0000000..d12a8a2 --- /dev/null +++ b/content/corpora/88.html @@ -0,0 +1,568 @@ + + + + +Nupserha andamanica - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Nupserha andamanica

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Nupserha andamanica +
Scientific classification +
Kingdom: +
Animalia
+
Phylum: +
Arthropoda
+
Class: +
Insecta
+
Order: +
Coleoptera
+
Suborder: +
Polyphaga
+
Family: +
Cerambycidae
+
Genus: +
Nupserha
+
Species: +
N. andamanica
+
Binomial name +
Nupserha andamanica
Breuning, 1960
+
+

Nupserha andamanica is a species of beetle in the family Cerambycidae. It was described by Stephan von Breuning in 1960.[1] +

+

References[edit]

+
+
    +
  1. ^ BioLib.cz - Nupserha andamanica. Retrieved on 8 September 2014. +
    2. +
+
+


+

+

This Nupserha article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Nupserha_andamanica&oldid=1058477642"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/89.html b/content/corpora/89.html new file mode 100644 index 0000000..183d188 --- /dev/null +++ b/content/corpora/89.html @@ -0,0 +1,411 @@ + + + + +Caton (surname) - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Caton (surname)

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

Caton is the surname of the following people: +

+ + +

Academics[edit]

+ +

Performers[edit]

+ +

Politics and law[edit]

+ +

Sportspeople[edit]

+ +

Others[edit]

+ + + + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Caton_(surname)&oldid=1074105732"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/9.html b/content/corpora/9.html new file mode 100644 index 0000000..6097c1a --- /dev/null +++ b/content/corpora/9.html @@ -0,0 +1,518 @@ + + + + +Cairo Gang - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Cairo Gang

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+
"The Cairo Gang" redirects here. For the band, see The Cairo Gang (band).
+

+

The Cairo Gang was a group of British intelligence agents who were sent to Dublin during the Irish War of Independence to conduct intelligence operations against prominent members of the Irish Republican Army (IRA) with, according to Irish intelligence, the intention of assassinating them. Twelve men, including British Army officers, Royal Irish Constabulary officers and a civilian informant, were killed on the morning of 21 November 1920 by the Irish Republican Army, in a planned series of simultaneous early-morning strikes engineered by Michael Collins. The events were the first killings of Bloody Sunday. +

Tim Pat Coogan's biography of Michael Collins asserts that the "nom de guerre" of the British unit derived from a common history of service in the Middle East,[1] but that is disputed by some Irish historians, such as Conor Cruise O'Brien, and it has been suggested that they received the name because they often held meetings at Cafe Cairo, at 59 Grafton Street in Dublin. Earlier books on the 1919–1923 period do not refer to the Cairo Gang by that name. +

+ + +

Background[edit]

+

By 1920, the IRA's Dublin headquarters, under the direction of Michael Collins, had, through targeted assassination and intelligence penetration, effectively eliminated the G Division of the Dublin Metropolitan Police, previously the mainstay of the Crown's intelligence operations against Irish Republicans. In response, the Dublin Castle administration, at that time the headquarters of the British government in Ireland, were forced to look for external intelligence support. +

In January 1920, the British Army Intelligence Centre in Ireland formed a special plain-clothes unit of 18 to 20 demobilised ex-army officers, and some officers still on active duty, to conduct clandestine operations against the IRA. The officers received training in London, most likely under the supervision of Special Branch, which had been part of Britain's Directorate of Home Intelligence since February 1919. They may also have received some training from MI5 officers and former officers working for Special Branch. Army Centre in Dublin hoped these officers could eventually be divided up and deployed to the provinces to support its 5th and 6th Division intelligence staff, but it decided to keep the unit in Dublin, at the Dublin District Division, commanded by General Gerald Boyd. It was known officially as the Dublin District Special Branch (DDSB) and also as "D Branch". In May 1920, Lieutenant Colonel Walter Wilson arrived in Dublin to take command of D Branch. +

Following the events of Bloody Sunday, 21 November 1920, when twelve D Branch officers were assassinated by the Irish Republican Army under the command of Michael Collins, D Branch was transferred to the command of Brigadier-General Sir Ormonde Winter in January 1921. Winter had been placed in charge of a new police intelligence unit, the Combined Intelligence Service, in May 1920, and his charter was to set up a central intelligence clearing house to more effectively collate and coordinate army and police intelligence. Those members of D Branch who survived Bloody Sunday were very unhappy to be transferred from army command to CIS command and, for the next six months, until the Truce of July 1921, D Branch continued to maintain regular contact with Army Intelligence Centre while undertaking missions for Winter's CIS.[2][3][4] +

+
A photo purportedly of the Cairo Gang, but more probably the Igoe Gang
+

The famous photograph, that is purported to show members of the Cairo Gang, is lodged in the National Library of Ireland photographic archive Piaras Béaslaí collection (five copies). An inscription describes the men as "the special gang F company Auxiliaries". The men in the photo are numbered, but there are no names or details on the back of the photos. Three other photos in the collection show Auxiliaries posing on vehicles in the grounds of Dublin Castle. Those three photos are similarly numbered. +

The IRA Intelligence Department (IRAID) was receiving information from numerous well-placed sources, including Lily Mernin, who was the confidential code clerk for British Army Intelligence Centre in Parkgate Street, and Sergeant Jerry Mannix, stationed in Donnybrook. Mannix provided the IRAID with a list of names and addresses of all the members of the Cairo Gang. In addition, Michael Collins' case officers on the intelligence staff — Liam Tobin, Tom Cullen and Frank Thornton — were meeting with several D Branch officers nightly, pretending to be informers. Another IRA penetration source, participating in the nightly repartee with the D Branch men at Cafe Cairo, Rabiatti's Saloon, and Kidds Back Pub, was Detective Constable David Neligan, one of people Michael Collins had organised to penetrate G-Division, the secret detectives of the Dublin Metropolitan Police. Additionally, the IRA had co-opted most of the Irish servants who worked in the rooming houses where the D Branch officers lived, and all of their comings and goings were meticulously recorded by servants and reported to Collins' staff. +

All the members of the Gang were kept under surveillance for several weeks, and intelligence was gathered from sympathisers, for example, who was coming home at strange hours, thereby indicating that they were being allowed through the military curfew. The IRA Dublin Brigade and the IRAID then pooled their resources and intelligence to draw up their own hit list of suspected Gang members, and set the date for the assassinations to be carried out as 21 November 1920, at 9:00 am. +

+

Assassinations[edit]

+

The operation was planned by several senior IRA members, including Michael Collins, Dick McKee, Liam Tobin, Peadar Clancy, Tom Cullen, Frank Thornton and Oscar Traynor. The killings were planned to coincide with a Gaelic football match between Dublin and Tipperary, because the large crowds around Dublin would allow the members of Collins' Squad to move about more easily, and make it more difficult for the British to detect them before and after they carried out the assassinations. +

Clancy and McKee were picked up by Crown forces on the evening of Saturday, 20 November. They were tortured and later shot dead "while trying to escape". Tortured and killed with them was Conor Clune, the nephew of Archbishop Clune of Perth, who had been senior chaplain to the Catholic members of the Australian Imperial Force in World War I.[5] Clune was manager of the seed and plant nursery owned by Edward MacLysaght near Quin, and Clune and MacLysaght travelled to Dublin on the morning of Saturday, 20 November 1920, bringing with him the books of the Raheen Co-op for its annual audit. Clune was arrested in a raid on Vaughan's Hotel in Dublin, where he was a registered guest. +

+

28 Pembroke Street Upper[edit]

+

The operation began at 9:00 am, when members of the Squad entered 28 Pembroke Street. The first British agents to die were Major Charles Milne Cholmeley Dowling[6] and Captain Leonard Price.[7] Andy Cooney of the Dublin Brigade removed documents from their rooms. +

Three more members of the Gang were shot in the same house: Captain Brian Christopher Headlam Keenlyside, Colonel Wilfrid Woodcock, and Lieutenant-Colonel Hugh Montgomery. Woodcock was not connected with intelligence and had walked into a confrontation on the first floor of the Pembroke Street house as he was preparing to leave to command a regimental parade at army headquarters. He was in his military uniform and, when he shouted to warn the other five British officers living in the house, he was shot in the shoulder and back, but survived. As Keenlyside was about to be shot, a struggle ensued between his wife and Mick O'Hanlon. The leader of the unit, Mick Flanagan, arrived, pushed Mrs Keenlyside out of the way and shot her husband. +

+

117 Morehampton Road[edit]

+

At 117 Morehampton Road, Donnybrook, 2.3 km from the scene of the first shootings, another member of the Cairo Gang, Lieutenant Donald Lewis MacLean,[8] along with suspected informer T.H. Smith and MacLean's brother-in-law, John Caldow, were taken into the hallway and about to be shot, when MacLean asked that they not be shot in front of his wife. The three were taken to an unused bedroom and shot. Caldow survived his wounds and fled to his home in Scotland. +

+

92 Lower Baggot Street[edit]

+

Just 800 metres away, at 92 Lower Baggot Street, another Gang member, Captain William Frederick Newberry,[9] and his wife, heard their front door come crashing down and blockaded themselves into their bedroom. Newberry rushed for his window to try to escape but was shot while climbing out by Bill Stapleton and Joe Leonard, after they finally broke the door down. +

+

38 Upper Mount Street[edit]

+

Two key members of the Gang, Lieutenant Peter Ashmun Ames[10] and Captain George Bennett,[11] were made to stand facing the wall on a bed in a downstairs rear bedroom and shot by Vinny Byrne and others in his squad. A maid had let the attackers into 38 Upper Mount Street and indicated, at gunpoint, the rooms occupied by the two targeted men. Despite many accounts to the contrary, Byrne was not involved in the killings in Morehampton Road that morning. +

+

28 Earlsfort Terrace[edit]

+

Sergeant John J Fitzgerald,[12] of the Royal Irish Constabulary, also known as "Captain Fitzgerald" or "Captain Fitzpatrick", whose father was from County Tipperary, was killed a kilometre away at 28 Earlsfort Terrace. He had survived a previous assassination attempt when a bullet grazed his head. This time he was shot twice in the head. The documents found in his house detailed the movements of senior IRA members. +

+

22 Lower Mount Street[edit]

+

An IRA unit led by Tom Keogh entered 22 Lower Mount Street to kill Lieutenant Henry Angliss, alias Patrick Mahon,[13] and Lieutenant Charles Ratsch Peel. The two intelligence specialists in the Gang, Angliss and Peel, had been recalled from Russia to organise British intelligence operations in the South Dublin area. Angliss had survived a previous assassination attempt when he had been shot at in a billiard hall. He was targeted for killing Sinn Féin fundraiser John Lynch, mistaken for General Liam Lynch, Divisional Commandant of the 1st Southern Division, IRA. Angliss was shot as he reached for his gun. +

Peel, hearing the shots, managed to block his bedroom door and survived even though more than a dozen bullets were fired into his room. When members of Fianna Éireann, who were on lookout, reported that the Auxiliary Division were approaching the house, the unit of eleven men split up into two groups, the first leaving by the front door, the second through the laneway at the back of the house. +

+

119 Baggot Street[edit]

+

At 119 Baggot Street, a three-man unit killed Captain Geoffrey Thomas Baggallay,[14] a barrister who had been employed as a prosecutor under the Restoration of Order in Ireland Act 1920 regulations,[15] and who had been a member of military courts that sentenced IRA volunteers to death. +

+

Gresham Hotel[edit]

+

Captain Patrick McCormack and Lieutenant Leonard Wilde were in the Gresham Hotel in O'Connell Street. The IRA unit gained access to their rooms by pretending to be British soldiers with important dispatches. When the men opened their doors they were shot and killed. A listing in The Times for McCormack and Wilde does not indicate any rank for the latter — in fact he was a discharged army officer who had been a British consul in Spain.[16] McCormack's killing was a mistake. He was a member of the Royal Army Veterinary Corps and was in Ireland to buy horses for the British Army. He was shot in bed and Collins himself later acknowledged the error. Unlike the other British officers, McCormack, a Catholic from Castlebar,[17] was buried in Ireland, at Glasnevin Cemetery, Dublin.[18] +

+

Fitzwilliam Square[edit]

+

Captain John Scott Crawford, in charge of motor repair of the British Army Service Corps, narrowly escaped death after the IRA entered a guesthouse in Fitzwilliam Square where he was staying, looking for a Major Callaghan. On not finding their target, they debated whether or not to shoot Crawford. They decided not to shoot him because he was not on their list. Instead, they gave him 24 hours to leave Ireland, although the major left Ireland in no hurry despite that close call. +

+

Eastwood Hotel[edit]

+

In the Eastwood Hotel at 91 Lower Leeson Street, the IRA failed to find their target, Captain Thomas Jennings. Other targets who escaped were Captain Jocelyn Hardy[19] and Major William Lorraine King, a colleague of Hardy who was missing when Joe Dolan burst into King's room. According to the prim Todd Andrews, Dolan took revenge by giving King's half-naked mistress "a right scourging with a sword scabbard", and setting fire to the room afterwards.[20] +

Major Frank Murray Maxwell Hallowell Carew, an intelligence officer who, with Captain Price, had almost cornered 3rd Tipperary Brigade commander Seán Treacy a month before, was on the list. (Treacy had been killed by G men as he tried to shoot his way out of a trap on 14 October, a week before the day of the Cairo Gang assassinations.) +

When the IRA came calling for Murray, he had moved to an apartment across the street. He heard the gunfire at his former lodging and fired his revolver at an IRA sentry outside. The sentry was hit and took cover inside the house. The Volunteers moved on. +

Several IRA men carried sledgehammers with them the morning of 21 November, because they expected to encounter bolted doors. They did not find any, but T. Ryle Dwyer claims that they used them to smash the skulls and faces of some of the officers they had shot.[21] +

Two members of the Auxiliary Cadet Division, Temporary Cadets Frank Garniss, aged 34,[22] and Cecil Augustus Morris, aged 24,[23] were among a patrol of Auxiliaries who responded to the scene of one of the attacks, armed with .45 calibre Webley revolvers and a carbine. Garniss and Morris were shot and killed as they sought to cordon off the rear of one of the scenes of assassination.[24][25] +

A listing in The Times of killed and wounded notes that, in addition to Caldow, Captain Brian Keenlyside, Colonel Hugh Montgomery, Major (Wilfrid) Woodcock, and Lieutenant Randolph Murray were wounded, but not killed. On 10 December 1920, Montgomery died of the wounds he received on Bloody Sunday.[26] +

+

Fatalities[edit]

+

Nineteen men were shot. Fourteen were killed on 21 November and Montgomery died later, making fifteen in all. Five were wounded (including King's mistress). Ames, Angliss, Baggallay, Bennet, Dowling, Fitzgerald, McCormack, MacLean, Montgomery, Newberry, Price, Wilde, Smith, Morris and Garniss were killed. Keenlyside, Woodcock, Murray and Caldow were wounded. Peel and others escaped. The dead included members of the "Cairo Gang", British Army Courts-Martial officers, the two Auxiliaries and a civilian informant. +

+

Aftermath[edit]

+

Of the IRA men involved, only Frank Teeling was captured during the operation. He was court-martialled and sentenced to hang, but escaped from Kilmainham Gaol before the sentence could be carried out, although he was later tried for shooting a member of the National Army, and convicted for killing a man for bringing a bag of tomatoes into the bar at the Theatre Royal, Dublin.[27] Patrick Moran and Thomas Whelan were arrested later and, despite their protestations of innocence, and 19 false witnesses attesting to alibis,[28] were convicted. and hanged for murder on 14 March 1921. +

The remaining Cairo Gang members, along with many other spies, fled to either Dublin Castle or England, fearing they were next on the IRA's hit list. Another member committed suicide in Dublin Castle. The deaths and flights dealt a severe blow to British intelligence gathering in Ireland. +

+

The Igoe Gang[edit]

+

Eventually another group of intelligence operatives, known officially as the Identification Branch of the Combined Intelligence Service (CIS), took the fight to the IRA. The group was known informally as The Igoe Gang, named after its leader Head Constable Eugene Igoe, who was from County Mayo. Igoe reported to Colonel Ormonde Winter. +

The Igoe Gang consisted of RIC personnel drawn from different parts of Ireland who patrolled the streets of Dublin in plain clothes, looking for wanted men.[29] The Igoe Gang posed a serious threat to Collins' apparatus and even caught a Volunteer whom Collins had brought to Dublin to identify Igoe.[30] The Gang was never penetrated by the IRA. Igoe later conducted secret service operations for Special Branch over many years in other countries, but never returned to his farm in Mayo out of fear of reprisal. Brigadier General Winter appeared on Igoe's behalf to obtain an increase in his pension in view of his many services to the Crown in Ireland and elsewhere.[31] +

+

See also[edit]

+ +

References[edit]

+
+
    +
  1. ^ Coogan, Tim Pat (1991). Michael Collins. London: Arrow Books. p. 157. ISBN 0-09-968580-9. +
    2. +
  2. ^ Imperial War Museum, General Hugh Jeudwine Papers, A Record of the Rebellion in Ireland, 1919–1921 and of the part played by the Army in it. Volume II +
    3. +
  3. ^ Caroline Woodcock, Experiences of an Officer's Wife in Ireland(London and Edinburgh: Blackwood and Sons, 1921). +
    4. +
  4. ^ Charles Townsend, The British Campaign in Ireland 1919–1921 (Oxford: Oxford University Press, 1975) +
    5. +
  5. ^ The Irish War of Independence by Michael Hopkinson (ISBN 978-0717137411), page 91 +
    6. +
  6. ^ "Casualty Details: Charles Milne Cholmeley Dowling". Commonwealth War Graves Commission. 21 November 1920. Retrieved 4 June 2009. +
    7. +
  7. ^ "Casualty Details: L Price". Commonwealth War Graves Commission. 21 November 1920. Retrieved 16 May 2014. +
    8. +
  8. ^ "Casualty Details: Donald Lewis MacLean". Commonwealth War Graves Commission. 21 November 1920. Retrieved 4 June 2009. +
    9. +
  9. ^ "Casualty Details: William Frederick Newberry". Commonwealth War Graves Commission. 21 November 1920. Retrieved 4 June 2009. +
    10. +
  10. ^ "Casualty Details: Peter Ashmun Ames". Commonwealth War Graves Commission. 21 November 1920. Retrieved 4 June 2009. +
    11. +
  11. ^ "Casualty Details: G Bennett". Commonwealth War Graves Commission. 21 November 1920. Retrieved 4 June 2009. +
    12. +
  12. ^ "National Police Officers Roll of Honour: Royal Irish Constabulary 1867–1922". Police Roll of Honour Trust. 6 May 2009. Retrieved 4 June 2009. +
    13. +
  13. ^ "Casualty Details: Henry James Angliss". Commonwealth War Graves Commission. 21 November 1920. Retrieved 4 June 2009. +
    14. +
  14. ^ Casualty Details: Baggallay, Geoffrey Thomas. Commonwealth War Graves Commission. 1920-11-21. Retrieved 2009-12-29. +
    15. +
  15. ^ The Times, 23 November 1920 +
    16. +
  16. ^ Leonard Wilde accessed June 11,2019 +
    17. +
  17. ^ "Capt Patrick McCormack". Cairogang.com. Retrieved 11 June 2019. +
    18. +
  18. ^ The Times, Murdered Officers' Last Journey 25 November 1920 +
    19. +
  19. ^ Tim Pat Coogan, Michael Collins: The Man Who Made Ireland, p.160 +
    20. +
  20. ^ Todd Andrews, Dublin Made Me, Mercier Press, 1979, p. 153 +
    21. +
  21. ^ T Ryle Dwyer, The Squad and the Intelligence Operations of Michael Collins (Cork: Mercier, 2005). +
    22. +
  22. ^ Cadet Garniss +
    23. +
  23. ^ Cadet Morris +
    24. +
  24. ^ James Mackay, Michael Collins, A Life (Edinburgh and London: Mainstream Publishers, 1996). +
    25. +
  25. ^ Michael Hopkinson, The Irish War of Independence (Montreal: McGill Queens University Press, 2002) +
    26. +
  26. ^ "Casualty Details: Hugh Ferguson Montgomery". Commonwealth War Graves Commission. 10 December 1920. Retrieved 4 June 2009. +
    27. +
  27. ^ "STRANGE SHOOTING IN DUBLIN THEATRE; Coroner Finds Lieut. Teeling, Free State Officer, Killed Civic Guard in Self Defense. (Published 1923)". The New York Times. 29 March 1923. ISSN 0362-4331. Retrieved 12 November 2020. +
    28. +
  28. ^ "Court-Martial (Patrick Moran) - Hansard". hansard.parliament.uk. Retrieved 12 November 2020. +
    29. +
  29. ^ Tim Pat Coogan, Michael Collins: The Man Who Made Ireland. +
    30. +
  30. ^ William Henry [2012] Blood For Blood: The Black and Tan War in Galway. Mercier Press, Cork p.178–181 +
    31. +
  31. ^ Ormonde Winter, A Report of the Intelligence Branch of the Chief Police Commissioner 1921, Public Record Office (PRO). +
    32. +
+

Bibliography[edit]

+
  • Todd Andrews, Dublin Made Me, Mercier Press, 1979, p. 153
    • +
  • Yigal Sheffy, British Military Intelligence in the Palestine Campaign, 1914–1918 (Cass Series – Studies in Intelligence, 1998).
    • +
  • Michael Smith, The Spying Game (Victor Gollancz Ltd, 1996).
+

External links[edit]

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Cairo_Gang&oldid=1087101025"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/90.html b/content/corpora/90.html new file mode 100644 index 0000000..a4bcacb --- /dev/null +++ b/content/corpora/90.html @@ -0,0 +1,1001 @@ + + + + +Ahmednagar Fort - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Ahmednagar Fort

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+ +

+
Ahmednagar fort
Ahmednagar, Maharashtra
Ahmednagar Fort Main Gate.jpg
Ahmednagar fort is located in Maharashtra
Ahmednagar fort
Ahmednagar fort
Ahmednagar fort is located in India
Ahmednagar fort
Ahmednagar fort
Coordinates19°05′41.3″N 74°45′19.7″E / 19.094806°N 74.755472°E / 19.094806; 74.755472
TypeLand fort
Site information
OwnerIndian Military
Controlled byAhmadnagar Sultanate (1562-1600)
Mughal Empire (1600-1724)
 Hyderabad (1724-1759)
 Maratha (1759-1803)
 United Kingdom + + India (1947-)
Open to
the public		daily 10am to 5pm
ConditionGood
Site history
MaterialsStone
Battles/warsSiege of Ahmednagar
Garrison information
Past
commanders		Chand Bibi, Aurangzeb
OccupantsNana Phadanvis, Jawaharlal Nehru, Abul Kalam Azad, Sardar Patel
+

The Ahmednagar Fort (Ahmadnagar Qilaa) is a fort located near to the Bhingar Nala near Ahmednagar in[1] Maharashtra. It was the headquarters of the Ahmednagar Sultanate. In 1803, it was taken by the British during the Second Anglo-Maratha War. It was used as a prison during the British Raj. Currently, the fort is under the administration of the Armoured Corps of the Indian Army. +

+ + +

Major features[edit]

+

In 1803 the Ahmednagar Fort was round in appearance, with twenty-four bastions, one large gate, and three small sally ports. It had a glacis, no covered way; a ditch, revetted with stone on both sides, about 18 feet (5.5 m) wide, with 9 feet (2.7 m) water all around, which only reached within 6 or 7 feet (2.1 m) of the top of the scarp; long reeds grew in it all around. The berm was only about one yard wide. The rampart was of black hewn stone; the parapet of brick in chunam, and both together appeared from the crest of the glacis to be only as high as the pole of a field-officer's tent. The bastions were all about 4+1⁄2 feet higher; they were round. One of them mounted eight guns en barbet, pointing eastward; all the rest had jingies,[check spelling] four in each. In 1803 two guns were visible in each bastion, and 200 were said to be ready in the fort to be mounted.[2] +

A gunshot to the west of the fort was the Pettah of Ahmednagar. The main gate of the fort faced the pettah, and was defended by a small half-circular work, with one traverse and several little towers for men. There was a wooden bridge over the ditch, which could be taken away in time of war, but it was not a drawbridge. It was reported that an iron trough as large as the bridge, could be placed upon it, or on the supporters of it, and fill with charcoal or other combustibles, to which could be ignited as an enemy approached.[2] The fort is also called as Bhuikot Killa which means it is a land fort and is not constructed on any hill.[3] It should not be confused with other Bhuikot Killas in Maharashtra like Solapur Bhuikot Killa. +

A small river came from the northward, round the west side of the pettah, and passed to the southward of the fort. A nullah also passed from the northward, between the fort and a town called Bhingar, about a gunshot to the eastward, and joined the river. A potential defensive weakness was a little hill or rising ground close to and east of Bhingar, from which shot from siege guns could reach the fort.[2] +

Two nills or covered aqueducts came from the hills, a mile or more to the north, passed through and supplied the pettah and the town, and then went into the fort, either under or through the ditch, into which the wastewater fell.[2] +

There were no passages across the ditch from the sally ports, and no part of the aqueducts appeared above the ditch. The nullah mentioned above had steep banks and passed within 60 yards of the fort; the aqueduct from Bhingar passed under it. There was no bridge or even a prominent crossing point at the nullah and hence no clearly defined route between the fort and the town of Bhingar.[2] +

There were many small pagodas and mosques around the pettah and the fort, but none exactly between, or between the fort and Bhingar, or nearer to the fort than those towns.[2] +

+

History[edit]

+
Ahmednagar fort (on the left side)
+

The fort was built by Malik Ahmad Nizam Shah I (after whom the city of Ahmednagar is named) in 1427.[4] He was the first sultan of the Nizam Shahi dynasty and he built the fort to defend the city against invaders from neighbouring Idar.[4] Initially it was made of mud but major fortification began in 1559 under Hussain Nizam Shah. It took four years and was finally finished in 1562.[5] In February 1596, Chand Bibi the queen regent successfully repulsed the Mughal invasion but when Akbar attacked again in 1600 the fort went to the Mughals.[5][6][7][8] +

Aurangzeb died at Ahmednagar fort at the age of 88 on 20 February 1707. After Aurangzeb's death, the fort passed to the Nizams in 1724, to Marathas in 1759 and later the Scindias in 1790. During the period of instability in the Maratha Empire following the death of Madhavrao II, Daulat Scindia had the fort and its surrounding region ceded to him. In 1797, he imprisoned Nana Phadanvis the Peshwa diplomat at Ahmednagar fort.[9] +

In 1803 during the Second Anglo-Maratha War, Arthur Wellesley defeated the Maratha forces and the East India Company came into possession of the fort. +

+

Modern era[edit]

+

The fort was known as Ahmednagar Fort and was used by the British Raj as a prison and this was where Jawaharlal Nehru, Abul Kalam Azad, Sardar Patel and nine other members of the Indian National Congress were detained for almost three years after they passed the Quit India Resolution.[10][11] Jawaharlal Nehru wrote his popular book -the Discovery of India- while he was imprisoned at the fort.[6][11][12] During the same time, Congress leader, Maulana Abul Kalam Azad also compiled his acclaimed "Ghubar-e-Khatir" (Sallies of Mind) (Urdu: غبار خاطر) which is considered as the best example of "Epistolary Essays" in Urdu literature.[citation needed] +

During the same time, Odisha's first Chief-Minister and ex-Governor of undivided Bombay State, Harekrushna Mahatab also compiled three volumes of History of Odisha in Odia. This has later been translated and published in English and Hindi. +

Currently, the fort is under the administration of the Armoured Corps of the Indian Army.[11] +

+

Gallery[edit]

+
    +
  • +
    +
    +

    Ahmednagar fort with the national flag +

    +
    +
    • +
  • +
    +
    +

    Ahmednagar fort fortification +

    +
    +
    • +
  • +
    +
    +

    Ahmednagar fort interior +

    +
    +
    • +
  • +
    +
    +

    Ahmednagar fort inside view of the fort gate +

    +
    +
    • +
  • +
    +
    +

    Part of the Moat around the fort +

    +
    +
    • +
  • +
    +
    +

    Jawaharlal Nehru's room during his incarceration (1942-'45) +

    +
    +
    • +
+

See also[edit]

+ +

References[edit]

+ + + + + +
+
    +
  1. ^ In some older references Fort of Ahmednuggur +
    2. +
  2. ^ a b c d e f Public Domain This article incorporates text from this source, which is in the public domain: Wellesley (Duke of Wellington), Arthur Richard (1859). "Memorandum of the Ahmednuggur Fort". In J. Murray (ed.). Supplementary despatches and memoranda of field marshal Arthur duke of Wellington 1797-1819 with a map of India. p. 100. +
    3. +
  3. ^ "Ahmednagar Fort (Bhuikot Fort) - Total Safari". +
    4. +
  4. ^ a b Gazetteer of the Bombay Presidency. Govt Central Press. 1896. p. 238. Retrieved 10 March 2009. +
    5. +
  5. ^ a b Cowley, Capt Cecil (1919). "IX". Tales of Ahmednagar. Bombay: Thacker and Company Ltd. +
    6. +
  6. ^ a b "Ahmednagar fort". Maharashtra Tourism Development Corporation. Retrieved 10 March 2009. +
    7. +
  7. ^ Sen, Sailendra (2013). A Textbook of Medieval Indian History. Primus Books. p. 164. ISBN 978-9-38060-734-4. +
    8. +
  8. ^ Mehta, Jaswant L. (1990). Advanced study in the history of medieval India. Sterling Publ. p. 271. ISBN 9788120710153. OCLC 633709290. +
    9. +
  9. ^ Gazetteer of the Bombay Presidency. Govt. Central Press. 1884. p. 409. Retrieved 10 March 2009. +
    10. +
  10. ^ Mufti, Amir (2007). "3". Enlightenment in the Colony. Princeton University Press. pp. 129–130. ISBN 978-0-691-05732-3. Retrieved 10 March 2009. +
    11. +
  11. ^ a b c Gill, Himmat Singh (3 September 2006). "Where freedom held fort". The Sunday Tribune. Retrieved 10 March 2009. +
    12. +
  12. ^ "Tribute in the thick of toil". The Telegraph-Calcutta. 15 August 2004. Retrieved 10 March 2009. +
    13. +
+
+
+
+

Coordinates: 19°05′41.3″N 74°45′19.7″E / 19.094806°N 74.755472°E / 19.094806; 74.755472 +

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Ahmednagar_Fort&oldid=1087118216"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/91.html b/content/corpora/91.html new file mode 100644 index 0000000..72be65d --- /dev/null +++ b/content/corpora/91.html @@ -0,0 +1,658 @@ + + + + +Prunus geniculata - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Prunus geniculata

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Prunus geniculata +
Prunus geniculata flowers.jpg +
+

Vulnerable (NatureServe)
+
Scientific classification edit +
Kingdom: +Plantae +
Clade: +Tracheophytes +
Clade: +Angiosperms +
Clade: +Eudicots +
Clade: +Rosids +
Order: +Rosales +
Family: +Rosaceae +
Genus: +Prunus +
Subgenus: +Prunus subg. Prunus +
Section: +Prunus sect. Prunocerasus +
Species: +
P. geniculata
+
Binomial name +
Prunus geniculata
+
+

Prunus geniculata is a rare species of plum known by the common name scrub plum. The species is endemic to Florida. +

+ + +

Description[edit]

+

This plant is a low, rounded shrub with a gnarled trunk emerging from the sand and branching densely to form a mound up to two meters tall. The zig-zagging, angled, sharp-tipped branches are sometimes buried in sand and emerge covered in lichens. The gray bark cracks, revealing new reddish brown bark beneath. The alternately arranged leaves have smooth blades 1 to 3 centimeters long with wavy or toothed edges. Blooming occurs before the leaves appear. The flowers are usually solitary. They have five red sepals and five white petals a few millimeters long. There are many stamens at the center, each with a yellow anther. The species is andromonoecious, with individuals bearing both bisexual and male-only flowers.[3][4] The fruit is a bitter-tasting, egg-shaped drupe up to 2.5 centimeters long.[5] The drupe is reddish purple in color.[3] +

The plant may be solitary or it may grow colonially. Little is known about the plant's life history.[5][3] +

+

Distribution and habitat[edit]

+

The species is endemic to Florida in the United States, where it occurs on the Lake Wales Ridge in the central ridges of the peninsula.[6] It grows in yellow-sand sandhill habitat dominated by longleaf pine and turkey oak and white-sand Florida scrub among sand pine, Florida rosemary, and scrub hickory.[5] +

As of 2008 there were 83 populations counted, but 39 of these contained fewer than 10 plants each. Most populations are on the Lake Wales Ridge, and a few are on adjacent ridges. Half the populations are on private land, but most of the large populations are in protected or managed areas.[7] +

+

Ecology[edit]

+

The plant's native habitat is maintained by periodic wildfire. The natural fire regime in the area produces openings in the vegetation, removing woody, overgrown plants in the canopy and creating gaps where the smaller plants can receive sun. This shrub cannot tolerate shade and it thrives when fire clears the vegetation around it.[5] It resprouts from its fibrous root system after its aboveground part burns.[3] Flowering increases in the seasons after a fire, then decreases the longer the area goes unburned.[4] The plant is long-lived, has low mortality, and can survive many years without fire. However, fire suppression is the major threat to the survival of the species.[7] Due to the loss of its habitat, the plant is federally listed as an endangered species of the U.S.[6] +

Another threat to the species is the outright loss of its habitat in the conversion to residential and agricultural properties, including citrus groves.[5] The plant's own biology may contribute to its rarity: germination rates are low and many of the developing fruits are lost before they mature, either to abortion or predation.[4] The species then experiences low recruitment, with few seedlings joining the population.[7] +

The drupe is consumed by animals.[3] +

+

References[edit]

+
+
    +
  1. ^  Prunus geniculata was first described and published in Torreya. 11: 67. 1911 (Note: the article in which the name appears begins on page 64, the species name not appearing until page 67.) "Plant Name Details for Prunus geniculata". IPNI. Retrieved July 9, 2011. +
    2. +
  2. ^ Roland M. Harper (1911). "A New Plum from the Lake Region of Florida" (PDF). Torreya; A Monthly Journal of Botanical Notes and News. New York: Torrey Botanical Club, USA. 11: 64–67. Retrieved July 9, 2011. +
    3. +
  3. ^ a b c d e Prunus geniculata. Archived 2011-08-29 at the Wayback Machine Center for Plant Conservation. +
    4. +
  4. ^ a b c Weekley, C. W., et al. (2010). Multiple causes of seedling rarity in scrub plum, Prunus geniculata (Rosaceae), an endangered shrub of the Florida scrub. Am J Bot 97(1) 144. +
    5. +
  5. ^ a b c d e Prunus geniculata. The Nature Conservancy. +
    6. +
  6. ^ a b "Scrub Plum (Prunus geniculata) Species Account | North Florida ESO Jacksonville". Archived from the original on 4 April 2021. +
    7. +
  7. ^ a b c USFWS. Prunus geniculata Five-year Review. May 2009. +
    8. +
+

External links[edit]

+ + + + + + +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Prunus_geniculata&oldid=1087328033"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/92.html b/content/corpora/92.html new file mode 100644 index 0000000..705a529 --- /dev/null +++ b/content/corpora/92.html @@ -0,0 +1,1093 @@ + + + + +Josh Unice - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Josh Unice

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ +
Josh Unice
Born + (1989-06-24) June 24, 1989 (age 32)
Holland, Ohio, U.S.
Height +6 ft 1 in (185 cm)
Weight +179 lb (81 kg; 12 st 11 lb)
Position +Goaltender
Caught +Left
AIHL team +CBR Brave
Played for +
+ +
NHL Draft +86th overall, 2007
Chicago Blackhawks
Playing career +2014[1]–2015
+ + + + + + + + + + + + + + + + + + + + + + + + + + + +
Medal record +
Ice hockey +
Representing  United States +
IIHF World U18 Championship +
Silver medal – second place2006 SaskatchewanTeam[2] +
IIHF World U18 Championship +
Silver medal – second place2007 FinlandTeam[2] +
+

Josh Unice (born June 24, 1989) is an American former professional ice hockey goaltender. +

Unice was selected by the Chicago Blackhawks in the 3rd round (86th overall) of the 2007 NHL Entry Draft.[2][3] +

+ + +

Playing career[edit]

+

Youth career[edit]

+

Unice began his career playing two seasons with the USA Hockey National Team Development Program (2005–07), before playing three seasons in the Ontario Hockey League playing with both the Kitchener Rangers and Windsor Spitfires (2007–09).[2] While with the Spitfires, the team won the Ontario Hockey League Championship after the 2008-09 season.[2] +

+

University career[edit]

+

After his junior career ended, Unice spent his college ice hockey career playing for the University of Western Ontario Mustangs of Canadian Interuniversity Sport for five seasons (2009-2014).[2] While at the University of Western Ontario, Unice studied Criminology.[4] +

+

Senior career[edit]

+

On March 6, 2014, Unice began his professional career by signing with the Gwinnett Gladiators of the ECHL.[1] On August 7, 2014, Unice signed with the Missouri Mavericks of the Central Hockey League.[5] +

On October 7, 2014, it was announced that the Central Hockey League had folded and had joined the ECHL, nullifying Unice's Central Hockey League contract with the team.[6][7] On October 9, 2014, Unice re-signed with the Mavericks under an ECHL contract.[8] That same day, he was traded by the Mavericks to the Rapid City Rush of the ECHL for undisclosed considerations.[8][9][10] +

On October 15, 2014, Unice was released by the Rush.[11] +

24 January 2015, Unice signed with Elite Ice Hockey League side Sheffield Steelers on a short term contract to cover the injured first-choice netminder Frank Doyle.[12] Josh slotted into the first team well at the Steelers and finished the season by winning the league with the best save percentage out of any goaltender in the EIHL.[2] Following his success with the Steelers in April 2015 retiring goaltender Frank Doyle made a public statement endorsing Unice by saying he felt Josh would be the ideal replacement for him at the Steelers for the next EIHL season.[13] +

1 May 2015, Josh Unice signed with the CBR Brave and became the club's starting goaltender.[14] Unice is the first NHL drafted player to play for the Brave. Josh made his CBR Brave debut between the pipes in round one of the 2015 AIHL season as the Brave beat the Sydney Bears 4-2 in front of a sold-out crowd at Phillip Ice Centre.[14][15] +

14 July 2015, Josh Unice was named CBR Brave interim Head Coach for the last seven games of the 2015 AIHL regular season and any finals matches. Josh was installed Head Coach after being approached by Brave Chairman Peter Chamberlain following the mutual separation between the club and former Head Coach Brad Hunt. Joining Josh in the coaching department as Josh's right-hand man is veteran Brave defenceman and alternative captain Aaron Clayworth who has taken the assistant coaching position.[16] +

On 9 March 2016, Josh Unice was named as the permanent 2016 CBR Brave head coach for the 2016 AIHL season. Josh was once again joined by experienced assistant coach Dave Rogina and strength and conditioning trainer Stuart Philps.[17] +

+

Awards and honors[edit]

+ +

Career statistics[edit]

+

References:[2][19][20][21][22][23][24][25] +

+

Regular season[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  +  +
Season +Team +League +GP +W +L +T +MIN +GA +SO +GAA +
2004–05 +Victory Honda +MWEHL +1741108026204.17 +
2005-06 +United States NTDP U17 +Ind +6231-23-3.79 +
2005–06 +United States NTDP +NAHL +2111701245:496202.99 +
2006-07 +United States NTDP U18 +Ind +27159215828333.15 +
2006–07 +United States NTDP +NAHL +6500368:311312.12 +
2007–08 +Kitchener Rangers +OHL +42306023769742.45 +
2008–09 +Kitchener Rangers +OHL +1641008765603.84 +
2008–09 +Windsor Spitfires +OHL +127506743002.67 +
2009–10 +Windsor Spitfires +OHL +3010539010.27 +
2009–10 +Western Mustangs +OUA +5130236:391904.82 +
2010–11 +Western Mustangs +OUA +148508103012.22 +
2011–12 +Western Mustangs +OUA +20154011404042.10 +
2012–13 +Western Mustangs +OUA +24195014515912.44 +
2013–14 +Western Mustangs +OUA +21164012215212.56 +
2013–14 +Gwinnett Gladiators +ECHL +40312041404.11 +
2014–15 +HC Banska Bystrica +SEL +2---72-03.33 +
2014–15 +Sheffield Steelers +EIHL +19145011263952.80 +
2015 +CBR Brave +AIHL +146806794203.09 +
OHL totals +7341220397919242.90 +
+

Playoffs[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  +  +
Season +Team +League +GP +W +L +T +MIN +GA +SO +GAA +
2005–06 +United States NTDP +NAHL +8530489.321421.72 +
2006–07 +United States NTDP +NAHL +00000:00000 +
2007–08 +Kitchener Rangers +OHL +1611309483812.41 +
2008–09 +Windsor Spitfires +OHL +3210114603.15 +
2009–10 +Western Mustangs +CIS +00000000[26] +
2010–11 +Western Mustangs +CIS +00000000[26] +
2011–12 +Western Mustangs +CIS +118306692612.33[26] +
2012–13 +Western Mustangs +CIS +4310240812.00[26] +
2013–14 +Western Mustangs +CIS +63303811402.20[26] +
OHL totals +1913505044412.49 +
+

Memorial Cup[edit]

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  +  +
Season +Team +League +GP +W +L +T +MIN +GA +SO +GAA +
2008 +Windsor Spitfires +MEM +5 +2 +2 +0 +316 +14 +1 +2.66 +
+

References[edit]

+
+
    +
  1. ^ a b "Josh Unice signs with the ECHL's Gwinnett Gladiators". University of Western Ontario. March 6, 2014. Retrieved August 9, 2014. +
    2. +
  2. ^ a b c d e f g h i j k l m n o p q r s t u "Josh Unice EliteProspects.com Profile". EliteProspects.com. Retrieved August 9, 2014. +
    3. +
  3. ^ "Josh Unice". Chicago Blackhawks. Retrieved August 9, 2014. +
    4. +
  4. ^ "2013-14 Men's Ice Hockey Roster". University of Western Ontario. Retrieved August 9, 2014. +
    5. +
  5. ^ "Mavericks Sign Unice and Former Mav Tochkin". OurSportsCentral.com. August 7, 2014. {{cite web}}: Missing or empty |url= (help) +
    6. +
  6. ^ "Days Before Season Begins, ECHL Adds 7 Former Central Hockey League Teams". SB Nation. October 7, 2014. Retrieved October 11, 2014. +
    7. +
  7. ^ Genet, Mike (October 10, 2014). "A NEW ERA". The Examiner. Retrieved October 11, 2014. +
    8. +
  8. ^ a b "ECHL Transactions - Oct. 9". ECHL. October 9, 2014. Retrieved October 11, 2014. +
    9. +
  9. ^ Shawn Green [@shawngreenPHM] (October 9, 2014). "Client Josh Unice has been traded to the @RapidCityRush of the ECHL" (Tweet). Retrieved October 11, 2014 – via Twitter. +
    10. +
  10. ^ Althaus, Bill (October 10, 2014). "ECHL Rule Forces Mavs to Cut Fan Favorite Pszenyczny". The Examiner. Retrieved October 11, 2014. +
    11. +
  11. ^ "ECHL Transactions - Oct. 15". ECHL. October 15, 2014. Archived from the original on October 17, 2014. Retrieved October 17, 2014. +
    12. +
  12. ^ "EIHL: Sheffield Steelers sign Josh Unice and Tomas Petruska". www.findpubsport.com. January 24, 2015. Retrieved August 10, 2015.[permanent dead link] +
    13. +
  13. ^ "Josh Unice would be a good choice to replace me, says Sheffield Steelers goalie Frank Doyle". www.thestar.co.uk. April 15, 2015. Retrieved August 10, 2015. +
    14. +
  14. ^ a b Gaskin, Lee (May 1, 2015). "Former junior USA goalkeeper Josh Unice joins Canberra Brave". The Canberra Times. Retrieved August 10, 2015. +
    15. +
  15. ^ "CBR Brave vs Sydney Bears Boxscore". www.theaihl.com. Archived from the original on May 6, 2015. Retrieved August 1, 2015. +
    16. +
  16. ^ "Brave Move: Unice appointed interim Head Coach for remainder of 2015 season". CBR Brave ltd. Archived from the original on July 14, 2015. Retrieved July 14, 2015. +
    17. +
  17. ^ "2016 Coaching Team Announcement". CBR Brave ltd. Retrieved March 9, 2016. +
    18. +
  18. ^ "Hockey Awards and Achievements". http://www.eliteprospects.com. Retrieved August 1, 2015. {{cite web}}: External link in |publisher= (help) +
    19. +
  19. ^ "Josh Unice". HockeyDB.com. Retrieved August 10, 2014. +
    20. +
  20. ^ "# 1 Josh Unice". Pointstreak.com. Retrieved August 10, 2014. +
    21. +
  21. ^ "# 31 Josh Unice". Pointstreak.com. Retrieved August 10, 2014. +
    22. +
  22. ^ "Josh Unice". Ontario Hockey League. Archived from the original on August 12, 2014. Retrieved August 10, 2014. +
    23. +
  23. ^ "Josh Unice (G)". LeagueStat.com. Retrieved August 10, 2014. +
    24. +
  24. ^ "Josh Unice (G)". LeagueStat.com. Retrieved August 10, 2014. +
    25. +
  25. ^ "Josh Unice #70". NHL. Retrieved August 10, 2014. +
    26. +
  26. ^ a b c d e Average of annual total/average. +
    27. +
+

External links[edit]

+ + + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Josh_Unice&oldid=1089249184"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/93.html b/content/corpora/93.html new file mode 100644 index 0000000..20c4995 --- /dev/null +++ b/content/corpora/93.html @@ -0,0 +1,550 @@ + + + + +2016 Treviso Open - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

2016 Treviso Open

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +

+

+
Dynamic Billiard Treviso Open
Tournament information
Dates24–26 November 2017
VenueBHR Treviso Hotel,[1]
CityTreviso
CountryItaly
Organisation(s)Euro Tour
FormatSingle Elimination
Total prize fund€36,000
Winner's share€4,500
Final
ChampionSpain David Alcaide
Runner-upGermany Joshua Filler
Score9-6
← 2015
2017 →
+

The 2016 Treviso Open was a Nine-ball pool event, and part of the Euro Tour. The event was held between 24–26 November 2016 in the BHR Treviso Hotel in Treviso, Italy. +

The winner was David Alcaide. The Spaniard secured his second Euro Tour victory by a 9–6 final win against the German Joshua Filler. Third place went to the Pole Mieszko Fortuński and the Dutch Niels Feijen who won the previous Euro Tour tournament, the 2016 Leende Open +

The defending champion was the Englishman Mark Gray, who lost in the round of 16 against Marco Teutscher. +

+

Tournament results[edit]

+

The event saw 163 Participants first in a Double elimination tournament. With 32 players left, the event turned into a Single-elimination tournament.[2] +

+
Round of 32 +Round of 16 +Quarterfinal +Semifinal +Final +
          
England Mark Gray +9 +
Russia Sergei Luzker +6 +
England Mark Gray +5 +
+
Netherlands Marco Teutscher +9 +
England Imran Majid +1 +
Netherlands Marco Teutscher +9 +
Netherlands Marco Teutscher +8 +
+
Poland Mieszko Fortuński +9 +
Spain Francisco Sánchez +9 +
Poland Tomasz Kapłan +0 +
Spain Francisco Sánchez +6 +
+
Poland Mieszko Fortuński +9 +
Russia Konstantin Stepanow +6 +
Poland Mieszko Fortuński +9 +
Poland Mieszko Fortuński +8 +
+
Spain David Alcaide +9 +
Poland Marek Kudlik +9 +
Germany Ralf Souquet +7 +
Poland Marek Kudlik +8 +
+
Poland Konrad Juszczyszyn +9 +
Germany Sascha Trautmann +5 +
Poland Konrad Juszczyszyn +9 +
Poland Konrad Juszczyszyn +7 +
+
Spain David Alcaide +9 +
Netherlands Nick van den Berg +9 +
Greece Damianos Giallourakis +7 +
Netherlands Nick van den Berg +4 +
+
Spain David Alcaide +9 +
Spain David Alcaide +9 +
Russia Andrei Seroschtan +3 +
Spain David Alcaide +9 +
+
Germany Joshua Filler +6 +
France Stephan Cohen +5 +
Austria Albin Ouschan +9 +
Austria Albin Ouschan +9 +
+
Poland Wojciech Sroczyński +3 +
Poland Wojciech Sroczyński +9 +
Portugal Joao Grilo +8 +
Austria Albin Ouschan +8 +
+
Germany Joshua Filler +9 +
Poland Mateusz Śniegocki +7 +
Germany Joshua Filler +9 +
Germany Joshua Filler +9 +
+
Russia Maxim Dudanez +6 +
Russia Maxim Dudanez +9 +
Austria Maximilian Lechner +8 +
Germany Joshua Filler +9 +
+
Netherlands Niels Feijen +8 +
Germany Sebastian Ludwig +9 +
Germany Sebastian Staab +3 +
Germany Sebastian Ludwig +9 +
+
Austria Mario He +7 +
Spain Francisco Díaz-Pizarro +8 +
Austria Mario He +9 +
Germany Sebastian Ludwig +8 +
+
Netherlands Niels Feijen +9 +
Greece Alexander Kazakis +9 +
Spain José Delgado +6 +
Greece Alexander Kazakis +3 +
+
Netherlands Niels Feijen +9 +
Czech Republic Roman Hybler +4 +
Netherlands Niels Feijen +9 +
+

References[edit]

+
+
    +
  1. ^ "Treviso hosts the final Euro-Tour of the 2017 season – European Pocket Billiard Federation". europeanpocketbilliardfederation.com. Archived from the original on 26 January 2019. Retrieved 25 January 2019. +
    2. +
  2. ^ "Matches – Draw and Results". billiardapps.com. European Pocket Billiard Federation. Archived from the original on 27 November 2016. Retrieved 26 November 2016. +
    3. +
+

External links[edit]

+ + +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=2016_Treviso_Open&oldid=1068937406"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/94.html b/content/corpora/94.html new file mode 100644 index 0000000..ffee631 --- /dev/null +++ b/content/corpora/94.html @@ -0,0 +1,448 @@ + + + + +Peak Downs Mine - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Peak Downs Mine

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+ +

+
Peak Downs Mine
Peak Downs CHPP.jpg
Coal Handling and Preparation Plant
Location
Peak Downs Mine is located in Australia
Peak Downs Mine
Peak Downs Mine
Location in Australia
LocationMoranbah
StateQueensland
CountryAustralia
Coordinates22°15′16″S 148°10′50″E / 22.25444°S 148.18056°E / -22.25444; 148.18056Coordinates: 22°15′16″S 148°10′50″E / 22.25444°S 148.18056°E / -22.25444; 148.18056
Production
ProductsCoal
Production9,000,000 Tonnes / Year
History
OpenedApril 1972
Owner
CompanyBHP Mitsubishi Alliance
+

Peak Downs Mine is a large open cut coking coal mine in Queensland located 31 km SSE of Moranbah.[1] Peak Downs is one of seven mines in Bowen Basin owned by the BHP Mitsubishi Alliance, Australia's largest coal miner and exporter. Production at Peak Downs started in 1972. +

The Caval Ridge Coal Mine, which will be located adjacent to Peak Downs, will begin being constructed in 2011 and exporting by 2014. It is expected to process 2.5 million tons of coal each year from Peak Downs.[2] +

The National Pollution Inventory revealed this mine was the biggest generator of airborne pollution in the country for the 2015–16 financial year.[3] +

+

See also[edit]

+ + +

References[edit]

+
+
    +
  1. ^ About BMA +
    2. +
  2. ^ Esmarie Swanepoel (13 August 2010). "Queensland approves A$4bn BHP-Mitsubishi coal mine". Mining Weekly. Creamer Media. Retrieved 6 September 2010. +
    3. +
  3. ^ Cameron Atfield (15 April 2017). "Queensland mines top list of Australia's biggest coal dust polluters". The Sydney Morning Herald. Fairfax Media. Retrieved 15 April 2017. +
    4. +
+

External links[edit]

+ +
+

This Central Queensland geography article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Peak_Downs_Mine&oldid=1084974659"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/95.html b/content/corpora/95.html new file mode 100644 index 0000000..6113d9c --- /dev/null +++ b/content/corpora/95.html @@ -0,0 +1,572 @@ + + + + +Aethiopsestis austrina - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Aethiopsestis austrina

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Aethiopsestis austrina +
Scientific classification +
Kingdom: +
Animalia
+
Phylum: +
Arthropoda
+
Class: +
Insecta
+
Order: +
Lepidoptera
+
Family: +
Drepanidae
+
Genus: +
Aethiopsestis
+
Species: +
A. austrina
+
Binomial name +
Aethiopsestis austrina
Watson, 1965
+
+

Aethiopsestis austrina is a moth in the family Drepanidae. It was described by Watson in 1965.[1] It is found in Zimbabwe and South Africa.[2] +

+

Subspecies[edit]

+
  • Aethiopsestis austrina austrina (Zimbabwe)
    • +
  • Aethiopsestis austrina nebulosa Watson, 1965 (South Africa)
+

References[edit]

+
+
    +
  1. ^ Beccaloni, G.; Scoble, M.; Kitching, I.; Simonsen, T.; Robinson, G.; Pitkin, B.; Hine, A.; Lyal, C., eds. (2003). "Aethiopsestis austrina". The Global Lepidoptera Names Index. Natural History Museum. Retrieved May 18, 2018. +
    2. +
  2. ^ Afro Moths +
    3. +
+
+


+

+
Stub icon

This article on a moth of the subfamily Thyatirinae is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Aethiopsestis_austrina&oldid=934531999"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/96.html b/content/corpora/96.html new file mode 100644 index 0000000..38898a1 --- /dev/null +++ b/content/corpora/96.html @@ -0,0 +1,397 @@ + + + + +Charlie Gellatly - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Charlie Gellatly

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

+ +

+
Charlie Gellatly
Personal information
Full name +Charles Thelluson Gellatly
Date of birth +(1910-04-18)18 April 1910
Place of birth +Brodsworth, England
Date of death +10 November 1973(1973-11-10) (aged 63)
Position(s) +Left-back
Senior career*
Years +Team +Apps +(Gls)
+Norwood Rangers + +
+Shirebrook + +
1928–1929 +Halifax Town +0 +(0)
+Shirebrook + +
1930–1931 +Leicester City +0 +(0)
1931–1934 +Gillingham +56 +(0)
+Darenth Training Colliery + +
+*Club domestic league appearances and goals
+

Charles Thelluson Gellatly (18 April 1910 – 10 November 1973) was an English professional footballer who played as a left-back.[1] +

Gellatly was born in Brodsworth. He played for Halifax Town, Leicester City and Gillingham between 1928 and 1934.[2] +

+

References[edit]

+
+
    +
  1. ^ Joyce, Michael (2012) [2002]. Football League Players' Records 1888 to 1939. Nottingham: SoccerData. p. 109. ISBN 978-1-905891-61-0. +
    2. +
  2. ^ Triggs, Roger (2001). The Men Who Made Gillingham Football Club. Tempus Publishing Ltd. p. 18. ISBN 0-7524-2243-X. +
    3. +
+


+

+
Flag of EnglandSoccer icon

This biographical article related to association football in England, about a defender born in the 1910s, is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Charlie_Gellatly&oldid=1047950448"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/97.html b/content/corpora/97.html new file mode 100644 index 0000000..610c9e9 --- /dev/null +++ b/content/corpora/97.html @@ -0,0 +1,422 @@ + + + + +Haïti Trans Air - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Haïti Trans Air

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Haïti Trans Air
Douglas DC-7B, Haiti Trans Air AN0199498.jpg
+ + + + + + + + + +
IATA +ICAO +Callsign +
TV +HTC +Haïti Trans Air +
Founded1986
Ceased operations1995
Fleet size4
HeadquartersPort-au-Prince, Haïti
+
A Peruvian registered Boing 727-247 of Haiti Trans Air
+

Haïti Trans Air was an airline based in Port-au-Prince, Haiti, which was operational from 1986 to 1995.[1] +

+ + +

History[edit]

+

Haïti Trans Air began operations in 1987 with a single Boeing 727-247 with flights mainly to Miami. A second Boeing 727 was received in 1988 configured in a combi layout. The airline expanded operations to include San Juan and Kingston, Jamaica. In December 1990 a Boeing 737-222 was added for a brief period of time, then in 1992 a Douglas DC-8-61 was added to the fleet and operations expanded with multiple daily flights to Miami and San Juan. Due to the political instability in the island, the tourist traffic almost disappeared and Haïti Trans Air found itself not being able to meet its obligations. Flight schedules were scaled back and one of the Boeing 727s was taken out of service because the airline could not afford to keep it flying. In March 1995 the situation could not be sustained anymore and Haïti Trans Air went out of business.[2] +

+

Fleet[edit]

+ +

References[edit]

+
    +
  1. ^ List of airline from Haiti, at airlineupdate.com Archived 2012-07-17 at archive.today +
    2. +
  2. ^ Airlines Remembered by BI Hengi, Publisher Midland Publishing +
    3. +
+

External links[edit]

+ + +
Stub icon

This article relating to a North American, Central American or Caribbean airline is a stub. You can help Wikipedia by expanding it.

+
Stub icon 1 Stub icon 2

This Haiti corporation or company article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Haïti_Trans_Air&oldid=989011960"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + +
+ + + + + + + + + + + + + + + + + + + + + + +
+ +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/98.html b/content/corpora/98.html new file mode 100644 index 0000000..d0a70d4 --- /dev/null +++ b/content/corpora/98.html @@ -0,0 +1,419 @@ + + + + +Locked breech - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Locked breech

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
Short Recoil Lock from Walther P38
+

Locked breech is the design of a breech-reloading firearm's action. This is important in understanding how a self-reloading firearm works. In the simplest terms, the locked breech is one way to slow down the opening of the breech of a self-reloading firearm when fired. The source of power for the movement is recoil. +

+
Blowback action
+
Roller locking action
+
Sig Sauer short recoil system
+

The principle of firing a projectile from a firearm is that when the propellant in a bullet's casing is ignited, the propellant burns quickly for a very short time. This creates a high-pressure pocket of gas that expands, pushing the projectile (bullet) out of the chamber and down the barrel of the firearm. If the high-pressure gas were not confined within certain parts of the weapon, it could damage the firearm or injure the shooter. A 'locked breech' barrel confines the high-pressure gas to the barrel, allowing the gas to expand and cool without risk of damaging weapon or shooter. Because of the pressure drop, a breech block can be opened in a self-reloading firearm due to the recoil inertia generation by the movement of the projectile. +

+ + +

Versus other types[edit]

+
Blowback
+
This action relies on the inertia of a breechblock to retard breech opening until pressures have dropped to safe levels. This is not a locked breech and works by the cartridge case push against the breech and moving while there is pressure in the chamber. The inertia of the slide/breechblock will allow the case to move immediately but not so fast that dangerous pressures escape.[1]
+
Delayed blowback
+
This action is found where recoil is light enough that a fully locked breech is not necessary. Like simple blowback, it is case movement that opens the breech. This is a more robust version of simple blowback. Sometime a spring loaded lever is used to increase the resistance inertia of the slide/breech to keep the case in the chamber long enough to be safe.[1]
+
Locked breech
+
This action is used when the pressure in the chamber is high enough that the opening of the breech would occur too rapidly with simple or delayed blowback which could cause weapons damage or human injury. The breechblock is "locked" into the barrel. At the point of firing the inertia pushes the barrel and slide/breechblock backwards together for a certain distance. This type of action utilizes the inertia of the locked together slide/breech and barrel so that its inertia prevents movement too quickly. The locking mechanism will disengage after a certain amount of travel at which time the pressures will have dropped.[1]
+

The main difference is that there is a very strong lock in the locked breech action where the blowback systems rely on the inertia of components to provide safe operation. The type of action used by a firearms designer will be determined by the design goal inherent for that firearm. The three actions described are increasingly more expensive to manufacture. +

+

Recoil[edit]

+
Main article: Recoil
+

Recoil is described by Newton's third law of motion, which states that for every action there is an equal and opposite reaction.[2] This force is felt in the hand or on the shoulder when a person fires a handgun or a rifle. It takes the form of a quick sharp push away from the path the bullet is flying in and directly against the hand or shoulder of the shooter. +

+

Mechanism[edit]

+
I: Petter-Browning; II: CZ 75; III: HK USP; IV: Glock (Sig Sauer System)
+
Beretta 950 tilting barrel
+
Beretta PX 4 Rotary locking barrel
+

The locked breech systems in handguns and rifle vary significantly. The photograph showing four handgun barrels illustrates the evolution of handgun locked breech systems in four of the most famous firearms. This is from the Browning Hi-Power (I in the photograph), John Browning's last design. The second barrel is of the same action type in the CZ model 75 handgun. The third barrel type is from an HK USP pistol. The fourth barrel is from a Glock (which uses the Sig Sauer system). +

+
CZ model 52 roller locking system
+

The photograph on the right is of a different type of locking system. This one is the Beretta Rotary locking system found in their PX Four Storm handgun. The next photograph on the left is of the CZ model 52 showing a roller locking system. Some sources describe this as a delayed blowback action but it is actually a locked breech. +

+

Examples of use[edit]

+

In the late 19th century, firearms makers learned how to use this mechanical force to create "self-loading" weapons, whether they were in artillery, rifles, shotguns, or handguns. The lower-powered calibers such as .22 caliber rimfire, (example gun) Walther P22 .22 Rimfire handgun were able to self-load using the energy produced by the .22 rimfire cartridges which simply blew the action open to reload a new cartridge. (This is called simple blowback.) +

As cartridges grew in size and power the amount of recoil in the chamber increased. The energy created by larger and higher pressure cartridges, such as 9×19mm Parabellum pistol cartridge, results in violent movement of the gun's action. +

In the case of simple blowback (and delayed blowback) the changes needed for a firearm to be able to control the higher amount of inertia and higher chamber pressures resulted in firearms design changes. Some designers handled this problem by making the moving parts of the firearm heavier and the strength of the recoil spring much greater. Firearms such as the .25 ACP Beretta SB950, take a great deal of force to chamber a round. Beretta solved this problem with a tilting barrel which allowed loading without having to pull the slide to the rear. +

Gun makers developed ways to keep the actions from opening too soon by "locking" the breech closed. Using this technique a firearm, such as the Colt .45 ACP Government model handgun was made which featured a grooved barrel and a grooved slide which were cammed together to prevent the breech from opening. The camming mechanism "locked" the breech closed until the entire barrel and slide assembly had moved far enough that the pressure in the chamber was low enough to safely unlock the breech during the process of ejecting the spent casing which was followed by loading a new loaded cartridge.[3] (This is called locked breech.) +

+

Short versus long recoil[edit]

+

Firearms that are physically small, such as handguns, use a system of recoil referred to as short recoil.[1][4] This is adequate for the smaller calibers. In large firearms such as the Browning M2HB .50 caliber machine gun a similar system called long recoil is used. The difference is how far the breech moves after a shot is fired.[1] +

Locked recoil systems rely on timing to allow safe operation. A very heavy bolt mechanism can be used (such as in sub-machineguns) to slow the rate of movement and reduce the rate of fire.[5] This is not adequate with higher velocity and higher energy cartridges. Rifles and most handguns use locked breech designs to control recoil safely. +

The amount of mass of the components, the strength of springs,[6] and the distance the barrel and slide are allowed to recoil is carefully calculated and tested to ensure safety. +

+

References[edit]

+
+
    +
  1. ^ a b c d e Becke Martin Davis (May 23, 2014). "How "Automatic" Pistols Really Work by Adam Firestone". Romance University. Retrieved July 5, 2016. +
    2. +
  2. ^ "Newton's Three Laws of Motion". utk.edu. Retrieved 4 July 2016. +
    3. +
  3. ^ "Principles of Firearms -- Operating Systems -- Short Recoil". rkba.org. Retrieved 4 July 2016. +
    4. +
  4. ^ The Editor (7 September 2010). "Firearms History, Technology & Development: Actions: Recoil Action: Short Recoil Operation". firearmshistory.blogspot.com. Retrieved 4 July 2016. {{cite web}}: |author= has generic name (help) +
    5. +
  5. ^ "MP38 (Maschinenpistole 38) - Development and Operational History, Performance Specifications and Picture Gallery". militaryfactory.com. Retrieved 4 July 2016. +
    6. +
  6. ^ "How Recoil Spring Rate Affects Timing - Shooting Times". shootingtimes.com. 7 January 2015. Retrieved 4 July 2016. +
    7. +
+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Locked_breech&oldid=1084077203"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/content/corpora/99.html b/content/corpora/99.html new file mode 100644 index 0000000..e6f0eeb --- /dev/null +++ b/content/corpora/99.html @@ -0,0 +1,356 @@ + + + + +Mount Copaja - Wikipedia + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
+
+
+

Mount Copaja

+
+
From Wikipedia, the free encyclopedia
+
+
+ +
+ Jump to navigation + Jump to search +
+

Mount Copaja or Capaja (Cerro Capaja) is a mountain in the Western Andes, located in the province of Oruro, Bolivia (c. 18°09'S, 68°22'W). It has an altitude of 5097 m and is in the neighbourhood of the higher Lliscaya and Curumane peaks. +

+

References[edit]

+ +

Coordinates: 18°09′S 68°22′W / 18.150°S 68.367°W / -18.150; -68.367 +


+

+

This Oruro Department location article is a stub. You can help Wikipedia by expanding it.

+ + + + +
+
Retrieved from "https://en.wikipedia.org/w/index.php?title=Mount_Copaja&oldid=1082945373"
+ +
+
+ +
+

Navigation menu

+
+ + + + +
+ + + + + + + + +
+
+ + + + + + + + + + + +
+
+ + + + +
+ + + + + + + + \ No newline at end of file diff --git a/db/bookmarks_test.go b/db/bookmarks_test.go new file mode 100644 index 0000000..17e44f7 --- /dev/null +++ b/db/bookmarks_test.go @@ -0,0 +1,100 @@ +package db + +import ( + "fmt" + "io" + "log" + "net/http" + "net/http/httptest" + "os" + "testing" + + "github.com/tardisx/linkwallet/entity" +) + +var bmm *BookmarkManager +var corporaDB string = "/tmp/corpora.db" + +func createCorporaIfNecessary() { + _, err := os.Stat(corporaDB) + if err != nil { + log.Printf("creating corpora") + dbh := DB{} + dbh.Open(corporaDB) + bmm := NewBookmarkManager(&dbh) + importCorpora(*bmm) + dbh.Close() + log.Printf("finished creating corpora") + + } +} + +func newCorpusTestServer() *httptest.Server { + mux := http.NewServeMux() + + mux.HandleFunc("/", func(w http.ResponseWriter, r *http.Request) { + id := 0 + n, _ := fmt.Sscanf(r.URL.Path, "/%d", &id) + if n != 1 { + panic("bad req") + } + w.Header().Set("Content-Type", "text/html") + f, err := os.Open(fmt.Sprintf("../content/corpora/%d.html", id)) + if err != nil { + panic(err) + } + io.Copy(w, f) + }) + return httptest.NewServer(mux) +} + +func importCorpora(bmm BookmarkManager) { + ts := newCorpusTestServer() + defer ts.Close() + + for i := 1; i <= 100; i++ { + url := fmt.Sprintf("%s/%d", ts.URL, i) + bm := entity.Bookmark{URL: url} + bmm.AddBookmark(&bm) + bmm.ScrapeAndIndex(&bm) + } + +} + +func createDBAndImportCorpora() *BookmarkManager { + + return bmm +} + +func BenchmarkOneWordSearch(b *testing.B) { + createCorporaIfNecessary() + dbh := DB{} + dbh.Open(corporaDB) + bmm := NewBookmarkManager(&dbh) + b.ResetTimer() + for i := 0; i < b.N; i++ { + bmm.Search("hello") + } +} + +func BenchmarkTwoWordSearch(b *testing.B) { + createCorporaIfNecessary() + dbh := DB{} + dbh.Open(corporaDB) + bmm := NewBookmarkManager(&dbh) + b.ResetTimer() + for i := 0; i < b.N; i++ { + bmm.Search("human relate") + } +} + +func BenchmarkThreeWordSearch(b *testing.B) { + createCorporaIfNecessary() + dbh := DB{} + dbh.Open(corporaDB) + bmm := NewBookmarkManager(&dbh) + b.ResetTimer() + for i := 0; i < b.N; i++ { + bmm.Search("human wiki editor") + } +}